10
50
100
150
200
หมายเลข CAS | ชื่อสามัญภาษาอังกฤษ | ชื่อ IUPAC | พิกัดศุลกากร | กฎหมายควบคุม |
---|---|---|---|---|
100-01-6 | 4-Nitroaniline | 4-Nitroaniline | 2904.9 | |
1000172-11-1 | Pentadecane, 7-methylene-, mixed with 1-tetradecene, dimers and trimers, hydrogenated | 2710.19 | ||
100-02-7 | 4-Nitrophenol | 4-Nitrophenol | 2908.99 | 3 |
10004-44-1 | Hymexazol | 5-methyl-1,2-oxazol-3-ol | 2934.99 | 8 |
100-06-1 | 4-Methoxyacetophenone | 1-(4-methoxyphenyl)ethanone | 2914.5 | |
10006-28-7 | Dipotassium silicate | Dipotassium oxosilanebis(olate) | 3824.9 | |
100085-39-0 | Glycerides, C8-21 and C8-21-unsatd. mono- and di-, 2-(acetyloxy)-3-hydroxybutanedioates 2,3-bis(acetyloxy)butanedioates | 2918.13 | ||
1000-90-4 | Zinc O,O'-diisopropyl bis[dithiocarbonate] | 4-Methoxybenzoic acid | ||
10010-67-0 | Sodium hydrogen piperazine-1,4-diethanesulphonate | Sodium hydrogen 2-[4-(2-sulfonatoethyl)piperazin-1-yl]ethane-1-sulfonate | 2933.59 | |
100-10-7 | 4-Dimethylaminobenzaldehyde | 4-Dimethylaminobenzaldehyde | 2922.29 | |
1001354-72-8 | 3-Aminooctan-4-ol | 2922.19 | ||
10016-20-3 | alpha-Cyclodextrin | 2940 | 6 | |
10017-11-5 | Allylammonium chloride | Allylammonium chloride | 2921.19 | |
100-18-5 | 1,4-Diisopropylbenzene | 1,4-Diisopropylbenzene | 2902.9 | |
100-20-9 | Terephthaloyl dichloride | 1,4-Benzenedicarbonyl dichloride | 2917.39 | |
100209-45-8 | Hydrolyzed vegetable protein | 3504 | ||
100-21-0 | Terephthalic acid | Benzene-1,4-dicarboxylic acid | ||
100-22-1 | N,N,N′,N′-Tetramethyl-p-phenylenediamine | N,N,N′,N′-Tetramethyl-p-phenylenediamine | 2933.69 | 3 |
10022-31-8 | Barium dinitrate | Baium dinitrate | 2834.29 | |
10022-68-1 | Nitric acid | Cadmium dinitrate  | 2834.29 | |
100231-64-9 | Heptyl D-glucoside | Heptyl D-glucopyranoside | 3402.13 | |
10024-47-2 | Isobutyl oleate | Isobutyl oleate | 3824.9 | |
10024-66-5 | Manganese citrate | 2-Hydroxypropane-1,2,3-tricarboxylate manganese(2+) | 2918.15 | |
10024-97-2 | Nitrous oxide | Nitrous oxide | 2804.3 | |
1002-53-5 | Di-n-Butyltin | 3815.12 | ||
100-25-4 | 1,4-Dinitrobenzene | 1,4-Dinitrobenzene | 2904.2 | 8 |
10025-65-7 | Platinum(II) chloride | Platinum(2+) dichloride | 2843.9 | |
10025-69-1 | Tin(II) chloride dihydrate | Dichlorotin dihydrate | 2827.39 | |
10025-70-4 | Stannic chloride | Strontium chloride | 2827.39 | |
10025-73-7 | Chromic chloride | Trichlorochromium | 2833.29 | 8 |
10025-75-9 | Erbium (III) chloride hexahydrate | Erbium(3+);trichloride;hexahydrate | 2846.9 | |
10025-77-1 | Ferric chloride hexahydrate | Iron(III) chloride hexahydrate    | ||
10025-82-8 | Indium trichloride | Indium trichloride | ||
10025-84-0 | Lanthanum chloride heptahydrate | Trichlorolanthanum | 2827.39 | |
10025-87-3 | Phosphorus oxychloride | Phosphorus trichloride oxide | 2812.1 | |
10025-91-9 | Antimony trichloride | Trichlorostibane | 2827.39 | 3 |
10025-98-6 | Potassium tetrachloropalladate(II) | Dipotassium;tetrachloropalladium(2-) | 2843.9 | |
10026-04-7 | Silicon tetrachloride | Tetrachlorosilane | 2812.1 | 3 |
10026-06-9 | Tin (IV) chloride pentahydrate | Tetrachlorostannane;pentahydrate | 2827.39 | |
10026-07-0 | Tellurium tetrachloride | Tellurium Tetrachloride | 2812.1 | |
10026-11-6 | Zirconium(IV) chloride anhydrous | Tetrachlorozirconium | ||
10026-12-7 | Niobium(V) chloride | Pentachloroniobium | 2827.39 | |
10026-22-9 | Cobalt (II) nitrate hexahydrate | Cobalt(2+) dinitrate hexahydrate | 2827.31 | |
10026-24-1 | Cobalt sulfate heptahydrate | Cobalt(2+) sulfate heptahydrate | ||
10028-22-5 | Ferric sulfate | Iron(3+); trisulfate | 2833.29 | |
10028-24-7 | Disodium hydrogen orthophosphate | Disodium; hydrogen phosphate; dihydrate | 2835.22 | |
1002-84-2 | Pentadecanoic acid | Pentadecanoic acid | 2915.9 | |
1002-88-6 | Cobalt stearate | Cobalt distearate | 2915.7 | |
1002-89-7 | Ammonium stearate | 3402.11 | ||
1003-04-9 | Tetrahydrothiophene-3-one | Tetrahydrothiophene-3-one | 2934.99 | |
10030-67-8 | Melezitose monohydrate | (2R,3R,4S,5S,6R)-2-[(2S,3S,4R,5R)-4-hydroxy-2,5-bis(hydroxymethyl)-2-[(2R,3R,4S,5S,6R)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxyoxolan-3-yl]oxy-6-(hydroxymethyl)oxane-3,4,5-triol hydrate | 2940 | |
1003-07-2 | 2,3-dihydro-1,2-thiazol-3-one | 2,3-dihydro-1,2-thiazol-3-one | 2934.1 | |
10030-80-5 | L-Mannose | (2R,3R,4S,5S)-2,3,4,5,6-pentahydroxyhexanal | 2940 | |
10030-85-0 | L(+)-Rhamnose Monohydrate | (2R,3R,4S,5S)-2,3,4,5-tetrahydroxyhexanal hydrate | 2938.1 | |
1003-09-4 | 2-Bromothiophene | 2-Bromothiophene | 2934.99 | |
10031-22-8 | Lead (II) bromide | Dibromolead | 2827.59 | |
10031-30-8 | Monohydrate | Calcium; dihydrogen phosphate; hydrate | 2835.26 | |
10031-43-3 | Cupric nitrate | Copper; dinitrate; trihydrate | 2834.29 | |
10031-49-9 | Dysprosium nitrate | Dysprosium(3+); trinitrate; pentahydrate | 2846.9 | |
10032-15-2 | Hexyl 2-methylbutyrate | Hexyl 2-methylbutyrate | 2915.9 | |
1003-29-8 | Pyrrole-2-carboxaldehyde | Pyrrole-2-carboxaldehyde | 2933.99 | |
10034-76-1 | Plaster of paris | |||
10034-81-8 | Magnesium perchlorate | Magnesium; diperchlorate | 2829.9 | |
10034-85-2 | Hydriodic acid | Iodane | 2811.19 | 3 |
10034-88-5 | Sodium bisulfate monohydrate | Sodium bisulfate monohydrate | ||
10034-93-2 | Hydrazine sulfate | Hydrazine;sulfuric acid | 2825.1 | |
10034-96-5 | Manganese(II) sulfate monohydrate | Magnesium;sulfate;heptahydrate | 2833.29 | |
10034-99-8 | Magnesium sulfate heptahydrate | Magnesium sulfate heptahydrate | ||
10035-04-8 | Calcium chloride dihydrate | Calcium; dichloride; dihydrate | ||
10035-06-0 | Bismuth trinitrate | Bismuth trinitrate pentahydrate | 2834.29 | |
10035-10-6 | Hydrobromic acid | Bromane | 2811.19 | 3 |
100-37-8 | 2-Diethylaminoethanol | 2-Diethylaminoethanol | 2922.19 | 8 |
100-39-0 | Bromomethylbenzene | Bromomethylbenzene | 2903.99 | |
10039-32-4 | Anhydrous monobasic sodium phosphate | Disodium; hydrogen phosphate; dodecahydrate | 2835.22 | |
10039-54-0 | Hydroxylamine sulfate | Hydroxyazanium;sulfate | 2825.1 | |
10039-56-2 | Sodium hypophosphite | Sodium; hydroxyphosphinite; hydrate | 2835.1 | |
100402-78-6 | Silanedione 3-(trimethoxysilyl)propyl 2-methylprop-2-enoate | Silanedione 3-(trimethoxysilyl)propyl 2-methylprop-2-enoate | 3824.9 | |
100-40-3 | 4-Ethenylcyclohexene | 4-Ethenylcyclohexene | 2902.19 | |
100403-19-8 | Ceramides | N-(1,3-dihydroxyoctadecan-2-yl)octadecanamide | ||
100403-23-4 | Pitch coke | 2715 | ||
100403-24-5 | Deoxyribonucleic acids, fish sperm | 2934.99 | ||
100-41-4 | Ethylbenzene | Ethylbenzene | 2902.6 | |
100-42-5 | Styrene | Styrene | 2902.5 | |
10042-59-8 | 2-Propylheptan-1-ol | 2-Propylheptan-1-ol | 2905.19 | |
10042-76-9 | Strontium nitrate | Strontium dinitrate | 2834.29 | |
10043-01-3 | Aluminum sulfate | Dialuminum trisulfate | 2833.22 | |
10043-11-5 | Boron nitride | Azanylidyneborane | 2850 | |
10043-35-3 | Boric acid, crude natural | 8 | ||
10043-52-4 | Calcium chloride | Calcium chloride | 3 | |
100-43-6 | 4-Vinylpyridine | 4-Vinylpyridine | 2933.39 | |
10043-66-0 | Iodine-131 | (¹³¹I)iodanyl | 2844.4 | 5 |
10043-67-1 | Aluminium potassium bis(sulphate) | Aluminium potassium bis(sulfate) | ||
100-44-7 | Chloromethylbenzene | Chloromethylbenzene | 2903.99 | |
10045-89-3 | Ammonium iron ( II ) sulphate | Azane; hydrogen sulfate; iron(2+); hexahydrate | 2842.9 | |
10045-97-3 | Cesium-137 | Cesium-137 | 2844.4 | 5 |
100-46-9 | Phenylmethanamine | Phenylmethanamine | 2921.49 | 3 |
10048-95-0 | Sodium arsenate dibasic heptahydrate | Disodium; hydrogen arsorate; heptahydrate | 2842.9 | |
10049-05-5 | Chromium(II) chloride | Chromium dichloride | ||
10049-21-5 | Sodium dihydrogen phosphate monohydrate | Sodium; dihydrogen phosphate; hydrate | 2835.22 | |
10049-83-9 | Pyritinol dihydrochloride | Pyritinol dihydrochloride | 2933.39 | |
100-51-6 | Benzyl alcohol ; Fragrance of benzyl alcohol | Phenylmethanol | ||
100-52-7 | Benzaldehyde | Benzaldehyde | 2912.21 | 3 |
100-53-8 | Benzyl Mercaptan | Benzyl Mercaptan | 2930.9 | |
10054-21-4 | 1-Dodecyl-5-Oxoprrolidine-3-Carboxylic Acid | 1-Dodecyl-5-Oxoprrolidine-3-Carboxylic Acid | 2933.79 | |
100-58-3 | Phenylmagnesium bromide | Phenylmagnesium bromide | 2931.9 | |
10058-44-3 | Ferric phosphate | Iron(3+); phosphonato phosphate | 2835.29 | |
100587-95-9 | Europium(III) nitrate hexahydrate | Europium(3+) trinitrate | 2846.9 | |
100-59-4 | Phenylmagnesium chloride | Phenylmagnesium chloride | 2931.9 | |
10060-13-6 | Ammonium tetrachlorocuprate(II) dihydrate | Diazanium; tetrachlorocopper(2-); dihydrate | 2842.9 | |
100-61-8 | N-Methyaniline | N-Methyaniline | ||
100-63-0 | Phenylhydrazine | Phenylhydrazine | 2928 | 8 |
100-64-1 | Cyclohexanone oxime | Cyclohexanone oxime | 2928 | |
100641-13-2 | Dysprosium(III) nitrate hydrate | Dysprosium(3+); trinitrate; hydrate | 2846.9 | |
100643-71-8 | Desloratadine | 8-Chloro-11-(4-piperidylidene)-6,11-dihydro-5H-benzo[5,6]cyclohepta[1,2-b]pyridine | 2933.39 | 6 |
100646-51-3 | Quizalofop P-Ethyl | (R)-2-[4-(6-chloroquinoxalin-2-yloxy)phnoxy]propionate | 2933.99 | 8 |
100-66-3 | Anisole | Anisole | 2909.3 | |
100683-54-3 | Tetrabutylazanium | (1E)-3-oxoprop-1-en-1-olate | 2923.9 | |
100-69-6 | 2-Vinylpyridine | 2-Vinylpyridine | 2933.39 | |
1007304-55-3 | Glycereth-25 PCA Isostearate | 3402.13 | ||
100-74-3 | 4-Ethylmorpholine | 4-Ethylmorpholine | 2934.99 | |
10079-20-6 | [2-(3-amino-4-methoxybenzenesulfonyl)ethoxy]sulfonic acid | [2-(3-amino-4-methoxybenzenesulfonyl)ethoxy]sulfonic acid | 2930.9 | |
100-79-8 | 2,2-dimethyl-1,3-dioxolan-4-ylmethanol | 2,2-dimethyl-1,3-dioxolan-4-ylmethanol | 2932.99 | |
10081-67-1 | Bis[4-(2-phenyl-2-propyl)phenyl]amine | 4-(2-phenylpropan-2-yl)-N-[4-(2-phenylpropan-2-yl)phenyl]aniline | ||
100-83-4 | 3-Hydroxybenzaldehyde | 3-Hydroxybenzaldehyde | 2912.49 | |
100-85-6 | Benzyltrimethylammonium hydroxide | Benzyltrimethylammonium hydroxide | 2923.9 | |
100-86-7 | Dimethyl benzyl carbinol | 2-Methyl-1-phenyl-2-propanol | 2942 | |
1008-89-5 | 2-Phenylpyridine | 2-Phenylpyridine | 2933.39 | |
1009119-65-6 | Daclatasvir Dihydrochloride | Methyl((1S)-1-(((2S)-2-(5-(4'-(2-((2S)-1-((2S)-2-((methoxycarbonyl)amino)-3-methylbutanoyl)-2-pyrrolidinyl)-1H-imidazol-5-yl)-4-biphenylyl)-1H-imidazol-2-yl)-1-pyrrolidinyl)carbonyl)-2-methylpropyl)carbamate dihydrochloride | 2942 | |
1009-14-9 | Valerophenone | 1-phenylpentan-1-one | 2914.39 | |
100-93-6 | 4'-Anilinotoluene-4-sulphonanilide | 4-methyl-N-[4-(phenylamino)phenyl]benzene-1-sulfonamide | 2935 | |
10094-34-5 | Dimethylbenzylcarbinyl butyrate | 1,1-Dimethyl-2-phenylethyl butyrate | ||
10094-45-8 | Stearyl erucamide | (Z)-N-octadecyldocos-13-enamide | 2924.19 | |
100-97-0 | Methenamine | 1,3,5,7-Tetraazaadamantane | 2 | |
10097-09-3 | 4,4'-Bis(N,N-dimethylureido)diphenylmethane | 4,4'-Bis(N,N-dimethylureido)diphenylmethane | 3815.9 | |
10097-28-6 | Silicon monoxide | Oxoniumylidynesilanide | ||
100986-85-4 | Levofloxacin | (S)-9-fluoro-2,3-dihydro-3-methyl-10-(4-methylpiperazin-1-yl)-7-oxo-7H-pyrido[1,2,3-de]-1,4-benzoxazine-6-carboxylic acid | 2934.99 | |
10099-74-8 | Lead nitrate | Plumbous dinitrate | 2834.29 | |
10101-41-4 | Calcium sulfate dihydrate | Calcium sulfate dihydrate | 2833.29 | |
10101-52-7 | Zirconium silicate | Zirconium(4+) silicate | ||
10101-53-8 | Chromium sulfate | Dichromium tris(sulfate) | 3210 | |
10101-63-0 | Lead (II) iodide | Diiodolead | 2827.6 | |
10101-66-3 | Pigment violet 16 | Ammonium manganese pyrophosphate | 3204.17 | |
10101-68-5 | Manganese(II) sulfate tetrahydrate | Manganese(2+); sulfate; tetrahydrate | 2833.29 | |
10101-89-0 | Trisodium phosphate dodecahydrate | Trisodium; phosphate; dodecahydrate | ||
10101-97-0 | Nickel(II) sulfate hexahydrate | Nickel(2+) sulfate hexahydrate | ||
101-02-0 | Triphenyl phosphite | Triphenyl phosphite | 2902.9 | 3 |
10102-05-3 | Palladium dinitrate | Palladium dinitrate | 3815.9 | |
10102-17-7 | Sodium thiosulfate pentahydrate | Disodium; dioxido-oxo-sulfanylidene-λ6-sulfane; pentahydrate | 2816.1 | |
10102-18-8 | Sodium selenite | Disodium selenite | 2842.9 | 3 |
10102-23-5 | Sodium selenate decahydrate | Disodium selenate decahydrate | 2842.9 | |
10102-24-6 | Lithium silicate | Dilithium metasilicate | ||
10102-25-7 | Lithium sulfate monohydrate | Dilithium; sulfate; hydrate | 2833.29 | |
10102-40-6 | Sodium molybdate dihydrate | Disodium; dioxido(dioxo)molybdenum; dihydrate | 2841.7 | |
10102-43-9 | Nitric oxide | 1S/NO/c1-2 | 2804.3 | 8 |
10102-68-8 | Calcium iodide | Calcium diiodide | 2827.6 | |
10102-71-3 | Sodium sluminum sulfate | Aluminum; sodium; disulfate | 2833.22 | |
10102-90-6 | Copper pyrophosphate | Dicopper; phosphonato phosphate | 2835.39 | |
10108-64-2 | Cadmium chloride anhydrous | Dichlorocadmium | 2827.39 | |
10111-08-7 | Imidazole-2-carboxaldehyde | Imidazole-2-carboxaldehyde | 2932.99 | |
101-11-1 | 3-{[ethyl(phenyl)amino]methyl}benzene-1-sulfonic acid | 3-{[ethyl(phenyl)amino]methyl}benzene-1-sulfonic acid | 2921.42 | |
101-14-4 | 4,4'-Methylene-bis(2-chloroaniline) | 4,4'-Methylene-bis(2-chloroaniline) | 2921.59 | 3 |
10114-58-6 | Basic brown 1 dihydrochloride ; C.I. 21000 | 1,3-bis(2,3-diaminophenylazo)benzene hydrochloride | 3212.9 | |
1011-73-0 | Sodium 2,4-dinitrophenoxide | Sodium 2,4-dinitrophenoxide | 2908.99 | |
101-20-2 | Triclocarban | 1-(4-Chlorophenyl)-3-(3,4-dichlorophenyl)urea | 2924.21 | |
101-21-3 | Chlorpropham | 2924.29 | 8 | |
10124-36-4 | Cadmium sulfate | Cadmium(2+); sulfate | 2833.29 | |
10124-37-5 | Calcium nitrate | Calcium dinitrate | ||
10124-43-3 | Cobalt sulfate | Cobalt(2+) sulfate | 2833.29 | |
10124-53-5 | MagThio ® | Magnesium; dioxido-oxo-sulfanylidene-λ6-sulfane; hexahydrate | 2832.3 | |
10124-56-8 | Sodium hexametaphosphate | Hexasodium;2,4,6,8,10,12-hexaoxido-1,3,5,7,9,11-hexaoxa-2$l^{5},4$l^{5},6$l^{5},8$l^{5},10$l^{5},12$l^{5}-hexaphosphacyclododecane 2,4,6,8,10,12-hexaoxide | ||
10124-65-9 | Potassium laurate | Potassium laurate | 2915.9 | |
10125-13-0 | Copper(II) chloride dihydrate | Dichlorocopper;dihydrate | 2827.39 | |
101-25-7 | N,N'-Dinitrosopentamethylenetetramine | N,N'-Dinitrosopentamethylenetetramine | 2933.99 | |
101-26-8 | Pyridostigmine Bromide | (1-methylpyridin-1-ium-3-yl) N,N-dimethylcarbamate bromide | 2933.29 | |
10127-02-3 | Acridine orange | Zinc dichloride—N,N,N',N'-tetramethylacridine-3,6-diamine hydrochloride (1:1) | 3204.13 | |
1012-72-2 | 1,4-Di-tert-butylbenzene | 1,4-Di-tert-butylbenzene | 2902.9 | |
101314-97-0 | Simvastatin sodium | (3R,5R)-7-[(1S,2S,6R,8S,8aR)-8-(2,2-dimethylbutanoyloxy)-2,6-dimethyl-1,2,6,7,8,8a-hexahydronaphthalen-1-yl]-3,5-dihydroxyheptanoic acid sodium | 2917.2 | 6 |
101316-46-5 | Petroleum ether for residue analysis, bp 40-60 °C | 2710.12 | ||
101357-30-6 | Pigment blue 29 | 3204.9 | ||
101357-32-8 | Nigrosine | 3204.12 | ||
101357-36-2 | 1,2,3,4-Butanetetracarboxylic acid, polymer with 2,2-bis(hydroxymethyl)-1,3-propanediol and 3-hydroxy-2,2-dimethylpropanal, 1,2,2,6,6-pentamethyl-4-piperidinyl ester | 3812.3 | ||
101-37-1 | Triallyl cyanurate | 2,4,6-tris(allyloxy)-1,3,5-triazine | 2933.69 | |
10138-04-2 | Ferric ammonium sulfate | Azanium iron(3+) disulfate | 2833.3 | |
101-38-2 | 2,6-Dichloroquinone-4-chloroimide | 2,6-Dichloroquinone-4-chloroimide | 2925.29 | |
1013910-41-2 | Alcohols, C12-14-Secondary, Ethoxylated, Butoxylated | 3402.13 | ||
101-39-3 | 2-Methyl-3-phenylacrylaldehyde | 2-methyl-3-phenylacrylaldehyde | 2912.19 | |
10139-47-6 | Zinc iodide | Diiodozinc | 2827.6 | |
10139-54-5 | Cobalt (II) decanoate | 3815.9 | ||
10139-58-9 | Rhodium trinitrate | Rhodium trinitrate | ||
10141-05-6 | Cobaltous nitrate | Cobalt(2+) dinitrate | 2834.29 | |
101-41-7 | Methyl phenylacetate | Methyl phenylacetate | 2915.9 | |
101-42-8 | Fenuron | 1,1-dimethyl-3-phenylurea | 3824.9 | 8 |
101-43-9 | Cyclohexyl methacrylate | Cyclohexyl 2-methylprop-2-enoate | 2916.14 | |
101-50-8 | 4-Aminoazobenzene-3,4'-disulphonic acid | 4-Aminoazobenzene-3,4'-disulphonic acid | 2927 | |
101537-17-1 | Tetraheptylammonium Hydrogen Sulfate | Hydrogen sulfate tetraheptylazanium | 2923.9 | |
101-57-5 | p-Anilinobenzenesulphonic acid | p-Anilinobenzenesulphonic acid | 2921.44 | |
101-61-1 | Bis[4-(dimethylamino)phenyl]methane | Bis[4-(dimethylamino)phenyl]methane | 2922.39 | |
101-67-7 | Bis(4-octylphenyl)amine ; Octylated diphenylamine | Bis(4-octylphenyl)amine | ||
1016788-34-3 | Acetyl Glycyl Beta-Alanine | 2922.49 | ||
101-68-8 | Methylene diphenyl diisocyanate | Methylene diphenyl diisocyanate | 2929.1 | |
10169-02-5 | Acid red 97 | Disodium 4,4'-bis(2-hydroxynaphthalen-1-ylazo)biphenyl-2,6'-disulfonate | 3204.12 | |
10169-12-7 | Acid blue 117 | 3204.12 | ||
10170-69-1 | Manganese Carbonyl | Carbon monoxide manganese | 2931.9 | |
101711-78-8 | (4S)-4-Benzyl-3-propanoyl-1,3-oxazolidin-2-one | (4S)-4-Benzyl-3-propanoyl-1,3-oxazolidin-2-one | 2934.99 | |
101-72-4 | 4-Isopropylaminodiphenylamine | 4-Isopropylaminodiphenylamine | ||
101-77-9 | Methylene dianiline | 4,4'-methanediyldianiline | 3 | |
101-80-4 | 4,4'-Diaminodiphenylether | 4,4'-Diaminodiphenylether | ||
101-83-7 | Dicyclohexylamine | Dicyclohexylamine | ||
101-84-8 | Phenoxybenzene ; Fragrance of diphenyl Oxide | Phenoxybenzene | ||
101-86-0 | Hexyl cinnamic aldehyde | (2E)-2-Benzylideneoctanal | ||
10191-41-0 | alpha-Tocopherol | 3,4-dihydro-2,5,7,8-tetramethyl-2-(4,8,12-trimethyltridecyl)-2H-benzopyran-6-ol | 2936.28 | |
10192-30-0 | Ammonium hydrogensulphite | Ammonium hydrogensulphite | 2932.2 | |
101932-71-2 | Calyculin A | {[(2R,3R,5R,7S,8S,9R)-2-[(1S,3S,4S,5R,6R,7E,9E,11E,13Z)-14-cyano-3,5-dihydroxy-1-methoxy-4,6,8,9,13-pentamethyltetradeca-7,9,11,13-tetraen-1-yl]-7-[(2E)-3-{2-[(2S)-4-[(2S,3S,4S)-4-(dimethylamino)-2,3-dihydroxy-5-methoxypentanamido]butan-2-yl]-1,3-oxazol-4 | 2934.99 | |
101-94-0 | 4-Methylphenyl 2-phenylacetate | 4-methylphenyl 2-phenylacetate | 2942 | |
101947-16-4 | 1H,1H,2H,2H-Perfluorodecyltriethoxysilane | 3207.3 | ||
10196-04-0 | Ammonium sulfite | Diazanium;sulfite | 3102.29 | 4 |
10196-18-6 | Zinc nitrate hexahydrate | Zinc;dinitrate;hexahydrate | 2834.29 | |
101-96-2 | N,N'-Di-sec-butyl-p-phenylenediamine | N,N'-Di-sec-butyl-p-phenylenediamine | 2921.51 | |
101-97-3 | Ethyl phenylacetate ; Fragrance of ethyl phenylacetate | Ethyl phenylacetate | ||
10198-40-0 | Cobalt-60 | Cobalt-60 | 2844.4 | 5 |
10199-89-0 | 4-Chloro-7-nitro-2,1,3-benzoxadiazole | 4-Chloro-7-nitro-2,1,3-benzoxadiazole | 2934.99 | |
10200-59-6 | 2-Thiazolecarboxaldehyde | 2-Thiazolecarboxaldehyde | 2934.1 | |
102-01-2 | Acetoacetanilide | Acetoacetanilide | 2924.29 | |
102014-38-0 | 3-Hydroxy-2-methylbenzenesulfonic acid | 3-Hydroxy-2-methylbenzenesulfonic acid | 2908.99 | |
102029-73-2 | Acetyl Coenzyme A Sodium Salt | S-[2-[3-[[4-[[[5-(6-aminopurin-9-yl)-4-hydroxy-3-phosphonooxyoxolan-2-yl]methoxy-hydroxyphosphoryl]oxy-hydroxyphosphoryl]oxy-2-hydroxy-3,3-dimethylbutanoyl]amino]propanoylamino]ethyl] ethanethioate sodium | 2934.99 | |
10203-28-8 | Dodecan-2-ol | Dodecan-2-ol | 2905.19 | |
1020665-14-8 | Neuburg siliceous earth | |||
102-06-7 | 1,3-Diphenylguanidine | 1,3-Diphenylguanidine | ||
102-08-9 | 1,3-Diphenyl-2-thiourea | 1,3-Diphenyl-2-thiourea | 2930.9 | |
102110-74-7 | Azocasein | 3501.9 | ||
10213-10-2 | Sodium tungstate dihydrate | Disodium;dioxido(dioxo)tungsten;dihydrate | 2841.8 | |
10213-78-2 | N,N-Diethanolstearylamine | N,N-Diethanolstearylamine | ||
10213-79-3 | Sodium metasilicate pentahydrate | Disodium;dioxido(oxo)silane;pentahydrate | 2839.11 | |
10215-33-5 | 3-Butoxypropan-1-ol | 3-Butoxypropan-1-ol | 2932.13 | |
10217-52-4 | Hydrazine hydrate | Hydrazine;hydrate | 2825.1 | |
102184-95-2 | Silicic acid, zirconiumsalt, cadmium pigment-encapsulated | 3207.1 | ||
102185-33-1 | 5-Bromo-4-chloro-3-indolyl phosphate disodium salt | Disodium (5-bromo-4-chloro-1H-indol-3-yl) phosphate | 2933.99 | |
102-19-2 | Isoamyl phenylacetate | Isoamyl phenylacetate | 2916.39 | |
102-20-5 | Phenethyl phenylacetate | Phenethyl phenylacetate | 2916.39 | |
10222-01-2 | 2,2-Dibromo-3-nitrilopropionamide | 2,2-Dibromo-3-nitrilopropionamide | 2926.9 | |
102242-58-0 | Hydrocarbons, C4-10, 1,3-pentadiene-rich | 2710.12 | ||
102-25-0 | 1,3,5-Triethylbenzene | 1,3,5-Triethylbenzene | 2902.9 | |
10236-47-2 | Naringin | (2R)-5-Hydroxy-2-(4-hydroxyphenyl)-4-oxo-3,4-dihydro-2H-chromen-7-yl 2-O-(6-deoxyhexopyranosyl)hexopyranoside | 2938.9 | |
10238-21-8 | Glibenclamide | 5-chloro-N-(2-(4-(cyclohexylcarbamoyl)sulfamoyl)phenethyl)-2-methoxybenzamide | 2935 | 6 |
102-51-2 | 4-Methoxy-o-phenylenediamine | 4-Methoxy-o-phenylenediamine | 2922.29 | |
1025-15-6 | Triallyl isocyanurate | 1,3,5-triallyl-1,3,5-triazinane-2,4,6-trione | 2933.69 | |
102-52-3 | 1,1,3,3-Tetramethoxypropane | 1,1,3,3-Tetramethoxypropane | 2911 | |
102-53-4 | N,N,N',N'-Tetraethylmethylenediamine | N,N,N',N'-Tetraethylmethylenediamine | 2921.29 | |
102-54-5 | Ferrocene | Cyclopenta-1,3-diene iron(2+) | 2931.9 | |
10254-57-6 | Methylenebis (dibutyldithiocarbamate) | Methylenebis (dibutyldithiocarbamate) | 2930.2 | |
102-56-7 | 2,5-Dimethoxyaniline | 2,5-Dimethoxyaniline | 2921.42 | |
10257-55-3 | Calcium sulfite | Calcium;sulfite | 2830.9 | |
102-60-3 | Tetrahydroxypropyl Ethylenediamine | 1,1,1,1-ethylenedinitrilotetrapropan-2-ol | 2922.19 | |
1026511-90-9 | 25B-NBOMe | 2-(4-bromo-2,5-dimethoxyphenyl)-N-(2-methoxybenzyl) ethanamine | 2922.29 | 7 |
102-71-6 | Triethanolamine | 2-[Bis(2-hydroxyethyl)amino]ethanol | ||
102767-28-2 | Levetiracetam | (2R)-2-(2-oxopyrrolidin-1-yl)butanamide | 2933.79 | |
102-77-2 | 4-(1,3-benzothiazol-2-ylsulfanyl)morpholine | 4-(1,3-benzothiazol-2-ylsulfanyl)morpholine | ||
10277-43-7 | Lanthanum(III) nitrate hexahydrate | |||
102-79-4 | N-Butyldiethanolamine | N-Butyldiethanolamine | 2922.19 | |
10279-57-9 | White carbon black | Dioxosilane;hydrate | 2811.22 | |
10279-63-7 | Chromium potassium sulfate | 3210 | ||
102-82-9 | Tributylamine | Tributylamine | 2921.19 | |
10287-53-3 | Ethyl 4-dimethylaminobenzoate | Ethyl 4-dimethylaminobenzoate | 2916.31 | |
10294-26-5 | Silver sulfate | Disilver;sulfate | 2843.29 | |
10294-33-4 | Boron tribromide | Tribromoborane | 2812.9 | |
10294-34-5 | Boron trichloride | Trichloroborane | 2812.1 | |
10294-41-4 | Cerium(III) nitrate hexahydrate | Cerium(3+);trinitrate;hexahydrate | 2846.1 | |
10294-42-5 | Cerium(IV) sulfate tetrahtdrate | Cerium(4+);disulfate;tetrahydrate | 2846.1 | |
10294-46-9 | Copper(II) perchlorate hexahydrate 98% | Copper;diperchlorate;hexahydrate | 2829.901 | |
10294-54-9 | Caesium sulphate | Dicesium;sulfate | 2833.299 | |
10305-41-6 | 3-(Cyclohexyloxy)propane-1,2-diol | 3-(Cyclohexyloxy)propane-1,2-diol | 2904.9 | |
103055-07-8 | Lufenuron | N-{[2,5-dichloro-4-(1,1,2,3,3,3-hexafluoropropoxy)phenyl]carbamoyl}-2,6-difluorobenzamide | 2924.21 | 8 |
103-05-9 | Dimethylphenylethylcarbinol | Dimethylphenylethylcarbinol | 2906.29 | |
103-06-0 | Anilinomethanesulphonic acid | Anilinomethanesulphonic acid | 2921.49 | |
10309-37-2 | Bactris Gasipaes Fruit Juice | 4-[(1E,3S)-3-ethenyl-3,7-dimethylocta-1,6-dienyl]phenol | 2907.11 | |
1031-15-8 | Methyltriphenylphosphonium chloride | Methyltriphenylphosphonium chloride | 2931.9 | |
103-11-7 | 2-Ethylhexyl acrylate | 2-Ethylhexyl acrylate | 2916.12 | 8 |
10312-55-7 | 2-Aminoterephthalic Acid | 2-Aminoterephthalic Acid | 2922.49 | |
103170-28-1 | Zircon | ไม่พบข้อมูล | 2839.9 | |
10319-14-9 | Disperse yellow 64 | 3204.11 | ||
103-23-1 | Bis(2-ethylhexyl) adipate | Bis(2-ethylhexyl) adipate | 2917.12 | |
10323-20-3 | D-Arabinose | (2S,3R,4R)-2,3,4,5-tetrahydroxypentanal | 2940 | |
103239-24-3 | L-Glutathione oxidized disodium salt | Disodium (2S)-2-amino-5-[[(2R)-3-[[(2R)-2-[[(4S)-4-amino-4-carboxybutanoyl]amino]-3-(carboxylatomethylamino)-3-oxopropyl]disulfanyl]-1-(carboxymethylamino)-1-oxopropan-2-yl]amino]-5-oxopentanoate | 2930.9 | |
103-24-2 | Bis(2-ethylhexyl) azelate | Bis(2-ethylhexyl) azelate | 2917.13 | |
10326-27-9 | Barium chloride dihydrate | Barium(2+);dichloride;dihydrate | 2827.39 | |
103-26-4 | Methyl cinnamate | Methyl (E)-3-Phenylprop-2-enoate | 2932.19 | |
10326-41-7 | D-Lactic acid | (2R)-2-hydroxypropanoic acid | ||
103-29-7 | 1,2-Diphenylethane | 2-phenylethylbenzene | 2902.9 | |
10332-33-9 | Sodium perborate monohydrate | Sodium; 3-oxido dioxaborirane; hydrate | 2840.3 | |
103-34-4 | 4,4'-Dithiodimorpholine | 4-(morpholin-4-yldisulfanyl)morpholine | 2934.99 | |
1033464-89-9 | Myristoyl pullulan | 2931.9 | ||
103361-09-7 | Flumioxazin | 2-(7-fluoro-3-oxo-4-prop-2-yn-1-yl-3,4-dihydro-2H-1,4-benzoxazin-6-yl)-4,5,6,7-tetrahydro-1H-isoindole-1,3(2H)-dione | 2934.99 | 8 |
103-36-6 | Ethyl cinnamate | Ethyl cinnamate | 2916.39 | |
103370-83-8 | Kayamer PM 21 | 3824.9 | ||
103-37-7 | Benzyl butyrate | Benzyl Butyrate | 2915.6 | |
10339-55-6 | 3,7-Dimethylnona-1,6-dien-3-ol | 3,7-Dimethylnona-1,6-dien-3-ol | 2905.29 | |
103429-90-9 | 3-Methoxy-3-methylbutyl Acetate | 3-Methy-3-Methoxy butyl acetate | ||
103432-54-8 | Titanium IV 2, 2 (bis 2-propenolatomethyl) butanolato, tris (dioctyl) pyrophosphato - O | {[({1-[({bis[(6-methylheptyl)oxy]phosphoryl}oxy)(hydroxy)phosphoryl]-5-ethyl-2-{[({hydroxy[(6-methylheptyl)oxy]phosphoryl}oxy)[(6-methylheptyl)oxy]phosphoryl]oxy}-5-[(prop-2-en-1-yloxy)methyl]-1,3,7-trioxa-2-titanadec-9-en-2-yl}oxy)[(6-methylheptyl)oxy]ph | 2905.49 | |
1034343-98-0 | Graphene | Carbon | ||
10343-58-5 | Acid yellow 99 | Sodium hydroxy[2-hydroxy-5-nitro-3-[[2-oxo-1-(phenylcarbamoyl)propyl]azo]benzenesulphonato(3-)]chromate(1-) | 3204.12 | |
103-45-7 | Phenethyl acetate | Phenethyl acetate | 2915.39 | |
103476-89-7 | Leupeptin | Leupeptin | 2925.29 | |
103-48-0 | Phenylethyl isobutyrate | Phenylethyl isobutyrate | 2915.6 | |
103-49-1 | Dibenzylamine | Dibenzylamine | 2921.49 | |
103-50-4 | Benzyl ether | Benzyl ether | 2909.49 | |
103-54-8 | Cinnamyl acetate | Cinnamyl acetate | 2915.39 | |
103597-45-1 | 2,2'-Methylenebis[6-(benzotriazol-2-yl)-4-tert-octylphenol] | 2,2'-Methylenebis[6-(benzotriazol-2-yl)-4-tert-octylphenol] | ||
103598-93-2 | Solvent yellow 116 | 3204.12 | ||
103-60-6 | Phenoxyethyl isobutyrate | Phenoxyethyl isobutyrate | 2915.6 | |
10361-03-2 | Sodium polyphosphate | Sodium metaphosphate | 2835.39 | |
10361-29-2 | Ammonium carbonate | Diazanium;carbonate | 2836.99 | |
10361-37-2 | Barium Chloride | Barium Chloride | 8 | |
10361-43-0 | Bismuth hydroxide | Bismuth; trihydroxide | 2825.9 | |
10361-84-9 | Scandium (III) chloride | Triochloroscandium | 2846.9 | |
10361-92-9 | Yttrium chloride | Trichloroyttrium | 2846.9 | |
103639-04-9 | Ondansetron Hydrochloride | Ondansetron Hydrochloride | 2933.29 | |
103-65-1 | Propylbenzene | Propylbenzene | 2902.9 | 3 |
103671-44-9 | N,N-bis-(2-hydroxyethyl)-p-toluidine | N,N-bis-(2-hydroxyethyl)-p-toluidine | 2921.43 | |
103694-63-9 | Quaternary ammonium compounds, ethyl(2-hydroxy-C14-16-alkyl)bis[3-(ethyldimethylammonio)propyl]-, ethyl sulfates (salts) (1:3) ; Quaternium-75 | 3402.12 | ||
103-69-5 | N-Ethylaniline | N-Ethylaniline | 2921.42 | 3 |
103-71-9 | Phenyl isocyanate | Phenyl isocyanate | 2929.1 | |
103-72-0 | Phenyl isothiocyanate | Phenyl isothiocyanate | 2930.9 | |
103-73-1 | Benzylmethylether | Benzylmethylether | 2909.3 | |
1037-50-9 | Sulfadimethoxine sodium | Sulfadimethoxine sodium | 2935 | |
10377-48-7 | Lithium sulphate | Dilithium sulfate | 2833.29 | |
10377-51-2 | Lithium iodide crystalline powder | Lithium iodide | 2827.6 | |
10377-60-3 | Magnesium nitrate | Magnesium dinitrate | 4 | |
10377-66-9 | Manganese dinitrate | Manganese(2+) dinitrate | 2834.29 | |
10378-23-1 | EDTA tetrasodium salt dihydrate | etrasodium 2-[2-[bis(2-oxido-2-oxoethyl)amino]ethyl-(2-oxido-2-oxoethyl)amino] acetate dihydrate | 2921.21 | |
10378-47-9 | Ammonium cerium(IV) sulfate dihydrate | Tetraazanium; cerium(4+); tetrasulfate; dihydrate | 2846.1 | |
10380-28-6 | Oxine copper | Bis(quinolin-8-olato-κ2N,O)copper | 2933.49 | 8 |
103812-00-6 | Tetramethylammonium hydrogen sulfate monohydrate | Tetramethylammonium hydrogen sulfate monohydrate | 2923.9 | |
103-83-3 | N,N-Dimethylbenzylamine | N,N-Dimethylbenzylamine | 3 | |
103-84-4 | Acetanilide | Acetanilide | 2933.99 | |
103-85-5 | Phenyl-2-thiourea | Phenyl-2-thiourea | 2930.9 | |
10387-40-3 | Potassium thioacetate | Potassium thioacetate | 2930.9 | |
103-88-8 | 4-Bromoacetanilide | 4-Bromoacetanilide | 2924.29 | |
103-90-2 | Paracetamol | 4-Acetamidophenol | 2924.29 | 6 |
103-95-7 | 2-Methyl-3-(4-propan-2-ylphenyl)propanal | 2-Methyl-3-(4-propan-2-ylphenyl)propanal | 2912.29 | |
10396-10-8 | P-Tolene sulfonyl semicarbazide | [(4-methylphenyl)sulfonylamino]urea | 2836.3 | |
103980-44-5 | Ceftiofur hydrochloride | (6R,7R)-7-[[(2Z)-2-(2-amino-1,3-thiazol-4-yl)-2-methoxyiminoacetyl]amino]-3-(furan-2-carbonylsulfanylmethyl)-8-oxo-5-thia-1-azabicyclo[4.2.0]oct-2-ene-2-carboxylic acid;hydrochloride | 2941.9 | |
104010-37-9 | Ceftiofur sodium | Sodium (6R,7R)-7-[[(2Z)-2-(2-amino-1,3-thiazol-4-yl)-2-methoxyiminoacetyl]amino]-3-(furan-2-carbonylsulfanylmethyl)-8-oxo-5-thia-1-azabicyclo[4.2.0]oct-2-ene-2-carboxylate | 2941.9 | |
104-01-8 | (4-methoxyphenyl)acetic acid | (4-methoxyphenyl)acetic acid | 2918.99 | |
104040-78-0 | Flazasulfuron | N-[(4,6-dimethoxypyrimidin-2-yl)carbamoyl]-3-(trifluoromethyl)pyridine-2-sulfonamide | 2935.59 | |
104042-66-2 | Ammonium polyoxyalkylene polystylyl | 3402.11 | ||
10405-02-4 | Trospium chloride | (1R,3S,5S)-3-[(2-hydroxy-2,2-diphenylacetyl)oxy]-8λ⁵-azaspiro[bicyclo[3.2.1]octane-8,1'-pyrrolidin]-8-ylium chloride | 2934.99 | |
104098-48-8 | Imazapic | 2-(4-isopropyl-4-methyl-5-oxo-4,5-dihydro-1H-imidazol-2-yl)-5-methylnicotinic acid | 2933.39 | 8 |
104137-27-1 | Disperse Blue 354 ; C.I. 48480 | 3204.11 | ||
104-15-4 | Toluene-4-sulphonic acid | Toluene-4-sulphonic acid | 3 | |
10416-59-8 | Trimethylsilyl N-trimethylsilylacetamidate | 3824.6 | ||
10418-03-8 | Stanozolol | Stanozolol | 2937.9 | |
104-19-8 | N,N,4-Trimethyl-1-piperazinethanamin | N,N,4-Trimethyl-1-piperazinethanamin | 2933.59 | |
104206-82-8 | Mesotrione | 2-(4-mesyl-2-nitrobenzoyl) cyclohexane -1,3-dione | 2930.9 | |
10421-48-4 | Ferric nitrate | Iron(+3); trinitrate | 2834.29 | |
10422-66-9 | Bis(3-hydroxy-p-tolylammonium) sulphate | Bis(3-hydroxy-p-tolylammonium) sulphate | 2918.19 | |
104-23-4 | 4-[(4-aminophenyl)diazenyl]benzenesulfonic acid | 4-[(4-aminophenyl)diazenyl]benzenesulfonic acid | 2927 | |
10424-65-4 | Tetramethylammonium hydroxide pentahydrate | Tetramethylammonium hydroxide pentahydrate | 2923.9 | |
104-29-0 | Chlorphenesin | 3-(4-Chlorophenoxy)-1,2-propanediol | 6 | |
104295-55-8 | 6-Amino-N-methylnaphthalene-2-sulfonamide | 6-amino-N-methylnaphthalene-2-sulfonamide | ||
104322-63-6 | (1S)-(+)-(10-Camphorsulfonyl)oxaziridine | (1S)-(+)-(10-Camphorsulfonyl)oxaziridine | 2934.99 | |
1043376-75-2 | Polyoxyethylene Styrenated Phenyl Ether | 3402.13 | ||
104344-23-2 | Bisoprolol Hemifumarate | Bisoprolol Hemifumarate | 2922.5 | 6 |
104376-79-6 | Ceftriaxone Sodium | Sodium (6R,7R)-7-[[(2Z)-2-(2-amino-1,3-thiazol-4-yl)-2-methoxyiminoacetyl]amino]-3-[(2-methyl-5,6-dioxo-1H-1,2,4-triazin-3-yl)sulfanylmethyl]-8-oxo-5-thia-1-azabicyclo[4.2.0]oct-2-ene-2-carboxylate | 2941.9 | 6 |
1043868-97-8 | N-(2-Methoxybenzyl)-2-(2,5-dimethoxy-4-iodophenyl)ethanamine hydrochloride | 2-(4-iodo-2,5-dimethoxyphenyl)-N-[(2-methoxyphenyl)methyl]ethanamine hydrochloride | 2922.29 | |
10438-94-5 | 3-Octoxypropane-1,2-diol | 3-Octoxypropane-1,2-diol | 2905.39 | |
104404-17-3 | Ceramide | N-[(E,2S,3R)-1,3-dihydroxyoctadec-4-en-2-yl]octadecanamide | 3504 | |
104-40-5 | 4-Nonylphenol | 4-Nonylphenol | 2907.13 | |
10442-39-4 | Iminomethanide tetrabutylazanium | Iminomethanide tetrabutylazanium | 2923.9 | |
104-46-1 | Anethol | Anethol | ||
10450-60-9 | Periodic acid | Pentahydroxy(oxo)-λ7-iodane | 2811.19 | |
104-50-7 | Gamma-Octalactone ; Fragrance of gamma-Octalactone | Gamma-Octanolactone | ||
10453-86-8 | Resmethrin | Resmethrin | 2932.19 | |
104-54-1 | Cinnamic alcohol | (E)-3-phenylprop-2-en-1-ol | 2906.29 | |
104-55-2 | Cinnamaldehyde | Cinnamaldehyde | 2916.39 | |
104-58-1 | Acid blue 90 | 3204.11 | ||
104594-70-9 | Phenethyl Caffeate | Phenethyl Caffeate | 2918.29 | |
104-61-0 | Nonan-4-olide | Nonan-4-olide | 2942 | |
10461-98-0 | Rose Nitrile | Rose Nitrile | 2926.9 | |
104632-25-9 | Pramipexoldihydrochlorid | Pramipexoldihydrochlorid | 2934.2 | |
104634-06-2 | Dipentaerythritol (EO)13 hexaacrylate | 2916.12 | ||
104-67-6 | Gamma-undecalactone | Gamma undecalactone | 2912.29 | |
1047-16-1 | Pigment violet 19 | 5,12-dihydroquino[2,3-b]acridine-7,14-dione | 3206.19 | |
104-75-6 | Ethylhexylamine | Ethylhexylamine | 2921.19 | |
104-76-7 | Ethylhexanol | Ethylhexanol | ||
10476-85-4 | Stannic chloride | Strontium dichloride | 2827.39 | |
104-78-9 | Diethylaminopropyl amine | Diethylaminopropyl amine | 2921.29 | 3 |
104810-48-2 | A mixture of: a-3-(3-(2Hbenzotriazol- 2-yl)-5-tert-butyl- 4-hydroxyphenyl)propionyl-whydroxypoly( oxyethylene);a-3- (3-(2H-benzotriazo | |||
104821-25-2 | Dihydroethidium | 5-Ethyl-6-phenyl-6H-phenanthridine-3,8-diamine | 2933.99 | |
10486-00-7 | Sodium perborate tetrahydrate | Sodium; 3-oxido dioxaborirane; tetrahydrate | 2840.3 | |
104-86-9 | 4-Chlorobenzylamine | 4-Chlorobenzylamine | 2921.49 | |
104-87-0 | P-Tolualdehyde | 4-Methylbenzaldehyde | 2912.29 | |
104-88-1 | 4-Chlorobenzaldehyde | 4-Chlorobenzaldehyde | 2913 | |
10489-46-0 | Rhodium sulphate | Dirhodium trisulphate | 3824.9 | |
104903-79-9 | beta-Secretase substrate IV, fluorogenic | (4S)-4-[(1R,2S)-2-hydroxy-1,4-dimethylcyclohex-3-en-1-yl]-3-(hydroxymethyl)-4-methylcyclopent-2-en-1-one | 2927 | |
104-93-8 | Methyl p-tolyl ether | Methyl p-tolyl ether | 2909.3 | |
104-94-9 | P-Anisidine | P-Anisidine | 2922.29 | 3 |
105-05-5 | 1,4-Diethylbenzol | 1,4-Diethylbenzol | 2902.9 | |
105076-77-5 | Disperse blue 367 | 3204.11 | ||
105-07-7 | 4-Cyanobenzaldehyde | 4-Cyanobenzaldehyde | 2926.9 | |
10508-09-5 | Di-tert-pentyl peroxide | Di-tert-pentyl peroxide | 2909.6 | |
105-08-8 | 1,4-Cyclohexanedimethanol | 1,4-Cyclohexanedimethanol | 2906.19 | |
105-11-3 | p-Benzoquinone dioxime | p-Benzoquinone dioxime | ||
1051375-19-9 | Dolutegravir sodium | Sodium (4R,12aS)-9-[(2,4-difluorophenyl)methylcarbamoyl]-4-methyl-6,8-dioxo-3,4,12,12a-tetrahydro-2H-pyrido[5,6]pyrazino[2,6-b][1,3]oxazin-7-olate | 2942 | |
105157-03-7 | Solvent red 83:1 | 3204.19 | ||
105-16-8 | Diethylaminoethylmethacrylate | Diethylaminoethylmethacrylate | 2916.19 | |
1051924-91-4 | Dipentaerythrityl hexaisononanoate | 2915.9 | ||
105-21-5 | Gamma-Heptanolactone | Gamma-Heptanolactone | 2932.99 | |
105219-56-5 | 4-[3-[4[(2-Chlorophenyl)-9-methyl-6H-thieno[3,2-f][1,2,4]triazolo[4,3-a]diazepin-2-yl]-1-oxopropyl]morpholine | 4-[3-[4[(2-Chlorophenyl)-9-methyl-6H-thieno[3,2-f][1,2,4]triazolo[4,3-a]diazepin-2-yl]-1-oxopropyl]morpholine | 2934.99 | |
105-30-6 | 2-Methylpentan-1-ol | 2-Methylpentan-1-ol | 2905.19 | |
10534-59-5 | Tetrabutylammonium Acetate | Tetrabutylazanium acetate | 2923.9 | |
10534-89-1 | Hexaamminecobalt(III) chloride | Azane; cobalt(3+); trichloride | 2842.9 | |
105-37-3 | Ethyl Propionate ; Fragrance of ethyl propionate | Ethyl propionate | ||
105-43-1 | 3-Methylpentanoic acid | 3-Methylpentanoic acid | 2915.9 | |
10543-57-4 | Tetraacetylethylenediamine | N-acetyl-N-[2-(diacetylamino)ethyl]acetamide | 2921.29 | |
105-45-3 | Methyl Acetoacetate | Methyl Acetoacetate | 2918.3 | |
105-46-4 | Sec-butyl Acetate | Sec-butyl Acetate | ||
105-53-3 | Diethyl propanedioate | Diethyl propanedioate | 2917.19 | |
105-54-4 | Ethyl butanoate ; Fragrance of ethyl butyrate | Ethyl butanoate | ||
105-55-5 | 1,3-Diethyl-2-thiourea | Diethyl thiourea | ||
10555-76-7 | Sodium metaborate tetrahydrate | Sodium; oxido(oxo)borane; tetrahydrate | 2840.2 | |
105-56-6 | Ethyl Cyanoacetate | Ethyl 2-cyanoacetate | 2926.9 | |
105-57-7 | Acetal | 1,1-Diethoxyethane | 2911 | 3 |
105-58-8 | Ethyl Carbonate | Diethyl carbonate | 2917.19 | |
105-59-9 | Methyl diethanolamine | 2-[2-hydroxyethyl(methyl)amino]ethanol | 2922.19 | |
105-60-2 | Caprolactam | azepan-2-one | 2933.79 | |
10563-29-8 | Dimethyldipropylenetriamine | N'-[3-(dimethylamino)propyl]propane-1,3-diamine | 2921.29 | |
105635-66-3 | Reactive red 106 | 3204.16 | ||
10563-70-9 | Melitracen Hydrochloride | 3-(10,10-dimethylanthracen-9-ylidene)-N,N-dimethylpropan-1-amine;hydrochloride | 2921.49 | |
105-64-6 | Diisopropyl Peroxydicarbonate | Propan-2-yl propan-2-yloxycarbonyloxy carbonate | ||
105-67-9 | 2,4-dimethylphenol | 2,4-dimethylphenol | 2907.19 | |
105-68-0 | Isoamyl Propionate ; Fragrance of isoamyl propionate | 3-methylbutyl propanoate | ||
105-74-8 | Lauroyl Peroxide | Dodecanoyl dodecaneperoxoate | 2915.9 | 3 |
105-75-9 | Dibutyl Fumarate | Dibutyl (E)-but-2-enedioate | 2917.19 | |
105-76-0 | Dibutyl maleate | Dibutyl (Z)-but-2-enedioate | 2917.19 | |
105-83-9 | N,N-Bis(3-aminopropyl)methylamine | N'-(3-aminopropyl)-N'-methylpropane-1,3-diamine | 2921.29 | |
10584-98-2 | Dibutyltinbis(2-ethylhexyl mercaptoacetate) | 2-ethylhexyl 4,4-dibutyl-10-ethyl-7-oxo-8-oxa-3,5-dithia-4-stannatetradecan-1-oate | 3812.3 | |
105-86-2 | Geranyl Formate | [(2E)-3,7-dimethylocta-2,6-dienyl] formate | 2915.39 | |
105-87-3 | Geranyl Acetate | [(2E)-3,7-dimethylocta-2,6-dienyl] acetate | 2915.39 | |
10588-01-9 | Sodium dichromate | Disodium; oxido-(oxido(dioxo) chromio)oxy-dioxochromium | 2841.3 | 3 |
10591-84-1 | N,N'-Dimethyldiphenylthiuram disulphide | N,N'-dimethyldiphenylthiuram disulfide | ||
10591-85-2 | Tetrabenzylthiuram Disulfide | Dibenzylcarbamothioylsulfanyl N,N-dibenzylcarbamodithioate | ||
10592-13-9 | Doxycycline Hydrochloride | (4S,4aR,5S,5aR,6R,12aR)-4-(dimethylamino)-1,5,10,11,12a-pentahydroxy-6-methyl-3,12-dioxo-4a,5,5a,6-tetrahydro-4H-tetracene-2-carboxamide;hydrochloride | 2941.3 | 6 |
105-95-3 | Ethylene Brassylate | 1,4-dioxacycloheptadecane-5,17-dione | 2917.19 | |
105953-73-9 | Basic blue 159 | 3204.13 | ||
10595-72-9 | Ditridecyl Thiodipropionate | Tridecyl 3-(3-oxo-3-tridecoxypropyl)sulfanylpropanoate | ||
10597-89-4 | N-Acetylmuramic acid | (2R)-2-[(2R,3R,4R,5R)-2-acetamido-4,5,6-trihydroxy-1-oxohexan-3-yl]oxypropanoic acid | 2932.99 | |
10599-69-6 | 2-Methyl-5-propionylfuran | 1-(5-methylfuran-2-yl)propan-1-one | 2932.19 | |
105-99-7 | Dibutyl Adipate | Dibutyl hexanedioate | ||
10599-70-9 | 3-Acetyl-2,5-dimethylfuran | 1-(2,5-dimethylfuran-3-yl)ethanone | 2932.19 | |
106-02-5 | Pentadecalactone | Oxacyclohexadecan-2-one | 2932.2 | |
10605-02-4 | Palmatine Chloride | 2,3,9,10-tetramethoxy-5,6-dihydroisoquinolino[2,1-b]isoquinolin-7-ium;chloride | 2939.99 | |
10605-21-7 | Carbendazim ; methyl benzimidazol-2-ylcarbamate | 2933.39 | 8 | |
106-09-2 | N-[2-[(2-hydroxyethyl)amino]ethyl]dodecanamide | N-{2-[(2-hydroxyethyl)amino]ethyl}dodecanamide | 3402.9 | |
106096-93-9 | Basic fibroblast growth factor | 3504 | ||
106-11-6 | PEG-2 Stearate | 2-(2-Hydroxyethoxy)ethyl octadecanoate | ||
106-14-9 | 12-Hydroxystearic acid | 12-hydroxyoctadecanoic acid | ||
106-21-8 | 3,7-Dimethyloctan-1-ol | 3,7-dimethyloctan-1-ol | 2905.22 | |
106-22-9 | Citronellol | 3,7-dimethyloct-6-en-1-ol | 2905.29 | |
106-23-0 | Citronellal | 3,7-dimethyloct-6-enal | 2912.19 | |
1062368-62-0 | BMP Inhibitor IV, LDN-193189 | 4-[6-(4-piperazin-1-ylphenyl)pyrazolo[1,5-a]pyrimidin-3-yl]quinoline;hydrochloride | 2933.59 | |
106-24-1 | Geraniol | (2E)-3,7-dimethylocta-2,6-dien-1-ol | 2905.29 | |
106-25-2 | Nerol | (2Z)-3,7-dimethylocta-2,6-dien-1-ol | 2905.22 | |
106264-79-3 | Dimethyl thio-toluene diamine | 3,5-dimethylthio-2,4-toluenediamine 3,5-dimethylthio-2,6-toluenediamine-(mixture) | ||
106266-06-2 | Risperidone | 3-[2-[4-(6-fluoro-1,2-benzoxazol-3-yl)piperidin-1-yl]ethyl]-2-methyl-6,7,8,9-tetrahydropyrido[1,2-a]pyrimidin-4-one | 2942 | |
106-27-4 | Isoamyl butyrate | 3-methylbutyl butanoate | 2915.6 | |
106276-79-3 | Pigment yellow 109 | 3204.17 | ||
106-28-5 | Farnesol | (2E,6E)-3,7,11-trimethyldodeca-2,6,10-trien-1-ol | 2905.22 | |
106-30-9 | Ethyl Heptanoate | Ethyl Heptanoate | 2915.9 | |
106-32-1 | Ethyl Octanoate ; Fragrance of ethyl caprylate | Ethyl octanoate | ||
106-33-2 | Ethyl Laurate | Ethyl dodecanoate | 2909.5 | |
106-34-3 | Quinhydrone | Benzene-1,4-diol cyclohexa-2,5-diene-1,4-dione | 2942 | |
106359-91-5 | Reactive yellow 174 | 3204.16 | ||
106-36-5 | Propyl Propionate | Propyl Propionate | 2915.5 | 3 |
106-37-6 | P-Dibromobenzene | 1,4-dibromobenzene | 2903.99 | |
106387-52-4 | Reactive yellow 164 | 3204.16 | ||
106392-12-5 | Oxirane, 2-methyl-, polymer with oxirane, block | 3402.13 | ||
106-40-1 | P-Bromoaniline | 4-bromoaniline | 2921.42 | |
106-42-3 | P-Xylene | 1,4-xylene | 2902.43 | 3 |
106-44-5 | Para-cresol | 4-methylphenol | 2907.12 | 8 |
1064-48-8 | Acid black 1 | Sodium 4-amino-5-hydroxy-3-(4-nitrophenylazo)-6-(phenylazo)naphthalene-2,7-disulfonate | 3204.12 | |
106463-17-6 | Tamsulosin Hydrochloride | 5-[(2R)-2-[2-(2-ethoxyphenoxy)ethylamino]propyl]-2-methoxybenzenesulfonamide hydrochloride | 2935 | |
106463-33-6 | Sodium Molybdate | 3402.9 | ||
106-46-7 | Paradichlorobenzene | 1,4-dichlorobenzene | 2903.91 | |
106-47-8 | 4-Chloroaniline | 4-Chloroaniline | 2921.42 | |
106-48-9 | Parachlorophenol | Parachlorophenol | 2908.19 | 8 |
106-49-0 | 4-Methylbenzenamine | 4-methylaniline | 2921.43 | 3 |
106-50-3 | P-Phenylenediamine | Benzene-1,4-diamine | 2921.51 | 3 |
106-51-4 | Quinone | Cyclohexa-2,5-diene-1,4-dione | 2914.69 | 3 |
106-54-7 | P-Chlorothiophenol | 4-Chlorobenzenethiol | 2930.9 | |
106-58-1 | 1,4-Dimethylpiperazine | 1,4-Dimethylpiperazine | 2933.59 | |
106627-54-7 | N-Hydroxysulfosuccinimide sodium salt | Sodium 1-hydroxy-2,5-dioxopyrrolidine-3-sulfonate | 2925.19 | |
1066-30-4 | Chromium(III) acetate | Chromium(3+) triacetate | 2915.29 | |
1066-33-7 | Ammonium bicarbonate | Azanium;hydrogen carbonate | 2836.99 | |
106-63-8 | Isobutyl Acrylate ; Fragrance of isobutyl acrylate | 2-methylpropyl prop-2-enoate | 3 | |
1066-40-6 | Trimethylsilanol | Hydroxy(trimethyl)silane | 2931.9 | |
106-65-0 | Dimethyl Succinate | Dimethyl butanedioate | 2917.19 | |
1066-54-2 | Trimethylsilylacetylene | Ethynyl(trimethyl)silane | 2931.9 | |
106-68-3 | Fragrance of 3-octanone | Octan-3-one | 3302.9 | |
106685-40-9 | Adapalene | 6-[3-(1-adamantyl)-4-methoxyphenyl]naphthalene-2-carboxylic acid | 2918.99 | |
106-70-7 | Methyl caproate | Methyl hexanoate | 2915.9 | |
106-72-9 | Melonal | 2,6-Dimethylhept-5-enal | 2912.19 | |
1067-33-0 | Dibutyltin diacetate | Dibutyltin diacetate | 2931.9 | |
1067-47-6 | 3-Cyanopropyltriethoxysilane | 4-triethoxysilylbutanenitrile | 2931.9 | |
106-75-2 | Oxydiethylene Bis(Chloroformate) | 2-(2-carbonochloridoyloxyethoxy)ethyl carbonochloridate | 2915.9 | 3 |
1067-53-4 | Methoxyethoxyvinylsilane | 3824.1 | ||
106797-53-9 | 2-Hydroxy-4'-(2-hydroxyethoxy)-2-methylpropiophenone | 2-hydroxy-1-[4-(2-hydroxyethoxy)phenyl]-2-methylpropan-1-one | 2914.5 | |
106803-25-2 | Barrel therm 200 | 2710.19 | ||
1068-55-9 | Isopropylmagnesium chloride | Magnesium propane chloride | 2931.9 | |
1068-57-1 | Acetylhydrazine | Acetohydrazide | 2928 | |
106-88-7 | Butylene oxide ; 1,2-Epoxybutane | 2-Ethyloxirane | ||
106-89-8 | Epichlorohydrin | 2-(chloromethyl)oxirane | 2910.3 | |
106-91-2 | Glycidyl Methacrylate | Oxiran-2-ylmethyl 2-methylprop-2-enoate | 3 | |
106917-31-1 | 1-acetyl-4-(3-dodecyl-2,5-dioxo-1-pyrrolidinyl)-2,2,6,6-tetramethylpiperidine | 1-(1-acetyl-2,2,6,6-tetramethylpiperidin-4-yl)-3-dodecylpyrrolidine-2,5-dione | 3812.3 | |
106-92-3 | Allyl Glycidyl Ether | 2-(prop-2-enoxymethyl)oxirane | 2910.9 | 3 |
106-94-5 | Propyl Bromide | 1-Bromopropane | 2903.39 | 3 |
106-95-6 | Allyl Bromide | 3-bromoprop-1-ene | 2903.39 | |
106956-32-5 | Oncostatin M | 3504 | ||
1069-66-5 | Valproate Sodium | Sodium 2-propylpentanoate | 2915.9 | |
106-96-7 | Propargyl Bromide | 3-Bromoprop-1-yne | 2903.39 | |
106-97-8 | Butane | 3 | ||
106-98-9 | 1-Butene | But-1-ene | 2901.23 | 3 |
106-99-0 | 1,3-Butadiene | Buta-1,3-diene | ||
106990-43-6 | N,N',N'',N'''-tetrakis(4,6-bis(butyl-(N-methyl-2,2,6,6-tetramethylpiperidin-4-yl)amino)triazin-2-yl)-4,7-diazadecane-1,10-diamine | 3812.3 | ||
1070-00-4 | Trioctylaluminum | Trioctylalumane | 2931.1 | |
1070-10-6 | Titanium(IV) 2-ethylhexyloxide | 2-ethylhexan-1-olate titanium(4+) | 3824.9 | |
1070-11-7 | Ethambutol dihydrochloride | (2S)-2-[2-[[(2S)-1-hydroxybutan-2-yl]amino]ethylamino]butan-1-ol dihydrochloride | ||
107-05-1 | Allyl chloride ; 3-chloro-1-propene | 3-chloropropene | 2903.29 | |
107-06-2 | Ethylene dichloride | 1,2-dichloroethane | ||
107-07-3 | Ethylene Chlorohydrin | 2-chloroethanol | 2905.59 | |
107091-89-4 | Thiazole Orange | 4-methylbenzenesulfonate (2Z)-3-methyl-2-[(1-methylquinolin-1-ium-4-yl)methylidene]-1,3-benzothiazole | 2934.2 | |
107-11-9 | Allylamine | Prop-2-en-1-amine | 2921.19 | 3 |
107-12-0 | Propionitrile | Propanenitrile | 2926.9 | 8 |
1071-23-4 | Phosphorylcolamine | 2-aminoethyl dihydrogen phosphate | 2922.19 | |
107-13-1 | Acrylonitrile | Prop-2-enenitrile | 2926.1 | |
107-15-3 | Ethylenediamine | Ethane-1,2-diamine | 2921.21 | |
1071-83-6 | Glyphosate ; N-(phosphonomethyl)glycine | 2931.39 | 8 | |
1071-93-8 | Adipic dihydrazide | Hexanedioic acid, 1,6-dihydrazide | ||
107-19-7 | Propargyl Alcohol | Prop-2-yn-1-ol | 2905.29 | 3 |
107-21-1 | Ethylene glycol | 3 | ||
107-22-2 | Oxaldehyde | Oxaldehyde | 2912.19 | 3 |
1072-35-1 | Lead stearate | Lead(2+);octadecanoate | ||
1072-63-5 | N-Vinylimidazole | 1-ethenylimidazole | 2933.29 | |
1072-71-5 | 1,3,4-Thiadiazolidine-2,5-dithione | 1,3,4-Thiadiazolidine-2,5-dithione | 2934.2 | |
1072-83-9 | 2-Acetylpyrrole | 1-(1H-pyrrol-2-yl)ethanone | 2933.99 | |
1072-97-5 | 2-Amino-5-bromopyridine | 5-bromopyridin-2-amine | 2933.39 | |
107-35-7 | Taurine | 2-aminoethanesulfonic acid | 2921.19 | |
107-39-1 | Diisobutylene | 2,4,4-trimethylpent-1-ene | 2901.29 | 3 |
107-41-5 | Hexylene Glycol | 2-methylpentane-2,4-diol | 2909.49 | 3 |
1074-36-8 | 4-Mercaptobenzoic acid | 4-sulfanylbenzoic acid | 2930.9 | |
107-43-7 | Betaine | 2-(trimethylazaniumyl)acetate | ||
107-45-9 | Tert-octylamine | 2,4,4-trimethylpentan-2-amine | 2921.19 | |
107-46-0 | Hexamethyldisiloxane | Trimethyl(trimethylsilyloxy)silane | 2931.9 | |
1074-82-4 | Potassium phthalimide | Potassium isoindol-2-ide-1,3-dione | 2925.19 | |
107534-96-3 | Tebuconazole | 1-(4-chlorophenyl)-4,4-dimethyl-3-(1,2,4-triazol-1-ylmethyl)pentan-3-ol | 2933.99 | 8 |
107-54-0 | 3,5-Dimethylhex-1-yn-3-ol | 3,5-Dimethylhex-1-yn-3-ol | ||
107628-04-6 | Trideceth-2 carboxamide MEA | 3402.13 | ||
1076-38-6 | 4-Hydroxycoumarin | 4-hydroxycoumarin | 3212.9 | |
107-64-2 | Distearyldimonium Chloride | Dimethyl(dioctadecyl)azanium chloride | ||
107-66-4 | Dibutyl Phosphate | Dibutyl hydrogen phosphate | 2919.9 | |
1076-97-7 | 1,4-Cyclohexanedicarboxylic acid | Cyclohexane-1,4-dicarboxylic acid | 2917.2 | |
1077-28-7 | Thioctic Acid | 5-(dithiolan-3-yl)pentanoic acid | 2934.99 | |
107-75-5 | Hydroxycitronellal | 7-hydroxy-3,7-dimethyloctanal | 2912.49 | |
107761-42-2 | Human beta-amyloid peptide (1-42) | 6 | ||
1078153-58-8 | 1,2,4,5-Tetrakis(4-carboxyphenyl)benzene | 4-[2,4,5-tris(4-carboxyphenyl)phenyl]benzoic acid | 2917.39 | |
107-83-5 | 2-Methylpentane | 2-Methylpentane | ||
107-87-9 | Methyl Propyl Ketone | Pentan-2-one | ||
107-88-0 | 1,3-Butanediol | Butane-1,3-diol | 2905.39 | |
107898-54-4 | Supersantol | 3,3-dimethyl-5-(2,2,3-trimethylcyclopent-3-en-1-yl)pent-4-en-2-ol | 2906.19 | |
107-92-6 | Butyric acid ; Fragrance of n-butyric acid | Butyric acid | 3 | |
107-93-7 | Crotonic Acid | (E)-but-2-enoic acid | 2916.19 | |
107-95-9 | beta-Alanine | 3-aminopropanoic acid | 2922.29 | |
107-96-0 | 3-Mercaptopropionic acid | 3-sulfanylpropanoic acid | 2930.9 | |
1079-66-9 | Chlorodiphenylphosphine | Chloro(diphenyl)phosphane | 2931.9 | |
107-97-1 | Sarcosine | 2-(methylamino)acetic acid | 2922.49 | |
107-98-2 | 1-Methoxy-2-propanol | 1-methoxypropan-2-ol | 2909.49 | 3 |
108-01-0 | Deanol | 2-(dimethylamino)ethanol | 2922.19 | |
108-03-2 | 1-Nitropropane | 1-Nitropropane | 3 | |
108050-54-0 | Tilmicosin | (4R,5S,6S,7R,9R,11E,13E,15R,16R)-6-[(3R,4S,5S,6R)-4-(dimethylamino)-3,5-dihydroxy-6-methyloxan-2-yl]oxy-7-[2-[(3R,5S)-3,5-dimethylpiperidin-1-yl]ethyl]-16-ethyl-4-hydroxy-15-[[(2R,3R,4R,5R,6R)-5-hydroxy-3,4-dimethoxy-6-methyloxan-2-yl]oxymethyl]-5,9,13-tr | 2941.9 | |
108-05-4 | Vinyl Acetate | Ethenyl acetate | 2915.32 | |
108-10-1 | Methyl Isobutyl Ketone | 4-methylpentan-2-one | 2914.5 | |
108-11-2 | 4-Methyl-2-pentanol | 4-methylpentan-2-ol | 2905.19 | 3 |
108-18-9 | Diisopropylamine | N-propan-2-ylpropan-2-amine | 2921.19 | 3 |
108-19-0 | Imidodicarbonic Diamide | Carbamoylurea | 2924.19 | |
108-20-3 | Isopropyl Ether | 2-propan-2-yloxypropane | 2909.2 | 3 |
108-21-4 | Isopropyl Acetate | Propan-2-yl acetate | 2915.39 | 3 |
108-22-5 | Isopropenyl acetate | Prop-1-en-2-yl acetate | 2915.39 | |
108-24-7 | Acetyl acetate | Acetyl acetate | 2915.24 | |
108250-40-4 | Dioctyldodeceth-5 lauroyl glutamate | 3402.13 | ||
108-26-9 | 3-Methyl-2-pyrazolin-5-one | 3-methyl-1,4-dihydropyrazol-5-one | 2933.19 | |
1082-88-8 | Trimethoxyamphetamine ; TMA | (±)-3,4,5-trimethoxy-α-methylphenethylamine | 2922.29 | 7 |
108-30-5 | Succinic Anhydride | Oxolane-2,5-dione | 2917.19 | 3 |
108-31-6 | Maleic Anhydride | Furan-2,5-dione | 2917.14 | |
108321-42-2 | Geneticin Disulfate | (2S,3S,4S,5S)-2-[(1S,2S,3R,4S,6R)-4,6-diamino-3-[(2S,3R,4R,5S,6R)-3-amino-4,5-dihydroxy-6-(1-hydroxyethyl)oxan-2-yl]oxy-2-hydroxycyclohexyl]oxy-5-methyl-4-(methylamino)oxane-3,5-diol;sulfuric acid | 2941.9 | |
108-32-7 | Propylene Carbonate | 4-methyl-1,3-dioxolan-2-one | ||
108341-18-0 | Norepinephrine bitartrate monohydrate | 4-(2-amino-1-hydroxyethyl)benzene-1,2-diol 2,3-dihydroxybutanedioic acid hydrate | 2937.9 | |
1083-48-3 | 4-(4-Nitrobenzyl)pyridine | 4-[(4-nitrophenyl)methyl]pyridine | 2933.39 | |
108-38-3 | m-Xylene | 1,3-xylene | 2902.42 | 3 |
108-39-4 | Metacresol | 3-methylphenol | 2907.12 | 8 |
108-44-1 | M-Toluidine | 3-methylaniline | 2921.43 | 3 |
108-45-2 | M-Phenylenediamine | Benzene-1,3-diamine | 2921.51 | 3 |
108-46-3 | Resorcinol | 1,3-dihydroxybenzene | 3 | |
108464-53-5 | Poly(acrylamide-co-diallyldimethylammonium chloride) | 3402.19 | ||
108-48-5 | 2,6-Lutidine | 2,6-dimethylpyridine | 2933.39 | |
108-55-4 | Glutaric Anhydride | Oxane-2,6-dione | 2917.19 | |
108-59-8 | Dimethyl malonate | Dimethyl propanedioate | 2917.19 | |
108-64-5 | Ethyl Isovalerate ; Fragrance of ethyl isovalerate | Ethyl isovalerate | ||
108-65-6 | 1-Methoxy-2-propyl acetate | 1-methoxypropan-2-yl acetate | ||
108-67-8 | Mesitylene | 1,3,5-trimethylbenzene | 2902.9 | |
108688-10-4 | LiChroprep RP-18 | 3824.9 | ||
108-69-0 | 3,5-Xylidine | 3,5-dimethylaniline | 2921.49 | |
108-73-6 | Phloroglucinol | Benzene-1,3,5-triol | 2907.29 | |
108-75-8 | 2,4,6-Trimethylpyridine | 2,4,6-Trimethylpyridine | 2933.39 | |
108-77-0 | Cyanuric Acid Chloride | 2,4,6-trichloro-1,3,5-triazine | 2933.69 | 3 |
108777-93-1 | Polyglyceryl-3 Caprylate | 2915.9 | ||
108-78-1 | Melamine | 1,3,5-triazine-2,4,6-triamine | 2933.61 | |
108-80-5 | Cyanuric acid | 1,3,5-triazinane-2,4,6-trione | 2933.69 | |
1088-11-5 | Nordazepam | 7-chloro-1,3-dihydro-5-phenyl-2H-1,4-benzodiazepin-2-one | 2933.91 | 9 |
108811-61-6 | 4-(2-Furyl)-3-buten-2-one | (3Z)-4-(furan-2-yl)but-3-en-2-one | 2932.19 | |
108-82-7 | 2,6-Dimethyl-4-heptanol | 2,6-dimethylheptan-4-ol | 2914.19 | |
108-83-8 | Diisobutyl Ketone | 2,6-dimethylheptan-4-one | 2914.19 | 3 |
108-86-1 | Bromobenzene | Bromobenzene | 2903.99 | 3 |
108-87-2 | Methylcyclohexane | Methylcyclohexane | 3 | |
108-88-3 | Toluene | Toluene | ||
108-90-7 | Chlorobenzene | Chlorobenzene | 2903.99 | |
108-91-8 | Cyclohexylamine | Cyclohexylamine | 2921.3 | |
108929-04-0 | Epinastine Hydrochloride | 3-Amino-9,13b-dihydro-1H-dibenz(c,f)imidazo(1,5-a)azepine monohydrochloride | 2933.99 | |
108-93-0 | Cyclohexanol | Cyclohexanol | 2906.12 | 3 |
108-94-1 | Cyclohexanone | Cyclohexanone | 2914.22 | 3 |
108-95-2 | Phenol | Phenol | ||
108-98-5 | Thiophenol | Benzenethiol | 2930.9 | 8 |
109-01-3 | N-Methylpiperazine | 1-methylpiperazine | 2933.59 | |
109-02-4 | 4-Methylmorpholine | 4-Methylmorpholine | 2934.99 | |
109037-78-7 | Titanium, Bu phosphate Et alc. iso-Pr alc. Complexes | |||
109-04-6 | 2-Bromopyridine | 2-Bromopyridine | 2933.39 | |
109-06-8 | alpha-Picoline | 2-methylpyridine | 2933.39 | 3 |
109-08-0 | 2-Methylpyrazine | 2-Methylpyrazine | 2933.99 | |
109-09-1 | 2-Chloropyridine | 2-Chloropyridine | 2933.39 | |
109-12-6 | Pyrimidin-2-amine | Pyrimidin-2-amine | 2933.59 | |
109-16-0 | Triethylene Glycoldimethacrylate | 2-[2-[2-(2-methylprop-2-enoyloxy)ethoxy]ethoxy]ethyl 2-methylprop-2-enoate | 2916.14 | |
109-19-3 | Butyl Isovalerate | Butyl 3-methylbutanoate | 2915.6 | |
109-21-7 | Butyl butyrate | Butyl butanoate | 2915.6 | 3 |
109–23–9 | N,N'-Methylenebis(stearamide) | N-[(octadecanoylamino)methyl]octadecanamide | 2924.19 | |
1094026-85-3 | 2-Iodo-4,5-dimethylbenzaldehyde | 2-Iodo-4,5-dimethylbenzaldehyde | 2913 | |
109414-04-2 | Pigment brown 29 | Chromium iron oxide | 3204.17 | |
109-43-3 | Dibutyl Sebacate | Dibutyl decanedioate | 2917.13 | |
109-46-6 | 1,3-Dibutylthiourea | 1,3-Dibutylthiourea | 2930.3 | |
109-52-4 | Valeric acid | Pentanoic acid | 2915.6 | 3 |
109-55-7 | 3-Dimethylaminopropylamine | N',N'-dimethylpropane-1,3-diamine | 3 | |
109-57-9 | Allylthiourea | Prop-2-enylthiourea | 2930.9 | |
1095-90-5 | Methadone hydrochloride | 6-(dimethylamino)-4,4-diphenylheptan-3-one hydrochloride | 2933.91 | |
109-60-4 | Propyl Acetate | Propyl Acetate | 2915.39 | 3 |
109-63-7 | Boron trifluoride ethyl ether | Ethoxyethane trifluoroborane | 2942 | |
109-64-8 | Trimethylene Bromide | 1,3-dibromopropane | 2903.39 | |
109-65-9 | Butyl Bromide | 1-bromobutane | 2903.39 | |
109-66-0 | Pentane | Pentane | 2901.1 | 3 |
109-67-1 | 1-Pentene | Pent-1-ene | 2901.29 | |
109-68-2 | 2-Pentene | Pent-2-ene | 2901.29 | |
109-69-3 | Butyl Chloride | 1-chlorobutane | 2903.19 | 3 |
109-70-6 | 1-Bromo-3-chloropropane | 1-Bromo-3-chloropropane | 2903.99 | |
109-72-8 | n-Butyllithium | Butyllithium | 3815.9 | |
109-73-9 | Butylamine | Butan-1-amine | 2912.19 | 3 |
109-76-2 | 1,3-Propanediamine | Propane-1,3-diamine | 2921.29 | |
109-77-3 | Malononitrile | Propanedinitrile | 2926.9 | |
109-80-8 | 1,3-Propane dithiol | Propane-1,3-dithiol | 2930.9 | |
109-81-9 | 2-Aminoethylmethylamine | N'-methylethane-1,2-diamine | 2921.29 | |
109-83-1 | 2-(Methylamino)ethanol | 2-(Methylamino)ethanol | 2922.19 | 3 |
109-86-4 | Ethylene glycol monomethyl ether | 2-methoxyethanol | 2909.44 | |
109-87-5 | Methylal | Dimethoxymethane | ||
109-89-7 | Diethylamine | N-ethylethanamine | 2921.19 | |
109-94-4 | Ethyl formate | Ethyl formate | 2915.13 | |
1099-45-2 | (Carbethoxymethylene)triphenylphosphorane | Ethoxycarbonylmethylen-triphenylphosphorane | 2931.9 | |
109-97-7 | Pyrrole | 1H-pyrrole | 2933.99 | |
109-99-9 | Tetrahydrofuran | Oxolane | 2932.11 | 3 |
110-00-9 | Furan | Furan | 2932.19 | |
110-02-1 | Thiophene | Thiophene | 2934.99 | |
11003-38-6 | Capreomycin | 2922.19 | ||
110-05-4 | Tert-butylperoxide | 2-tert-butylperoxy-2-methylpropane | 3 | |
11006-34-1 | Chlorophyllin sodium copper salt ; Fragrance of chlorophyllin, trisodium salt | Trisodium (2S-trans)-[18-carboxy-20-(carboxymethyl)-13-ethyl-2,3-dihydro-3,7,12,17-tetramethyl-8-vinyl-21H,23H-porphine-2-propionato(5-)-N21,N22,N23,N24]cuprate(3-) | ||
110069-04-0 | Alkyl polysaccharide | 3402.13 | ||
1100-88-5 | Triphenyl(phenylmethyl)phosphonium chloride | Benzyltriphenylphosphonium chloride | 3812.1 | |
110-11-1 | Polyoxypropylene-polyoxyethylene glycerol ether | 3402.13 | ||
110-12-3 | Isopentyl Methyl Ketone | 5-methylhexan-2-one | 2914.19 | 3 |
110-13-4 | Acetonylacetone | Hexane-2,5-dione | 2914.19 | |
110-14-5 | Succinamide | Butanediamide | 2924.19 | |
110-15-6 | Succinic Acid | Butanedioic acid | ||
110-16-7 | Maleic acid | (Z)-but-2-enedioic acid | 2917.19 | |
110-17-8 | Fumaric Acid | (E)-but-2-enedioic acid | 3 | |
110-18-9 | Tetramethylethylenediamine | N,N,N',N'-tetramethylethane-1,2-diamine | 2921.29 | |
110-19-0 | Isobutyl Acetate | 2-methylpropyl acetate | 2915.39 | 3 |
11024-24-1 | Digitonin | (2S,3R,4S,5S,6R)-2-{[(2S,3R,4S,5S,6R)-2-{[(2S,3R,4S,5R,6R)-2-{[(2R,3R,4R,5R,6R)-4,5-dihydroxy-2-(hydroxymethyl)-6-[(1'R,2R,2'S,3'S,4'R,5R,7'S,8'R,9'S,12'S,13'S,15'R,16'R,18'S)-5,7',9',13'-tetramethyl-5'-oxaspiro[oxane-2,6'-pentacyclo[10.8.0.0²,⁹.0⁴,⁸.0¹³, | 2938.9 | |
110-25-8 | Oleylsarcosine | N-oleoylsarcosine | 3402.9 | |
110-26-9 | Bisacrylamide | N-[(prop-2-enoylamino)methyl]prop-2-enamide | 2924.19 | |
110-27-0 | Isopropyl myristate | Propan-2-yl tetradecanoate | ||
11028-00-5 | Bacoside A | (5R,8R,9S,10S,13R,14R,17S)-3-[(2R,3R,4R,5S,6R)-3,4-dihydroxy-6-(hydroxymethyl)-5-[(2S,3R,4S,5S)-3,4,5-trihydroxyoxan-2-yl]oxyoxan-2-yl]oxy-10-(hydroxymethyl)-17-[(2S)-2-hydroxy-6-methylhept-5-en-2-yl]-4,4,8,14-tetramethyl-1,2,3,5,6,7,9,11,12,13,15,17-dode | 2938.9 | |
11028-72-1 | Conchiolin | 3504 | ||
11029-12-2 | Grape anthocyanes | 2-phenylchromenylium | 3203 | |
110-30-5 | Ethylene-bis-stearamide  | N,N'-1,2-Ethanediyldioctadecanamide | ||
110-31-6 | Ethylene Dioleamide | (Z)-N-[2-[[(Z)-octadec-9-enoyl]amino]ethyl]octadec-9-enamide | 2924.19 | |
1103-38-4 | Pigment red 49:1 | 1-Naphthalenesulfonic acid, 2-[(2-hydroxy-1-naphthalenyl)azo]-, barium salt (2:1) | 3204.9 | |
1103-39-5 | Pigment red 49:2 | 1-Naphthalenesulfonic acid, 2-[(2-hydroxy-1-naphthalenyl) azo]-, calcium salt (2:1) | 3204.17 | |
110369-45-4 | PEG-25 glyceryl isostearate | 3402.19 | ||
110-38-3 | Ethyl Decanoate | Ethyl Decanoate | 2916.12 | |
110-41-8 | 2-Methylundecanal | 2-Methylundecanal | 2912.19 | |
11042-64-1 | gamma-Oryzanol | gamma-Oryzanol | 2936.29 | |
110-42-9 | Methyl Caprate | Methyl decanoate | 2915.9 | |
110429-35-1 | Paroxetine Hydrochloride Hemihydrate | (3S,4R)-3-(1,3-benzodioxol-5-yloxymethyl)-4-(4-fluorophenyl)piperidine;hydrate;dihydrochloride | 2934.99 | |
110-43-0 | 2-Heptanone ; Fragrance of 2-heptanone | Heptan-2-one | 3 | |
110-44-1 | Sorbic Acid | (2E,4E)-hexa-2,4-dienoic acid | 2916.19 | |
110488-70-5 | Dimethomorph | 3-(4-chlorophenyl)-3-(3,4-dimethoxyphenyl)-1-(morpholin-4-yl)prop-2-en-1-one | 2934.99 | 8 |
110-52-1 | 1,4-Dibromobutane | 1,4-Dibromobutane | 2903.39 | |
110-53-2 | 1-Bromopentane | 1-Bromopentane | 2903.39 | |
110-54-3 | Hexane | Hexane | 3 | |
110553-27-0 | 4,6-Bis(octylthiomethyl)-o-cresol | 2-methyl-4,6-bis(octylsulfanylmethyl)phenol | ||
110-58-7 | Pentylamine | Pentan-1-amine | 2921.19 | |
110-60-1 | Putrescine | Butane-1,4-diamine | 2921.29 | |
110615-47-9 | D-Glucopyranose, oligomeric, C10-16-alkyl glycosides | 3402.13 | ||
110-63-4 | 1,4-Butanediol | Butane-1,4-diol | 8 | |
110-65-6 | 2-Butyne-1,4-diol | But-2-yne-1,4-diol | 2905.39 | 3 |
110-70-3 | N,N'-Dimethylethylenediamine | N,N'-dimethylethane-1,2-diamine | 2921.29 | |
11070-44-3 | Methyltetrahydrophthalic anhydride | Methyltetrahydro-2-benzofuran-1,3-dione | 2917.2 | |
110-71-4 | 1,2-Dimethoxyethane | 1,2-Dimethoxyethane | 2909.19 | 3 |
1107-26-2 | 8’-apo-ß-Carotenal | 3204.19 | ||
110735-25-6 | Direct blue 151 | 3204.14 | ||
110-73-6 | 2-Ethylaminoethanol | 2-(ethylamino)ethanol | 2922.19 | |
110-80-5 | Ethylene Glycol Monoethyl Ether | 2-Ethoxyethanol | ||
110-82-7 | Cyclohexane | Cyclohexane | 2902.11 | 3 |
110-85-0 | Piperazine | Piperazine | 2933.59 | |
110-86-1 | Pyridine | Pyridine | 2933.31 | 3 |
110-87-2 | 3,4-Dihydro-2H-pyran | 3,4-Dihydro-2H-pyran | 2932.99 | |
110-88-3 | 1,3,5-Trioxane | 1,3,5-Trioxane | 2912.5 | 3 |
110-89-4 | Piperidine | Piperidine | ||
1109-11-1 | Food orange 7 ; (2E,4E,6E,8E,10E,12E,14E,16E)-2,6,11,15-Tetramethyl-17-(2,6,6-trimethyl-1-cyclohexenyl)heptadeca-2,4,6,8,10,12,14,16-octaenoic acid ethyl ester | Ethyl 8'-apo-β-caroten-8'-oate | 3204.19 | |
1109-15-5 | Tris(Pentafluorophenyl)Borane | Tris(2,3,4,5,6-pentafluorophenyl)borane | 2931.9 | |
110-91-8 | Morpholine | Morpholine | 3 | |
1109-28-0 | Maltotriose | (2R,3R,4S,5S,6R)-2-[(2R,3S,4R,5R,6R)-4,5-dihydroxy-2-(hydroxymethyl)-6-[(2R,3S,4R,5R)-4,5,6-trihydroxy-2-(hydroxymethyl)oxan-3-yl]oxyoxan-3-yl]oxy-6-(hydroxymethyl)oxane-3,4,5-triol | 2940 | |
110-93-0 | Methyl Heptenone ; Fragrance of 6-methyl-5-hepten-2-one | 6-methylhept-5-en-2-one | ||
110-94-1 | Glutaric Acid | Pentanedioic acid | 2917.19 | |
110-96-3 | Diisobutylamine | 2-methyl-N-(2-methylpropyl)propan-1-amine | 2921.19 | |
110-97-4 | Diisopropanolamine | 1-(2-hydroxypropylamino)propan-2-ol | 2922.19 | 3 |
11097-59-9 | Magnesium aluminum hydroxide carbonate hydrate | Dialuminum hexamagnesium carbonate hexadecahydroxide | ||
11097-68-0 | Aluminum sesquichlorohydrate | 3824.9 | ||
11097-74-8 | Acid violet 54 | 3204.12 | ||
11099-03-9 | Solvent black 5 | |||
11099-06-2 | Silicic acid, ethyl ester | 3824.9 | ||
11099-07-3 | Octadecanoic acid, ester with 1,2,3-propanetriol | |||
110-99-6 | Diglycolic acid | 2-(carboxymethoxy)acetic acid | 2918.99 | |
111-01-3 | Squalane ; Fragrance of dodecahydrosqualene | 2,6,10,15,19,23-hexamethyltetracosane | ||
111-02-4 | Squalene | (6E,10E,14E,18E)-2,6,10,15,19,23-hexamethyltetracosa-2,6,10,14,18,22-hexaene | 2901.1 | |
111-03-5 | Glyceryl monooleate | 2,3-dihydroxypropyl (9Z)-octadec-9-enoate | ||
11103-57-4 | Retinol | (2E,4E,6E,8E)-3,7-dimethyl-9-(2,6,6-trimethylcyclohexen-1-yl)nona-2,4,6,8-tetraen-1-ol | 2936.21 | |
11103-72-3 | Ruthenium red | 3204.9 | ||
11103-86-9 | Potassium hydroxyoctaoxodizincatedichromate(1-) | 3206.2 | ||
11104-59-9 | Chromate | Dioxido(dioxo)chromium | 2841.5 | |
11104-88-4 | Phosphomolybdic acid | Molybdenum;oxygen(2-);phosphorus(3-);hydroxide | 2811.19 | |
11105-10-5 | Polyether sulfate triton qs-15 | 3402.9 | ||
1110686-34-4 | Isooctadecanoic acid, 1,1'-(1,3-propanediyl) ester | 2915.7 | ||
111072-31-2 | 2,3- Bis-(2-methoxy-4-nitro-5-sulfophenyl)-2H-tetrazolium-5-carboxanilide sodium salt | Sodium 4-methoxy-5-[3-(2-methoxy-4-nitro-5-sulfonatophenyl)-5-(phenylcarbamoyl)tetrazol-3-ium-2-yl]-2-nitrobenzenesulfonate | 2933.99 | |
111109-77-4 | Dipropylene glycol dimethyl ether | |||
11113-61-4 | Molecular sieve 3A | 3824.9 | ||
111-13-7 | 2-Octanone | Octan-2-one | 2914.19 | |
111-14-8 | Heptanoic Acid | Heptanoic Acid | 2916.39 | |
11114-92-4 | Cobalt chromium alloy | Chromium cobalt | 2610 | |
111-15-9 | 2-Ethoxyethyl acetate | 2-Ethoxyethyl acetate | 2915.39 | |
11115-97-2 | Iron molybdenum oxide | 3815.9 | ||
1111-67-7 | Cuprous thiocyanate | Copper(1+); thiocyanate | 2842.902 | |
11116-97-5 | Calcium lactate gluconate | Calcium 2-hydroxypropanoate (2R,3S,4R,5R)-2,3,4,5,6-pentahydroxyhexanoate | ||
111174-62-0 | Hydroxypropyltrimonium hydrolyzed collagen | 3504 | ||
111-18-2 | Tetramethylhexamethylenediamine | N,N,N',N'-tetramethylhexane-1,6-diamine | 2921.29 | |
111-19-3 | Sebacoyl chloride | Decanedioyl dichloride | 2917.19 | |
11120-25-5 | Ammonium paratungstate | ไม่พบข้อมูล | 2841.8 | |
111-20-6 | Sebacic Acid | Decanedioic acid | 2917.13 | |
11121-48-5 | Rose bengal | 3212.9 | ||
1112-39-6 | Dimethoxydimethylsilane | Dimethoxy(dimethyl)silane | 2931.9 | |
111-26-2 | Hexylamine | Hexan-1-amine | 2921.19 | |
1112-67-0 | Tetrabutylammonium Chloride | Tetrabutylazanium chloride | 2923.9 | |
111-27-3 | 1-Hexanol | Hexan-1-ol | 2905.19 | 3 |
11128-98-6 | Ammonium borate | Triazanium;borate | 2836.99 | |
111-29-5 | 1,5-Pentanediol | Pentane-1,5-diol | 2905.39 | |
1113-02-6 | Omethoate ; O,O-dimethyl S-methylcarbamoylmethyl phosphorothioate | 2930.9 | ||
111-30-8 | Glutaraldehyde | Pentanedial | 8 | |
111-33-1 | N,N'-Dimethylpropane-1,3-diamine | N,N'-Dimethylpropane-1,3-diamine | 2939.99 | |
11138-11-7 | Barium ferrite | Oxobarium; oxo(oxoferriooxy)iron | 2841.9 | |
11138-49-1 | Sodium aluminate | Sodium oxido-oxo-alumane | 2841.9 | |
11138-60-6 | Decanoic acid, ester with 2-ethyl-2-(hydroxymethyl)-1,3-propanediol octanoate | 2,2-bis[(octanoyloxy)methyl]butyl decanoate | 2917.19 | |
11138-66-2 | Xanthan gum | 6-[6-[6-(acetyloxymethyl)-2-[3-[3,4-dihydroxy-6-(hydroxymethyl)-5-phosphanyloxyoxan-2-yl]oxy-5-hydroxy-2-(hydroxymethyl)-6-(phosphanylmethyl)oxan-4-yl]oxy-4,5-dihydroxyoxan-3-yl]oxy-2-carboxy-4,5-dihydroxyoxan-3-yl]oxy-7,8-dihydroxy-2-methyl-4,4a,6,7,8,8a | ||
11139-88-1 | 1-Glyceryl caprate | 2905.49 | ||
111-40-0 | Diethylenetriamine | N'-(2-aminoethyl)ethane-1,2-diamine | ||
11140-80-0 | Acid red 143 | 3204.12 | ||
111-41-1 | Aminoethylethanolamine | 2-(2-aminoethylamino)ethanol | 2922.19 | |
11141-17-6 | Azadirachtin | dimethyl (2aR,3S,4S,4aR,5S,7aS,8S,10R,10aS,10bR)-10-(acetyloxy)-3,5-dihydroxy-4-[(1aR,2S,3aS,6aS,7S,7aS)-6a-hydroxy-7a-methyl-3a,6a,7,7a-tetrahydro-2,7-methanofuro[2,3-b]oxireno[e]oxepin-1a(2H)-yl]-4-methyl-8-{[(2E)-2-methylbut-2-enoyl]oxy}octahydro-1H-na | 2932.99 | 8 |
11141-21-2 | Praseodymium Neodymium Oxide | Oxo(oxoneodymiooxy) neodymium; oxo(oxopraseodymiooxy) praseodymium | 2805.3 | |
111-42-2 | Diethanolamine | 2,2'-iminodiethanol | 3812.3 | 3 |
111439-76-0 | Isobutylisopropyldimethoxysilane | Dimethoxy-(2-methylpropyl)-propan-2-ylsilane | 2931.9 | |
11145-27-0 | Aluminium silicon | Aluminum; silicon | 2804.69 | |
111-45-5 | Ethylene Glycol Allyl Ether | 2-prop-2-enoxyethanol | 2909.49 | |
111-46-6 | 2,2'-oxydiethanol ; Diethylene Glycol | 2-(2-hydroxyethoxy)ethanol | ||
111470-99-6 | Amlodipine Besylate | Benzenesulfonic acid;3-O-ethyl 5-O-methyl 2-(2-aminoethoxymethyl)-4-(2-chlorophenyl)-6-methyl-1,4-dihydropyridine-3,5-dicarboxylate | 2942 | |
111479-05-1 | Propaquizafop | 2-[(isopropylideneamino)oxy]ethyl (2R)-2-{4-[(6-chloroquinoxalin-2-yl)oxy]phenoxy}propanoate | 2933.99 | 8 |
111-50-2 | Adipoyl chloride | Hexanedioyl dichloride | 2917.19 | |
1115-20-4 | 3-Hydroxy-2,2-dimethylpropyl hydroxypivalate | (3-hydroxy-2,2-dimethylpropyl) 3-hydroxy-2,2-dimethylpropanoate | 2918.99 | |
111-55-7 | Ethylene Glycol Diacetate | 2-acetyloxyethyl acetate | 2915.39 | |
1115-70-4 | Metformin Hydrochloride | 3-(diaminomethylidene)-1,1-dimethylguanidine hydrochloride | 2925.29 | |
111-60-4 | Glycol Stearate ; Ethylene glycol monostearate | 2-hydroxyethyl octadecanoate | ||
111-61-5 | Ethyl stearate | Ethyl octadecanoate | 2915.7 | |
111-62-6 | Ethyl Oleate | Ethyl (Z)-octadec-9-enoate | 2916.15 | |
111-65-9 | Octane ; Fragrance of octane | Octane | 3 | |
111-66-0 | 1-Octene | Oct-1-ene | 2901.29 | |
1116-73-0 | Trihexylaluminium | Trihexylalumane | 2931.9 | |
1116-76-3 | Trioctylamine | N,N-dioctyloctan-1-amine | 2921.19 | |
111-68-2 | Heptylamine | Heptan-1-amine | 2921.19 | |
111-69-3 | Adiponitrile | Hexanedinitrile | 2926.9 | 8 |
111-70-6 | Heptyl alcohol | Heptan-1-ol | 2905.19 | |
111-71-7 | Heptanal | Heptanal | 2912.19 | |
111-75-1 | 2-Butylaminoethanol | 2-(butylamino)ethanol | 2922.19 | |
111-76-2 | 2-Butoxyethanol | 2-Butoxyethanol | ||
111771-12-1 | 2-Fluoro-6-iodobenzoyl chloride | 2-Fluoro-6-iodobenzoyl chloride | 2916.39 | |
111-77-3 | Diethylene Glycol Monomethyl Ether | 2-(2-methoxyethoxy)ethanol | 2909.49 | |
111774-28-8 | Polyquaternium-4 | Cellulose, 2-hydroxyethyl ether, polymer with N,N-dimethyl-N-2-propenyl-2-propen-1-aminium chloride, graft | 3824.9 | |
111-78-4 | 1,5-Cyclooctadiene | Cycloocta-1,5-diene | 2902.19 | |
1117-86-8 | Caprylyl Glycol | 1,2-Octanediol | 3824.9 | |
1117-86-8  | Octane-1,2-diol | Octane-1,2-diol | 2905.39 | |
111-79-5 | Methyl non-2-enoate | Methyl non-2-enoate | 2916.19 | |
111-80-8 | Methyl 2-nonynoate | Methyl 2-nonynoate | 2916.19 | |
111-82-0 | Methyl laurate | Methyl dodecanoate | 2915.9 | |
111-84-2 | Nonane | Nonane | 2901.1 | |
1118-46-3 | Butyltin trichloride | Butyl(trichloro)stannane | 2931.9 | |
111-86-4 | Octylamine | Octan-1-amine | 2921.19 | |
1118-71-4 | Dipivaloylmethane | 2,2,6,6-tetramethylheptane-3,5-dione | 2914.19 | |
111-87-5 | Octyl alcohol | Octan-1-ol | ||
111-88-6 | 1-Octanethiol | Octane-1-thiol | 2930.9 | |
111-90-0  | 2-(2-Ethoxyethoxy)ethanol | 2-(2-Ethoxyethoxy)ethanol | 2909.44 | |
111905-53-4 | Alcohols, C13-15-branched and linear, butoxylated ethoxylated | 3402.13 | ||
111-92-2 | Dibutylamine | N-butylbutan-1-amine | 2921.19 | 3 |
1119-34-2 | Arginine Hydrochloride | (2S)-2-amino-5-(diaminomethylideneamino)pentanoic acid;hydrochloride | 2925.29 | |
111937-03-2 | Isononanoic acid, C16-18 alkyl ester | 2915.9 | ||
1119-62-6 | 3,3'-Dithiodipropionic acid | 3-(2-carboxyethyldisulfanyl)propanoic acid | 2930.9 | |
111-96-6 | Diethylene Glycol Dimethylether | 1-methoxy-2-(2-methoxyethoxy)ethane | 2909.44 | 8 |
1119-72-8 | cis,cis-Muconic acid | (2Z,4Z)-hexa-2,4-dienedioic acid | 2917.19 | |
111974-72-2 | Quetiapine Fumarate | 2-[2-(4-benzo[b][1,4]benzothiazepin-6-ylpiperazin-1-yl)ethoxy]ethanol;(E)-but-2-enedioic acid | 2934.99 | |
1119-86-4 | 1,2-Decanediol | Decane-1,2-diol | 2905.39 | |
1119-87-5 | 1,2-Dodecanediol | Dodecane-1,2-diol | 2905.39 | |
111988-49-9 | Thiacloprid | 3-[(6-chloropyridin-3-yl)methyl]-1,3-thiazolidin-2-ylidenecyanamide | 2934.1 | 8 |
111991-09-4 | Nicosulfuron | 2-({[(4,6-dimethoxypyrimidin-2-yl)carbamoyl]amino}sulfonyl)-N,N-dimethylnicotinamide | 2935.9 | 8 |
1119-94-4 | Laurtrimonium Bromide | Dodecyl(trimethyl)azanium bromide | 2923.9 | |
1119-97-7 | Tetradonium bromide | Trimethyl(tetradecyl)azanium bromide | 2923.9 | |
112-00-5 | Dodecyl trimethyl ammonium chloride ; Laurtrimonium Chloride | Dodecyl(trimethyl)azanium chloride | ||
1120-06-5 | Decan-2-ol | Decan-2-ol | 2905.19 | |
1120-21-4 | Undecane | Undecane | ||
1120-25-8 | Methyl Palmitoleate | Methyl (Z)-hexadec-9-enoate | 2916.19 | |
112-02-7 | Cetrimonium Chloride | Hexadecyl(trimethyl)azanium chloride | ||
1120-28-1 | Methyl Icosanoate | Methyl icosanoate | 2915.9 | |
1120-36-1 | Tetradecene | Tetradec-1-ene | 2901.29 | |
112-03-8 | Trimethyl Octadecyl Ammonium Chloride | Trimethyl(octadecyl)azanium chloride | ||
1120-48-5 | Dioctylamine | N-octyloctan-1-amine | 2921.19 | |
112-04-9 | Octadecyl Trichlorosilane | Trichloro(octadecyl)silane | 2931.9 | |
112-05-0 | Nonanoic acid ; Pelargonic acid | Nonanoic acid | ||
112-07-2 | 2-Butoxyethyl acetate | 2-Butoxyethyl acetate | 3 | |
112077-84-6 | Hydrazine carbonate | Carbonic acid;hydrazine | 2825.1 | |
112-10-7 | Isopropyl stearate | Propan-2-yl octadecanoate | ||
112-11-8 | Isopropyl Oleate | Propan-2-yl (Z)-octadec-9-enoate | 2916.15 | |
1121-22-8 | 1,2-Diaminocyclohexane | (1R,2R)-cyclohexane-1,2-diamine | 2921.3 | |
112-12-9 | 2-Undecanone | Undecan-2-one | 2914.19 | |
112-13-0 | Decanoyl chloride | Decanoyl chloride | 2915.9 | |
112-14-1 | Octyl Acetate | Octyl Acetate | 2942 | |
112-15-2 | Carbitol acetate | 2-(2-ethoxyethoxy)ethyl acetate | 2915.39 | |
1121-60-4 | Picolinaldehyde | Pyridine-2-carbaldehyde | 2933.39 | |
112-16-3 | Lauroyl chloride | Dodecanoyl chloride | 2915.9 | |
112-18-5 | Dimethyl Lauramine | N,N-dimethyldodecan-1-amine | ||
1121-86-4 | 1-Fluoro-3-iodobenzene | 1-Fluoro-3-iodobenzene | 2903.99 | |
112-24-3 | Trientine ; Triethylenetetramine | N'-[2-(2-aminoethylamino)ethyl]ethane-1,2-diamine | ||
112-25-4 | 2-(Hexyloxy)ethanol | 2-Hexoxyethanol | 2909.44 | |
1122-58-3 | 4-Dimethylaminopyridine | N,N-dimethylpyridin-4-amine | ||
1122-62-9 | 2-Acetylpyridine | 1-pyridin-2-ylethanone | 2933.99 | |
112-27-6 | Triethylene glycol | 2-[2-(2-hydroxyethoxy)ethoxy]ethanol | ||
112281-77-3 | Tetraconazole | 1-[2-(2,4-dichlorophenyl)-3-(1,1,2,2-tetrafluoroethoxy)propyl]-1H-1,2,4-triazol | 2933.99 | 8 |
112-29-8 | 1-Bromodecane | 1-Bromodecane | 2903.39 | |
112-30-1 | Decyl alcohol | Decan-1-ol | 2905.19 | |
112-31-2 | Decanal | Decanal | 2912.19 | |
112324-16-0 | 1-Propanaminium, N-ethyl-3-[[(9Z,12R)-12-hydroxy-1-oxo-9-octadecen-1-yl]amino]-N,N-dimethyl-, ethyl sulfate (1:1) | 3402.11 | ||
112340-30-4 | Monononadecanoin | Glyceryl monononadecanoate | 2915.9 | |
112-34-5 | Butyl carbitol | 2-(2-butoxyethoxy)ethanol diethylene glycol monobutyl ether | ||
112-35-6 | Methoxytriglycol | 2-[2-(2-methoxyethoxy)ethoxy]ethanol | 2909.49 | |
112-38-9 | Undecenoic acid | 3823.19 | ||
112-39-0 | Methyl Palmitate | Methyl hexadecanoate | 2915.7 | |
112-40-3 | Dodecane | Dodecane | 2901.1 | |
1124-11-4 | Ligustrazine | 2,3,5,6-tetramethylpyrazine | 2933.99 | |
112-41-4 | Dodecene | Dodec-1-ene | 2901.29 | |
112-42-5 | Undecyl Alcohol | Undecan-1-ol | 2905.19 | |
112-45-8 | 10-Undecenal | Undec-10-enal | 2912.49 | |
112-47-0 | 1,10-Decanediol | Decane-1,10-diol | 2905.39 | |
1125-21-9 | 4-Oxoisophorone | 2,6,6-trimethylcyclohex-2-ene-1,4-dione | 2914.29 | |
112529-15-4 | Pioglitazone Hydrochloride | 5-[[4-[2-(5-ethylpyridin-2-yl)ethoxy]phenyl]methyl]-1,3-thiazolidine-2,4-dione;hydrochloride | 2934.99 | 6 |
112-53-8 | Lauryl alcohol ; Fragrance of 1-Dodecanol | Dodecan-1-ol | ||
112-54-9 | Dodecanal | Dodecanal | 2912.49 | |
112-55-0 | Dodecyl mercaptan | |||
112-57-2 | Tetraethylenepentamine | 3,6,9-triazaundecamethylenediamine | 3 | |
1125-88-8 | Benzaldehyde Dimethyl Acetal | Dimethoxymethylbenzene | 2911 | |
112-59-4 | Diethylene glycol monohexyl ether | 2-(2-hexoxyethoxy)ethanol | 2909.44 | |
112-60-7 | Tetraethylene Glycol | 2-[2-[2-(2-hydroxyethoxy)ethoxy]ethoxy]ethanol | 2909.49 | |
112-61-8 | Methyl Stearate | Methyl octadecanoate | 2915.7 | |
112-62-9 | Methyl Oleate | Methyl (Z)-octadec-9-enoate | 2916.15 | |
112-63-0 | Methyl Linoleate | Methyl (9Z,12Z)-octadeca-9,12-dienoate | 2916.15 | |
1126-61-0 | 4-Allylpyrocatechol | 4-prop-2-enylbenzene-1,2-diol | 2907.29 | |
112-66-3 | Lauryl acetate | Dodecyl acetate | 2915.39 | |
112-70-9 | Tridecyl alcohol | Tridecan-1-ol | ||
112-72-1 | Myristyl alcohol ; Tetradecanol | Tetradecan-1-ol | ||
112725-59-4 | Butyl-methoxydibenzoylmethane | 2-butyl-2-methoxy-1,3-diphenylpropane-1,3-dione | 2914.5 | |
112-73-2 | Bis(2-butoxyethyl) ether | 1-[2-(2-butoxyethoxy)ethoxy]butane | 2909.19 | |
112732-17-9 | Enrofloxacin HCl | 1-cyclopropyl-7-(4-ethylpiperazin-1-yl)-6-fluoro-4-oxoquinoline-3-carboxylic acid hydrochloride | 2933.59 | |
1127442-82-3 | IWR-1 | 4-(1,3,3a,4,7,7a-Hexahydro-1,3-dioxo-4,7-methano-2H-isoindol-2-yl)-N-8-quinolinyl-Benzamide | 2933.49 | |
112-75-4 | Dimethyl myristamine | N,N-dimethyltetradecan-1-amine | 2921.19 | |
112764-76-8 | Pigment yellow 184 | 3204.17 | ||
112-76-5 | Stearoyl Chloride | Octadecanoyl chloride | 2915.9 | |
112-77-6 | Oleoyl chloride | (Z)-octadec-9-enoyl chloride | 2916.19 | |
112-80-1 | Oleic acid | |||
112-84-5 | Erucamide | (Z)-docos-13-enamide | 2924.19 | |
112-85-6 | Behenic acid | Docosanoic acid | ||
112-86-7 | Erucic acid | (Z)-docos-13-enoic acid | ||
112-88-9 | Octadecene | Octadec-1-ene | 2901.29 | |
112-90-3 | Oleylamine | (9Z)-octadec-9-en-1-amine | 2921.19 | |
112-92-5 | Stearyl alcohol | Octadecan-1-ol | ||
112926-00-8 | Silicon dioxide ; Amorphous synthetic silica gel | |||
112945-52-5 | Silica fumed | Silicon dioxide | ||
112-95-8 | Eicosane | Icosane | 2901.1 | |
113114-19-5 | Perfluoropolytrimethyleneoxide | 2710.99 | ||
1131-18-6 | 5-Amino-3-methyl-1-phenylpyrazole | 5-Amino-3-methyl-1-phenylpyrazole | 2933.19 | |
113-15-5 | Ergotamine | (ergotaman-3',6',18'-trione, 12'-hydroxy-2'-methyl-5'- (phenylmethyl)-,(5α)) | 2939.62 | 7 |
1131-62-0 | 3,4-Dimethoxyphenyl methyl ketone | 1-(3,4-dimethoxyphenyl)ethanone | 2914.5 | |
113170-55-1 | Magnesium L-ascorbic acid-2-phosphate | Magnesium [(2R)-2-[(1S)-1,2-dihydroxyethyl]-3-hydroxy-5-oxo-2H-furan-4-yl] phosphate | 2936.27 | |
113-24-6 | Sodium Pyruvate | |||
1132-61-2 | 4-Morpholinepropanesulfonic acid | 3-morpholin-4-ylpropane-1-sulfonic acid | 2934.99 | |
113-42-8 | Methylergometrine | 2939.61 | 7 | |
113431-54-2 | Triisostearyl citrate | Tris(16-methylheptadecyl) 2-hydroxypropane-1,2,3-tricarboxylate | 2918.15 | |
1134-47-0 | Baclofen | 4-amino-3-(4-chlorophenyl)butanoic acid | 2922.49 | 6 |
113-45-1 | Methylphenidate | methyl α-phenyl-2-piperidine acetate | 9 | |
113-48-4 | N-(2-Ethylhexyl)-5-norbornene-2,3-dicarboximide | N-(2-Ethylhexyl)-5-norbornene-2,3-dicarboximide | 2925.19 | |
113-52-0 | Imipramine Hydrochloride | 3-(5,6-dihydrobenzo[b][1]benzazepin-11-yl)-N,N-dimethylpropan-1-amine;hydrochloride | 2933.99 | |
1135-24-6 | Ferulic Acid | (E)-3-(4-hydroxy-3-methoxyphenyl)prop-2-enoic acid | 2918.19 | |
1135279-38-7 | Sodium 2-(2-nonylphenoxy)ethyl sulfate | 3402.11 | ||
1135-40-6 | 3-(Cyclohexylamino)propanesulfonic acid | 3-(cyclohexylamino)propane-1-sulfonic acid | 2921.3 | |
113559-13-0 | N-(4-{1-[2-(6-methylpyridin-2-yl)ethyl]piperidine-4-carbonyl}phenyl)methanesulfonamide dihydrochloride | N-(4-{1-[2-(6-methylpyridin-2-yl)ethyl]piperidine-4-carbonyl}phenyl)methanesulfonamide dihydrochloride | 2917.19 | |
113653-03-5 | Reactive red 218 | 3204.16 | ||
113669-97-9 | Polyester | 2,2-Dimethylpropane-1,3-diol;furo[3,4-f][2]benzofuran-1,3,5,7-tetrone;hexanedioic acid;hexane-1,6-diol | 3403.91 | |
113740-61-7 | Cetirizine Acetic Acid | 2-[4-[(4-chlorophenyl)-phenylmethyl]piperazin-1-yl]acetic acid | 2933.59 | 6 |
113894-92-1 | Hydroxypropyl starch phosphate | |||
113-92-8 | Chlorpheniramine maleate | (Z)-but-2-enedioic acid 3-(4-chlorophenyl)-N,N-dimethyl-3-pyridin-2-ylpropan-1-amine | 2933.39 | |
113-98-4 | Penicillin G Potassium | Potassium (2S,5R,6R)-3,3-dimethyl-7-oxo-6-[(2-phenylacetyl)amino]-4-thia-1-azabicyclo[3.2.0]heptane-2-carboxylate | 2941.1 | |
114013-41-1 | Solvent red 151 | 3204.11 | ||
114040-31-2 | Magnesium Ascorbyl Phosphate | Trimagnesium;(2R)-2-[(1S)-1,2-dihydroxyethyl]-3,4-dihydroxy-2H-furan-5-one;diphosphate | ||
11-40-5 | Wolfberry extract | 3301.9 | ||
114-07-8 | Erythromycin | (3R,4S,5S,6R,7R,9R,11R,12R,13S,14R)-6-[(2S,3R,4S,6R)-4-(dimethylamino)-3-hydroxy-6-methyloxan-2-yl]oxy-14-ethyl-7,12,13-trihydroxy-4-[(2R,4R,5S,6S)-5-hydroxy-4-methoxy-4,6-dimethyloxan-2-yl]oxy-3,5,7,9,11,13-hexamethyl-oxacyclotetradecane-2,10-dione | 2941.5 | 6 |
1141-38-4 | Naphthalene-2,6-dicarboxylic acid | Naphthalene-2,6-dicarboxylic acid | 2917.39 | |
114168-16-0 | Yttria stabilized zirconia | 3815.9 | ||
1142-20-7 | N-Carbobenzyloxy-L-alanine | (2S)-2-{[(benzyloxy)carbonyl]amino}propanoic acid | 2924.29 | |
1143-38-0 | Anthralin | 1,8-dihydroxy-10H-anthracen-9-one | 2914.5 | |
114460-21-8 | Calcium acetate hydrate | Calcium acetate hydrate | 2915.29 | |
1148-79-4 | Terpyridine | Terpyridine | 2933.39 | |
1149-16-2 | Glyoxal-bis(2-hydroxyanil) | 6-[(E)-2-(2-hydroxyanilino)ethenyl]iminocyclohexa-2,4-dien-1-one | 2925.29 | |
114956-81-9 | Laminin | D-tyrosyl-L-isoleucyl-glycyl-L-seryl-L-arginine | 3504 | |
115-07-1 | Propylene | 3 | ||
115099-55-3 | Reactive yellow 178 | 3204.16 | ||
115-10-6 | Dimethyl Ether | Methoxymethane | 2909.19 | 3 |
115-11-7 | Isobutylene | 2-methylprop-1-ene | 2804.3 | |
115-19-5 | 2-Methyl-3-butyn-2-OL | 2-methylbut-3-yn-2-ol | 2905.29 | |
115-20-8 | Trichloroethanol | 2,2,2-trichloroethanol | 2905.59 | |
115-25-3 | Octafluorocyclobutane | 1,1,2,2,3,3,4,4-octafluorocyclobutane | 2903.99 | 8 |
115-27-5 | Chlorendic Anhydride | 1,4,5,6,7,7-Hexachloro-8,9,10-trinorborn-5-ene-2,3-dicarboxylic anhydride | 2917.2 | 3 |
115-28-6 | Chlorendic Acid | 1,2,3,4,7,7-hexachlorobicyclo[2.2.1]hept-2-ene-5,6-dicarboxylic acid | 2917.2 | |
115-37-7 | Thebaine | (4R,7aR,12bS)-7,9-dimethoxy-3-methyl-2,4,7a,13-tetrahydro-1H-4,12-methanobenzofuro[3,2-e]isoquinoline | 2939.11 | 7 |
115-39-9 | Bromophenol Blue | 3,3-bis(3,5-dibromo-4-hydroxyphenyl)-3H-2,1λ⁶-benzoxathiole-1,1-dione | ||
115-40-2 | Bromocresol purple | 4,4'-(1,1-Dioxido-3H-2,1-benzoxathiole-3,3-diyl)- bis(2-bromo-6-methylphenol) | 2934.99 | |
115-41-3 | Pyrocatechol Violet | 3,3-bis(3,4-dihydroxyphenyl)-3H-2,1λ⁶-benzoxathiole-1,1-dione | 2907.29 | |
115470-91-2 | Hexanedioic acid, polymer with 2,2-bis(hydroxymethyl)-1,3-propanediol, octadecanoate | 3824.9 | ||
115550-35-1 | Marbofloxacin | 9-Fluoro-2,3-dihydro-3-methyl-10-(4-methyl-1-piperazinyl)-7-oxo-7H-pyridol(3,2,1-ij)(4,2,1)benzoxadiazin-6 carboxylic acid | 2933.99 | |
115-69-5 | Aminomethyl Propanediol | 2-amino-2-methylpropane-1,3-diol | 2922.19 | |
115-70-8 | 2-Amino-2-ethyl-1,3-propanediol | 2-amino-2-ethylpropane-1,3-diol | 2922.19 | |
115-71-9 | 5-(2,3-dimethyltricyclo[2.2.1.02,6]hept-3-yl)-2-methylpent-2-en-1-ol, stereoisomer | 5-(2,3-dimethyl-4,5,6,7-tetrahydro-1H-tricyclo[2.2.1.0^{2,6}]heptan-3-yl)-2-methylpent-2-en-1-ol | 2905.29 | |
115-77-5 | Pentaerythritol | 2,2-bis(hydroxymethyl)propane-1,3-diol | 2905.42 | |
115-83-3 | Pentaerythrityl tetrastearate | [3-Octadecanoyloxy-2,2-bis(octadecanoyloxymethyl)propyl] octadecanoate | ||
115-84-4 | 2-Ethyl-2-butyl-1,3-propanediol | 2-Butyl-2-ethylpropane-1,3-diol | 2905.39 | |
115852-48-7 | Fenoxanil | N-(1-cyano-1,2-dimethylpropyl)-2-(2,4-dichlorophenoxy)propanamide | 2926.9 | |
115-86-6 | Triphenyl phosphate | Triphenyl phosphate | ||
115-95-7 | Linalyl Acetate | 3,7-dimethylocta-1,6-dien-3-yl acetate | 2915.39 | |
116-09-6 | Acetol | 1-hydroxypropan-2-one | 2914.4 | |
116-11-0 | 2-Methoxypropene | 2-methoxyprop-1-ene | 2909.19 | |
116-26-7 | Safranal | 2,6,6-trimethylcyclohexa-1,3-diene-1-carbaldehyde | ||
116279-08-4 | 3-Cyclopentyl-1-propyne | Prop-2-ynylcyclopentane | 2902.19 | |
116-31-4 | Retinal | (2E,4E,6E,8E)-3,7-dimethyl-9-(2,6,6-trimethylcyclohexen-1-yl)nona-2,4,6,8-tetraenal | 2936.21 | |
1163-19-5 | Decabromodiphenyl Oxide | 1,2,3,4,5-pentabromo-6-(2,3,4,5,6-pentabromophenoxy)benzene | 2909.3 | 14 |
1163-36-6 | Clemizole Hydrochloride | 1-[(4-chlorophenyl)methyl]-2-(pyrrolidin-1-ylmethyl)benzimidazole hydrochloride | 2933.99 | 6 |
116453-73-7 | 1,4,8,11,15,18,22,25-Octa-n-butoxyphthalocyanine | 2934.99 | ||
116-53-0 | 2-Methylbutanoic acid | 2-Methylbutanoic acid | 2915.6 | |
1165-91-9 | Bis(2,4,6-trichlorophenyl) oxalate | Bis(2,4,6-trichlorophenyl) oxalate | 2917.11 | |
116-63-2 | 1-Amino-2-naphthol-4-sulfonic acid | 4-amino-3-hydroxynaphthalene-1-sulfonic acid | 2922.21 | |
1166-46-7 | D-Tetramethrin | (1,3-dioxo-4,5,6,7-tetrahydroisoindol-2-yl)methyl (1R,3R)-2,2-dimethyl-3-(2-methylprop-1-enyl)cyclopropane-1-carboxylate | 2925.19 | |
116680-33-2 | 2-Methyl-1-(2-methylpropyl)-1H-imidazole | 2-methyl-1-(2-methylpropyl)imidazole | 2933.29 | |
116-75-6 | Solvent blue 104 | 1,4-bis(mesitylamino)anthraquinone | 3204.9 | |
116-81-4 | Bromamine Acid | 1-amino-4-bromo-9,10-dioxoanthracene-2-sulfonic acid | 2922.39 | |
116844-55-4 | Basic yellow 87 | 3204.13 | ||
116-95-0 | Acid blue 1 | 3212.9 | ||
117216-75-8 | Annexin V | 3507.9 | ||
1173021-09-4 | Clenproperol | 1-(4-amino-3,5-dichlorophenyl)-2-(1,1,1,2,3,3,3-heptadeuteriopropan-2-ylamino)ethanol | 2845.9 | |
117-34-0 | Diphenylacetic Acid | 2,2-diphenylacetic acid | 2916.39 | |
117-39-5 | Quercetin | 2-(3,4-dihydroxyphenyl)-3,5,7-trihydroxychromen-4-one | 2938.9 | |
117467-28-4 | Cefditoren Pivoxil | 2,2-dimethylpropanoyloxymethyl (6R,7R)-7-[[(2Z)-2-(2-amino-1,3-thiazol-4-yl)-2-methoxyiminoacetyl]amino]-3-[(Z)-2-(4-methyl-1,3-thiazol-5-yl)ethenyl]-8-oxo-5-thia-1-azabicyclo[4.2.0]oct-2-ene-2-carboxylate | 2941.9 | 6 |
1175612-76-6 | 1,6-bis[2-(2-methoxyethoxy)ethyl] hexanedioate 1,6-dibenzyl hexanedioate 1-benzyl 6-[2-(2-methoxyethoxy)ethyl] hexanedioate | 2917.12 | ||
117592-45-7 | Lactium | L-tyrosyl-L-leucyl-glycyl-L-tyrosyl-L-leucyl-L-alpha-glutamyl-L-glutaminyl-L-leucyl-L-leucyl-L-arginine | 3504 | |
117-59-9 | 5-Hydroxynaphthalene-1-sulfonic acid | 5-hydroxynaphthalene-1-sulfonic acid | 2908.99 | |
117-61-3 | Benzidine-2,2'-disulfonic acid | 5-amino-2-(4-amino-2-sulfophenyl)benzenesulfonic acid | ||
117-62-4 | 2-Amino-1,5-naphthalenedisulfonic acid | 2-aminonaphthalene-1,5-disulfonic acid | 2921.45 | |
1176-74-5 | Tetrabromophenolphthalein ethyl ester | Ethyl 2-[(3,5-dibromo-4-hydroxyphenyl)-(3,5-dibromo-4-oxocyclohexa-2,5-dien-1-ylidene)methyl]benzoate | 2918.99 | |
117772-70-0 | Azithromycin Hydrate | (2R,3S,4S,5R,8R,10R,11R,12S,13R,14R)-11-[(2S,3R,4S,6R)-4-(dimethylamino)-3-hydroxy-6-methyloxan-2-yl]oxy-2-ethyl-3,4,10-trihydroxy-13-[(2R,4R,5S,6S)-5-hydroxy-4-methoxy-4,6-dimethyloxan-2-yl]oxy-3,5,6,8,10,12,14-heptamethyl-1-oxa-6-azacyclopentadecan-15-o | 2941.5 | 6 |
1177-87-3 | Dexamethasone Acetate | [2-(9-fluoro-11,17-dihydroxy-10,13,16-trimethyl-3-oxo-6,7,8,11,12,14,15,16-octahydrocyclopenta[a]phenanthren-17-yl)-2-oxoethyl] acetate | 2937.22 | 6 |
117-80-6 | Dichlone | 2,3-dichloronaphthalene-1,4-dione | 2914.7 | 3 |
117-81-7 | Bis(2-ethylhexyl) phthalate ; Dioctyl phthalate | 8 | ||
117-92-0 | Quinaldine Red | 4-[(E)-2-(1-ethylquinolin-1-ium-2-yl)ethenyl]-N,N-dimethylaniline;iodide | 2901.29 | |
117933-89-8 | 5-Butan-2-yl-2-(2,4-dimethylcyclohex-3-en-1-yl)-5-methyl-1,3-dioxane | 5-butan-2-yl-2-(2,4-dimethylcyclohex-3-en-1-yl)-5-methyl-1,3-dioxane | 2911 | |
117976-90-6 | Rabeprazole Sodium | Sodium 2-[[4-(3-methoxypropoxy)-3-methylpyridin-2-yl]methylsulfinyl]benzimidazol-1-ide | 2942 | 6 |
118-00-3 | Guanosine | 2-amino-9-[(2R,3R,4S,5R)-3,4-dihydroxy-5-(hydroxymethyl)oxolan-2-yl]-3H-purin-6-one | 2934.99 | |
118-03-6 | 7-Aminonaphthalene-1,3,6-trisulfonic acid | 7-Aminonaphthalene-1,3,6-trisulfonic acid | 2921.45 | |
1180-95-6 | Taurodeoxycholic Acid, Sodium Salt | Sodium 2-[4-(3,12-dihydroxy-10,13-dimethyl-2,3,4,5,6,7,8,9,11,12,14,15,16,17-tetradecahydro-1H-cyclopenta[a]phenanthren-17-yl)pentanoylamino]ethanesulfonate | 2924.29 | |
118-10-5 | Cinchonine | (S)-[(2R,5R)-5-ethenyl-1-azabicyclo[2.2.2]octan-2-yl]-quinolin-4-ylmethanol | 2933.99 | |
118291-90-0 | 2-Chloro-4-nitrophenyl a-D-maltotrioside | (2R,3R,4S,5S,6R)-2-[(2R,3S,4R,5R,6R)-6-[(2R,3S,4R,5R,6R)-6-(2-chloro-4-nitrophenoxy)-4,5-dihydroxy-2-(hydroxymethyl)oxan-3-yl]oxy-4,5-dihydroxy-2-(hydroxymethyl)oxan-3-yl]oxy-6-(hydroxymethyl)oxane-3,4,5-triol | 2940 | |
118-32-1 | 2-Naphthol-6,8-disulfonic acid | 7-hydroxynaphthalene-1,3-disulfonic acid | 2921.21 | |
118-34-3 | Eleutheroside B | (2R,3S,4S,5R,6S)-2-(hydroxymethyl)-6-[4-[(E)-3-hydroxyprop-1-enyl]-2,6-dimethoxyphenoxy]oxane-3,4,5-triol | 2938.9 | |
1184-16-3 | NADP Sodium Salt | Sodium [[(2R,3R,4R,5R)-5-(6-aminopurin-9-yl)-3-hydroxy-4-phosphonooxyoxolan-2-yl]methoxy-oxidophosphoryl] [(2R,3S,4R,5R)-5-(3-carbamoylpyridin-1-ium-1-yl)-3,4-dihydroxyoxolan-2-yl]methyl phosphate | 2934.99 | |
118421-50-4 | Glutathione monoethyl ester | 2-amino-5-[[1-[(2-ethoxy-2-oxoethyl)amino]-1-oxo-3-sulfanylpropan-2-yl]amino]-5-oxopentanoic acid | 2930.9 | |
118443-89-3 | Cefquinome Sulfate | (6R,7R)-7-[[(2Z)-2-(2-amino-1,3-thiazol-4-yl)-2-methoxyiminoacetyl]amino]-8-oxo-3-(5,6,7,8-tetrahydroquinolin-1-ium-1-ylmethyl)-5-thia-1-azabicyclo[4.2.0]oct-2-ene-2-carboxylate sulfuric acid | 2942 | |
1184-58-3 | Dimethylaluminum chloride | Chloro(dimethyl)alumane | 2931.9 | |
1184-64-1 | Cupric carbonate | Copper;carbonate | ||
118-47-8 | Pyrazolone T | 5-Oxo-1-(4-sulfophenyl)-4H-pyrazole-3-carboxylic acid | 2933.19 | |
118-48-9 | Isatoic Anhydride | 1H-3,1-benzoxazine-2,4-dione | 2934.99 | |
1185-53-1 | Tromethamine Hydrochloride | 2-amino-2-(hydroxymethyl)propane-1,3-diol hydrochloride | ||
1185-55-3 | Methyltrimethoxysilane | Trimethoxy(methyl)silane | 2931.9 | |
1185-57-5 | Ferric ammonium citrate | Azane 2-hydroxypropane-1,2,3-tricarboxylic acid iron | ||
118-55-8 | Phenyl Salicylate | Phenyl 2-hydroxybenzoate | 2918.23 | |
118-56-9 | Homosalate | (3,3,5-trimethylcyclohexyl) 2-hydroxybenzoate | 2918.23 | |
118578-11-3 | Reactive red 231 | 3204.16 | ||
118-58-1 | Benzyl Salicylate | Benzyl 2-hydroxybenzoate | 2918.23 | |
118-60-5 | Octisalate | 2-ethylhexyl 2-hydroxybenzoate | 2918.23 | |
118-61-6 | Ethyl Salicylate ; Fragrance of ethyl salicylate | Ethyl 2-hydroxybenzoate | ||
1186-30-7 | γ,γ-Dimethylallyl pyrophosphate triammonium salt | 2919.9 | ||
1186-52-3 | Acetic acid-d4 | Deuterio 2,2,2-trideuterioacetate | 2845.9 | |
118-71-8 | Maltol | 3-Hydroxy-2-methyl-4H-Pyran-4-one | ||
118-72-9 | 2,6-Dimethylthiophenol | 2,6-dimethylbenzenethiol | 2930.9 | |
118-90-1 | O-Toluic acid | 2-methylbenzoic acid | 2916.39 | |
1189-08-8 | 1,3-Butyleneglycol dimethacrylate | 3-(2-methylprop-2-enoyloxy)butyl 2-methylprop-2-enoate | 2916.14 | |
118-91-2 | 2-Chlorobenzoic acid | 2-Chlorobenzoic acid | 2916.39 | |
118-92-3 | Anthranilic acid | 2-aminobenzoic acid | 2922.43 | 7 |
1189-71-5 | Chlorosulfonyl isocyanate | N-(oxomethylidene)sulfamoyl chloride | 2853 | |
1189726-22-4 | Mephedrone Hydrochloride | 2-(methylamino)-1-(4-methylphenyl)propan-1-one hydrochloride | 2933.91 | |
1189805-46-6 | Mephedrone | (RS)-2-methylamino-1-(4-methylphenyl)propan- 1-one | 2939.99 | 7 |
118997-30-1 | Peptide YY human | 3504 | ||
1190099-88-7 | Capryloyl glycerin ; sebacic acid copolymer | 2917.19 | ||
1190307-88-0 | Sofosbuvir | Propan-2-yl (2S)-2-[[[(2R,3R,4R,5R)-5-(2,4-dioxopyrimidin-1-yl)-4-fluoro-3-hydroxy-4-methyloxolan-2-yl]methoxy-phenoxyphosphoryl]amino]propanoate | 2942 | 6 |
119-06-2 | 1,2-Benzenedicarboxylic acid, ditridecyl ester | Di(tridecyl) phthalate | 2710.99 | |
1190-63-2 | Cetyl stearate | Hexadecyl octadecanoate | 2915.7 | |
1191-15-7 | Diisobutylaluminium hydride | Diisobutylaluminium hydride | 2931.9 | |
1191-16-8 | Prenyl Acetate | 3-methylbut-2-enyl acetate | 2942 | |
119-13-1 | delta-Tocopherol | 2,8-dimethyl-2-(4,8,12-trimethyltridecyl)-3,4-dihydrochromen-6-ol | 2936.28 | |
1191-50-0 | Sodium tetradecyl sulphate | Sodium n-tetradecyl sulfate | 3402.11 | |
119168-77-3 | Tebufenpyrad | N-(4-tert-butylbenzyl)-4-chloro-3-ethyl-1-methyl-1H-pyrazole-5-carboxamide | 2933.19 | 8 |
119171-18-5 | 1-Methyl-3-propylimidazolium iodide | 1-methyl-3-propylimidazol-1-ium iodide | 2933.29 | |
119-17-5 | 1-(3-Sulfophenyl)-3-methyl-5-pyrazolone | 3-(3-methyl-5-oxo-4H-pyrazol-1-yl)benzenesulfonic acid | 2933.19 | |
1191-99-7 | 2,3-Dihydrofuran | 2,3-Dihydrofuran | 2932.19 | |
119205-39-9 | Sodium 2-phenyl-1H-indole-5-sulfonate | Sodium 2-phenyl-1H-indole-5-sulfonate | 2933.99 | |
1192-62-7 | 2-Acetylfuran | 1-(furan-2-yl)ethanone | 2932.13 | |
119-26-6 | 2,4-Dinitrophenylhydrazine | (2,4-dinitrophenyl)hydrazine | 2928 | |
119-28-8 | 8-Amino-2-naphthalenesulfonic acid | 8-aminonaphthalene-2-sulfonic acid | 2921.45 | |
1193-02-8 | P-Aminothiophenol | 4-aminobenzenethiol | 2930.9 | |
119313-12-1 | 2-benzyl-2-(dimethylamino)-1-(4-morpholin-4-ylphenyl)butan-1-one | 2-benzyl-2-(dimethylamino)-1-(4-morpholin-4-ylphenyl)butan-1-one | 2934.99 | |
119344-86-4 | 2-(dimethylamino)-2-[(4-methylphenyl)methyl]-1-[4-(morpholin-4-yl)phenyl]butan-1-one | 2-(dimethylamino)-2-[(4-methylphenyl)methyl]-1-[4-(morpholin-4-yl)phenyl]butan-1-one | 2934.99 | |
119345-01-6 | Phosphorous trichloride, reaction products with 1,1'-biphenyl and 2,4-bis(1,1-dimethylethyl)phenol | |||
119345-04-9 | Sodium dodecyl diphenyl oxide disulfonate ; Alkyldiphenyloxide Disulfonate ; Benzene 1-1-oxybis tetrapropylene | 3402.11 | ||
119-34-6 | 4-Amino-2-nitrophenol | 4-Amino-2-nitrophenol | 2922.29 | |
119-36-8 | Methyl Salicylate | Methyl 2-hydroxybenzoate | 2918.23 | |
119401-96-6 | Iridium(IV) chloride | Tetrachloroiridium;hydrate | 2843.9 | |
1194-02-1 | 4-Fluorobenzonitrile | 4-Fluorobenzonitrile | 2926.9 | |
119-40-4 | 7-Anilino-4-hydroxy-2-naphthalenesulfonic acid | 7-Anilino-4-hydroxy-2-naphthalenesulfonic acid | 2922.29 | |
119446-68-3 | Difenoconazole | 1-[[2-[2-chloro-4-(4-chlorophenoxy)phenyl]-4-methyl-1,3-dioxolan-2-yl]methyl]-1,2,4-triazole | 2934.99 | 8 |
119462-56-5 | 1,3-Bis(citraconimidomethyl)benzene | 3-methyl-1-({3-[(3-methyl-2,5-dioxo-2,5-dihydro-1H-pyrrol-1-yl)methyl]phenyl}methyl)-2,5-dihydro-1H-pyrrole-2,5-dione | 2925.19 | |
119-47-1 | Methylene DI-T-butylcresol | 2-tert-butyl-6-[(3-tert-butyl-2-hydroxy-5-methylphenyl)methyl]-4-methylphenol | ||
119478-55-6 | Danofloxacin Mesylate | 1-cyclopropyl-6-fluoro-7-[(1S,4S)-5-methyl-2,5-diazabicyclo[2.2.1]heptan-2-yl]-4-oxoquinoline-3-carboxylic acid;methanesulfonic acid | 2933.59 | |
119478-56-7 | Meropenem | (4R,5S,6S)-3-[(3S,5S)-5-(dimethylcarbamoyl)pyrrolidin-3-yl]sulfanyl-6-[(1R)-1-hydroxyethyl]-4-methyl-7-oxo-1-azabicyclo[3.2.0]hept-2-ene-2-carboxylic acid;trihydrate | 2912.49 | 6 |
119509-49-8 | Acid brown 425 | 3204.12 | ||
119509-50-1 | Acid brown 432 | 3204.12 | ||
119515-38-7 | Icaridin | Butan-2-yl 2-(2-hydroxyethyl)piperidine-1-carboxylate | 2933.39 | |
119-53-9 | Benzoin | 2-hydroxy-1,2-diphenylethanone | 2914.5 | |
1196157-73-9 | Mixture of the 2,2,4- and 2,4,4-trimethyl-hexamethylene diisocyanate | 1,6-diisocyanato-2,2,4-trimethylhexane 1,6-diisocyanato-2,4,4-trimethylhexane | 2929.1 | |
1196157-85-3 | Nitrate Ionophore VI | 9-hexadecyl-1,7,11,17-tetraoxa-2,6,12,16-tetrazacycloicosane | 2934.99 | |
119-61-9 | Benzophenone | Diphenylmethanone | 2914.39 | |
119-64-2 | Tetralin | 1,2,3,4-tetrahydronaphthalene | 2933.99 | |
1196-43-6 | Xanthine Sodium Salt | 3,7-dihydropurine-2,6-dione sodium | 2933.59 | |
119-67-5 | Phthalaldehydic Acid | 2-formylbenzoic acid | 2918.3 | |
119-70-0 | 5-Amino-2-(4-aminoanilino)benzenesulfonic acid | 5-amino-2-(4-aminoanilino)benzenesulfonic acid | 2921.44 | |
1197-18-8 | Tranexamic Acid | 4-(aminomethyl)cyclohexane-1-carboxylic acid | 2922.49 | |
1197-21-3 | Phentermine Hydrochloride | 2-methyl-1-phenylpropan-2-amine hydrochloride | 2921.46 | |
119-72-2 | 4-Nitro-4'-aminostilbene-2,2'-disulfonic acid | 5-amino-2-[(E)-2-(4-nitro-2-sulfophenyl)ethenyl]benzenesulfonic acid | 2921.59 | |
119738-06-6 | Quizalofop-P-tefuryl | Tetrahydrofuran-2-ylmethyl 2-{4-[(6-chloroquinoxalin-2-yl)oxy]phenoxy}propanoate | 2934.99 | 8 |
119-75-5 | 2-Nitrodiphenylamine | 2-nitro-N-phenylaniline | 2921.44 | |
119793-28-1 | 2-Hydroxydodecyloxyacetic acid monosodium salt ; Sodium lauryl glycol carboxylate | 3402.11 | ||
119-79-9 | 1-Naphthylamine-6-sulfonic acid | 5-aminonaphthalene-2-sulfonic acid | 2921.45 | |
119822-74-1 | Acid yellow 246 | 3204.9 | ||
119-84-6 | Benzodihydropyrone | 3,4-dihydrochromen-2-one | 2932.2 | |
119-90-4 | Dianisidine | 4-(4-amino-3-methoxyphenyl)-2-methoxyaniline | 2922.29 | |
119-93-7 | O-Tolidine | 4-(4-amino-3-methylphenyl)-2-methylaniline | 2921.59 | 3 |
120011-70-3 | Donepezil hydrochloride | 2-[(1-benzylpiperidin-4-yl)methyl]-5,6-dimethoxy-2,3-dihydroinden-1-one hydrochloride | 2921.29 | |
12001-26-2 | Mica ; Dimethicone treated synthetic mica | Dipotassium dioxosilane oxo(oxoalumanyloxy)alumane oxygen(2-) | ||
12001-29-5 | Chrysotile asbestos | Trimagnesium hydroxy (trioxido) silane hydrate | 2524.9 | 8 |
120014-06-4 | Donepezil | 2-[(1-benzylpiperidin-4-yl)methyl]-5,6-dimethoxy-2,3-dihydroinden-1-one | 2942 | 6 |
12002-43-6 | Gilsonite / Natural asphalt | |||
12003-38-2 | Synthetic fluorphlogopite | Fluorphlogopite, Mg3K[AlF2O(SiO3)3] (synthetic) | 2842.1 | |
12004-37-4 | Strontium aluminate phosphorescent | 3204.9 | ||
12006-79-0 | Chromium boride | Boranylidynechromium | 2850 | |
120068-37-3 | Fipronil | 5-amino-1-[2,6-dichloro-4-(trifluoromethyl)phenyl]-4-(trifluoromethylsulfinyl)pyrazole-3-carbonitrile | 2933.99 | 8 |
12007-60-2 | di-Lithium tetraborate | Dilithium; [oxido(oxoboranyl oxy)boranyl] oxy-oxoboranyl oxyborinate | 2840.2 | |
12008-21-8 | Lanthanum hexaboride | Boron; lanthanum | 2846.9 | |
120-11-6 | Benzyl Isoeugenol | 2-methoxy-1-phenylmethoxy-4-prop-1-enylbenzene | 2909.3 | |
120116-88-3 | Cyazofamid | 4-chloro-2-cyano-N,N-dimethyl-5-(4-methylphenyl)-1H-imidazole-1-sulfonamide | 2933.29 | |
12011-78-8 | Nickel(II) hydroxide carbonate | Hydrogen carbonate;nickel(2+);hydroxide | 2836.99 | |
120-12-7 | Anthracene | Anthracene | 2902.9 | |
12013-46-6 | Calcium aluminate | Calcium;dioxido(oxo)tin | 2841.9 | |
120144-90-3 | Methylaluminoxane | Methylaluminoxane | 2931.9 | |
12018-18-7 | Nickel chromite | Nickel(2+) dioxido(dioxo) dichromate(2-) | 2841.5 | |
120202-66-6 | Clopidogrel Bisulfate | Methyl (2S)-2-(2-chlorophenyl)-2-(6,7-dihydro-4H-thieno[3,2-c]pyridin-5-yl)acetate sulfuric acid | 2934.99 | 6 |
120-20-7 | Homoveratrylamine | 2-(3,4-dimethoxyphenyl)ethanamine | 2922.29 | |
12021-95-3 | Fluorozirconic acid | Tetrafluorozirconium; dihydrofluoride | ||
12022-71-8 | Iron(II) titanate | Dihydroxy(oxo) titanium; iron | 2841.9 | |
120-23-0 | 2-Naphthoxyacetic acid | 2-naphthalen-2-yloxyacetic acid | 2918.99 | |
1202-34-2 | 2,2'-Dipyridylamine | N-pyridin-2-ylpyridin-2-amine | 2933.39 | |
12023-91-5 | Strontium hexaferrite | Dodecairon strontium nonadecaoxide | ||
12026-57-2 | Phosphomolybdic acid | Phosphoric acid; trioxomolybdenum | 2811.19 | |
12027-06-4 | Ammonium iodide | Azanium; iodide | 2827.6 | |
12027-43-9 | Tungstosilicic acid hydrate ; Silicic acid, tungsten complex | Silicicacid; 1,3,5-trioxa-2λ6,4λ6,6λ6-tritungstacyclohexane 2,2,4,4,6,6-hexaoxide; hydrate | ||
12027-67-7 | Ammonium heptamolybdate | Azane; dihydroxy(dioxo) molybdenum; trioxomolybdenum; tetrahydrate | 2841.7 | |
12029-98-0 | Diiodine pentoxide | Iodic acid iodyl ester | 2811.29 | |
12030-97-6 | Potassium hexatitanate | Dipotassium; oxygen(2-); titanium(4+) | 2841.9 | |
120313-48-6 | Alcohols, C12-C15, branched and linear, ethoxylated, propoxylated | |||
120-32-1 | Clorophene | 2-benzyl-4-chlorophenol | 2908.19 | |
12033-89-5 | Nierite | Si3N4 B7 Silicon nitride | 2834.29 | |
120-35-4 | 3-Amino-4-methoxybenzanilide | 3-amino-4-methoxy-N-phenylbenzamide | 2924.29 | |
12036-01-0 | Zirconium monoxide | Zirconium oxide | 3207.3 | |
12036-32-7 | Praseodymium(III) oxide | Oxygen(2-);praseodymium(3+) | 2846.9 | |
120-40-1 | Lauric diethanolamide | N,N-bis(2-hydroxyethyl)dodecanamide | ||
12042-68-1 | Calcium aluminate | Calcium;oxido(oxo)alumane | ||
12042-91-0 | Aluminum chlorohydrate | Aluminum;chloroaluminum;pentahydrate | ||
12045-63-5 | Titanium boride powder | Diboranylidynetitanium | 2850 | |
12045-78-2 | Potassium tetraborate | Dipotassium; dioxido-[(4-oxoboranyloxy-1,3,2,4-dioxadiboretan-2-yl)oxy]borane; tetrahydrate | ||
12045-88-4 | Borax pentahydrate | 3824.9 | ||
120-46-7 | Dibenzoylmethane | 1,3-diphenylpropane-1,3-dione | ||
12047-11-9 | Barium ferrite powder ; Barium dodecairon nonadecaoxide | Oxobarium; oxo (oxoferriooxy) iron | ||
120-47-8 | Ethylparaben | Ethyl 4-hydroxybenzoate | 2918.29 | |
120478-62-8 | Carthamus yellow | 3203 | ||
120486-24-0 | Polyglyceryl-2 triisostearate | [3-[2,3-bis(16-methylheptadecanoyloxy)propoxy]-2-hydroxypropyl] 16-methylheptadecanoate | ||
120500-90-5 | Pigment red 255 | 3204.17 | ||
120512-59-6 | 4-Fluoro-3,5-dimethylbenzoic acid | 4-fluoro-3,5-dimethylbenzoic acid | 2916.39 | |
120-51-4 | Benzyl Benzoate ; Fragrance of benzyl benzoate | Benzyl Benzoate | ||
1205-17-0 | 3-(1,3-Benzodioxol-5-yl)-2-methylpropanal | 3-(1,3-benzodioxol-5-yl)-2-methylpropanal | 2912.49 | |
120-52-5 | p-benzoquinone bis(O-benzoyloxime) | p-benzoquinone bis(O-benzoyloxime) | 3812.1 | |
12054-48-7 | Nickel(II) hydroxide | Nickel;dihydrate | 2825.4 | |
120-54-7 | Dipentamethylenethiuram Tetrasulfide | (Piperidine-1-carbothioyltrisulfanyl) piperidine-1-carbodithioate | ||
12054-85-2 | Ammonium heptamolybdate tetrahydrate ; Fragrance of ammonium molybdate | Azane; dihydroxy(dioxo) molybdenum; trioxomolybdenum; tetrahydrate | ||
12055-62-8 | Holmium(III) oxide | Holmium(+3) cation; oxygen(-2) anion | 2846.9 | |
120-55-8 | Diethylene glycol dibenzoate | Oxydiethylene dibenzoate | 3812.2 | |
12056-51-8 | Potassium Hexatitanate | ไม่พบข้อมูล | 2841.9 | |
12057-24-8 | Lithium oxide | Dilithium oxygen(2-) | 2825.2 | |
12057-74-8 | Magnesium phosphide | Trimagnesium diphosphide | 2853.9 | 8 |
12058-66-1 | Sodium stannate | Disodium; dioxido(oxo)tin | 2841.9 | |
12060-08-1 | Scandium(III) oxide | Oxygen(2-); scandium(3+) | 2846.9 | |
12060-59-2 | Strontium titanate | Strontium; dioxido(oxo)titanium | 2841.9 | |
12061-16-4 | Erbium(III) oxide | Erbium(3+); oxygen(2-) | 2846.9 | |
120-61-6 | Dimethyl Terephthalate | Dimethyl benzene-1,4-dicarboxylate | 2917.37 | |
120618-65-7 | Ceftazidime hydrate | 1-[[(6R,7R)-7-[[(2Z)-(2-amino-4-thiazolyl)[(1-carboxy-1-methylethoxy)imino]acetyl]amino]-2-carboxy-8-oxo-5-thia-1-azabicyclo[4.2.0]oct-2-en-3-yl]methyl]pyridinum | 2941.9 | 6 |
12063-19-3 | Zinc Iron Oxide | Zinc; iron(3+); oxygen(2-) | 2841.9 | |
12064-62-9 | Gandolinium (III) oxide | Gadolinium(+3) cation; oxygen(-2) anion | 2846.9 | |
12065-65-5 | Trititanium pentoxide | Dioxotitanium; oxo(oxotitaniooxy)titanium | 2823 | |
12068-03-0 | Sodium Toluenesulfonate | 3402.11 | ||
12068-40-5 | Spodumene | Aluminum lithium dioxido (oxo) silane | 2529.1 | |
12068-46-1 | Calcium aluminosilicate | Dialuminum;dicalcium;oxygen(2-);silicate | 2839.9 | |
12068-51-8 | Magnesium aluminate, spinel | Dialuminum magnesium oxygen(2-) | ||
12069-32-8 | Boron carbide | 2849.9 | ||
12069-69-1 | Cupric carbonate | Dicopper; carbonate; dihydroxide | 2836.99 | |
12070-08-5 | Titanium carbide | Methanidylidynetitanium(1+) | 2849.9 | |
12070-12-1 | Tungsten carbide | Methanidylidynetungsten | ||
1207-12-1 | 4,6-Dimethyldibenzothiophene | 4,6-Dimethyldibenzo[b,d]thiophene | 2934.99 | |
120-71-8 | P-Cresidine | 2-Methoxy-5-methylaniline | 2922.29 | |
12071-83-9 | Propineb ; Zinc propylenebisdithiocarbamate, polymeric | 2930.2 | 8 | |
120-72-9 | Indole | 1,3-Benzopyrrole | 2934.99 | |
120-73-0 | Purine | 7H-purine | 2933.59 | |
120-78-5 | Dibenzothiazyl disulfide | 2-(1,3-benzothiazol-2-yldisulfanyl)-1,3-benzothiazole | ||
120-80-9 | Benzene-1,2-diol ; catechol | 1,2-Dihidroxibenceno | 2907.29 | 3 |
120-82-1 | 1,2,4-Trichlorobenzene | 1,2,4-Trichlorobenzene | 2903.99 | |
120-83-2 | 2,4-Dichlorophenol | 2,4-Dichlorophenol | 2908.19 | |
1208-67-9 | Sodium;4-(2-methylprop-2-enoxy)benzenesulfonate | Sodium;4-(2-methylprop-2-enoxy)benzenesulfonate | 2909.5 | |
120928-09-8 | Fenazaquin | 2933.99 | 8 | |
120-93-4 | Ethylene urea | 2-Imidazolidinone | 2933.29 | |
120962-03-0 | Rapeseed oil, refined  | 2710.19 | ||
121-00-6 | 2-Tert-butyl-4-methoxyphenol | 2-Tert-butyl-4-methoxyphenol | 2909.5 | |
121-03-9 | 4-Nitrotoluene-2-sulfonic acid | 2-Methyl-5-nitrobenzenesulfonic acid | 2904.9 | |
121053-17-6 | Castor oil | 3302.9 | ||
12105-81-6 | Chromium carbide | Bis(methane) trichromium | 3824.3 | |
1210-83-9 | N-acetyl-5-hydroxytryptamine | N-[2-(5-hydroxy-1H-indol-3-yl)ethyl]acetamide | 2933.99 | |
121181-53-1 | Filgrastim | Colony-stimulating factor (human clone 1034), N-L-methionyl- (9CI) | 3823.7 | |
12122-67-7 | Zineb ; Zinc ethylenebisthiocarbamate | Zinc ethane-1,2-diylbis(dithiocarbamate) | 8 | |
121246-28-4 | 2,4,6-Tris-(N-1,4-dimethylpentyl-p-phenylenediamino)-1,3,5-triazine | 2-N,4-N,6-N-tris[4-(5-methylhexan-2-ylamino)phenyl]-1,3,5-triazine-2,4,6-triamine | 2933.69 | |
12124-97-9 | Ammonium bromide | Azanium; bromide | ||
12125-01-8 | Ammonium fluoride | Azanium fluoride | ||
12125-02-9 | Ammonium chloride | Azanium;chloride | 3 | |
12125-03-0 | Potassium stannate trihydrate | Dipotassium;dioxido(oxo)tin;trihydrate | 2841.9 | |
121250-47-3 | Octadecadienoic acid ; Conjugated linoleic acid | |||
12125-08-5 | Ammonium hexachloroosmate(IV) | Diazanium;hexachloroosmium(2-) | 2843.9 | |
12125-28-9 | Magnesium carbonate hydroxide | Tetramagnesium tetracarbonate | ||
121-30-2 | 4-Amino-6-chloro-1,3-benzenedisulfonamide | 4-Amino-6-chloro-1,3-benzenedisulfonamide | 2933.99 | |
121-32-4 | Ethylvanillin ; Fragrance of 3-ethoxy-4-hydroxybenzaldehyde | 3-Ethoxy-4-hydroxybenzaldehyde | ||
121-33-5 | Vanillin ; 4-hydroxy-3-methoxybenzaldehyde | |||
121-34-6 | Vanillic acid | 4-Hydroxy-3-methoxybenzoic acid | 2918.99 | |
12135-76-1 | Ammonium sulfide solution | ไม่พบข้อมูล | 2830.9 | |
12141-45-6 | Sillimanite | Tetraaluminum dioxido (oxo) silane oxygen (2-) | 2508.5 | |
12141-46-7 | Aluminum silicate | Dialuminum; dioxido(oxo)silane; oxygen(2-) | ||
12141-67-2 | Sodium polytungstate | Hexasodium; dioxido(dioxo)tungsten; trioxotungsten | 2841.8 | |
12142-33-5 | Potassium stannate | Dipotassium; dioxido(oxo)tin | 2815.12 | |
1214-39-7 | Benzylaminopurine-6 | 6-Benzyladenine | 8 | |
121-44-8 | Triethylamine | Ethanamine,N,N-diethyl | 3 | |
121-45-9  | Trimethyl phosphite | 3404.9 | 8 | |
121-47-1 | Metanilic acid | 3-Aminobenzene sulphonic acid | 2921.42 | |
121-51-7 | 3-Nitrobenzenesulfonyl chloride | 3-Nitrobenzene-1-sulfonyl chloride | 2933.99 | |
121-54-0 | Benzethonium chloride | Benzethonium chloride | 2923.9 | |
121543-31-5 | Valocoll E | 3504 | ||
121-57-3 | Sulfanilic Acid | 4-aminobenzenesulfonic acid | 2921.42 | 3 |
12161-08-9 | Zirconyl hydroxide | 3815.9 | ||
121-65-3 | p-Dodecylbenzenesulphonic acid | 4-dodecylbenzenesulfonic acid | ||
12167-74-7 | Calcium phosphate tribasic | Pentacalcium; hydroxide; triphosphate | 2835.26 | |
12168-52-4 | Ilmenite | Iron titanium trihydrate | ||
12168-54-6 | Iron nickel oxide | Oxonickel; oxo(oxoferriooxy)iron | 2842.9 | |
121-69-7 | N,N-Dimethylaniline | N,N-dimethylaniline | 2921.42 | 3 |
12173-47-6 | Hectorite (clay mineral) | 3802.9 | ||
12173-81-8 | Leucoxene | 2614 | ||
12174-11-7 | Attapulgite | Aluminum magnesium silicon hydroxide tetradecahydrate | ||
121-75-5 | Malathion | 2930.9 | 8 | |
12179-04-3 | Borax pentahydrate | Disodium; [oxido(oxoboranyloxy)boranyl]oxy-oxoboranyloxyborinate; pentahydrate | 2840.19 | |
121-79-9 | Propyl Gallate | Propyl 3,4,5-trihydroxybenzoate | ||
12183-80-1 | Andalusite | Aluminum oxido-[oxido(oxo)silyl]oxy-oxosilane hydrate | 2508.5 | |
121-87-9 | 2-Chloro-4-nitroaniline | 2-Chloro-4-nitroaniline | 2921.42 | |
121-88-0 | 2-Amino-5-nitrophenol | 2-Amino-5-nitrophenol | 2922.29 | |
121-91-5 | Isophthalic Acid | Benzene-1,3-dicarboxylic acid | 2917.39 | |
121-92-6 | 3-Nitrobenzoic acid | 3-Nitrobenzoic acid | 2916.39 | |
12198-93-5 | Ozokerite | 2712.9 | ||
12199-37-0 | Smectite clay minerals | Aluminium magnesium oxosilanediolate | ||
122008-85-9 | Cyhalofop-butyl | Butyl (2R)-2-[4-(4-cyano-2-fluorophenoxy)phenoxy]propanoat | 2926.9 | 8 |
122-00-9 | P-Methyl acetophenone | 1-(4-methylphenyl)ethanone | 2914.39 | |
122012-52-6 | Zinc Dicyanatodiamine | 3815.9 | ||
12202-17-4 | Tribasic lead sulfate | Tetralead trioxide | ||
122-03-2 | Cuminaldehyde | 4-propan-2-ylbenzaldehyde | 2912.29 | |
122-04-3 | P-Nitrobenzoyl chloride | 4-nitrobenzoyl chloride | 2916.39 | |
122-07-6 | 2,2-Dimethoxyethylmethylamine | 2,2-dimethoxy-N-methylethanamine | 2922.5 | |
12208-13-8 | Potassium hexahydroxoantimonate(V) | Potassium; antimony(3+); hexahydroxide | 2841.9 | |
122097-34-1 | Cobalt manganese bromide | Cobalt(2+);manganese(2+);tetrabromide | 2827.59 | |
122-09-8 | Phentermine | α,α-dimethylphenethylamine | 9 | |
122-14-5 | Fenitrothion | Methyl 3-methyl-4-nitrophenyl methoxy(sulfanylidene)phosphonite | 8 | |
12216-97-6 | Acid blue 225 | 3204.12 | ||
12217-33-3 | Acid orange 95 | 3204.11 | ||
12217-34-4 | Acid red 57 | 2-Naphthalenesulfonic acid, 6-amino-5-[[2-[(ethylphenylamino)sulfonyl]phenyl]azo]-4-hydroxy- | 3204.12 | |
12217-48-0 | Basic red 14 ; C.I. 48016 | 3204.13 | ||
12217-50-4 | Basic yellow 13 | 3204.13 | ||
12217-52-6 | Direct black 112 | 3204.14 | ||
12217-57-1 | Direct blue 200 | 3204.14 | ||
12217-67-3 | Direct red 89 | 3204.14 | ||
12217-77-5 | Disperse blue 54 | 3204.11 | ||
12217-78-9 | Disperse black EXSF | 3204.11 | ||
12217-79-7 | Disperse blue 56 | 3204.13 | ||
12217-80-0 | Disperse blue 60 ; 2,3-Anthracenedicarboximide | 4,11-diamino-2-(3-methoxypropyl)-1H-naphtho[2,3-f]isoindole-1,3,5,10(2H)-tetrone | 3204.11 | |
12217-95-7 | Disperse biolet 26 | 3204.9 | ||
122-18-9 | Benzyldimethylhexadecylammonium chloride | Benzyl-hexadecyl-dimethylazanium chloride | 2923.9 | |
12218-95-0 | Acid black 60 | 3204.11 | ||
12218-96-1 | Acid black 107 | 3204.9 | ||
12219-32-8 | Acid blue 221 | 3204.12 | ||
12219-42-0 | Acid blue 239 | 3204.12 | ||
12219-46-4 | Acid blue 245 | 3204.12 | ||
12219-57-7 | Acid brown 188 | 3204.12 | ||
12219-93-1 | Acid green 73 | 3204.12 | ||
12220-06-3 | Acid orange 67 | 3204.12 | ||
12220-07-4 | Acid orange 86 | 3204.12 | ||
12220-08-5 | Acid orange 107 | 3204.12 | ||
12220-12-1 | Reactive orange 122 | 3204.11 | ||
12220-20-1 | Acid red 119 | 3204.12 | ||
12220-27-8 | Acid red 279 | 3204.12 | ||
12220-29-0 | Acid red 299 | 3204.12 | ||
122-20-3 | Triisopropanolamine | 1-[bis(2-hydroxypropyl)amino]propan-2-ol | ||
12220-47-2 | Acid red 315 | 3204.12 | ||
12220-51-8 | Acid violet 48 | 3204.12 | ||
1222-05-5 | Galoxolide ; Fragrance of 1,3,4,6,7,8-hexahydro-4,6,6,7,8,8-hexamethylindeno(5,6-c)pyran | 4,6,6,7,8,8-hexamethyl-1,3,4,7-tetrahydrocyclopenta[g]isochromene | ||
12220-63-2 | Acid violet 109 | 3204.12 | ||
12220-72-3 | Acid yellow 104 | 3204.12 | ||
12220-74-5 | Acid yellow 110 | 3204.12 | ||
12221-32-5 | Cationic yellow 40 | 3204.13 | ||
12221-69-1 | Basic red 46 | 3204.9 | ||
12222-04-7 | Direct blue 199 | 3204.14 | ||
12222-29-6 | Direct brown 210 | 3204.14 | ||
12222-48-9 | Direct red 224 | 3204.14 | ||
12222-51-4 | Direct red 227 | 3204.14 | ||
12222-60-5 | Direct yellow 106 | 3204.14 | ||
12222-69-4 | Disperse black 9 | 3204.11 | ||
12222-78-5 | Disperse blue 73 | 3204.11 | ||
12222-85-4 | Disperse blue 79 | 3204.11 | ||
12223-22-2 | Disperse orange 25 | 3204.11 | ||
12223-23-3 | Disperse orange 30 | 3204.11 | ||
12223-27-7 | Disperse orange 45 | 3204.11 | ||
12223-35-5 | Disperse orange 42 | 3204.11 | ||
12223-35-7 | Disperse red 50 | 3204.11 | ||
12223-37-9 | Disperse red 60 | 3204.11 | ||
12223-42-6 | Disperse red 82 | 3204.11 | ||
12223-78-8 | Disperse violet 40 | 3204.11 | ||
12223-85-7 | Disperse yellow 54 | 3204.11 | ||
12224-03-2 | Diethylaminomethylcoumarin | 7-(diethylamino)-4-methylchromen-2-one | 2917.2 | |
12224-06-5 | Fluorescent Brightener 85 | 3204.2 | ||
12224-08-7 | Fluorescent Brightener 90 | 3204.2 | ||
12224-42-8 | 2H,3H-Decafluoropentane ; C.I. 185 | 3204.2 | ||
12224-98-5 | Pigment red 81 | 9-[2-(Ethoxycarbonyl)phenyl]-3,6-bis(ethylamino)-2,7-dimethylxanthylium molybdatetungstatephosphate | 3204.17 | |
12225-08-0 | Pigment violet 32 | 3204.17 | ||
12225-18-2 | Pigment yellow 97 | N-(4-chloro-2,5-dimethoxyphenyl)-2-{[2,5-dimethoxy-4-(phenylsulfamoyl)phenyl]diazenyl}-3-oxobutanamide | 3204.17 | |
12225-21-7 | Pigment yellow 100 | 1H-pyrazole-3-carboxylic acid, 4,5-dihydro-5-oxo-1-(4-sulfophenyl)-4-((4-sulfophenyl)azo)- aluminum salt | 3206.11 | |
12225-25-1 | Reactive black 5 | 3204.16 | ||
12225-26-2 | Reactive black 8 | 3204.16 | ||
12225-45-5 | Reactive blue 28 | 3204.11 | ||
12225-66-0 | Reactive brown 9 | 3204.16 | ||
12225-68-2 | Reactive brown 11 | 3204.16 | ||
12225-82-0 | Reactive orange 4 | 3204.16 | ||
12225-83-1 | Reactive orange 16 | 3204.16 | ||
12225-84-2 | Reactive orange 12 | 3204.16 | ||
12225-85-3 | Reactive orange 13 | Trisodium 2-[(2E)-2-[6-[(4-amino-6-chloro-1, 3, 5-triazin-2-yl)-methylamino]-1-oxo-3-sulfonatonaphthalen-2-ylidene]hydrazinyl]naphthalene-1, 5-disulfonate; | 3204.16 | |
12225-88-6 | Reactive orange 16 | 3204.16 | ||
12226-12-9 | Reactive red 35 | 3204.9 | ||
12226-17-4 | Reactive red 40 | 3204.16 | ||
12226-32-3 | Reactive red 65 | 3204.16 | ||
12226-38-9 | Reactive violet 5 | 3204.16 | ||
12226-46-9 | Reactive yellow 7 | 3204.14 | ||
12226-47-0 | Reactive yellow 15 | 3204.16 | ||
12226-48-1 | Reactive yellow 18 | 3204.16 | ||
12226-49-2 | Reactive yellow 22 | 3204.16 | ||
12226-56-1 | Reactive yellow 29 | 3206.2 | ||
12226-61-8 | Reactive yellow 39 | 3204.16 | ||
12226-63-0 | Reactive Yellow 42 | 3204.16 | ||
12226-78-7 | Solvent blue 67 | 3204.19 | ||
12227-55-3 | Solvent red 122 | 3204.19 | ||
12227-67-7 | Solvent yellow 82 | 3204.19 | ||
12227-89-3 | Pigment black 11 | 3204.11 | ||
12230-71-6 | Barium hydroxide octahydrate | Barium(2+);dihydroxide;octahydrate | 2816.4 | |
122-31-6 | Malonaldehyde Diethyl Acetal | 1,1,3,3-tetraethoxypropane | 2911 | |
122-32-7 | Glyceryl Trielaidate | 2,3-di(octadec-9-enoyloxy)propyl octadec-9-enoate | 2916.15 | |
12234-64-9 | Acid blue 185 | 3204.9 | ||
12234-91-2 | Acid green 84 | 3204.12 | ||
12234-99-0 | Acid red 131 | 3204.12 | ||
12235-02-8 | Acid red 310 | 3204.12 | ||
12236-02-1 | Disperse orange 32 | 3204.11 | ||
12236-03-2 | Disperse orange 47 | 3204.11 | ||
12236-25-8 | Disperse violet 33 | 3204.11 | ||
12236-31-6 | Disperse yellow 63 | 3204.11 | ||
12236-62-3 | Pigment orange 36 | 3204.17 | ||
12236-64-5 | Pigment orange 38 | 3204.17 | ||
12236-86-1 | Reactive blue 21 | 3204.16 | ||
12236-87-2 | Reactive blue 25 | 3204.16 | ||
12236-90-7 | Reactive blue 38 | 3204.16 | ||
12236-92-9 | Reactive blue 49 | 1-Amino-4-[[3-[[4-chloro-6-[(3-sulfophenyl)amino]-1,3,5-triazin-2-yl]amino]-2,4,6-trimethyl-5-sulfophenyl]amino]-9,10-dihydro-9,10-dioxo-2-anthracenesulfonic acid sodium salt | 3204.16 | |
12237-00-2 | Reactive red 31 | 3204.16 | ||
12237-16-0 | Reactive yellow 37 | 3204.16 | ||
12237-22-8 | Solvent black 27 | 3204.9 | ||
12237-24-0 | Solvent blue 70 | 3204.19 | ||
12237-30-8 | Solvent orange 54 | 3204.17 | ||
12237-31-9 | solvent yellow 79 | 3204.19 | ||
12237-62-6 | Pigment violet 27 | Ferrate(4-), hexakis(cyano-c)-, methylated 4-[(4-aminophenyl)(4-imino-2,5-cyclohexadien-1-ylidene)methyl]benzenamine copper(2+) salts | 3204.17 | |
12237-63-7 | Pigment red 169 | 2-[6-(Ethylamino)-3-(ethylimino)-2,7-dimethyl-3H-xanthen-9-yl]benzoic acid ethyl ester copper-iron complex | 3204.17 | |
12238-31-2 | Pigment red 52:2 | 3204.17 | ||
12238-96-9 | Acid brown 44 | 3204.12 | ||
122390-54-9 | Aizen spilon yellow C-GNH | 3204.9 | ||
12239-07-5 | Acid red 260 | 3204.12 | ||
122390-98-1 | Pigment red 254 | 3204.9 | ||
122390-99-2 | Reactive blue 224 | 3204.16 | ||
12239-11-1 | Acid red 336 | 3204.12 | ||
12239-15-5 | Acid yellow 49 | Benzenesulfonic acid, 4-[(5-amino-3-methyl-1-phenyl-1H-pyrazol-4-yl)azo]-2,5-dichloro- | 3204.12 | |
12239-34-8 | Disperse blue 79 | 3204.11 | ||
122-39-4 | Diphenylamine | N-phenylaniline | 2921.44 | 3 |
12239-58-6 | Disperse yellow 82 | 3204.11 | ||
12239-87-1 | Pigment blue 15:2 | Copper, [C-chloro-29H,31H-phthalocyaninato( 2-)-.kappa.N29,.kappa.N30,. kappa.N31,.kappa.N32]- | 3212.9 | |
12240-15-2 | Pigment blue 27 | 3206.49 | ||
122-40-7 | alpha-Amylcinnamaldehyde | (2E)-2-benzylideneheptanal | 2912.29 | |
1224-41-8 | Fluorescent brightener 185 | 3204.2 | ||
122453-73-0 | Chlorfenapyr | 4-bromo-2-(4-chlorophenyl)-1-(ethoxymethyl)-5-(trifluoromethyl)-1H-pyrrole-3-carbonitrile | 2933.39 | 8 |
122-48-5 | Vanillylacetone | 4-(4-hydroxy-3-methoxyphenyl)butan-2-one | 2914.5 | |
122-51-0 | Ethyl Orthoformate | Diethoxymethoxyethane | 2915.13 | |
122-57-6 | Benzylideneacetone | (E)-4-phenylbut-3-en-2-one | 2914.29 | |
122-59-8 | Phenoxyacetic Acid | 2-phenoxyacetic acid | 2918.99 | |
1226056-71-8 | Thiazovivin | N-benzyl-2-(pyrimidin-4-ylamino)-1,3-thiazole-4-carboxamide | 2934.1 | |
122-62-3 | Bis(2-ethylhexyl) sebacate | Bis(2-ethylhexyl) decanedioate | ||
12262-58-7 | Cyclohexanone peroxide | 1-(1-hydroperoxycyclohexyl)peroxycyclohexan-1-ol | 3 | |
122-63-4 | Benzyl Propionate | Benzyl Propionate | 2915.5 | |
12264-18-5 | Calcium dihydrogen ethylenediaminetetraacetate | Calcium dihydrogen 2-({2-[bis(carboxylatomethyl)amino]ethyl}(carboxylatomethyl)amino)acetate | 2922.49 | |
1226-46-6 | 4,4'-Bis(dimethylamino)thiobenzophenone | Bis[4-(dimethylamino)phenyl]methanethione | 2930.9 | |
122-66-7 | Hydrazobenzene | 1,2-Diphenylhydrazine | 3402.11 | |
12269-78-2 | Pyrophyllite | Aluminum dihydroxy (oxo) silane | 2530.9 | |
12269-87-3 | Acid brown 58 | 3204.12 | ||
12269-90-8 | Acid brown 235 | 3204.12 | ||
12270-02-9 | Acid red 337 | 3204.12 | ||
12270-13-2 | Basic blue 41 | 3204.16 | ||
12270-15-4 | Basic blue 77 | 3204.11 | ||
12270-25-6 | Basic red 51 ; 2-[((4-Dimethylamino)phenyl)azo]-1,3-dimethyl-1H-imidazolium chloride | |||
12270-76-7 | Reactive orange 35 | 3204.16 | ||
12270-87-0 | Reactive violet 13 | 3204.16 | ||
12271-12-4 | Basic red 18:1 | 3204.13 | ||
1227608-02-7 | 25C-NBOMe | 2-(4-chloro-2,5-dimethoxyphenyl)-N-(2-methoxybenzyl) ethanamine | 2921.46 | 7 |
122775-19-3 | Acrylamide | 3402.11 | ||
122-78-1 | Phenylacetaldehyde | 2-phenylacetaldehyde | 2912.29 | |
122-79-2 | Phenyl Acetate | Phenyl Acetate | 2915.39 | |
12280-0 | Disodium octaborate tetrahydrate | Pyridine-2,3-dicarboxylic acid | 2840.19 | |
12280-03-4 | Disodium octaborate tetrahydrate ; Borowood | Disodium;(9,11-dioxido-5-oxoboranyloxy-2,4,6,8,10,12,13-heptaoxa-1,3,5,7,9,11-hexaborabicyclo[5.5.1]tridecan-3-yl)oxy-oxoborane | 2840.2 | 8 |
122-80-5 | P-Aminoacetanilide | N-(4-aminophenyl)acetamide | 2924.29 | |
1228182-44-2 | Cimaterol-d7 | 2-amino-5-[2-(1,1,1,2,3,3,3-heptadeuteriopropan-2-ylamino)-1-hydroxyethyl]benzonitrile | 2845.9 | |
122836-35-5 | Sulfentrazone | N-{2,4-dichloro-5-[4-(difluoromethyl)-3-methyl-5-oxo-4,5-dihydro-1H-1,2,4-triazol-1-yl]phenyl}methanesulfonamide | 2935.9 | 8 |
12286-65-6 | Pigment yellow 61 | 3204.17 | ||
12286-66-7 | Pigment yellow 62 | 3204.17 | ||
122-88-3 | 4-Chlorophenoxyacetic acid | 2-(4-chlorophenoxy)acetic acid | 2918.99 | 3 |
122965-43-9 | Methylene blue hydrate | [7-(dimethylamino)phenothiazin-3-ylidene]-dimethylazanium;chloride;hydrate | ||
122-97-4 | 3-Phenyl-1-propanol | 3-phenylpropan-1-ol | 2906.29 | |
122-99-6 | Phenoxyethanol ; Ethylene glycol monophenyl ether | 2-phenoxyethan-1-ol | ||
123-01-3 | Dodecylbenzene | Dodecylbenzene | 3817 | |
123-03-5 | Cetylpyridinium chloride | 1-hexadecylpyridin-1-ium;chloride | 2933.39 | |
12304-65-3 | Hydrotalcite (Mg6(CO3)[Al(OH)6]2(OH)4.4H2O) | 3812.3 | ||
123-05-7 | 2-Ethylhexanal | 2-Ethylhexanal | ||
123071-42-1 | Malonaldehyde bis(phenylimine) monohydrochloride | N,N'-diphenylpropane-1,3-diimine;hydrochloride | 2925.29 | |
123-08-0 | 4-Hydroxybenzaldehyde | 4-Hydroxybenzaldehyde | 2912.49 | |
123-11-5 | P-Anisaldehyde ; Fragrance of p-Anisaldehyde | 4-methoxybenzaldehyde | ||
123120-98-9 | Fragrance of 1,2-Propanediol | Propane-1,2-diol | 3302.9 | |
123-19-3 | 4-Heptanone | Heptan-4-one | 2914.19 | 3 |
123-25-1 | Diethyl succinate ; Fragrance of diethyl succinate | Diethyl succinate | ||
123-26-2 | N,N'-Ethylenebis(12-hydroxystearamide) | 12-hydroxy-N-[2-(12-hydroxyoctadecanoylamino)ethyl]octadecanamide | 2924.19 | |
123-28-4 | Dilauryl thiodipropionate | Dodecyl 3-(3-dodecoxy-3-oxopropyl)sulfanylpropanoate | 2934.99 | |
123-30-8 | P-Aminophenol | 4-aminophenol | 2922.29 | |
123312-89-0 | Pymetrozine | 6-methyl-4-{[(1E)-pyridin-3-ylmethylene]amino}-4,5-dihydro-1,2,4-triazin-3(2H)-one | 2933.69 | |
123-31-9 | Hydroquinone | Benzene-1,4-diol | 2907.22 | |
123-32-0 | 2,5-Dimethylpyrazine | 2,5-dimethylpyrazine | 2933.99 | |
12333-11-8 | Ammonium metatungstate hydrate | Hexaammonium trioxido-[[(oxido-dioxo-tungstenio)oxy-dioxo-tungstenio]oxy-dioxo-tungstenio]oxy-bis[[[[(oxido-dioxo-tungstenio)oxy-dioxo-tungstenio]oxy-dioxo-tungstenio]oxy-dioxo-tungstenio]oxy]tungsten hydrate | 2841.8 | |
123333-53-9 | 1-Hydroxybenzotriazole monohydrate | 1-hydroxybenzotriazole hydrate | 2933.99 | |
123333-64-2 | Chlorophenol Red sodium salt | 2934.99 | ||
123333-66-4 | Potassium tellurite-hydrate | Dipotassium tellurite hydrate | 2842.901 | |
123-35-3 | Myrcene | 7-methyl-3-methylideneocta-1,6-diene | 2901.1 | |
12336-95-7 | Chromium sulfate | Chromium(3+); hydroxide; sulfate | 2833.22 | |
123-38-6 | Propionaldehyde | Propanal | 2912.19 | 3 |
123-39-7 | N-Methylformamide | N-methylformamide | 2924.19 | |
123409-01-8 | Sodium 1,3,(6,7)-naphthalenetrisulfonate tribasic hydrate | Sodium 1,3,(6,7)-naphthalenetrisulfonate tribasic hydrate | 2904.1 | |
123-41-1 | Choline Hydroxide | 2-hydroxyethyl(trimethyl)azanium hydroxide | 2923.1 | |
123-42-2 | Diacetone alcohol | 4-hydroxy-4-methylpentan-2-one | 2914.4 | 3 |
123457-83-0 | 4-Maleimidophenyl isocyanate | 1-(4-isocyanatophenyl)pyrrole-2,5-dione | 2929.1 | |
123-51-3  | Isoamyl Alcohol | 3-methylbutan-1-ol | ||
123-54-6 | Acetylacetone | Pentane-2,4-dione | 2914.69 | 3 |
123-62-6 | Propionic Anhydride | Propanoyl propanoate | 2915.5 | 3 |
123-66-0 | Ethyl caproate | Ethyl hexanoate | 2916.12 | |
123-68-2 | Allyl Hexanoate | Prop-2-enyl hexanoate | 2915.9 | |
123-72-8 | Butyraldehyde | Butanal | 2912.19 | 3 |
123-75-1 | Pyrrolidine | Pyrrolidine | 2933.99 | |
123-76-2 | Levulinic Acid | 4-oxopentanoic acid | 2918.3 | |
123-77-3 | Carbamoyliminourea | Azo-1,2-dicarboxamide | ||
123-79-5 | Dioctyl adipate | Dioctyl adipate | 3812.3 | |
123-82-0 | Tuaminoheptane | Heptan-2-amine | 2921.19 | |
12382-30-8 | Ferromolybdenum | Iron molybdenum | ||
123-86-4 | Butyl acetate | Butyl acetate | 2915.33 | |
123-91-1 | Dioxane | 1,4-dioxane | 2932.99 | 3 |
123-92-2 | Isoamyl Acetate ; Fragrance of isoamyl acetate | 3-methylbutyl acetate | ||
12392-64-2 | Acid Blue 193 | Disodium hydrogen bis[3-hydroxy-4-[(2-hydroxy-1-naphthyl)azo]naphthalene-1-sulphonato(3-)]chromate(3-) | 3204.12 | |
123-94-4 | Glycerol monostearate | 2,3-dihydroxypropyl octadecanoate | ||
1239-45-8 | Homidium Bromide | 5-ethyl-6-phenylphenanthridin-5-ium-3,8-diamine bromide | 6 | |
123-95-5 | Butyl Stearate | Butyl octadecanoate | 2915.7 | |
123-96-6 | 2-Octanol | Octan-2-ol | 2905.16 | |
1239908-48-5 | Methoxetamine Hydrochloride | 2-(ethylamino)-2-(3-methoxyphenyl)cyclohexan-1-one hydrochloride | 2922.5 | |
123-99-9 | Azelaic acid | Nonanedioic acid | 2917.13 | |
124-02-7 | Diallylamine | N-prop-2-enylprop-2-en-1-amine | 2921.19 | |
124-04-9 | Adipic Acid | Hexanedioic acid | 2917.12 | 3 |
124-06-1 | Ethyl myristate | Ethyl tetradecanoate | 2916.12 | |
124-07-2 | Octanoic Acid | Octanoic Acid | 2915.9 | |
12408-47-8 | Magnesium aluminometasilicate | Dialuminum;dimagnesium;dioxido(oxo)silane;oxygen(2-);hydrate | 2842.1 | |
124-09-4 | Hexamethylenediamine | Hexane-1,6-diamine | 2921.22 | |
124-13-0 | Caprylaldehyde | Octanal | 2912.19 | |
12415-34-8 | Emery | |||
124172-53-8 | N,N'-bis(2,2,6,6-tetramethyl-4-piperidyl)-N,N'-diformylhexamethylenediamine | N-[6-[formyl-(2,2,6,6-tetramethylpiperidin-4-yl)amino]hexyl]-N-(2,2,6,6-tetramethylpiperidin-4-yl)formamide | 2933.99 | |
124-17-4 | Butyl carbitol acetate ; 2-(2-Butoxyethoxy)ethyl acetate | 2-(2-butoxyethoxy)ethyl acetate | 8 | |
12417-86-6 | Moroccan lava clay | 3802.9 | ||
124-18-5 | Decane | Decane | 2901.1 | |
124-19-6 | Nonanal | Nonanal | 2912.19 | |
124-20-9 | Spermidine | N'-(3-aminopropyl)butane-1,4-diamine | 2921.29 | |
124-22-1 | Dodecylamine | Dodecan-1-amine | 2921.19 | |
124-26-5 | Stearamide | Octadecanamide | ||
12427-27-9 | Perlite | 3802.9 | ||
124-28-7 | Dymanthine | N,N-dimethyloctadecan-1-amine | 2921.19 | |
124-30-1 | Octadecylamine | Octadecylamine | ||
12436-94-1 | Ammonium sulphate nitrate | Triazanium nitrate sulfate | 3102.3 | 4 |
124-38-9 | Carbon dioxide ; Liquid carbon dioxide | Carbon dioxide | 8 | |
124-40-3 | Dimethylamine | N-methylmethanamine | 2921.11 | 2 |
12441-09-7 | Sorbitan | (3S)-2-(1,2-dihydroxyethyl)oxolane-3,4-diol | 3823.19 | |
124-41-4 | Sodium Methoxide | Sodium methanolate | ||
124448-55-1 | Reactive Blue 198 | 3204.16 | ||
12449-55-7 | Magnesium fluorosilicate | ไม่พบข้อมูล | 2826.9 | |
1245-13-2 | Bicinchoninic Acid | 2-(4-carboxyquinolin-2-yl)quinoline-4-carboxylic acid | 2933.49 | |
124594-15-6 | Nickel bis(sulphamidate) tetrahydrate | 3824.9 | ||
124605-84-1 | 2-Carbethoxy Amino-5-Napthol-sulfonic acid | 2922.21 | ||
124-63-0 | Methanesulfonyl chloride | Methanesulfonyl Chloride | 2904.9 | |
124-65-2 | Sodium cacodylate trihydrate | Sodium; dimethylarsinate | 2805.11 | |
1246819-58-8 | Mabuterol-D9 hydrochloride | 1-[4-amino-3-chloro-5-(trifluoromethyl)phenyl]-2-[[1,1,1,3,3,3-hexadeuterio-2-(trideuteriomethyl)propan-2-yl]amino]ethanol | 2845.9 | |
124-68-5 | Aminomethylpropanol | 2-amino-2-methylpropan-1-ol | 2922.19 | 3 |
124750-99-8 | Losartan potassium | Potassium [2-butyl-5-chloro-3-[[4-[2-(1,2,3-triaza-4-azanidacyclopenta-2,5-dien-5-yl)phenyl]phenyl]methyl]imidazol-4-yl]methanol | 2932.2 | 6 |
124-76-5 | Isoborneol | (1R,2R,4R)-1,7,7-trimethylbicyclo[2.2.1]heptan-2-ol | 2906.19 | |
1248-42-6 | Pitofenone Hydrochloride | Methyl 2-[4-(2-piperidin-1-ylethoxy)benzoyl]benzoate hydrochloride | 2933.39 | |
124-94-7 | Triamcinolone | (8S,9R,10S,11S,13S,14S,16R,17S)-9-fluoro-11,16,17-trihydroxy-17-(2-hydroxyacetyl)-10,13-dimethyl-6,7,8,11,12,14,15,16-octahydrocyclopenta[a]phenanthren-3-one | 2937.22 | |
12501-23-4 | Phosphotungstic acid hydrate | Phosphoric acid;trioxotungsten;hydrate | 2811.19 | |
125-02-0 | Prednisolone Sodium Phosphate | Disodium [2-[(8S,9S,10R,11S,13S,14S,17R)-11,17-dihydroxy-10,13-dimethyl-3-oxo-7,8,9,11,12,14,15,16-octahydro-6H-cyclopenta[a]phenanthren-17-yl]-2-oxoethyl] phosphate | 2933.11 | |
12508-61-1 | Magnesium hydroxide sulphate trihydrate | ไม่พบข้อมูล | 2833.29 | |
125109-85-5 | Isopropylphenylbutanal | 3-(3-propan-2-ylphenyl)butanal | 2912.29 | |
125110-14-7 | Cefixime | (6R,7R)-7-[[(2Z)-2-(2-amino-1,3-thiazol-4-yl)-2-(carboxymethoxyimino)acetyl]amino]-3-ethenyl-8-oxo-5-thia-1-azabicyclo[4.2.0]oct-2-ene-2-carboxylic acid trihydrate | 2941.9 | 6 |
125-12-2 | Isobornyl acetate | [(1S,3S,4S)-4,7,7-trimethyl-3-bicyclo[2.2.1]heptanyl] acetate | 2915.39 | |
12517-41-8 | Copper phosphorus | Copper; phosphorus | 2848 | |
12519-36-7 | Zinc edetate | Zinc 2-[2-[bis(carboxylatomethyl)amino]ethyl-(carboxylatomethyl)amino]acetate | 2922.49 | |
125-20-2 | Thymolphthalein ; 5',5''-Diisopropyl-2',2''-dimethylphenolphthalein | 3,3-bis(4-hydroxy-2-methyl-5-propan-2-ylphenyl)-2-benzofuran-1-one | ||
125304-04-3 | 2-(2H-1,2,3-benzotriazol-2-yl)-6-dodecyl-4-methylphenol | |||
125401-92-5 | Bispyribac sodium | Sodium 2,6-bis[(4,6-dimethoxypyrimidin-2-yl)oxy]benzoate | 2933.59 | 8 |
12542-30-2 | Dihydrodicyclopentadienyl acrylate | Dihydrodicyclopentadienyl acrylate | 2915.9 | |
125441-87-4 | Poly(oxy-1,2-ethanediyl), alpha-(2-methyl-1-oxo-2-propenyl)-omega hydroxy-, C22-alkyl ether | 2916.14 | ||
125572-95-4 | Trans-1,2-Diaminocyclohexane-N,N,N',N'-tetraacetic acid monohydrate | 2-[[(1R,2R)-2-[bis(carboxymethyl)amino]cyclohexyl]-(carboxymethyl)amino]acetic acid hydrate | 2922.49 | |
125590-73-0 | Isooctyl polyglucoside | 3402.13 | ||
125-60-0 | Fenpiverinium Bromide | 4-(1-methylpiperidin-1-ium-1-yl)-2,2-diphenylbutanamide bromide | 2933.39 | |
125643-61-0 | Reaction mass of isomers of: C7-9-alkyl 3-(3,5-di-tert-butyl-4-hydroxyphenyl)propionate | |||
125-69-9 | Dextromethorphan Hydrobromide | 3-methoxy-17-methylmorphinan hydrobromide | 2933.99 | |
125700-67-6 | 2-(1-H-benzotriazol-1-yl)-1,1,3,3-tetramethyluronium tetrafluoroborate | 2933.99 | ||
1257-08-5 | Epicatechin Gallate | [(2R,3R)-2-(3,4-dihydroxyphenyl)-5,7-dihydroxy-3,4-dihydro-2H-chromen-3-yl] 3,4,5-trihydroxybenzoate | 2932.99 | |
125718-04-9 | 1,3-diisocyanatomethylbenzene | 3824.6 | ||
1257642-74-2 | Bathocuproinedisulfonic acid disodium salt hydrate | Disodium 2,9-dimethyl-4,7-diphenyl-1,10-phenanthroline-3,8-disulfonate hydrate | 2933.99 | |
125829-24-5 | Chromoionophore I | N-[9-(diethylamino)benzo[a]phenoxazin-5-ylidene]octadecanamide | 2934.99 | |
125-83-7 | Decanedihydrazide | Decanedihydrazide | 2928 | |
125997-21-9 | Phosphoric trichloride, polymer with 1,3-benzenediol, phenyl ester | 2916.39 | ||
1260-17-9 | Carminic acid ; Natural red 4 | (1S)-1,5-anhydro-1-(7-carboxy-1,3,4,6-tetrahydroxy-8-methyl-9,10-dioxo-9,10-dihydroanthracen-2-yl)-D-glucitol | 3204.12 | |
12604-58-9 | Ferrovanadium | Iron vanadium | 2615.9 | |
126050-54-2 | 2,2'-methylenebis(4,6-di-tert-butyl-phenyl)-2-ethylhexyl phosphite | 2,2'-methylenebis(4,6-di-tert-butyl-phenyl)-2-ethylhexyl phosphite | 2920.9 | |
12607-70-4 | Nickel (II) carbonate basic hydrate | Nickel(2+); carbonate; tetrahydroxide | 2836.99 | |
126-07-8 | Griseofulvin | (2S,5'R)-7-chloro-3',4,6-trimethoxy-5'-methylspiro[1-benzofuran-2,4'-cyclohex-2-ene]-1',3-dione | 2941.9 | 6 |
126121-35-5 | Tris(2-octyldodecyl) citrate | 1,2,3-Tris(2-octyldodecyl) 2-hydroxypropane-1,2,3-tricarboxylate | 2918.29 | |
126-13-6 | Sucrose acetate isobutyrate | [(2S,3S,4R,5R)-5-[(acetyloxy)methyl]-2-{[(2R,3R,4S,5R,6R)-6-[(acetyloxy)methyl]-3,4,5-tris[(2-methylpropanoyl)oxy]oxan-2-yl]oxy}-3,4-bis[(2-methylpropanoyl)oxy]oxolan-2-yl]methyl 2-methylpropanoate | 2940 | |
1261392-47-5 | Metronidazole-(ethylene-d4) | 1,1,2,2-tetradeuterio-2-(2-methyl-5-nitroimidazol-1-yl)ethanol | 2845.9 | |
126-17-0 | Solasodine | 2939.99 | ||
126213-50-1 | 3,4-Ethylenedioxythiophene | 2,3-dihydrothieno[3,4-b][1,4]dioxine | ||
1262423-34-6 | Sodium Polyglutamate | 2922.42 | ||
12626-49-2 | Alkyldiphenyloxide disulfonate | 3402.11 | ||
1262661-88-0 | Distillates (FischerTropsch), heavy, C18- 50- branched and linear | 2710.19 | ||
12626-73-2 | Indigo blue (powder) | 3203 | ||
12627-14-4 | Lithium polysilicate | Dilithium;dioxido(oxo)silane | 2839.9 | |
126-27-2 | Oxethazaine | 2-[2-hydroxyethyl-[2-[methyl-(2-methyl-1-phenylpropan-2-yl)amino]-2-oxoethyl]amino]-N-methyl-N-(2-methyl-1-phenylpropan-2-yl)acetamide | 2924.29 | |
126-30-7 | Neopentyl glycol | 2,2-Dimethylpropane-1,3-diol | 2905.39 | |
126-33-0 | Sulfolane | Thiolane 1,1-dioxide | 2934.99 | 3 |
1263306-88-2 | Azeloyl Bis-Dipeptide-10 and Citrate buffer and Glycerin | 2942 | ||
1263-63-4 | Mesoporphyrin IX Dimethyl Ester | Methyl 3-[8,13-diethyl-18-(3-methoxy-3-oxopropyl)-3,7,12,17-tetramethyl-22,23-dihydroporphyrin-2-yl]propanoate | 2933.99 | |
12645-31-7 | Phosphoric acid 2-ethylhexyl ester | 2-ethylhexyl dihydrogen phosphate | ||
12645-49-7 | Iron manganese zinc oxide | Iron;manganese(2+);oxozinc | 2821.1 | |
12645-50-0 | Nickel-Zinc Ferrite powder (iron nickel zinc oxide) | Iron;nickel;zinc;tetrahydrate | 2821.1 | |
1264-72-8 | Colistin Sulfate | N-(4-amino-1-(1-(4-amino-1-oxo-1-(3,12,23-tris(2-aminoethyl)- 20-(1-hydroxyethyl)-6,9-diisobutyl-2,5,8,11,14,19,22-heptaoxo- 1,4,7,10,13,18-hexaazacyclotricosan-15-ylamino)butan-2-ylamino)-3-hydroxybutan-2-ylamino)-1-oxobutan-2-yl)-N,5-dimethylheptanamide | 2941.9 | 6 |
12650-69-0 | Mupirocin | 9-[(E)-4-[(2S,3R,4R,5S)-3,4-dihydroxy-5-[[(2S,3S)-3-[(2S,3S)-3-hydroxybutan-2-yl]oxiran-2-yl]methyl]oxan-2-yl]-3-methylbut-2-enoyl]oxynonanoic acid | 2941.9 | |
12650-88-3 | Lysozyme | L-valyl-L-phenylalanyl-glycyl-L-arginyl-L-cysteinyl-L-alpha-glutamyl-L-leucyl-L-alanyl-L-alanyl-L-alanyl-L-methionyl-L-lysyl-L-arginyl-L-histidyl-glycyl-L-leucyl-L-alpha-aspartyl-L-asparagyl-L-tyrosyl-L-arginyl-glycyl-L-tyrosyl-L-seryl-L-leucyl-glycyl-L-a | ||
12656-57-4 | Pigment orange 20 | 3207.1 | ||
12656-85-8 | Pigment red 104 ; C.I. 77605 | 3204.17 | ||
126-58-9 | Dipentaerythritol | 2-[[3-hydroxy-2,2-bis(hydroxymethyl)propoxy]methyl]-2-(hydroxymethyl)propane-1,3-diol | 2909.49 | |
126601-88-5 | Reactive blue 181 | 3204.16 | ||
1266615-56-8 | 2,6-Dichloroindophenol sodium salt dihydrate | Sodium 4-[(3,5-dichloro-4-oxocyclohexa-2,5-dien-1-ylidene)amino]phenolate dihydrate | 2925.29 | |
1266615-59-1 | MES hydrate | 2-(N-Morpholino)ethanesulfonic acid hydrate | 2933.99 | |
126-71-6 | Tri-isobutylphosphate | Tris(2-methylpropyl) phosphate | ||
12671-74-8 | Solvent yellow 98 | 3204.9 | ||
126729-57-5 | Pigment yellow 184 | 3204.17 | ||
126-73-8 | Tributylphosphate | Tributyl phosphate | 3 | |
12677-15-5 | Reactive blue 71 | 3204.16 | ||
126801-58-9 | Ethoxysulfuron | 2-ethoxyphenyl [(4,6-dimethoxypyrimidin-2-yl)carbamoyl]sulfamate | 2933.59 | 8 |
126-81-8 | Dimedone | 5,5-dimethylcyclohexane-1,3-dione | 2914.29 | |
126851-40-9 | Acid brown 434 | 3204.12 | ||
126-86-3 | Tetramethyl Decynediol | 2,4,7,9-tetramethyldec-5-yne-4,7-diol | ||
126-92-1 | Sodium Ethasulfate | Sodium 2-ethylhexyl sulfate | ||
126-96-5 | Sodium diacetate | Disodium diacetate | 2915.29 | |
126-97-6 | Ethanolamine thioglycolate | 2-aminoethanol 2-sulfanylacetic acid | 2930.9 | |
126990-35-0 | Dicyclopentyldimethoxysilane | 3815.9 | ||
127-00-4 | 1-Chloro-2-propanol | 1-chloropropan-2-ol | 2905.59 | |
127-07-1 | Hydroxyurea | Hydroxyurea | 2928 | |
127-08-2 | Potassium acetate | Potassium acetate | 2915.29 | |
127087-87-0 | 4-Nonylphenol, branched, ethoxylated ; Nonylphenol, branched, ethoxylated (1 - 2.5 moles ethoxylated) | |||
127-09-3 | Sodium acetate | Sodium acetate | 2915.29 | |
12710-34-8 | Neopeptone | 3504 | ||
12715-61-6 | Acid yellow 151 | Cobaltate(2-), bis[2-[[5-(aminosulfonyl)-2-(hydroxy-.kappa.O)phenyl]azo-.kappa.N1]-3-(oxo-.kappa.O)-N-phenylbutanamidato(2-)]-, dihydrogen | 3204.12 | |
127-17-3 | Pyruvic acid | 2-Oxopropanoic acid | 2918.3 | |
127-18-4 | Tetrachloroethylene | 1,1,2,2-tetrachloroethene | ||
127-19-5 | N,N-Dimethylacetamide | N,N-dimethylacetamide | 2924.19 | |
12737-27-8 | Pigment brown 29 | 3206.49 | ||
12738-23-7 | Gamma-Oryzanol | 2914.69 | ||
127-39-9 | Diisobutyl sodium-sulfosuccinate | Sodium 1,2-diisobutoxycarbonylethanesulfonate | 3402.9 | |
127-40-2 | Lutein | β,ε-carotene-3,3'-diol | 3203 | |
127406-56-8 | 4-(2-Pyridyl)benzaldehyde | 4-pyridin-2-ylbenzaldehyde | 2933.39 | |
127-41-3 | alpha-Ionone | (E)-4-(2,6,6-trimethylcyclohex-2-en-1-yl)but-3-en-2-one | 2914.39 | |
12743-28-1 | Silicomanganese | Iron manganese methane phosphane silicon | 2620.99 | |
127474-91-3 | Diethylhexyl naphthalate | Bis(2-ethylhexyl) naphthalene-2,6-dicarboxylate | 2917.39 | |
127-47-9 | Retinol Acetate | [(2E,4E,6E,8E)-3,7-dimethyl-9-(2,6,6-trimethylcyclohexen-1-yl)nona-2,4,6,8-tetraenyl] acetate | 2936.21 | |
12751-23-4 | Phosphoric acid, dodecyl ester | 3402.11 | ||
127519-17-9 | 3-(2H-Benzotriazolyl)-5-(1,1-di-methylethyl)-4-hydroxy-benzenepropanoic acid octyl esters | 3812.3 | ||
127-56-0 | Sulfacetamide Sodium | Sodium acetyl-(4-aminophenyl)sulfonylazanide | 2935 | 1 |
127564-92-5 | 3,3-Dichloro-1,1,1,2,2-pentafluoropropane | 3,3-dichloro-1,1,1,2,2-pentafluoropropane | 2903.75 | 12 |
127566-70-5 | Behenyl oleate | Docosyl (Z)-octadec-9-enoate | 3402.13 | |
127-63-9 | Diphenyl Sulfone | Benzenesulfonylbenzene | 2930.9 | |
127-65-1 | Chloramine-T anhydrous | Sodium chloro-(4-methylphenyl)sulfonylazanide | 2935 | 3 |
12765-39-8 | Sodium N-cocoyl-N-methyl taurate | 3402.11 | ||
127-68-4 | Sodium M-nitrobenzenesulfonate | Sodium 3-nitrobenzenesulfonate | 2904.9 | |
12768-78-4 | Acid green 16 | 3210 | ||
12768-92-2 | Fluorescent Brightener 113 | 3204.2 | ||
12769-07-2 | Reactive red 23 | 3204.16 | ||
12769-96-9 | Ultramarine violet | Hexaaluminum hexasodium tetrathietane hexasilicate | 2530.9 | |
12771-68-5 | Ancymidol | Cyclopropyl-(4-methoxyphenyl)-pyrimidin-5-ylmethanol | 2933.59 | |
12777-87-6 | Expandable graphite | 3824.9 | ||
127830-14-2 | Acid black 71 | 3204.16 | ||
12786-39-9 | Trypsin inhibitor | L-glutaminyl-glycyl-L-arginyl-L-prolyl-L-seryl-L-phenylalanyl-L-cysteinyl-L-asparagyl-L-leucyl-L-prolyl-L-alanyl-L-alpha-glutamyl-L-threonyl-glycyl-L-prolyl-L-cysteinyl-L-lysyl-L-alanyl-L-seryl-L-phenylalanyl-L-arginyl-L-glutaminyl-L-tyrosyl-L-tyrosyl-L-t | 3504 | |
12789-46-7 | Amyl acid phosphate | 3824.9 | ||
1279031-70-7 | Rosuvastatin-d6 | (E,3R,5S)-7-[4-(4-fluorophenyl)-2-[methylsulfonyl(trideuteriomethyl)amino]-6-propan-2-ylpyrimidin-5-yl]-3,5-dihydroxyhept-6-enoic acid;sodium | 2845.9 | 6 |
127-91-3 | beta-Pinene | 6,6-dimethyl-4-methylidenebicyclo[3.1.1]heptane | 2902.19 | |
128-04-1 | Sodium Dimethyldithiocarbamate | Sodium N,N-dimethylcarbamodithioate | 2930.2 | |
128055-74-3 | 2,2′,7,7′-Tetrabromo-9,9′-spirobifluorene | 2,2',7,7'-tetrabromo-9,9'-spirobi[fluorene] | 2903.99 | |
128-08-5 | N-Bromosuccinimide | 1-bromopyrrolidine-2,5-dione | 2929.9 | |
128-09-6 | N-Chlorosuccinimide | 1-chloropyrrolidine-2,5-dione | 2929.9 | |
128-13-2 | Ursodiol | (4R)-4-[(3R,5S,7S,8R,9S,10S,13R,14S,17R)-3,7-dihydroxy-10,13-dimethyl-2,3,4,5,6,7,8,9,11,12,14,15,16,17-tetradecahydro-1H-cyclopenta[a]phenanthren-17-yl]pentanoic acid | 2918.19 | |
128192-17-6 | Polyether-modified siloxane | 3402.13 | ||
128275-31-0 | 6-(phthalimido)peroxyhexanoic acid | 6-(1,3-dioxo-2,3-dihydro-1H-isoindol-2-yl)hexaneperoxoic acid | 3824.9 | |
128-37-0 | 3,5-Di-tert-butyl-4-hydroxytoluene | Butylated Hydroxytoluene | ||
128416-19-3 | Reactive blue 220 | 3204.16 | ||
128-42-7 | 4,4'-dinitrostilbene-2,2'-disulphonic acid | 4,4'-dinitrostilbene-2,2'-disulphonic acid | 2904.9 | |
128446-35-5 | beta-Cyclodextrin, 2-hydroxypropyl ethers | 2940 | ||
128446-36-6 | Methyl beta-cyclodextrin | |||
128-44-9 | Saccharin Sodium | Sodium 1,1-dioxo-1,2-benzothiazol-2-id-3-one | ||
128497-20-1 | Macadamia seed oil | 3302.9 | ||
128-51-8 | 2-Pinene-10-methyl acetate | 2-[(1R,5S)-6,6-dimethyl-4-bicyclo[3.1.1]hept-3-enyl]ethyl acetate | 2912.29 | |
128-53-0 | N-Ethylmaleimide | 1-ethylpyrrole-2,5-dione | 2925.19 | |
128-57-4 | Sennoside B | (9S)-9-[(9R)-2-carboxy-4-hydroxy-10-oxo-5-[(2S,3R,4S,5S,6R)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxy-9H-anthracen-9-yl]-4-hydroxy-10-oxo-5-[(2S,3R,4S,5S,6R)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxy-9H-anthracene-2-carboxylic acid | 2938.9 | |
128-58-5 | Vat green 1 ; C.I. 59825 | 3204.15 | ||
128625-52-5 | (Benzotriazol-1-yloxy)tripyrrolidinophosphonium | (Benzotriazol-1-yloxy)tripyrrolidinophosphonium | 2933.99 | |
128639-02-1 | Carfentrazone-ethyl | Ethyl 2-chloro-3-{2-chloro-5-[4-(difluoromethyl)-3-methyl-5-oxo-4,5-dihydro-1H-1,2,4-triazol-1-yl]-4-fluorophenyl}propanoate | 2933.99 | 8 |
128-69-8 | Perylene-3,4,9,10-tetracarboxylic dianhydride | Perylene-3,4,9,10-tetracarboxylic dianhydride | 2917.39 | |
128-80-3 | Solvent green 3 | 3204.9 | ||
128-95-0 | Disperse violet 1 | 3204.11 | ||
129-00-0 | Pyrene | Pyrene | 2902.9 | 8 |
129-06-6 | Warfarin Sodium | Sodium 2-oxo-3-(3-oxo-1-phenylbutyl)chromen-4-olate | 2932.2 | 6 |
129-09-9 | Vat yellow 2 | 3204.15 | ||
129101-54-8 | Rivastigmine tartrate | (2R,3R)-2,3-dihydroxybutanedioic acid [3-[(1S)-1-(dimethylamino)ethyl]phenyl] N-ethyl-N-methylcarbamate | 2924.29 | |
129138-58-5 | Clenbuterol-d9 | 1-(4-amino-3,5-dichlorophenyl)-2-[[1,1,1,3,3,3-hexadeuterio-2-(trideuteriomethyl)propan-2-yl]amino]ethanol | 2845.9 | |
129-16-8 | Merbromin | Disodium [2,7-dibromo-9-(2-carboxylatophenyl)-6-oxido-3-oxo-3H-xanthen-5-yl]mercurol | 2932.99 | |
129-17-9 | Sulfan Blue | Sodium 4-[[4-(diethylamino)phenyl]-(4-diethylazaniumylidenecyclohexa-2,5-dien-1-ylidene)methyl]benzene-1,3-disulfonate | 2934.99 | |
12926-00-8 | Silica gel | 3403.19 | ||
129-39-5 | 1,8-Dinitroanthraquinone | 1,8-dinitroanthracene-9,10-dione | 2914.7 | |
129423-54-7 | Pigment yellow 191 | calcium 4-chloro-5-methyl-2-{[3-methyl-5-oxo-1-(3-sulfonatophenyl)-4,5-dihydro-1H-pyrazol-4-yl]azo}benzenesulfonate | 3206.19 | |
129497-78-5 | Verteporfin | 2933.99 | ||
129499-78-1 | Ascorbyl Glucoside | (2R)-2-[(1S)-1,2-dihydroxyethyl]-3-hydroxy-4-[(2R,3R,4S,5S,6R)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxy-2H-furan-5-one | 2936.27 | |
129521-66-0 | Lignite | 2702.2 | ||
1295-35-8 | Bis(1,5-cyclooctadiene)nickel | (1Z,5Z)-cycloocta-1,5-diene nickel | 2931.9 | |
129558-76-5 | Tolfenpyrad | 4-chloro-5-ethyl-2-methyl-N-[[4-(4-methylphenoxy)phenyl]methyl]pyrazole-3-carboxamide | 2924.29 | 8 |
129-56-6 | Pyrazolanthrone | 2933.39 | ||
1296149-08-0 | Glucosamine Sulfate Potassium Chloride | Dipotassium (2R,3R,4S,5R)-2-amino-3,4,5,6-tetrahydroxyhexanal sulfuric acid dichloride | 2932.99 | |
129618-40-2 | Nevirapine | 11-cyclopropyl-4-methyl-5,11-dihydro-6H- dipyrido[3,2-b:2′,3′-e][1,4]diazepin-6-one | 2933.99 | |
129712-18-1 | Solmix AP 1 | 2710.19 | ||
129722-12-9 | Aripiprazole | 7-[4-[4-(2,3-dichlorophenyl)piperazin-1-yl]butoxy]-3,4-dihydro-1H-quinolin-2-one | 2933.79 | 6 |
129757-67-1 | A mixture of: bis(2,2,6,6-tetramethyl-1-octyloxypiperidin-4-yl)-1,10-decanedioate; 1,8-bis[(2,2,6,6-tetramethyl-4-((2,2,6,6-tetramethyl-1-octyloxypiperidin-4-yl)-decan-1,10-dioyl)piperidin-1-yl)oxy]octane | 3812.3 | ||
129811-19-4 | Macadamia nut oil | 3301.9 | ||
129828-24-6 | Eucalyptuscitriodoraoil ; Citronellal | 3301.29 | ||
129828-28-0 | Celery Oleoresin | 3301.9 | ||
129828-29-1 | Turmeric oleoresin | 3301.9 | ||
129871-01-8 | Pistacia vera seed oil | 3301.9 | ||
129893-17-0 | Asphalt extender | 2710.19 | ||
129898-77-7 | Reactive yellow 160 | C.I. Reactive Yellow 160 | 3204.19 | |
129909-90-6 | Amicarbazone | 4-amino-N-tert-butyl-3-isopropyl-5-oxo-4,5-dihydro-1H-1,2,4-triazole-1-carboxamide | 2933.99 | |
13001-38-2 | Fluorescent Brightener ER-II | 3204.2 | ||
13001-39-3 | 1,4-Bis(2-cyanostyryl)benzene | 3204.2 | ||
13001-40-6 | Fluorescent Brightener 199 | 3204.2 | ||
130018-87-0 | Levocetirizine Dihydrochloride | 2-[2-[4-[(R)-(4-chlorophenyl)-phenylmethyl]piperazin-1-yl]ethoxy]acetic acid dihydrochloride | 2933.59 | |
13003-12-8 | Butylidenebis[2-tert-butyl-5-methyl-p-phenylene]-P,P,P',P'-tetratridecylbis(phosphine) | 4-[2-(4-{[bis(tridecyloxy)phosphino]oxy}-5-tert-butyl-2-methylphenyl)pentyl]-2-isopropyl-5-methylphenyl ditridecyl phosphite | 2920.9 | |
1300-72-7 | Sodium xylenesulphonate | 3402.11 | ||
13007-85-7 | Gluceptate Sodium | Sodium (2R,3R,4S,5R,6R)-2,3,4,5,6,7-hexahydroxyheptanoate | 2918.16 | |
13007-92-6 | Chromium Carbonyl | Carbon monoxide chromium | 2931.9 | |
1300-94-3 | Amylmetacresol | 5-methyl-2-pentylphenol | 2907.19 | |
13011-62-6 | Solvent orange 45 | 3204.17 | ||
13011-68-2 | Acid brown 83 | 3204.12 | ||
130120-57-9 | Prezatide Copper Acetate | Copper acetic acid (2S)-6-amino-2-[[(2S)-2-[(2-aminoacetyl)amino]-3-(1H-imidazol-5-yl)propanoyl]amino]hexanoic acid | 2933.29 | |
130-14-3 | Sodium naphthalene-1-sulphonate | Sodium naphthalene-1-sulfonate | 3824.4 | |
130-15-4 | 1,4-Naphthoquinone | Naphthalene-1,4-dione | 2914.69 | |
1301-70-8 | Ferric Glycerophosphate | 2,3-dihydroxypropyl phosphate;iron(3+) | 2919.9 | |
130-17-6 | Dehydrothio-p-toluidine-o-sulfonic acid | 2-(4-Aminophenyl)-6-methyl-1,3-benzothiazole-7-sulfonic acid | 2934.99 | |
13019-20-0 | 2-Methylheptan-3-one | 2-Methyl-3-heptanone | 2914.19 | |
130-20-1 | Vat blue 6 | 3204.15 | ||
130-22-3 | C.I. 58005 ; Alizarine S | Sodium 3,4-dihydroxy-9,10-dioxo-9,10-dihydroanthracene-2-sulfonate | 3204.19 | |
1302-37-0 | Aluminium lithium silicate | Aluminum lithium dioxido(oxo)silane | 3824.9 | |
1302-58-5 | Amblygonite | 2530.9 | ||
1302-62-1 | Almandine garnet | Iron aluminum silicate | ||
1302-66-5 | Petalite | Aluminum Hydroxy-[hydroxy(oxo)silyl]oxy-oxosilane lithium | ||
130-26-7 | Clioquinol | 5-Chloro-7-iodoquinolin-8-ol | 2933.49 | |
1302-74-5 | Sand ; Corundum | Oxo(oxoalumanyloxy)alumane | ||
1302-76-7 | Kyanite | Aluminum silicic acid hydrate | 2508.5 | |
1302-78-9 | Bentonite ; Sodium bentonite | Dialuminum disodium oxygen (2-) silicon (4+) hydrate | ||
1302-87-0 | Clays | 3824.9 | ||
1302-88-1 | Cordierite | Magnesium iron aluminium cyclosilicate | 2507 | |
1302-90-5 | Sodalite | 2506.2 | ||
1302-93-8 | Mullite | Dioxosilane; oxo(oxoalumanyloxy)alumane | ||
130328-20-0 | Silver zinc zeolite | Silver zinc zeolite | ||
130328-22-2 | Fatty acids, C12-18, mixed esters with citric acid, pentaerythritol and stearyl alcohol | 3402.9 | ||
130-37-0 | Vitamin K3 sodium bisulfite | 1,2,3,4-Tetrahydro-2-methyl-1,4-dioxo-2-naphthalenesulfonic acid, sodium salt | 2914.7 | |
130381-05-4 | Steardimonium Hydroxypropyl Hydrolyzed Wheat Protein | 3402.12 | ||
130381-06-5 | Protein hydrolyzates, wheat germ, [3-(dodecyldimethylammonio)-2- hydroxypropyl], chlorides | 3402.9 | ||
1303-86-2 | Boron oxide | Oxo(oxoboranyloxy) borane | 2825.9 | |
13039-41-3 | Sucrose palmitate | [(2R,3S,4S,5R,6R)-6-[(2S,3S,4S,5R)-3,4-dihydroxy-2,5-bis(hydroxymethyl)oxolan-2-yl]oxy-3,4,5-trihydroxyoxan-2-yl]methyl hexadecanoate | 3823.19 | |
1303-96-4 | Borax decahydrate | Disodium; 3,7-dioxido-2,4,6,8,9-pentaoxa-1,3,5, 7-tetraborabicyclo [3.3.1]nonane; decahydrate | 2840.19 | |
13040-19-2 | Zinc diricinoleate | Zinc bis(12-hydroxyoctadec-9-enoate) | 2918.19 | |
130-40-5 | Riboflavin sodium phosphate | Sodium [(2R,3S,4S)-5-(7,8-dimethyl-2,4-dioxobenzo[g]pteridin-10-yl)-2,3,4-trihydroxypentyl] hydrogen phosphate | 2936.23 | |
130405-40-2 | Catechin gallate | [(2S,3R)-2-(3,4-dihydroxyphenyl)-5,7-dihydroxy-3,4-dihydro-2H-chromen-3-yl] 3,4,5-trihydroxybenzoate | 2932.99 | |
1304-28-5 | Barium oxide | Oxobarium | 2816.4 | |
1304-29-6 | Barium peroxide | Barium(2+);peroxide | 2816.4 | 3 |
1304-56-9 | Beryllium oxide | Oxoberyllium | 2825.9 | 8 |
13047-13-7 | 1-Phenyl-4-methyl-4-hydroxymethyl-3-pyrazolidinone | 4-(hydroxymethyl)-4-methyl-1-phenylpyrazolidin-3-one | 2933.19 | |
1304-76-3 | Dibismuth trioxide | [(oxobismuthanyl)oxy]bismuthanone | ||
13048-33-4 | 1,6-Hexanediol diacrylate | 6-prop-2-enoyloxyhexyl prop-2-enoate | 2916.12 | 3 |
1304-85-4 | Bismuth subnitrate | Tetrabismuth; oxobismuthanylium; nonahydroxide; tetranitrate | 2833.22 | |
13052-11-4 | [2-hydroxy-3-[(2-methyl-1-oxoallyl)oxy]propyl]trimethylammonium chloride | 3402.11 | ||
1305-62-0 | Slaked lime | Calcium dihydroxide | 3 | |
1305-78-8 | Calcium oxide | Oxocalcium | 3 | |
1305-79-9 | Calcium peroxide | Calcium; peroxide | 2825.9 | |
1306-06-5 | Hydroxyapatite | Pentacalcium; hydroxide; triphosphate | ||
1306-08-7 | Columbite | 2615.9 | ||
130-61-0 | Thioridazine Hydrochloride | 10-[2-(1-methylpiperidin-2-yl)ethyl]-2-methylsulfanylphenothiazine hydrochloride | 2934.3 | |
1306-19-0 | Cadmium oxide | Oxocadmium | 2825.9 | |
1306-38-3 | Cerium oxide | Dioxocerium | ||
130693-82-2 | Dorzolamide Hydrochloride | (4S,6S)-4-(ethylamino)-6-methyl-7,7-dioxo-5,6-dihydro-4H-thieno[2,3-b]thiopyran-2-sulfonamide hydrochloride | 2935 | |
1307-96-6 | Cobalt oxide | Oxocobalt | 2822 | |
1308-06-1 | Cobalt(II,III) oxide | Cobalt(II); dicobalt(III); oxide | 2822 | |
13080-86-9 | 2,2-Bis [4-(4-aminophenoxy)phenyl] propane | 4-[4-[2-[4-(4-aminophenoxy)phenyl]propan-2-yl]phenoxy]aniline | ||
13081-97-5 | Pentaerythrityl distearate | [2,2-Bis(hydroxymethyl)-3-octadecanoyloxypropyl] octadecanoate | 2915.9 | |
1308-31-2 | Chromite Ore | Dioxido (dioxo) chromium iron (2+) | ||
1308-38-9 | Chromium oxide | Oxo-(oxochromiooxy)chromium | ||
130885-09-5 | Perlite | |||
130-89-2 | Quinine Hydrochloride | (S)-[(2R,4R,5S)-5-ethenyl-1-azabicyclo[2.2.2]octan-2-yl]-(6-methoxyquinolin-4-yl)methanol hydrochloride | 2939.2 | 6 |
1309-33-7 | Iron hydroxide | 3212.9 | ||
1309-36-0 | Pyrite | Bis(sulfanyllidene) iron | ||
1309-37-1 | Iron(III) oxide ; Pigment Red 101 | Iron(III) oxide | ||
1309-38-2 | Magnetite ; Fragrance of triiron tetraoxide | Hydroxy(oxo)iron iron | ||
1309-42-8 | Magnesium hydroxide | Magnesium dihydroxide | ||
1309-48-4 | Magnesium oxide | Oxomagnesium | ||
130-95-0 | Quinine | (R)-[(2S,4S,5R)-5-ethenyl-1-azabicyclo[2.2.2]octan-2-yl]-(6-methoxyquinolin-4-yl)methanol | 2939.2 | 6 |
1309-56-4 | Molybdenum disulfide | 3403.19 | ||
1309-64-4 | Antimony trioxide | Di(phenyl)stiborylbenzene | ||
1310-58-3 | Potassium hydroxide | Potassium hydroxide | ||
1310-65-2 | Lithium hydroxide | Lithium hydroxide | 2825.2 | |
1310-66-3 | Lithium hydroxide monohydrate | Lithium hydroxide hydrate | 2825.2 | |
13106-76-8 | Ammonium molybdate | Diazanium; dioxido(dioxo)molybdenum | 2841.7 | |
1310-73-2 | Sodium hydroxide | Sodium hydroxide | ||
1311-10-0 | Strontium hydroxide octahydrate  | Strontium dihydroxide octahydrate | 2816.1 | |
131-11-3 | Dimethyl phthalate | Dimethyl benzene-1,2-dicarboxylate | 2917.34 | 8 |
13114-27-7 | 2-Methyl-4-(7H-purin-6-ylamino)but-2-en-1-ol | 2-methyl-4-(7H-purin-6-ylamino)but-2-en-1-ol | 2933.59 | |
131-17-9 | Diallyl Phthalate | Bis(prop-2-enyl) benzene-1,2-dicarboxylate | 2917.34 | 3 |
13122-18-4 | Tert-butyl 3,5,5-trimethylhexaneperoxoate | Tert-butyl 3,5,5-trimethylhexaneperoxoate | 2915.9 | |
1312-43-2 | Indium (III) oxide | Oxo- oxoindianyl oxyindigane | 2825.9 | |
131-27-1 | 3-aminonaphthalene-1,5-disulphonic acid | 3-aminonaphthalene-1,5-disulphonic acid | 2921.45 | |
1312-76-1 | Potassium silicate | Dipotassium; dioxido(oxo)silane | ||
13127-82-7 | N-oleyldiethanolamine | 2,2'-[(9Z)-octadec-9-en-1-ylimino]diethanol | 3402.13 | |
1312-81-8 | Lanthanum(III) oxide | Lanthanum(3+); oxygen(2-) | 2825.9 | |
131298-44-7 | Benzoic acid, C9-C11-branched alkyl ester | 2916.31 | ||
1313-13-9 | Manganese dioxide | Dioxomanganese | 8 | |
1313-27-5 | Molybdenum trioxide | Trioxomolybdenum | 2825.7 | |
13133-07-8 | Nystose | (2R,3R,4S,5S,6R)-2-[(2S,3S,4S,5R)-2-[[(2R,3S,4S,5R)-2-[[(2R,3S,4S,5R)-3,4-dihydroxy-2,5-bis(hydroxymethyl)oxolan-2-yl]oxymethyl]-3,4-dihydroxy-5-(hydroxymethyl)oxolan-2-yl]oxymethyl]-3,4-dihydroxy-5-(hydroxymethyl)oxolan-2-yl]oxy-6-(hydroxymethyl)oxane-3, | 2940 | |
1313-59-3 | Sodium oxide | Disodium; oxygen(2-) | 2825.9 | |
1313-60-6 | Sodium peroxide | Disodium; peroxide | 2815.3 | 3 |
1313-82-2 | Sodium sulfide | Disodium; sulfide | 2830.1 | 3 |
1313-84-4 | Sodium sulfide nonahydrate | Disodium; sulfide; nonahydrate | 2830.1 | |
13138-45-9 | Nickel nitrate | Nickel(2+); dinitrate; hexahydrate | ||
13138-48-2 | 3,3'-Dimethylnaphthidine | 3,3'-Dimethyl[1,1'-binaphthalene]-4,4'-diamine | 2921.59 | |
1313-85-5 | Sodium selenide | Disodium; selenium(2-) | 2842.9 | |
131390-32-4 | Dicyclopentyldimethoxysilane | Dicyclopentyl(dimethoxy)silane | 2931.9 | |
1313-96-8 | Niobium oxide | Dioxoniobiooxy (dioxo)niobium | 2825.9 | |
1313-97-9 | Neodymium oxide | Neodymium(3+); oxygen(2-) | ||
1313-99-1 | Nickel oxide | Nickel(2+); oxygen(2-) | 2825.4 | |
1314-11-0 | Strontium oxide | Strontium oxygen(2-) | 2816.4 | |
1314-13-2 | Zinc oxide | |||
1314-22-3 | Zinc peroxide | Zinc peroxide | 3812.1 | |
1314-23-4 | Zirconium dioxide | Zirconium dioxide | ||
1314-35-8 | Tungsten(VI) oxide | Trioxotungsten | 2825.9 | |
1314-36-9 | Yttrium(III) oxide | Oxo(oxoyttriooxy)yttrium | 2846.1 | |
1314-37-0 | Ytterbium(III) oxide | Oxoytterbium | 2846.9 | |
1314-41-6 | Lead tetroxide | Trilead tetraoxide | 2824.9 | 8 |
1314-56-3 | Phosphorus pentoxide | 1,3-dioxodiphosphoxane-1,3-diium-1,3-diolate | 2809.1 | |
1314-60-9 | Antimony pentoxide | (dioxo-λ5-stibanyl)oxy-dioxo-λ5-stibane | 2825.8 | |
1314-61-0 | Tantalum(V) oxide | Dioxotantaliooxy(dioxo)tantalum | 2825.9 | |
1314-62-1 | Vanadium pentoxide | Vanadium Pentaoxide | 2825.3 | 3 |
13147-09-6 | Desmethylprodine หรือ MPPP | (1-methyl-4-phenylpiperidin-4-yl) propanoate | 2933.39 | 7 |
1314-84-7 | Zinc phosphide | Trizinc diphosphide | 2853.9 | |
131-48-6 | N-acetylneuraminic acid | (2S,4S,5R,6R)-5-Acetamido-2,4-dihydroxy-6-[(1R,2R)-1,2,3-trihydroxypropyl]oxane-2-carboxylic acid | 2932.99 | |
1314-98-3 | Zinc sulfide | Sulfanylidenezinc | ||
1315-01-1 | Stannic sulfide | Tin(4+); disulfide | 2830.909 | |
131-53-3 | (2-Hydroxy-4-methoxyphenyl)-(2-hydroxyphenyl)methanone | 2,2'-Dihydroxy-4-methoxybenzophenone | 2914.5 | |
131538-00-6 | 2,3-Bis ((2-mercaptoethyl) thio) - 1-propanethiol | 2,3-Bis((2-mercaptoethyl)thio)-1-propanethiol | 2930.9 | |
131-54-4 | 2,2-Dihydroxy-4,4-dimethoxybenzophenone | 2,2'-Dihydroxy-4,4'-dimethoxybenzophenone | ||
131-55-5 | 2,2',4,4'-Tetrahydroxybenzophenone ; benzophenone-2 | 2,2',4,4'-Tetrahydroxybenzophenone | 2914.5 | |
131-56-6 | 2,4-Dihydroxybenzophenone | (2,4-Dihydroxyphenyl)(phenyl)methanone | 2914.69 | |
131-57-7 | 2-Hydroxy-4-methoxybenzophenone ; benzophenone-3 | (2-Hydroxy-4-methoxyphenyl)- phenylmethanone | 2914.7 | |
131-58-8 | (2-Methylphenyl)-phenylmethanone | (2-Methylphenyl)(phenyl)methanone | 2914.39 | |
131594-92-8 | Alcohol alkoxylate | 3402.13 | ||
13162-05-5 | N-vinylformamide | N-vinylformamide | 2924.19 | |
131685-53-5 | R)-(-)-4-Benzyl-3-propionyl-2-oxazolidinone | (4R)-4-Benzyl-3-propanoyl-1,3-oxazolidin-2-one | 2934.99 | |
13170-23-5 | Diacetoxydi-tert-butoxysilane | Diacetoxydi-tert-butoxysilane | 2931.9 | |
13170-55-1 | Magnesium L-ascorbic acid-2 phosphate | 2936.27 | ||
13171-00-1 | 1-(6-Tert-butyl-1,1-dimethyl-2,3-dihydroinden-4-yl)ethanone | 1-(6-Tert-butyl-1,1-dimethyl-2,3-dihydro-1H-inden-4-yl)ethan-1-one | 2914.39 | |
13171-25-0 | Trimetazidine dihydrochloride | 1-(2,3,4-Trimethoxybenzyl)piperazine dihydrochloride | 2933.59 | |
1317-33-5 | Molybdenum sulfide | Bis(sulfanylidene)molybdenum | ||
1317-36-8 | Lead monoxide | Oxolead | 8 | |
1317-37-9 | Iron(II) sulfide | Sulfanylideneiron | 2830.901 | |
1317-38-0 | Copper(II) oxide | Oxocopper | 2825.5 | |
1317-39-1 | Cuprous oxide | Copper; oxocopper | ||
1317-40-4 | Copper(II) sulfide | Sulfanylidenecopper | 2830.9 | |
1317-43-7 | Magnesium dihydroxide | 3824.9 | ||
1317-45-9 | Cassiterite | Dioxotin | 2609 | |
1317-54-0 | Ferrite | |||
1317-60-8 | Hematite | Iron (3+) oxygen (2-) | ||
1317-61-9 | Iron oxide black powder | Triiron tetraoxide | ||
1317-63-1 | Limonite | 2601.11 | ||
1317-65-3 | Limestone | Calcium carbonate | ||
1317-70-0 | Titanium(IV) oxide, anatase | Dioxotitanium | ||
1317-71-1 | Olivine | Iron magnesium silicic acid | ||
1317-80-2 | Rutile ; Titanium(IV) oxide | Dioxotitanium | ||
1317-93-7 | Tourmaline | 2530.9 | ||
1318-00-9 | Vermiculite | Aluminum magnesium dioxido (oxo) silane iron (2+) | ||
1318-02-1 | Zeolites ; Aluminosilicate dehydrate | Dioxosilane oxo (oxoalumanyloxy) alumane | ||
131812-67-4 | 2,4-Dimethyl-2-(5,5,8,8-tetramethyl-6,7-dihydronaphthalen-2-yl)-1,3-dioxolane | 2,4-Dimethyl-2-(5,5,8,8-tetramethyl-6,7-dihydronaphthalen-2-yl)-1,3-dioxolane | 2932.99 | |
1318-16-7 | Bauxite | Oxo (oxoalumanyloxy) alumane hydrate | 2606 | |
1318-27-0 | Carnallite | Magnesium potassium trichloride hexahydrate | 3104.9 | 4 |
1318-33-8 | Colemanite | Oxocalcium oxo(oxoboranyloxy)borane | ||
13183-79-4 | 5-Mercapto-1-methyltetrazole | 1,2-Dihydro-1-methyl-5H-tetrazole-5-thione | 2933.99 | 8 |
1318-59-8 | Chlorite | Chlorite | 2530.1 | |
131860-33-8 | Azoxystrobin | methyl (2E)-2-(2-{[6-(2-cyanophenoxy)pyrimidin-4-yl]oxy}phenyl)-3-methoxyacrylate | 2933.59 | 8 |
1318-74-7 | Kaolinite | Dialuminum;oxido-[oxido(oxo)silyl]oxy-oxosilane tetrahydroxide | ||
13189-00-9 | Zinc bismethacrylate ; ; 2-methylprop-2-enoate | Zinc bis(2-methylacrylate) | ||
1318-93-0 | Montmorillonite | Dialuminum dioxosilane oxygen (2-) hydrate | ||
131-91-9 | 1-Nitrosonaphthalen-2-ol | 1-Nitroso-2-naphthol | 2908.99 | |
131-92-0 | Vat brown 3 ; C.I. 69015 | 3204.15 | ||
1319-33-1 | Ulexite | Calcium;sodium;dioxido-[(7-oxido-2,4,6,8,9-pentaoxa-1,3,5,7-tetraborabicyclo[3.3.1]nonan-3-yl)oxy]borane octahydrate | 2528 | |
1319-69-3 | Potassium glycerophosphate | Dipotassium 3-(phosphonooxy)propane-1,2-diol | 2919.9 | |
1319-77-3 | Cresol ; Cresol (mixed isomers) | 8 | ||
13197-76-7 | Lauryl Hydroxysultaine | 3-[dodecyl(dimethyl)azaniumyl]-2-hydroxypropane-1-sulfonate | ||
131-99-7 | Inosinic Acid | [(2R,3S,4R,5R)-3,4-dihydroxy-5-(6-oxo-3H-purin-9-yl)oxolan-2-yl]methyl dihydrogen phosphate | 2934.99 | |
1320-06-5 | Solvent red 27 | 3204.19 | ||
1321-74-0 | Divinylbenzene | 1,2-divinylbenzene | ||
13217-66-8 | 2,2'-Azobis-2-methylpropanimidamide | 2-[(1-amino-1-imino-2-methylpropan-2-yl)diazenyl]-2-methylpropanimidamide | 2927 | |
13220-57-0 | Tryptanthrin | Indolo[2,1-b]quinazoline-6,12-dione | 2939.99 | |
132207-31-9 | Methylpolysiloxane PEG-7 Phosphate | 2-[3-[[dimethyl(trimethylsilyloxy)silyl]oxy-methyl-trimethylsilyloxysilyl]propoxy]ethyl dihydrogen phosphate | 3824.9 | |
132-22-9 | Chlorphenamine | 3-(4-chlorophenyl)-N,N-dimethyl-3-pyridin-2-ylpropan-1-amine | 2933.39 | |
132259-10-0 | Air, compressed | (2R)-4-methyl-2-propan-2-yl-2-[2-[4-[4-[2-(3,4,5-trimethoxyphenyl)ethyl]piperazin-1-yl]butoxy]phenyl]-1,4-benzothiazin-3-one;dihydrochloride | 2804.3 | |
132-27-4 | Sodium o-phenylphenate | Sodium 2-phenylphenolate | 2915.5 | 3 |
1323-03-1 | Myristyl lactate | Tetradecyl 2-hydroxypropanoate | 2918.11 | |
1323-38-2 | Glyceryl Ricinoleate | 2,3-dihydroxypropyl (Z,12R)-12-hydroxyoctadec-9-enoate | 2915.9 | |
13235-36-4 | Edetate Sodium Tetrahydrate | Tetrasodium 2-[2-[bis(carboxylatomethyl)amino]ethyl-(carboxylatomethyl)amino]acetate tetrahydrate | 2922.49 | |
13236-84-5 | Formamide, N-(4,6-diamino-1,3,5-triazin-2-yl)- | 2942 | ||
132388-59-1 | Fmoc-Asn(Trt)-OH | (2S)-2-(9H-fluoren-9-ylmethoxycarbonylamino)-4-oxo-4-(tritylamino)butanoic acid | 2937.9 | |
13241-33-3 | Neohesperidin | (2S)-7-[(2S,3R,4S,5S,6R)-4,5-dihydroxy-6-(hydroxymethyl)-3-[(2S,3R,4R,5R,6S)-3,4,5-trihydroxy-6-methyloxan-2-yl]oxyoxan-2-yl]oxy-5-hydroxy-2-(3-hydroxy-4-methoxyphenyl)-2,3-dihydrochromen-4-one | 2938.9 | |
13243-65-7 | 2,3-Dibromo-1,4-naphthoquinone | 2,3-dibromonaphthalene-1,4-dione | 2914.7 | |
1324-50-1 | Acid violet 15 | 3204.12 | ||
1324-58-9 | Direct blue 108 | 3204.14 | ||
132467-76-6 | Panthenyl hydroxypropyl steardimonium chloride | 3402.9 | ||
1324-80-7 | Acid blue 119 | 3204.12 | ||
1325-37-7 | Direct yellow 11 | Disodium 6-oxo-5-[(4-sulfonatophenyl)hydrazinylidene]naphthalene-2-sulfonate  | 3204.14 | |
132538-89-7 | Collagens, hydrolyzates, N-3-(dodecyldimethylammonio)-2-hydroxypropyl, chlorides | 3504 | ||
132539-06-1 | Olanzapine | 2-methyl-4-(4-methylpiperazin-1-yl)-5H-thieno[3,2-c][1,5]benzodiazepine | 2934.99 | 6 |
1325-54-8 | Direct orange 39 | 3204.12 | ||
1325-65-1 | Direct red 111 | 3204.12 | ||
1325-82-2 | Pigment violet 3 | 4-[(4-aminophenyl)-(4-methyliminocyclohexa-2,5-dien-1-ylidene)methyl]aniline | 3204.17 | |
1325-86-6 | Solvent blue 5 | 3204.19 | ||
1325-87-7 | Pigment blue 1 | 3204.17 | ||
1325-93-5 | Pigment blue 10 | 3204.17 | ||
1326-03-0 | Pigment violet 1 | 3204.17 | ||
132-60-5 | Cinchophen | 2-phenylquinoline-4-carboxylic acid | 2933.49 | |
132-65-0 | Dibenzothiophene | Dibenzothiophene | 2934.99 | |
1326-51-8 | Sulphur brown 10 | 3204.11 | ||
1326-82-5 | Sulphur Black | Sodium 2, 6-bis (4, 6-dimethoxypyrimidin-2-yloxy) benzoate | 2803.004 | |
1327-33-9 | Antimony oxide | Antimony(3+);oxygen(2-) | 2825.8 | |
1327-39-5 | Silicic acid, aluminum calcium salt | Aluminium(3+) ion calcium oxosilanebis(olate) | 3802.9 | |
1327-41-9 | Polyaluminiumchloride | |||
1327-43-1 | Magnesium aluminum silicate | Magnesium aluminum silicate | ||
1327-57-7 | Sulphur blue 7 | 3204.19 | ||
1327-69-1 | Sulphur blue 15 | 3204.19 | ||
1327-70-4 | Sulphur green blue cv | 3204.19 | ||
1327-85-1 | Sulphur bed 6 | 3204.19 | ||
13280-61-0 | 1,4-Bis(2-methylstyryl)benzene | 1,4-bis[(E)-2-(2-methylphenyl)ethenyl]benzene | 2902.9 | |
132821-77-3 | Polyester phthalate | 2917.39 | ||
13283-01-7 | Tungsten(VI) chloride | Hexachlorotungsten | 2827.39 | |
1328-51-4 | Solvent blue 38 | 3204.9 | ||
1328-53-6 | Pigment green 7 | Cu phthalocyanine | 3212.9 | |
132-87-6 | 7-Benzamido-4-hydroxynaphthalene-2-sulfonic acid | 7-benzamido-4-hydroxynaphthalene-2-sulfonic acid | 2908.99 | |
13292-46-1 | Rifampicin | (7S,9E,11S,12R,13S,14R,15R,16R,17S,18S,19E,21Z)-2,15,17,27,29-pentahydroxy-11-methoxy-3,7,12,14,16,18,22-heptamethyl-26-[N-(4-methylpiperazin-1-yl)carboximidoyl]-6,23-dioxo-8,30-dioxa-24-azatetracyclo | 2941.9 | 6 |
132-98-9 | Phenoxymethylpenicillin potassium | Phenoxymethylpenicillin potassium | 2941.1 | |
13301-61-6 | Disperse orange 37 | 3204.11 | ||
1330-20-7 | Xylene | Xylene | 3 | |
1330-38-7 | Direct blue 86 | 3208.9 | ||
1330-43-4 | Sodium tetraborate | Disodium; 3,7-dioxido-2,4,6,8,9-pentaoxa-1,3,5, 7-tetraborabicyclo [3.3.1]nonane | ||
1330-44-5 | Aluminum hydroxide hydrate | Aluminum; trihydroxide; hydrate | 2818.3 | |
133053-19-7 | 3-[1-[3-(dimethylamino)propyl]-5-methoxyindol-3-yl]-4-(1H-indol-3-yl)pyrrole-2,5-dione | 3-[1-[3-(dimethylamino)propyl]-5-methoxyindol-3-yl]-4-(1H-indol-3-yl)pyrrole-2,5-dione | 2933.99 | |
133-06-2 | Captan ; N-(trichloromethylthio)cyclohex-4-ene-1,2-dicarboximide | 2930.9 | 8 | |
133-07-3 | Folpet | 2-[(trichloromethyl)sulfanyl]-1H-isoindole-1,3(2H)-dione | 2930.9 | 8 |
1330-78-5 | Tris(methylphenyl) phosphate | 3-methylphenyl bis(4-methylphenyl) phosphate bis(3-methylphenyl) 4-methylphenyl phosphate tris(3-methylphenyl) phosphate | 3 | |
1330-80-9 | Oleic acid, monoester with propane-1,2-diol | 2-hydroxypropyl octadec-9-enoate | 2942 | |
13308-51-5 | Boron phosphate | 2,4,5-trioxa-λ5-phospha-3-borabicyclo[1.1.1]pentane 1-oxide | 2835.29 | |
133099-07-7 | Darifenacin Hydrobromide | 2-[(3S)-1-[2-(2,3-dihydro-1-benzofuran-5-yl)ethyl]pyrrolidin-3-yl]-2,2-diphenylacetamide;hydrobromide | 2942 | |
133-10-8 | Aminosalicylate Sodium | Sodium 4-amino-2-hydroxybenzoate | 2922.19 | |
1332-07-6 | Zinc borate | Trizinc; diborate | 2840.2 | |
1332-09-8 | Pumice | 2513.1 | ||
1332-37-2 | Red Iron Oxide | Oxo(oxoferriooxy)iron | ||
1332-40-7 | Copper oxychloride | Copper chloride oxide | 2827.41 | 8 |
13324-20-4 | Reactive blue 4 | 3204.16 | ||
13325-10-5 | 4-Aminobutanol | 4-Aminobutan-1-ol | 2922.19 | |
1332-58-7 | Kaolin | Oxo-oxoalumanyloxy-[oxo(oxoalumanyloxy)silyl]oxysilane dihydrate | ||
1332-65-6 | Copper oxychloride | Dicopper chloride trihydroxide | 3206.19 | 8 |
13327-56-5 | Ethyl 3-(methylthio)propionate | Ethyl 3-(methylsulfanyl)propanoate | 2918.99 | |
1332-77-0 | Potassium borate | Dipotassium oxoboranyl [(oxoboranyl boronato)oxy]boronate | 2840.2 | |
1333-22-8 | Tribasic copper sulfate | 8 | ||
133-32-4 | Indole-3-butyric acid | 3-Indolebutyric acid | 8 | |
1333-39-7 | Hydroxybenzenesulfonic acid | Hydroxybenzenesulfonic acid | 3402.9 | |
1333-74-0 | Hydrogen | Molecular hydrogen | 2806.1 | 3 |
133-37-9 | Tartaric acid | 2,3-Dihydroxybutanedioic acid | 2918.12 | |
1333-82-0 | Chromium trioxide | Trioxochromium | 2819.1 | 8 |
1333-84-2 | Activated alumina | Dialuminum;oxygen(2-);hydrate | ||
1333-86-4 | Carbon black | Carbon black, acetylene | ||
133407-82-6 | Benzyl n-[(2S)-4-methyl-1-[[(2S)-4-methyl-1-[[(2S)-4-methyl-1-oxopentan-2-yl]amino]-1-oxopentan-2-yl]amino]-1-oxopentan-2-yl]carbamate | Benzyl n-[(2S)-4-methyl-1-[[(2S)-4-methyl-1-[[(2S)-4-methyl-1-oxopentan-2-yl]amino]-1-oxopentan-2-yl]amino]-1-oxopentan-2-yl]carbamate | 2924.29 | |
13348-35-1 | 4,4 -Butyliden-bis-(3-methyl-6-tert-butyl-phenol) | 2-Tert-butyl-4-[4-(5-tert-butyl-4-hydroxy-2-methylphenyl)butyl]-5-methylphenol | 2907.29 | |
1335-30-4 | Aluminium silicate | Tetraaluminum dioxido (oxo) silane oxygen (2-) | 2530.9 | |
1335-46-2 | 1-(2,6,6-Trimethyl-1-cyclohex-2-enyl)pent-1-en-3-one | (E)-1-(2,6,6-Trimethylcyclohex-2-en-1-yl)pent-1-en-3-one | 2914.39 | |
1335-66-6 | Isocyclocitral | 2,4,6-trimethylcyclohex-3-ene-1-carbaldehyde and 3,5,6-trimethylcyclohex-3-ene-1-carbaldehyde | 2912.29 | |
1336-21-6 | Ammonium hydroxide | 8 | ||
13362-78-2 | 1,2-Di(4-pyridyl)ethylene | 4-[(E)-2-pyridin-4-ylethenyl]pyridine | 2933.39 | |
13368-13-3 | Ethylene glycol-bis(β-aminoethyl ether)-N,N,N′,N′-tetraacetic acid tetrasodium salt | 2922.5 | ||
133738-23-5 | Polyglyceryl-10 isostearate | 3402.13 | ||
133-74-0 | Hydrogen | 2804.1 | ||
1338-09-6 | Glycerol lacto-palmitate esters | [3-Hexadecanoyloxy-2-(2-hydroxypropanoyloxy)propyl] hexadecanoate | 2915.7 | |
1338-23-4 | Methyl ethyl ketone peroxide | 2-Hydroperoxy-2-(2-hydroperoxybutan-2-ylperoxy)butane | ||
1338-24-5 | Naphthenic acids | 3-(3-ethylcyclopentyl)propanoic acid | 3824.9 | |
1338-39-2 | Sorbitan monolaurate | (2R)-2-[(2R,3R,4S)-3,4-dihydroxyoxolan-2-yl]-2-hydroxyethyl dodecanoate | ||
1338-41-6 | Sorbitan stearate | (2R)-2-[(2R,3R,4S)-3,4-dihydroxyoxolan-2-yl]-2-hydroxyethyl octadecanoate | ||
1338-43-8 | Sorbitan oleate | (2R)-2-[(2R,3R,4S)-3,4-dihydroxyoxolan-2-yl]-2-hydroxyethyl (9Z)-octadec-9-enoate | ||
133855-98-8 | Epoxiconazole | rel-1-{[(2R,3S)-3-(2-chlorophenyl)-2-(4-fluorophenyl)oxiran-2-yl]methyl}-1H-1,2,4-triazole | 2934.99 | 8 |
13390-47-1 | Acid yellow 38 | 3204.12 | ||
13397-24-5 | Gypsum | Calcium sulfate | 2520.01 | |
13397-26-7 | Calcite | Calcium carbonate | 2530.9 | |
13400-13-0 | Cesium fluoride | Cesium fluoride | 2826.19 | |
134-03-2 | Sodium L-ascorbate | Sodium ascorbate | ||
134-04-3 | Pelargonidin chloride | 3203 | ||
1340-68-7 | Bentone | 3802.9 | ||
13408-09-8 | Sodium beta-glycerophosphate pentahydrate | Beta-glycerophosphoric acid disodium salt, pentahydrate | 2919.9 | |
134-09-8 | Menthyl anthranilate | Menthyl anthranilate | 2922.43 | |
134098-61-6 | Fenpyroximate | Tert-butyl 4-[({[(E)-(1,3-dimethyl-5-phenoxy-1H-pyrazol-4-yl)methylidene]amino}oxy)methyl]benzoate | 2933.19 | 8 |
13412-64-1 | Dicloxacillin sodium | Dicloxacillin sodium salt monohydrate | 2941.1 | 6 |
1341-36-2 | Melilotine | 2,3-Dihydrochromen-4-one | 2932.2 | |
1341-49-7 | Ammonium bifluoride | Azane; dihydrofluoride | 2826.19 | 3 |
13419-61-9 | Sodium decane-1-sulfonate; 1-decanesulfonic acid sodium salt | Sodium decane-1-sulphonate | 2904.1 | |
13419-67-5 | Ammonium thiolactate | Ammonium 2-mercaptopropionate | 2930.9 | |
134-20-3 | Methyl anthranilate ; Fragrance of methyl anthranilate | 2-Aminobenzoic acid, methyl ester | ||
13421-13-1 | 4-Chloro-2-iodobenzoic acid | 4-Chloro-2-iodobenzoic Acid | 2916.39 | |
13422-55-4 | Mecobalamin | Cobalt(3+) ion (6Z)-4,9,14-tris(2-carbamoylethyl)-3,8,19-tris(carbamoylmethyl)-18-{2-[(2-{[5-(5,6-dimethyl-1H-1,3-benzodiazol-1-yl)-4-hydroxy-2-(hydroxymethyl)oxolan-3-yl phosphonato]oxy}propyl)carbamoyl]ethyl}-2,3,6,8,13,13,16,18-octamethyl-20,21,22,23-t | 2936.26 | 6 |
13426-91-0 | Cupriethylenediamine | Copper;2-azanidylethylazanide | 2942 | 8 |
134-28-1 | Guaiyl acetate | 2-[(3S,8S)-3,8-Dimethyl-1,2,3,4,5,6,7,8-octahydroazulen-5-yl]propan-2-yl acetate | 2918.23 | |
1342-90-1 | Aluminium lake | 3205 | ||
134-31-6 | Oxyquinoline sulfate | 8-Hydroxyquinoline sulfate | 2933.49 | 3 |
134-32-7 | Alpha naphthylamine | 1-Naphthalenamine | 2921.45 | |
13435-12-6 | N-(Trimethylsilyl)acetamide | N-Trimethylsilylacetamide | 2931.9 | |
1343-88-0 | Magnesium silicate ; Florisil | Magnesium silicate | ||
1343-88-0 40 | Magnesol | Magnesium dioxido(oxo)silane | 2839.9 | |
1343-93-7 | Phosphotungstic acid | Phosphoric acid; trioxotungsten | 2811.199 | |
1343-98-2 | Silicic acid ; Precipitated silica | Dihydroxysilanone | ||
1344-00-9 | Sodium aluminium silicate | Dialuminum; disodium; oxygen(2-); silicon(4+); hydrate | ||
1344-09-8 | Sodium silicate | Disodium; dioxido(oxo)silane; hydrate | ||
1344-28-1 | Aluminum oxide ; Calcined Alumina | Dialuminum oxygen(2-) | 3 | |
1344-37-2 | Pigment yellow 34 | 3207.1 | ||
1344-43-0 | Manganese Oxide | Manganese(2+); oxygen(2-) | 2820.9 | |
1344-54-3 | Titanium(III) oxide | Titanium(III) oxide | 3206.11 | |
13446-18-9 | Nitromagnesite | Magnesium dinitrate | 4 | |
13446-34-9 | Manganese(II) chloride tetrahydrate | Dichloromanganese; tetrahydrate | 2827.391 | |
1344-67-8 | Copper chloride | 3815.9 | ||
134-47-4 | 4-Hydroxy-7-[(5-hydroxy-7-sulfonaphthalen-2-yl)carbamoylamino]naphthalene-2-sulfonic acid | 4,4'-Dihydroxy-7,7'-ureylenedi(naphthalene-2-sulphonic acid) | 2924.21 | |
1344-95-2 | Calcium silicate | Calcium dioxido(oxo)silane | ||
1344-96-3 | Calcium silicate hydrate | Dicalcium;silicate;hydrate | 2839.9 | |
1345-04-6 | Antimony (III) sulphide | Sulfanylidene (sulfanylidene stibanylsulfanyl) stibane | 2830.9 | 2 |
1345-16-0 | Pigment blue 28 ; Cobalt blue | Cobal aluminate spinel | ||
1345-19-3 | Pigment blue 35 | Cobalt tin trioxide | 3204.17 | |
134523-03-8 | Atorvastatin calcium | (3R,5R)-7-[2-(4-fluorophenyl)-3-phenyl-4-(phenylcarbamoyl)-5-propan-2-ylpyrrol-1-yl]-3,5-dihydroxyheptanoic acid | 6 | |
1345-27-3 | Red Iron Oxide (C33-128) | Oxo(oxoferriooxy)iron | 2821.1 | |
13453-07-1 | Gold (III) chloride | Trichlorogold | 2843.3 | |
13454-96-1 | Platinum tetrachloride | Tetrachloroplatinum | 2827.39 | |
13455-21-5 | Potassium fluoride dihydrate | Potassium fluoride dihydrate | 2815.3 | |
13455-24-8 | Potassium hydrogen diiodate | Potassium; iodic acid; iodate | 2829.9 | |
13455-64-0 | Cobalt sulfate monohydrate | Cobalt(2+);sulfate;hydrate | 2833.29 | |
134-62-3 | N,N-Diethyl-m-toluamide | Diethyltoluamide | 2924.29 | 8 |
13463-41-7 | Zinc omadine | Zinc, bis[1-(hydroxy-.kappa.O)-2(1H)-pyridinethionato-.kappa.S2]-, (T-4)- | ||
13463-43-9 | Ferrous sulfate monohydrate | Iron(2+); sulfate; hydrate | 2833.29 | 6 |
13463-67-7 | Titanium dioxide | Dioxotitanium | ||
1346416-71-4 | FK 102 Co(III) PF6 salt | 2822 | ||
13465-27-5 | Manganese(II) sulfate pentahydrate | 2833.29 | ||
134678-17-4 | Lamivudine | Lamivudine | 2933.59 | 6 |
134-71-4 | Ephedrine hydrochloride | (1-Hydroxy-1-phenylpropan-2-yl)(methyl)azanium chloride | 2933.99 | 6 |
13472-08-7 | 2,2'-Azobis(2-methylbutyronitrile) | 2,2'-Azobis(2-methylbutyronitrile) | 2927 | |
13472-30-5 | Sodium orthosilicate | Tetrasodium;silicate | ||
13472-35-0 | Sodium dihydrogen phosphate dihydrate | Sodium;dihydrogen phosphate;dihydrate | 2835.22 | |
13472-36-1 | tetra-Sodium diphosphate decahydrate ; Fragrance of tetrasodium diphosphate | Sodium pyrophosphate decahydrate | ||
13472-45-2 | Sodium tungstate | Disodium;dioxido(dioxo)tungsten | ||
13472-47-4 | Metastannic acid | Dihydroxy(oxo)tin | 2825.9 | |
13473-26-2 | Solvent red 48 | 3204.9 | ||
13473-90-0 | Nitric acid | Aluminum; trinitrate; nonahydrate | 2834.29 | |
13475-82-6 | Isododecane | 2,2,4,6,6-Pentamethylheptane | ||
13477-34-4 | Calcium nitrate | Calcium; dinitrate; tetrahydrate | ||
13478-00-7 | Nickel(II) nitrate hexahydrate | Nickel(2+) dinitrate hexahydrate | ||
13478-10-9 | Iron(II) chloride tetrahydrate | Iron(2+) dichloride tetrahydrate | 2827.39 | |
13479-54-4 | Copper-glycinate | Bis(glycinato)copper | 2922.49 | |
134-81-6 | 1,2-Diphenylethane-1,2-dione | 1,2-Diphenylethane-1,2-dione | 2914.39 | |
134-84-9 | 4-Methylbenzophenone | 4-Methylbenzophenone | 2914.39 | |
134-85-0 | (4-Chlorophenyl)-phenylmethanone | 4-Chlorobenzophenone | 2914.7 | |
134900-46-2 | 1,6-Hexanediol, polymer with methanamine | Hexane-1,6-diol methanamine | 2921.29 | |
13494-06-9 | 3,4-Dimethylcyclopentane-1,2-dione | 3,4-Dimethylcyclopentane-1,2-dione | 2902.19 | |
13494-80-9 | Tellurium | Tellurium | ||
135-02-4 | 2-Methoxybenzaldehyde | 2-Methoxybenzaldehyde | 2912.49 | |
135-11-5 | 2-Nitro 4-amino diphenylamine 4-sulfonic acid | 4-[(4-Aminophenyl)amino]-3-nitrobenzene-1-sulfonic acid | 2922.29 | |
13517-24-3 | Sodium metasilicate nonahydrate | Disodium;dioxido(oxo)silane;nonahydrate | 2839.11 | |
135-19-3 | Naphthalen-2-ol | 2-Naphthol | 2907.15 | 3 |
135-20-6 | Ammonium N-nitrosophenylhydroxylamine | Ammonium 2-oxo-1-phenylhydrazinolate | 2928 | |
13520-92-8 | Zirconium(IV) oxide chloride octahydrate | Oxozirconium;octahydrate;dihydrochloride | 2827.49 | |
13530-50-2 | Aluminum dihydrogen phosphate | Aluminum dihydrogen phosphate | 2835.29 | |
13530-65-9 | Zinc chromate | Zinc chromate | 3208.1 | |
13530-68-2 | Chromic acid | Dichromic acid | 3402.9 | |
13532-18-8 | Methyl 3-(Methylthoi)propionate | Methyl 3-(methylsulfanyl)propanoate | 2930.2 | |
135410-20-7 | Acetamiprid | (1E)-N-[(6-chloropyridin-3-yl)methyl]-N'-cyano-N-methylethanimidamide | 2933.39 | 8 |
13548-38-4 | Chromium (III) nitrate | Chromium trinitrate | ||
135-51-3 | 2-Naphthol-3,6-disulfonic acid disodium salt | 3-Hydroxynaphthalene-2,7-disulfonic acid disodium salt | 2908.99 | |
13552-80-2 | Triundecanoin | Propane-1,2,3-triyl triundecanoate | 2915.9 | |
13557-75-0 | Sodium lauroyl lactylate | Sodium 2-(1-carboxylatoethoxy)-1-methyl-2-oxoethyl laurate | ||
135-57-9 | O,O'-dibenzamidodiphenyl disulfide | Bis(2-benzamidophenyl) disulfide | ||
135-61-5 | 3-Hydroxy-2-Naphtho-O-toluidide | 3-Hydroxy-2'-methyl-2-naphthanilide | 2924.29 | |
135-62-6 | 3-Hydroxy-2-naphth-O-anisidide | 3-Hydroxy-2'-methoxy-2-naphthanilide | 2924.29 | |
135-65-9 | 3-Hydroxy-3'-nitro-2-naphthanilide | 3-Hydroxy-3'-nitro-2-naphthanilide | 2924.29 | |
13566-03-5 | Palladium sulphate | Palladium(2+);sulfate | 2833.29 | |
135668-58-5 | Pigment yellow 195 | 3208.9 | ||
13568-40-6 | Dilithium molybdate | Dilithium dioxido(dioxo)molybdenum | ||
13568-45-1 | Lithium tunstate | Dilithium;dioxido(dioxo)tungsten | 2841.8 | |
13569-57-8 | Iridium(III) chloride trihydrate | Trichloroiridium;trihydrate | 2827.39 | |
13573-16-5 | Reinecke salt | Azanium; azane; chromium(3+); tetrathiocyanate | 2842.9 | |
135752-28-2 | Aluminum magnesium hydroxide carbonate | Magnesium;aluminum;carbonate;hydroxide | 2816.1 | |
135-77-3 | 1,2,4-Trimethoxybenzene | 1,2,4-Trimethoxybenzene | 2909.3 | |
13580-38-6 | 3-Prop-2-ynoxypropane-1,2-diol | 3-(Prop-2-yn-1-yloxy)propane-1,2-diol | 2909.19 | |
135852-26-5 | Tris-Acetate-EDTA buffer | 3824.9 | ||
135861-56-2 | 1,3:2,4-Bis(3,4-dimethylobenzylideno) sorbitol | 1,3:2,4-Bis-o-(3,4-dimethyl bezylidene)-D-sorbitol | 2905.44 | |
13586-82-8 | 2-ethylhexanoic acid, cobalt salt | 3815.9 | ||
13586-84-0 | Cobalt stearate | Cobalt stearate | 2915.7 | |
13588-28-8 | 2-(2-Methoxypropoxy)propan-1-ol | 2-(2-Methoxypropoxy)propan-1-ol | 2909.49 | |
135-88-6 | N-phenyl-2-naphthylamine | N-2-naphthylaniline | 2921.45 | |
13590-82-4 | Cerium(IV) sulfate | Cerium(4+);disulfate | 2846.1 | |
13598-36-2 | Phosphorous acid | Dihydrogen hydridotrioxophosphate(2−) | 2811.19 | 8 |
135-98-8 | Sec-butylbenzene | Butan-2-ylbenzene | 2926.9 | |
13600-98-1 | Sodium hexanitrocobaltate(III) | Trisodium; cobalt; hexanitrite | 2842.9 | |
13601-06-4 | Tetrammine palladium (II) sulphate | Azane; palladium(2+); sulfate | 2843.9 | |
13601-08-6 | Tetraamminepalladium(II) nitrate | 3815.9 | ||
136030-00-7 | (1R,2S)-1-amino-2,3-dihydro-1H-inden-2-ol | (1R,2S)-1-amino-2,3-dihydro-1H-inden-2-ol | 2922.19 | |
136107-94-3 | Annexin V | 3504 | ||
136210-30-5 | Aspartic acid, N,N-(methylenedi-4,1-cyclohexanediyl)bis-, tetraethyl ester | Diethyl 2-[[4-[[4-[(1,4-diethoxy-1,4-dioxobutan-2-yl)amino]cyclohexyl]methyl]cyclohexyl]amino]butanedioate | 2922.49 | |
13623-11-5 | 2,4,5-Trimethylthiazole | 2,4,5-Trimethyl-1,3-thiazole | 2934.1 | |
136-23-2 | Zinc dibutyl dithiocarbamate. | Zinc bis(dibutyldithiocarbamate) | ||
136-30-1 | Sodium dibutyldithiocarbamate | Sodium dibutyldithiocarbamate | ||
136-40-3 | Phenazopyridine hydrochloride | 3-Phenylazo-2,6-diaminopyridine monohydrochloride | 2942 | |
13641-96-8 | 2-Acryloyloxyethyl isocyanate | 2-Isocyanatoethyl prop-2-enoate | 2930.9 | |
136504-96-6 | 1,3-Propanediamine,N,N''-1,2-ethanediylbis-, polymer with 2,4,6-trichloro-1,3,5-triazine, reactionproducts with N-butyl-2,2,6,6-tetramethyl-4-piperidinamine | 3812.3 | ||
1365-19-1 | Linalool oxide | 6-Methyl-2-(oxiran-2-yl)hept-5-en-2-ol | 2932.19 | |
136-52-7 | Cobalt bis(2-ethylhexanoate) | Cobalt bis(2-ethylhexanoate) | 3815.9 | |
136-53-8 | Zinc octoate | Zinc 2-ethylhexanoate | ||
136-60-7 | Butyl Benzoate | Butyl benzoate | 2916.31 | |
13673-99-9 | (+/-)-3,4-Methylenedioxy-amphetamine hydrochloride | 1-(1,3-Benzodioxol-5-yl)propan-2-ylazanium;chloride | 2922.29 | |
13674-84-5 | Tris(2-chloro-1-methylethyl) phosphate | Tris(2-chloro-1-methylethyl) phosphate | ||
13676-54-5 | N,N'-4,4'-diphenylmethanebismaleimide | 1,1'-(Methylenedi-4,1-phenylene)bis(1H-pyrrole-2,5-dione) | ||
13676-91-0 | Solvent yellow 163 | 3204.19 | ||
136-77-6 | 4-Hexylbenzene-1,3-diol | 4-Hexylresorcin | 2907.29 | |
13678-67-6 | Difurfuryl sulfide | 2,2'-[Thiobis(methylene)]bisfuran | 2942 | |
13679-70-4 | 5-Methyl-2-thiophenecarboxaldehyde | 5-Methylthiophene-2-carbaldehyde | 2934.99 | |
13679-74-8 | 2-Acetyl-5-methylthiophene | 2-Acetyl-5-methylthiophene | 2934.99 | |
13682-32-1 | 5-Methyl-2-phenylimidazole-4-methanol | (5-methyl-2-phenyl-1H-imidazol-4-yl)methanol | 2933.29 | |
136-85-6 | Tolutriazole | 5-Methyl-2H-benzotriazole | 2933.99 | |
136920-08-6 | Cocamidopropyl PG-dimonium chloride | Cocamidopropyl PG-dimonium chloride | 2923.9 | |
136954-25-1 | Fragrance of 3-(acetylthio)hexyl acetate | 3302.1 | ||
136-95-8 | 2-Amino benzothiazole | 2-Aminobenzothiazole | 2934.2 | |
137-00-8 | 4-Methyl-5-thiazoleethanol ; Fragrance of sulfurol | 2-(4-methylthiazol-5-yl)ethanol | ||
13701-59-2 | Barium metaborate | Barium(2+); oxido(oxo)borane | 2840.2 | |
13701-64-9 | Calcium borate | Calcium; oxido(oxo)borane | 2840.2 | |
137-05-3 | Methyl cyanoacrylate | Methyl 2-cyanoprop-2-enoate | 3506.91 | |
13708-12-8 | 5-Methyl quinoxaline ; Fragrance of 5-methylquinoxaline | |||
137-08-6 | Calcium D-pantothenate | Calcium bis(3-[(2R)-2,4-dihydroxy-3,3-dimethylbutanamido]propanoate) | ||
13708-85-5 | Sodium phosphite dibasic pentahydrate | Sodium phosphonate pentahydrate | 2835.22 | |
13709-46-1 | Praseodymium(III) fluoride | Trifluoropraseodymium | 2846.9 | |
137-09-7 | 2,4-Diaminophenol dihydrochloride | 4-Hydroxy-1,3-phenylendiammoniumdichlorid | 2922.29 | |
13710-19-5 | Tolfenamic acid | N-(3-Chloro-2-methylphenyl)anthranilic Acid | 2922.49 | |
137-16-6 | N-lauroylsarcosine sodium salt | 2-[Dodecanoyl(methyl)amino]acetic acid; sodium | ||
13717-00-5 | Magnesium carbonate heavy | Magnesium; carbonate | 2836.99 | |
13718-26-8 | Sodium metavanadate | Sodium; oxido(dioxo)vanadium | 2826.9 | |
13718-94-0 | Isomaltulose | (2R,3S,4S,5R,6S)-2-(hydroxymethyl)-6-[[(2R,3S,4S)-3,4,5-trihydroxy-5-(hydroxymethyl)oxolan-2-yl]methoxy]oxane-3,4,5-triol | 2940 | |
13721-39-6 | Sodium orthovanadate | Trisodium; trioxido (oxo)vanadium | 2841.9 | |
137234-62-9 | Voriconazole | (2R, 3S)-2-(2, 4-Difluorophenyl)-3-(5-fluoropyrimidin-4-yl)-1-(1H-1, 2, 4-triazol-1-yl)butan-2-ol | 2933.59 | |
137-26-8 | Thiram ; Tetramethylthiuram monosulfide | |||
137-29-1 | Copper(II) dimethyldithiocarbamate | Copper(2+) ion bis((dimethylcarbamothioyl)sulfanide) | 2930.2 | |
137-30-4 | Ziram | Bis[(dimethylcarbamothioyl)sulfanyl]zinc | ||
137-32-6 | 2-Methylbutan-1-ol | 2-Methylbutan-1-ol | 2905.19 | |
13732-62-2 | Morpholine p-toluenesulfonate | Morpholinium toluene-4-sulfonate | ||
137330-13-3 | Tilmicosin phosphate | Tilmicosin phosphate | 2941.9 | |
13739-02-1 | Diacerein | 4,5-diacetyloxy-9,10-dioxoanthracene-2-carboxylic acid | 2918.99 | 6 |
137398-54-0 | A mixture of: O,O-di(1-methylethyl)trithio-bis-thioformate; O,O-di(1-methylethyl)tetrathio-bis-thioformate; O,O-di(1-methylethyl)pentathio-bis-thioformate | 3812.1 | ||
137-40-6 | Sodium propionate | Sodium propanoate | 2915.5 | |
13746-66-2 | Potassium ferricyanide | Tripotassium;iron(3+);hexacyanide | 2837.2 | |
13746-96-8 | Neodymium(III) nitrate hydrate | 3824.9 | ||
1374859-51-4 | Amines, bis(hydrogenatedpalm-oil alkyl)hydroxy | 2928 | ||
13750-62-4 | 1-Benzyl-2-methyl-1H-imidazole | 1-Benzyl-2-methyl-1H-imidazole | 2933.29 | |
137-51-9 | Aniline 2,4 disulphonic Acid | 4-Aminobenzene-1,3-disulphonic acid | 2921.42 | |
13752-51-7 | N-oxydiethylenethiocarbamyl-N’-oxydiethylene sulfenamide | Morpholin-4-yl morpholine-4-carbodithioate | ||
13755-29-8 | Sodium tetrafluoroborate | Sodium;tetrafluoroborate | 2826.9 | |
13755-38-9 | Sodium nitroprusside, dihydrate | Disodium;iron(4+);nitroxyl anion;pentacyanide;dihydrate | 2837.2 | 8 |
137-58-6 | Lidocaine | Lidocaine | 2924.29 | 6 |
13759-83-6 | Samarium(III) nitrate hexahydrate | Samarium(3+);trinitrate;hexahydrate | 2846.9 | |
13765-26-9 | Gandolinium(III) fluoride | Trifluorogadolinium | 2846.9 | |
137658-79-8 | 2-(4,6-Bis(2,4-dimethylphenyl)-1,3,5-triazin-2-yl)-5-(3-((2-ethylhexyl)oxy)-2-hydroxypropoxy)-phenol | 6-[2,6-Bis(2,4-dimethylphenyl)-1H-1,3,5-triazin-4-ylidene]-3-[3-(2-ethylhexoxy)-2-hydroxypropoxy]cyclohexa-2,4-dien-1-one | 2933.69 | |
137-66-6 | Ascorbyl palmitate | [(2S)-2-[(2R)-3,4-Dihydroxy-5-oxo-2H-furan-2-yl]-2-hydroxyethyl] hexadecanoate | 2936.27 | |
13770-89-3 | Nickel sulfamate | Nickel bis(sulphamidate) | ||
13775-53-6 | Sodium hexafluoroaluminate | Aluminum; trisodium; hexafluoride | 2826.3 | |
13775-80-9 | Hydrazine monohydrobromide | Hydrazine;hydrobromide | 2825.1 | 6 |
137862-53-4 | Valsartan | (2S)-3-Methyl-2-[pentanoyl-[[4-[2-(2H-tetrazol-5-yl)phenyl]phenyl]methyl]amino]butanoic acid | 2933.99 | 6 |
137-88-2 | Amprolium hydrochloride | 1-[(4-Amino-2-propylpyrimidin-5-yl)methyl]-2-methylpyridin-1-ium chloride hydrochloride | 2933.59 | |
138067-74-0 | Acid blue 350 | 3204.12 | ||
138112-76-2 | Agomelatine | N-[2-(7-Methoxynaphthalen-1-yl)ethyl]acetamide | 2933.49 | |
13814-96-5 | Lead fluoborate | Lead(2+);ditetrafluoroborate | 2826.9 | |
13815-17-3 | Palla-assit | Azane;dichloropalladium | 2843.9 | |
138-15-8 | L-(+)-Glutamic acid hydrochloride | Glutamic acid hydrochloride | 2922.42 | |
138199-71-0 | Levofloxacin hemihydrate | (-)-(S)-9-Fluoro-2,3-dihydro-3-methyl-10-(4-methyl-1-piperazinyl)-7-oxo-7H-pyridol[1,2,3-de]-1,4-benzoxazine-6-carboxylic acid hemihydrate | 2934.99 | |
13820-53-6 | Sodium tetrachloropalladate(II | Disodium; tetrachloro palladium(2-) | 2843.9 | |
13822-56-5 | 3-Aminopropyltrimethoxysilane | 3-(Trimethoxysilyl)-1-propanamine | ||
13825-74-6 | Titanium(IV) oxysulfate | Oxotitanium ; Sulfuric acid | 2833.29 | |
138261-41-3 | Imidacloprid | N-[1-[(6-Chloropyridin-3-yl)methyl]-4,5-dihydroimidazol-2-yl]nitramide | 8 | |
13826-56-7 | Potassium magnesium sulfate | Dimagnesium dipotassium trisulfate | 3104.9 | 4 |
13826-83-0 | Ammonium tetrafluoroborate | Ammonium tetrafluoroboranuide | 2826.9 | |
13828-37-0 | Cis-4-(isopropyl)cyclohexanemethanol | (4-propan-2-ylcyclohexyl)methanol | 2906.19 | |
13832-70-7 | Stearyl glycyrrhetinate | Octadecyl (2S,4aS,6aR,6aS,6bR,8aR,10S,12aS,14bR)-10-hydroxy-2,4a,6a,6b,9,9,12a-heptamethyl-13-oxo-3,4,5,6,6a,7,8,8a,10,11,12,14b-dodecahydro-1H-picene-2-carboxylate | 3823.7 | |
138402-11-6 | Irbesartan | 2-Butyl-3-[[4-[2-(2H-tetrazol-5-yl)phenyl]phenyl]methyl]-1,3-diazaspiro[4.4]non-1-en-4-one | 2933.99 | 6 |
1384257-92-4 | 4-Hydroxy-cyclohexanecarboxylic acid butyl ester | 4-Hydroxy-cyclohexanecarboxylic acid butyl ester | 2918.19 | |
13845-36-8 | Potassium tripolyphosphate | Pentapotassium;[oxido(phosphonatooxy)phosphoryl] phosphate | ||
138495-42-8 | 1,1,1,2,2,3,4,5,5,5-Decafluoropentane | 1,1,1,2,2,3,4,5,5,5-Decafluoropentane | 2903.39 | 8 |
138517-61-0 | (R,R)-Dach-phenyl trost ligand | 2-Diphenylphosphanyl-N-[(1R,2R)-2-[(2-diphenylphosphanylbenzoyl)amino]cyclohexyl]benzamide | 2931.9 | |
138-52-3 | Salicin | (2R,3S,4S,5R,6S)-2-(hydroxymethyl)-6-[2-(hydroxymethyl)phenoxy]oxane-3,4,5-triol | ||
138-59-0 | Shikimic acid | 3,4,5-Trihydroxycyclohex-1-ene-1-carboxylic acid | 2942 | |
13870-28-5 | Disodium disilicate | Disodium dioxybis(oxosilanolate) | 3402.19 | |
13870-30-9 | Sodium trisilicate | Disodium;dioxido(oxo)silane | 2839.19 | |
1387636-35-2 | Dihydroxy methylchromonyl palmitate | (5-Hydroxy-2-methyl-4-oxochromen-7-yl) hexadecanoate | 2932.99 | |
13877-91-3 | 3,7-Dimethyl-1,3,6-octatriene; ocimene | 3,7-Dimethylocta-1,3,6-triene | 2901.29 | |
138786-67-1 | Pantoprazole sodium | 5-(Difluoromethoxy)-2-[[3,4-dimethoxy-2-pyridinyl)methyl]sulfinyl]-1H-benzimidazole sodium salt sesquihydrate | 2933.99 | |
138-85-2 | 4-(Hydroxymercuri)benzoic acid sodium salt | Sodium;(4-carboxylatophenyl)mercury;hydrate | 2852.1 | |
138-86-3 | Limonene | 1-methyl-4-(prop-1-en-2-yl)cyclohexene | 3 | |
138879-94-4 | 1,2-Ethanediaminium, N1,N2-bis[2-[bis(2-hydroxyethyl)methylammonio]ethyl]-N1,N2-bis(2-hydroxyethyl)-N1,N2-dimethyl-,chloride | 2-[Bis(2-hydroxyethyl)-methylazaniumyl]ethyl-[2-[2-[bis(2-hydroxyethyl)-methylazaniumyl]ethyl-(2-hydroxyethyl)-methylazaniumyl]ethyl]-(2-hydroxyethyl)-methylazanium;tetrachloride | 2923.9 | |
138-89-6 | N,N-Dimethyl-4-nitrosoaniline | N,N-Dimethyl-4-nitrosoaniline | 2921.42 | |
138926-19-9 | Ibandronate sodium | Sodium hydrogen [1-hydroxy-3-[methyl(pentyl)amino]-1-phosphonopropyl]phosphonate monohydrate | 2920.9 | |
139-05-9 | Sodium cyclamate ; Fragrance of sodium cyclamate | Sodium cyclamate | 6 | |
1390-65-4 | Carmine | 3,5,6,8-tetrahydroxy-1-methyl-9,10-dioxo-7-[3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]-9,10-dihydroanthracene-2-carboxylic acid | ||
139-08-2 | Benzyldimethyltetradecylammonium chloride | Benzyl(tetradecyl)dimethylammonium chloride | 2923.9 | |
139-12-8 | Aluminum acetate | Hydroxyalumanebis(ylium) diacetate | 2915.29 | |
139-13-9 | Nitrilotriacetic acid | Nitrilotriacetic acid | 2922.49 | |
139177-64-3 | Erbium(III) trifluoromethanesulfonate | Erbium(3+);trifluoromethanesulfonate | 2846.9 | |
1392-21-8 | Kitasamycin | 2-[(11E,13Z)-6-[(3R,4R,5S,6R)-5-[(4S,5R,6R)-4,5-Dihydroxy-4,6-dimethyloxan-2-yl]oxy-4-(dimethylamino)-3-hydroxy-6-methyloxan-2-yl]oxy-4,10-dihydroxy-5-methoxy-9,16-dimethyl-2-oxo-1-oxacyclohexadeca-11,13-dien-7-yl]acetaldehyde | 2941.9 | 6 |
1392221-69-0 | FK 102 Co(II) PF6 salt | ไม่พบข้อมูล | 2822 | |
13922-41-3 | Naphthalene-1-boronic acid | 1-Naphthaleneboronic acid | 2931.9 | |
13925-00-3 | Fragrance of 2-Ethylpyrazine | 3302.1 | ||
13925-07-0 | 2-Ethyl-3,5-dimethylpyrazine | 2-Ethyl-3,5-dimethylpyrazine | 2933.11 | |
13927-77-0 | Nickel dibutyldithiocarbamate | N,N-Dibutylcarbamodithioate;nickel(2+) | ||
139-33-3 | Ethylenediamine tetraacetic acid, di-sodium salt | Dinatriumhydogenethylendiaminacetat | ||
13933-31-8 | Tetraamminepalladium(II) chloride monohydrate | |||
13936-21-5 | 2-Pentylanthracene-9,10-dione | 2-(2-Methylbutan-2-yl)-9,10-dihydroanthracene-9,10-dione | 2914.69 | |
1393-63-1 | Natural orange 4 | (2E,4E,6E,8E,10E,12E,14E,16Z,18E)-4,8,13,17-tetramethylicosa-2,4,6,8,10,12,14,16,18-nonaenedioic acid | 3203 | |
13939-25-8 | Aluminium dihydrogen triphosphate | Aluminum (oxido-phosphonatooxy-phosphoryl) phosphate | ||
13940-38-0 | Sodium (para)periodate | Trisodium;dihydroxy-trioxido-oxo-$l^{7}-iodane | 2829.9 | |
139-44-6 | Trihydroxystearin | 2,3-Bis(12-hydroxyoctadecanoyloxy)propyl 12-hydroxyoctadecanoate | 2938.9 | |
13952-84-6 | Sec-butylamine | Butan-2-amine | 2921.19 | 3 |
13956-29-1 | Cannabidiol | 2-[(1R,6R)-3-Methyl-6-prop-1-en-2-ylcyclohex-2-en-1-yl]-5-pentylbenzene-1,3-diol | 9 | |
13963-57-0 | Aluminum acetylacetonate | Aluminium acetylacetonate | 2942 | |
13965-03-2 | Bis(triphenylphosphine)palladium(II) dichloride | Dichloropalladium; triphenylphosphane | 2843.9 | |
139653-55-7 | Tetrahexadecylammonium bromide | Tetrahexadecylazanium;bromide | 2923.9 | |
13967-50-5 | Gold (I) potassium cyanide | Potassium; gold(3+); tetrathiocyanate | 2843.3 | 8 |
1397-89-3 | Amphotericin B | (1R,3S,5R,6R,9R,11R,15S,16R,17R,18S,19E,21E,23E,25E,27E,29E,31E,33R,35S,36R,37S)-33-[(3-amino-3,6-dideoxy-β-D-mannopyranosyl)oxy]-1,3,5,6,9,11,17,37-octahydroxy-15,16,18-trimethyl-13-oxo-14,39-dioxabicyclo[33.3.1]nonatriaconta-19,21,23,25,27,29,31-heptaen | 3821 | 6 |
1397-89-3 | Amphotericin B trihydrate | (1S,3R,4E,6E,8E,10E,12E,14E,16E,18S,19R,20R,21S,25R,27R,30R,31R,33S,35R,37S,38R)-3-[(2R,3S,4S,5S,6R)-4-amino-3,5-dihydroxy-6-methyloxan-2-yl]oxy-19,25,27,30,31,33,35,37-octahydroxy-18,20,21-trimethyl-23-oxo-22,39-dioxabicyclo[33.3.1]nonatriaconta-4,6,8,10 | 3821 | |
13981-17-4 | Californium-252 | 2844.4 | 5 | |
13981-41-4 | Barium, isotope of mass 133 | Barium-133 | 2844.4 | 5 |
13981-50-5 | Cobalt-57 | Cobalt-57 | 2844.4 | 5 |
13983-17-0 | Wollatonite ; Calcium Metasilicate | Calcium;dioxido(oxo)silane | ||
13983-27-2 | Krypton | Krypton-85 | 2844.4 | 5 |
139-85-5 | 3,4-Dihydroxybenzaldehyde | 3,4-Dihydroxybenzaldehyde | 2912.49 | |
1398-61-4 | Chitin | 2922.49 | ||
139-88-8 | Sodium tetradecyl sulfate | Sodium;(7-ethyl-2-methylundecan-4-yl) sulfate | 2920.9 | |
139-89-9 | Trisodium HEDTA | Trisodium 2-(carboxylatomethyl(2-hydroxyethyl)amino)ethyliminodi(acetate) | 2922.49 | |
13991-08-7 | 1,2-Bis(diphenylphosphino)benzene | (2-Diphenylphosphanylphenyl)-diphenylphosphane | 2931.9 | 3 |
139-91-3 | Furaltadone | 5-(morpholin-4-ylmethyl)-3-[(E)-(5-nitrofuran-2-yl)methylideneamino]-1,3-oxazolidin-2-one | 2934.99 | |
139-96-8 | Triethanol amine lauryl sulfate | Dodecyl sulfate—2,2',2''-nitrilotriethanol (1:1) | 3402.11 | |
140-01-2 | Pentasodium diethylenetriaminepentaacetic acid | Pentasodium (carboxylatomethyl)iminobis(ethylenenitrilo)tetraacetate | ||
1400-61-9 | Nystatin | Octadeca-9,11,13,15-tetraenoic acid | 2941.9 | 6 |
1400-62-0 | Orcein | 2,8-bis(2,4-dihydroxy-6-methylanilino)-1,9-dimethyldibenzofuran-3,7-dione | 3203 | |
140-07-8 | Ethylenediamine Tetrathanol | 2-[2-[bis(2-hydroxyethyl)amino]ethyl-(2-hydroxyethyl)amino]ethanol | 2922.19 | |
140-10-3 | Trans-cinnamic acid | (2E)-3-Phenylacrylic acid | 2916.39 | |
140-11-4 | Benzyl acetate | (2E)-3-Phenylacrylic acid | 2915.39 | |
140114-63-2 | Pigment red 238 | 3204.17 | ||
1401-55-4 | Tannic acid ; Fragrance of tannic acid | Tannic acid | ||
1401-69-0 | Tylosin | (4R,5S,6S,7R,9R,11E,13E,15R,16R)-15-[[(6-Deoxy-2,3-di-O-methyl-β-D-allopyranosyl)oxy]methyl]-6-[[3,6-dideoxy-4-O-(2,6-dideoxy-3-C-methyl-α-L-ribo-hexopyranosyl)-3-(diethylamino)-β-D-glucopyranosyl]oxy]-16-ethyl-4-hydroxy-5,9,13-trimethyl-7(2-oxoethyl)oxac | 2941.9 | |
140-22-7 | 1,5-Diphenylcarbazide | 1,5-Diphenylcarbonohydrazide | 2928 | |
14024-18-1 | 2,4-Pentanedione iron(III) derivative | Iron acetylacetonate | 2914.19 | |
14024-56-7 | Magnesium acetylacetonate | Bis(2,4-pentanedionato)magnesium(II) | 2942 | |
14024-64-7 | 4-Hydroxypent-3-en-2-one;oxotitanium | Bis(2,4-pentanedionato)titanium(IV) Oxide | 2914.19 | |
14025-15-1 | Ethylenediaminetetraacetic acid, copper disodium complex | Copper disodium EDTA | 2922.49 | |
14025-21-9 | Zinc disodium EDTA | Disodium zinc 2-[2-[bis(carboxylatomethyl)amino]ethyl-(carboxylatomethyl)amino]acetate | ||
140-26-1 | Phenylethyl isovalerate | 3-Methlbutyric acid, 2-phenylethylester | 2915.6 | |
140-27-2 | Cinnamyl isovalerate | (2E)-3-Phenylprop-2-en-1-yl 3-methylbutanoate | 2915.6 | |
140-31-8 | N-Aminoethylpiperazine | 1-(2-Aminoethyl) piperazine | 2933.59 | |
140-39-6 | P-Cresyl acetate | 4-Methylbenzyl acetate | 2915.7 | |
14040-11-0 | Tungsten hexacarbonyl | Hexacarbonyltungsten | 2931.9 | |
14040-31-2 | Magnesium ascorbyl phosphate | 2936.27 | ||
140462-76-6 | Olopatadine hydrochloride | (Z)-11-[3-(Dimethylamino)propylidene]-6,11-dihydrodibenz[b,e]oxepin-2-acetic acid hydrochloride | 2932.99 | |
1404-88-2 | Tyrothricin | 3-[(3S,6R,8S,11S,13S,16S,19S,22S,25R,30aS)-19-(3-Aminopropyl)-3,6,25-tribenzyl-8-(carbamoylmethyl)-13-[(4-hydroxyphenyl)methyl]-22-(2-methylpropyl)-1,4,7,10,14,17,20,23,26-nonaoxo-16-(propan-2-yl)-triacontahydropyrrolo[2,1-f]1,4,7,10,13,16,19,22,25-nonaaz | 2941.9 | 6 |
1404-93-9 | Vancomycin | (1S,2R,18R,19R,22S,25R,28R,40R)-48-{[(2S,3R,4S,5S,6R)-3-{[(2S,4S,6S)-4-amino-5-hydroxy-4,6-dimethyloxan-2-yl]oxy}-4,5-dihydroxy-6-(hydroxymethyl)oxan-2-yl]oxy}-22-(carbamoylmethyl)-5,47-dichloro-2,18,32,35,37-pentahydroxy-19-[(2R)-4-methyl-2-(methylamino) | ||
14049-79-7 | Zinc hexacyanocobaltate ; Trizinc bis[hexacyanocobaltate(3-)] | 3815.19 | ||
1405-10-3 | Neomycin sulfate | Neomycin sulfate | 2941.9 | 6 |
1405-20-5 | Polymyxin B sulfate | 4-amino-2-[[2-[(4-amino-2-formamidobutanoyl)amino]-4-hydroxybutanoyl]amino]-N-[4,13,16-tris(2-aminoethyl)-7-benzyl-19-(2-hydroxyethyl)-10-(2-methylpropyl)-2,5,8,11,14,17,20-heptaoxo-3,6,9,12,15,18,21-heptazacyclotricos-1-yl]butanamide sulfuric acid | 6 | |
1405-41-0 | Gentamycin sulfate | Gentamicin sulfate | ||
1405-53-4 | Tylosin phosphate | (4R,5S,6S,7R,9R,11E,13E,15R,16R)-15-[[(6-Deoxy-2,3-di-O-methyl-ß-D-allo-pyranosyl)oxy]methyl]-6-[[3,6-dideoxy-4-O-(2,6-dideoxy-3-C-methyl-α-L-ribo-hexopyranosyl)-3-(dimethylamino)-ß-D-glucopyranosyl]oxy]-16-ethyl-4-hydroxy-5,9,13-trimethyl-7-(2-oxoethyl)o | 2941.9 | |
1405-69-2 | Avidin | |||
1405-87-4 | Bacitracin | Bacitracin | 2941.9 | |
1405-89-6 | Bacitracin zinc | Bacitracin zinc | 2941.9 | |
14059-33-7 | Pigment yellow 184 | 3204.17 | ||
1405-97-6 | Gramicidin | 2941.9 | 6 | |
1406-18-4 | Vitamin E ; Mixed tocopherols | (2R)-2,5,7,8-tetramethyl-2-[(4R,8R)-4,8,12-trimethyltridecyl]-3,4-dihydro-2H-1-benzopyran-6-ol | 6 | |
140-64-7 | Pentamidine isethionate | 1,5-Bis(p-amidinophenoxy)pentane bis(2-hydroxyethanesulfonate salt) | 2925.29 | 6 |
1406-66-2 | Tocopherols | (2R)-2,5,7,8-tetramethyl-2-[(4R,8R)-4,8,12-trimethyltridecyl]-3,4-dihydro-2H-1-benzopyran-6-ol; (2R)-2,5,8-trimethyl-2-[(4R,8R)-4,8,12-trimethyltridecyl]-3,4-dihydro-2H-1-benzopyran-6-ol; (2R)-2,7,8-trimethyl-2-[(4R,8R)-4,8,12-trimethyltridecyl]-3,4-dihyd | 2936.28 | |
140-67-0 | Estragole | 1-methoxy-4-prop-2-enylbenzene | 2909.3 | |
140681-55-6 | 1-Chloromethyl-4-fluoro-1,4-diazoniabicyclo[2.2.2]octane bis(tetrafluoroborate) | 1-(Chloromethyl)-4-fluoro-1,4-diazoniabicyclo[2.2.2]octane;ditetrafluoroborate | 2933.59 | |
14073-97-3 | Fragrance of L-Menthone | (2S,5R)-5-methyl-2-(propan-2-yl)cyclohexanone | 3301.25 | |
140-75-0 | 4-Fluorobenzylamine | (4-Fluorophenyl)methanamine | 2921.49 | |
14075-53-7 | Potassium tetrafluoroborate | |||
140876-11-5 | Reactive red 228 | 3204.16 | ||
140876-13-7 | Reactive yellow 138:1 | 3204.16 | ||
140876-15-9 | Reactive yellow 176 | 3204.16 | ||
140-88-5 | Ethyl acrylate | Ethyl 2-propenoate | 2916.12 | |
14089-52-2 | N-ethyl MDA ; MDE ; MDEA | (±)-N-ethyl-α-methyl-3,4-(methylenedioxy)phenethylamine | 2932.99 | 7 |
140-89-6 | Potassium ethyl xanthate | Potassium ethyl xanthogenate | 2930.9 | |
14097-03-1 | [2-[[4-[(2-chloro-4-nitrophenyl)azo]phenyl]ethylamino]ethyl]trimethylammonium | 3204.13 | ||
14099-01-5 | Pentacarbonylchlororhenium(I) | Pentacarbonylchlororhenium | 2931.9 | |
141-01-5 | Ferrous Fumarate ; Iron(II) fumarate | (E)-but-2-enedioate; iron(2+) | ||
14101-61-2 | Gamma-Tocotrienol | 2936.28 | ||
141-04-8 | Diisobutyl adipate | 1,6-Bis(2-methylpropyl) hexanedioate | 2917.12 | |
141-05-9 | Diethyl maleate | Diethyl (Z)-but-2-enedioate | 2917.19 | |
141112-29-0 | Isoxaflutole | (5-cyclopropylisoxazol-4-yl)[2-(methylsulfonyl)-4-(trifluoromethyl)phenyl]methanone | 2934.99 | 8 |
141-12-8 | Neryl acetate | (2E)-3,7-Dimethylocta-2,6-dien-1-yl acetate | 2915.39 | |
14113-05-4 | 10-Hydroxy-2-decenoic acid | (2E)-10-Hydroxydec-2-enoic acid | 2918.19 | |
14116-06-4 | 4-MTA ; 4-methylthioamphetamine | α-methyl-4-methylthio phenethylamine | 2930.9 | 7 |
141-17-3 | Dibutoxyethoxyethyl adipate | Dibutyldiglycol adipate | ||
141-22-0 | Ricinoleic acid | 12-hydroxyoctadec-9-enoic acid | 3823.19 | |
141-28-6 | Diethyl adipate | Diethyl hexanedioate | 2917.12 | |
141-32-2 | Butyl acrylate | Butyl prop-2-enoate | 3 | |
14133-76-7 | Technetium-99 | Technetium-99 | 2844.4 | 5 |
141-43-5 | Ethanolamine | 2-Aminoethanol | 2922.11 | 3 |
1414-45-5 | Nisin | |||
141464-42-8 | Decyl Glucoside | 3402.13 | ||
141517-21-7 | Trifloxystrobin | 3808.92 | 8 | |
141-53-7 | Sodium formate | Sodium formate | ||
14154-42-8 | Aluminum phthalocyanine chloride | 3212.9 | ||
1415-73-2 | Aloin | (R)-10-β-D-Glucopyranosyl-1,8-dihydroxy-3-(hydroxymethyl)anthracen-9(10H)-one | 2932.99 | |
14158-31-7 | Iodine-125 | Iodine-125 | 2844.4 | 5 |
1415-93-6 | Humic acids | |||
141615-27-2 | 2-Hydroxypropylmethylcellulose stearoxy ether | 3812.3 | ||
14168-73-1 | Magnesium sulfate monohydrate | Magnesium;sulfate;hydrate | ||
141773-73-1 | Dimethylcyclohexylethoxy isobutylpropanoate | [2-[1-(3,3-dimethylcyclohexyl)ethoxy]-2-methylpropyl] propanoate | 2915.5 | |
141-78-6 | Ethyl acetate ; Fragrance of ethyl acetate | Ethyl acetate | ||
141-79-7 | 4-Methylpent-3-en-2-one | 4-Methylpent-3-en-2-one | 2914.19 | 3 |
141-82-2 | Malonic acid | 1,3-Propanedioic acid | 2917.19 | |
141-86-6 | 2,6-Diaminopyridine | 2,6-Diaminopyridine | 2933.39 | |
14187-31-6 | 1,1′-Diethyl-2,2′-dicarbocyanine iodide | 1-Ethyl-2-[5-(1-ethyl-2(1H)-quinolylidene)penta-1,3-dienyl]quinolinium iodide | 2933.49 | |
141-93-5 | 1,3-Diethylbenzene | 1,3-Diethylbenzene | 2902.9 | |
141-95-7 | Sodium malonate dibasic | Disodium propanedioate | 2917.19 | |
141-97-9 | Ethyl acetoacetate | 1-Ethoxybutane-1,3-dione | 2918.3 | |
1420-04-8 | Niclosamide ethanolamine salt | 2-aminoethanol 5-chloro-N-(2-chloro-4-nitrophenyl)-2-hydroxybenzamide | 2924.29 | 8 |
142-03-0 | Aluminium acetate,basic | Aluminium hydroxide diacetate | 2915.29 | |
142-04-1 | Aniline hydrochloride | Aniline hydrochloride | 2921.41 | |
142-16-5 | Bis(2-ethylhexyl) maleate | Bis(2-ethylhexyl) (Z)-but-2-enedioate | 2917.19 | |
142-18-7 | Glyceryl laurate | Glycerolmonolaurate | 2915.9 | |
142-19-8 | Allyl heptanoate | 2-Propenyl heptanoate | 2916.14 | |
1422-07-7 | Codeine Hydrochloride | (4R,4aR,7S,7aR,12bS)-9-methoxy-3-methyl-2,4,4a,7,7a,13-hexahydro-1H-4,12-methanobenzofuro[3,2-e]isoquinoline-7-ol hydrochloride | 2933.99 | 9 |
14221-01-3 | Tetrakis(triphenylphosphine)palladium | Palladium;triphenylphosphane | 2843.9 | |
142-22-3 | Allyl diglycol carbonate | 2,5,8,10-Tetraoxatridec-12-enoic acid, 9-oxo-, 2-propen-1-yl ester | 2930.9 | |
14222-60-7 | Prothionamide | Prothionamide | 2922.19 | |
142-31-4 | Sodium-n-octyl sulfate | Octyl sulfate, sodium salt | 2920.9 | |
14233-37-5 | Solvent blue 36 | 1,4-bis(isopropylamino) anthraquinone | 3204.9 | |
1423-60-5 | 3-Butyn-2-one | 3-Butyn-2-one | 2942 | |
142-45-0 | Acetylenedicarboxylic Acid | Acetylenedicarboxylic acid | 2917.19 | |
14246-53-8 | Capryloyl glycine ; N-(1-oxooctyl)glycine | Capryloylglycin | ||
142-47-2 | L-Glutamic acid monosodium salt hydrate | Monosodium glutamate | 2922.42 | |
142-61-0 | Hexanoyl chloride | 1-Pentanecarbonyl chloride | 2915.9 | |
142-62-1 | Hexanoic acid | 1-Hexanoic acid | 2915.9 | |
142-63-2 | Piperazine Hexahydrate | Piperazine hexahydrate | 2933.59 | |
14263-59-3 | Potassium gold(III) cyanide | Potassium; gold(3+); tetracyanide | 2843.3 | |
142-64-3 | Piperazine dihydrochloride | Piperazine dihydrochloride | 2933.59 | |
14265-44-2 | Phosphate | Phosphate | 2922.49 | |
142-68-7 | Tetrahydropyran | Tetrahydropyran | 2933.99 | |
142-71-2 | Cupric acetate ; Copper(II) acetate | Copper;diacetate | ||
142-72-3 | Magnesium acetate | Magnesium (di-)acetate tetrahydrate | 2915.29 | |
142-73-4 | Iminodiacetic acid | 2-(Carboxymethylamino)acetic acid | 2922.49 | |
14273-90-6 | Methyl 6-bromohexanoate | Methyl 6-bromohexanoate | 2915.9 | |
142-75-6 | Propylene glycol monostearate | 2-Hydroxypropyl octadecanoate | 2915.9 | |
14281-77-7 | Manganese-glycinate | Carboxymethylazanide; manganese(2+) | 2922.49 | |
14281-83-5 | Zinc-glycine | Zinc bis(aminoacetate) | ||
142-82-5 | n-Heptane | Heptane | 3 | |
14282-91-8 | Hexaammineruthenium(III) chloride | Azane; ruthenium(3+); trichloride | 2843.9 | |
14283-07-9 | Lithium tetrafluoroborate | Lithium; tetrafluoroborate | 2826.9 | |
142-84-7 | Di-n-propylamin | Di-n-propylamin | 2921.19 | 3 |
14284-92-5 | Rhodium(III) acetylacetonate | Tris(2,4-pentanedionato)rhodium | 2931.9 | |
14285-68-8 | Dirhenium decacarbonyl | Decacarbonyldirhenium | 2931.9 | |
14286-02-3 | Diamminedinitroplatinum(II) | Diammineplatinum(II) nitrite | 3815.9 | |
142-87-0 | Sodium decyl sulfate | 3402.11 | ||
142-90-5 | Lauryl methacrylate | Dodecyl 2-methylprop-2-enoate | ||
142-91-6 | Isopropyl palmitate | Propan-2-yl hexadecanoate | ||
142-92-7 | Hexyl acetate ; Fragrance of hexyl acetate | Hexyl acetate | ||
1429-50-1 | Ethylenediamine tetra(methylene phosphonic acid) | Ethane-1,2-diylbis[nitrilobis(methylene)]]tetrakisphosphonic acid | 2931.9 | |
14302-13-7 | Pigment green 36 | 3204.17 | ||
14306-25-3 | Phytic acid sodium salt hydrate | Hexakis(dihydrogen phosphate) | 2919.9 | |
143-06-6 | 4,4'-Methylene bis cyclohexylamine carbamate | Hexamethylene diamine carbamate | ||
143-07-7 | Lauric acid ; Dodecanoic acid | Lauric acid | 2915.9 | |
143-08-8 | Nonan-1-ol | 1-Nonanol | 2905.19 | |
14314-42-2 | Water-18O | Oxidane | 2845.9 | |
143-14-6 | Undec-9-enal | (9E)-Undec-9-enal | 2912.19 | |
143-18-0 | Potassium oleate | 9-Octadecenoic acid (9Z)-, potassium salt | 2916.15 | |
143180-74-9 | Granzyme B | 2932.2 | ||
143-19-1 | Sodium nitroprusside ; Oleic acid sodium salt | Sodium; octadec-9-enoate | ||
143-22-6 | Triethylene Glycol Monobutyl Ether | 2-[2-(2-butoxyethoxy)ethoxy]ethanol | ||
14324-55-1 | Zinc diethyldithiocarbamate | Bis(dibutyldithiocarbamato)zinc | ||
143-24-8 | 2,5,8,11,14-Pentaoxapentadecane | Bis(2-(2-methoxyethoxy)ethyl) ether | 2909.49 | |
143-28-2 | Oleyl alcohol | (Z)-octadec-9-en-1-ol | 3823.7 | |
143-29-3 | 1-[2-[2-[2-(2-butoxyethoxy)ethoxymethoxy]ethoxy]ethoxy]butane | bis(2-(2-butoxyethoxy)ethoxy)methane | 3812.2 | |
1433-11-0 | (2H4)urea ; Urea-d4 | 3812.1 | ||
143314-17-4 | 1-Ethyl-3-methylimidazolium acetate | 1-Ethyl-3-methylimidazolium acetate | 2917.35 | |
143-33-9 | Sodium cyanide | Sodium; cyanide | 2837.11 | |
14338-82-0 | Methylene bis(butylthioglycolate) | Dibutyl 2,2'-(methylenedisulfanediyl)diacetate | 2942 | |
143390-89-0 | Kresoxim-methyl | 2928 | 8 | |
14344-48-0 | Ligand for labelling with 99mTc | (2R)-2-[2-[[(1R)-1-carboxy-2-sulfanylethyl]amino]ethylamino]-3-sulfanylpropanoic acid | 2845.9 | |
143491-57-0 | Emtricitabine | 4-Amino-5-fluoro-1-[(2R,5S)-2-(hydroxymethyl)-1,3-oxathiolan-5-yl]pyrimidin-2-one | 2934.99 | 6 |
14364-93-3 | Iodotrimethylplatinum(IV) | Carbanide;iodoplatinum | 2843.9 | |
143-66-8 | Sodium tetraphenylborate | Sodium;tetraphenylboranuide | ||
14367-46-5 | para-Methoxyethylamphetamine | N-Ethyl-1-(4-methoxyphenyl)propane-2-amine | 2924.19 | |
14371-10-9 | trans-3-Phenyl-2-propenal | (2E)-3-Phenylprop-2-enal | 2912.29 | |
1437281-01-0 | Synthetic Paraffins | 2710.19 | ||
143-74-8 | Phenol red | 3,3-Bis(4-hydroxyphenyl)-3H-2,1λ⁶-benzoxathiole-1,1-dione | ||
143824-78-6 | N-alpha-Fmoc-Nin-Boc-L-tryptophan | 1-[(1,1-Dimethylethoxy)carbonyl]-N-[(9H-fluoren-9-ylmethoxy)carbonyl]-L-tryptophan | 2933.99 | |
14392-02-0 | Chromium-51 | Chromium-51 | 2844.4019 | 5 |
143928-57-8 | Novelight TT | 2836.5 | ||
14402-67-6 | Potassium titanium oxide oxalate dihydrate | 2917.11 | ||
14402-88-1 | Ethylenediaminetetraacetic acid, magnesium disodium salt | Disodium [2,2',2'',2'''-(ethane-1,2-diyldinitrilo)tetraacetato(4-)]magnesate(2-) | ||
144-11-6 | Trihexyphenidyl | 1-Cyclohexyl-1-phenyl-3-(piperidin-1-yl)propan-1-ol | 2933.39 | |
14414-32-5 | Syringaldazine | 4-Hydroxy-3,5-dimethoxybenzaldehyde azine | 2928 | |
144-19-4 | 2,2,4-Trimethyl-1,3-pentanediol | 2,2,4-Trimethyl-1,3-pentanediol | 2905.39 | |
144245-85-2 | Alkyl Ketene Dimer (AKD) | 2-Oxetanone, 3-C12-16‐alkyl-4-C13-17-alkylidene derivertive | 3809.1 | |
144-29-6 | Piperazine citrate | Tripiperazine dicitrate | 2933.59 | 6 |
14430-23-0 | 5,6-Dimethoxyindole | 5,6-Dimethoxy-1H-indole | 2933.99 | |
144314-88-5 | Sodium ferrous citrate | Sodium 2-hydroxypropane-1,2,3-tricarboxylate iron(2+) | 2918.15 | |
14433-76-2 | Decanamide, N,N-dimethyl | N,N-Dimethylcapramide | 2924.19 | |
14434-22-1 | Sodium ferrocyanide | Tetrasodium; iron(2+); hexacyanide; decahydrate | 2837.2 | |
14436-32-9 | 9-Decenoic acid | Dec-9-enoic acid | 2916.19 | |
144-48-9 | Iodoacetamide | 2-Iodacetamid | 2924.19 | |
14450-07-8 | Dioleyl hydrogen phosphate | Bis[(Z)-octadec-9-enyl] hydrogen phosphate | 3823.7 | |
144538-83-0 | Iminodisuccinate sodium salt | Iminodisuccinic acid sodium salt | 2922.49 | |
1445-45-0 | Trimethyl orthoacetate | Trimethoxyethane | 2915.9 | |
144-55-8 | Sodium bicarbonate | Sodium;hydrogen carbonate | ||
1445-79-0 | Trimethylgallium | Trimethylgallium | 2931.9 | |
1445-91-6 | (1S)-1-phenylethanol | (1S)-1-phenylethanol | 2906.29 | |
14459-95-1 | Potassium hexacyanoferrate(II) trihydrate | Tetrapotassium; iron(2+); hexacyanide; trihydrate | 2837.2 | |
144-62-7 | Oxalic acid | Ethanedioic acid | 3 | |
14463-68-4 | β-Naphthyl phosphate monosodium salt | 2-Naphthyl phosphate monosodium salt | 2919.9 | |
14464-46-1 | Cristobalite | Dioxosilane | ||
14464-85-8 | Tocopherol Calcium Succinate | Calcium 4-oxo-4-[[(2R)-2,5,7,8-tetramethyl-2-[(4R,8R)-4,8,12-trimethyltridecyl]-3,4-dihydrochromen-6-yl]oxy]butanoate | 2936.28 | |
144-68-3 | Zeaxanthin | Zeaxanthin | 3204.19 | |
144689-63-4 | Olmesartan medoxomil | (5-Methyl-2-oxo-1,3-dioxol-4-yl)methyl 1-((2'-(2H-tetrazol-5-yl)biphenyl-4-yl)methyl)-4-(2-hydroxypropan-2-yl)-2-propyl-1H-imidazole-5-carboxylate | 2934.99 | 6 |
144701-48-4 | Telmisartan | 4'-(1,7'-Dimethyl-2'-propyl-1H-[2,5']bibenzoimidazolyl-3'-ylmethyl)-biphenyl-2-carboxylic acid | 2942 | 6 |
14475-63-9 | Zirconium(IV) hydroxide | Zirconium(4+);tetrahydroxide | 2825.9 | |
14476-16-5 | Siderite | Iron (2+) carbonate | 2601.11 | |
144768-02-5 | Chlorotolyloxypropionic acid polyglycol ester | 2918.99 | ||
144-82-1 | Sulfamethizole | Sulfamethizole | 2935 | |
14484-64-1 | Iron(III) dimethyldithiocarbamate | Ferbam | 8 | |
14484-69-6 | Potassium aluminium fluoride | Potassium;tetrafluoroalumanuide | 2826.19 | |
145017-98-7 | Reactive red 198 | 3204.16 | ||
145040-37-5 | Candesartan Cilexetil | Candesartan cilexetil | 2942 | 6 |
145224-94-8 | 2-Morpholinoethanesulfonic acid hydrate | 2-morpholin-4-ylethanesulfonic acid hydrate | 2934.99 | |
1453-82-3 | Isonicotinamide | Isonicotinamide | 2933.39 | |
145-42-6 | Taurocholic acid sodium salt | Sodium 2-[(4R)-4-[(1S,2S,5R,7S,9R,10R,11S,14R,15R,16S)-5,9,16-trihydroxy-2,15-dimethyltetracyclo[8.7.0.0²,⁷.0¹¹,¹⁵]heptadecan-14-yl]pentanamido]ethane-1-sulfonate | 2924.29 | |
1454266-19-3 | Ethylone hydrochloride | 1-(1,3-Benzodioxol-5-yl)-2-(ethylamino)propan-1-one;hydrochloride | 2932.99 | |
145-50-6 | alpha-Naphtholbenzein | 4-[(4-hydroxynaphthalen-1-yl)-phenylmethylidene]naphthalen-1-one | 2914.5 | |
14552-35-3 | Copper (II)- Ethylenediamine complex | Ethylenediamine copper(II) hydroxide | 2921.29 | |
145650-60-8 | Phosphorous acid, bis(2,4-bis(1,1-dimethylethyl)-6-methylphenyl) ethyl ester | Bis(2,4-di-tert-butyl-6-methylphenyl) ethyl phosphite | 2920.9 | |
14567-64-7 | Kieserite ; Magnesium sulphate monohydrate | Magnesium sulfuric acid hydrate | ||
145701-21-9 | Diclosulam | N-(2,6-dichlorophenyl)-5-ethoxy-7-fluoro[1,2,4]triazolo[1,5-c]pyrimidine-2-sulfonamide | 2935.9 | |
14586-35-7 | 2-Hydroxyethyl-trimethylammonium acetate | 2-Hydroxyethyl(trimethyl)azanium;acetate | 2923.1 | |
1459205-54-9 | Acetyl hexapeptide-46 | 3504 | ||
14596-10-2 | Americium-241 | Americium-241 | 2844.4 | 5 |
14596-37-3 | Phosphorus, isotope of mass 32 | Phosphane | 2844.4 | 5 |
1459-93-4 | Dimethyl Isophthalate | Dimethyl benzene-1,3-dicarboxylate | 2917.39 | |
1461-15-0 | Oftasceine ; Calcein | 2,2',2'',2'''-[(3',6'-dihydroxy-3-oxo-3H-spiro[2-benzofuran-1,9'-xanthene]-2',7'-diyl)bis(methanediylnitrilo)]tetraacetic acid | 3212.9 | 6 |
14611-52-0 | Selegiline hydrochloride | (2R)-N-methyl-1-phenyl-N-prop-2-ynylpropan-2-amine;hydrochloride | 2921.49 | |
1461-22-9 | Tributyltin chloride | Tributyltin chloride | 2931.2 | 13 |
14617-85-7 | 4-Nitrophenyl myristate | (4-nitrophenyl) tetradecanoate | 2915.9 | |
146-22-5 | Nitrazepam | 1,3-dihydro-7-nitro-5-phenyl-2H-1,4-benzodiazepin-2-one | 9 | |
146340-16-1 | Alcohols, C12-18, ethers with polyethylene glycol mono-Bu ether | 3402.13 | ||
14634-91-4 | Ferroin | Iron(2+) 1,10-phenanthroline sulfate | 2933.99 | |
14634-93-6 | Zinc ethylphenyl dithiocarbamate | Zinc ethylphenyl dithiocarbamate | ||
14639-25-9 | Chromium picolinate | Chromium picolinate | ||
1463-95-2 | 2-[2-[(5-Bromo-2-pyridyl)amino]vinyl]-1-ethyl-6-methylpyridinium iodide | 2-[(E)-2-[(5-Bromopyridin-2-yl)amino]ethenyl]-1-ethyl-6-methylpyridin-1-ium iodide | 2933.39 | |
14643-87-9 | 2-Propenoicacid,zincsalt | Zinc acrylate | ||
14644-61-2 | Zirconium(IV) sulfate | Zirconium; disulfatee | 2833.29 | |
14649-03-7 | (S)-(-)-Alpha-methylbenzyl isocyanate | [(1S)-1-Isocyanatoethyl]benzene | 2929.1 | |
1465-25-4 | N-(1-Naphthyl)ethylenediamine dihydrochloride | 2-(Naphthalen-1-ylamino)ethylazanium dihydrochloride | 2921.59 | |
14657-64-8 | 3-(hydroxyphenylphosphinyl)propanoic acid | 3-[hydroxy(phenyl)phosphoryl]propanoic acid | 3809.91 | |
14666-91-2 | Sodium molybdate | 3402.9 | ||
14667-55-1 | 2,3,5-Trimethyl pyrazine ; Fragrance of 2,3,5-trimethylpyrazine | 2,3,5-Trimethylpyrazine | ||
146-68-9 | Iodonitrotetrazolium chloride | 2-(4-iodophenyl)-3-(4-nitrophenyl)-5-phenyltetrazol-2-ium chloride | ||
1467-16-9 | Imidazole hydrochloride | 1H-Imidazole, monohydrochloride | 2933.29 | 6 |
146796-02-3 | Hydroxymethyl EDOT | 2,3-Dihydrothieno[3,4-b][1,4]dioxin-3-ylmethanol | 2934.99 | |
14680-77-4 | Potassium tetrakis(4-chlorophenyl)borate | Potassium tetrakis(p-chlorophenyl)borate(1-) | 2931.9 | |
146905-79-5 | Modified methylaluminoxane,type 4 | 3815.9 | ||
146-91-8 | Guanosine-5'-triphosphate | [(2R,3S,4R,5R)-5-(2-Amino-6-oxo-3H-purin-9-yl)-3,4-dihydroxyoxolan-2-yl]methyl phosphono hydrogen phosphate | 2934.99 | |
14694-69-0 | Iridium-192 | Iridium-192 | 2844.4 | 5 |
146958-06-7 | Formamidinium bromide | Aminomethylideneazanium bromide | 2501 | |
14698-29-4 | Oxolinic acid | 5,8-Dihydro-5-ethyl-8-oxo-1,3-dioxolo[4,5-g]quinoline-7-carboxylic acid | 2934.99 | |
146986-50-7 | (1R,4r)-4-((R)-1-Aminoethyl)-N-(pyridin-4-yl)cyclohexanecarboxamide | 4-[(1R)-1-Aminoethyl]-N-pyridin-4-ylcyclohexane-1-carboxamide | 2933.39 | |
147014-52-6 | Disperse red 367 | 3204.11 | ||
1470-61-7 | Silver diethyldithiocarbamate | Silver;N,N-diethylcarbamodithioate | 2843.29 | |
147098-20-2 | Rosuvastatin calcium | Rosuvastatin calcium | 2933.59 | 6 |
147-14-8 | Pigment blue 15 ; Copper Phthalocyanine | tetrabenzo-5,10,15,20-diazaporphyrinephthalocyanine | 3212.9 | |
147170-44-3 | 1-Propanaminium, 3-amino-N-(carboxymethyl)-N,N-dimethyl-, N-(C8-18 and C18-unsatd. acyl) derivs., inner salts | 3402.19 | ||
147-24-0 | Diphenhydramine Hydrochloride | Diphenhydramine hydrochloride | 2922.19 | |
14726-36-4 | Zinc dibenzyldithiocarbamate | Zinc bis(dibenzyldithiocarbamate) | ||
1473386-36-5 | Heptadecyl acrylate C17A | Heptadecyl (branched) acrylate | 2916.12 | |
147385-61-3 | Leupeptin trifluoroacetate | 2-Acetamido-N-[1-[[5-(diaminomethylideneamino)-1-oxopentan-2-yl]amino]-4-methyl-1-oxopentan-2-yl]-4-methylpentanamide;2,2,2-trifluoroacetic acid | 2925.29 | |
147-47-7 | 1,2-Dihydro-2,2,4-trimethylquinoline | 2,2,4-trimethyl-1H-quinoline | ||
14765-30-1 | 2-Butan-2-ylcyclohexan-1-one | 2-Butan-2-ylcyclohexan-1-one | 2914.29 | |
1476-53-5 | Novobiocin sodium salt | Novobiocin sodium | 2941.9 | |
147-71-7 | D-Tartaric acid | Tartaric acid | 2918.12 | |
147732-56-7 | Palmitoyl tripeptide-1 | 2933.29 | ||
147741-30-8 | Tetrabutylammonium hydroxide 30-hydrate | Tetrabutylazanium;hydroxide;triacontahydrate | 2923.9 | |
1477-50-5 | Indole-2-carboxylic acid | 1H-Indole-2-carboxylic acid | 2933.99 | |
1477-55-0 | m-Xylylenediamine | 1,3-Benzenedimethanamine | 2921.59 | |
147783-69-5 | Bis(1,2,2,6,6-pentamethyl-4-piperidinyl) 2-(4-methoxybenzylidene)malonate | Bis(1,2,2,6,6-pentamethyl-4-piperidinyl)2-(4-methoxy-benzylidene)malonate | 3812.3 | |
147-81-9 | Arabinose | (2R,3S,4S)-2,3,4,5-tetrahydroxypentanal | 2940 | |
147826-71-9 | Reactive blue 203 | 3204.16 | ||
14782-75-3 | Aluminum di(isopropoxide)acetoacetic ester chelate | Aluminium(3+) ion (1E)-1-ethoxy-3-oxobut-1-en-1-olate bis(propan-2-olate) | 3824.9 | |
14783-68-7 | Magnesium bisglycinate | Magnesium(2+) ion bis(2-aminoacetate) | 2922.49 | |
147-85-3 | Proline | (2S)-pyrrolidine-2-carboxylic acid | ||
147853-32-5 | C36 fatty diol | 2915.9 | ||
1478-61-1 | 4,4'-[2,2,2-trifluoro-1-(trifluoromethyl)ethylidene]diphenol | 4,4'-(1,1,1,3,3,3-hexafluoropropane-2,2-diyl)diphenol | 3812.1 | |
147-93-3 | Thiosalicylic acid | 2-Mercaptobenzoic acid | 2930.9 | |
14794-31-1 | Ethyl succinyl chloride | Ethyl 3-(chloroformyl)propionate | 2917.19 | |
148016-81-3 | Doripenem | (4R,5S,6S)-6-[(1R)-1-hydroxyethyl]-4-methyl-7-oxo-3-[(3S,5S)-5-[(sulfamoylamino)methyl]pyrrolidin-3-yl]sulfanyl-1-azabicyclo[3.2.0]hept-2-ene-2-carboxylic acid | 2941.9 | 6 |
14802-03-0 | 2-Ethylhexyl hydrogen -2-ethylhexylphosphonate | (2-Ethylhexyl)[(2-ethylhexyl)oxy]phosphinic acid | 2931.9 | |
14807-96-6 | Talcum ; Magnesium silicate | Dioxosilane oxomagnesium hydrate | 4 | |
14808-60-7 | Quartz | Dioxosilane | ||
14808-79-8 | Sulfate standard | Sulfate | 2807 | |
148-24-3 | 8-Hydroxyquinoline | 1-Azanaphthalene-8-ol | 2933.49 | |
14832-14-5 | Pigment green 7 | Copper, [1,2,3,4,8,9,10,11,15,16,17,18,22,23,24,25-hexadecachloro-29H,31H-phthalocyaninato(2-)-.kappa.N29,.kappa.N30,.kappa.N31,.kappa.N32]-, (SP-4-1)- | 3204.17 | |
1483-28-9 | 2,5-Dimethoxybenzenesulfonyl chloride | 2,5-Dimethoxybenzenesulfonyl chloride | 2909.3 | |
148462-57-1 | Propylene glycol monomethyl ether propionate (PMP) | 1-Methoxypropan-2-yl propanoate | 2915.5 | |
148504-34-1 | Calcein-AM | Calcein acetoxymethyl ester | 2932.2 | |
148-51-6 | 4-Deoxypyridoxine hydrochloride | 3-Hydroxy-5-(hydroxymethyl)-2,4-dimethylpyridin-1-ium chloride | 2933.39 | |
148553-50-8 | Pregabalin | Pregabalin | 2942 | 6 |
14857-34-2 | Ethoxy(dimethyl)silane | Ethoxydimethylsilan | 2910.9 | |
14858-73-2 | Diethylhexyl carbonate | Carbonic acid | 2915.9 | |
148641-02-5 | Interleukin - 3 | 3504 | 6 | |
14866-33-2 | Tetra-N-octylammonium bromide | Tetra octyl ammonium bromide | 2923.9 | |
148-79-8 | 2-(4-Thiazolyl)benzimidazole | Thiabendazole | 2934.1 | 8 |
148812-64-0 | Protein hydrolyzates,wheat, reaction products with lauroyl chloride, sodium salts | 3402.11 | ||
148819-93-6 | Carboxy-ptio sodium salt | 1,3-Dihydroxy-4,4,5,5-tetramethyl-2-(4-carboxyphenyl)tetrahydroimidazole | 2933.29 | |
14882-18-9 | Bismuth Subsalicylate | 2937.29 | ||
148849-67-6 | Ivabradine hydrochloride | 3-[3-[[(7S)-3,4-Dimethoxy-7-bicyclo[4.2.0]octa-1,3,5-trienyl]methyl-methylamino]propyl]-7,8-dimethoxy-2,5-dihydro-1H-3-benzazepin-4-one;hydrochloride | 2922.5 | |
148893-10-1 | 1-[Bis(dimethylamino)methylene]-1H-1,2,3-triazolo[4,5-b]pyridinium 3-oxid hexafluorophosphate | 1H-1,2,3-Triazolo(4,5-b)pyridinium, 1-(bis(dimethylamino)methylene)-, hexafluorophosphate(1-), 3-oxide | 2933.99 | |
1490-04-6 | Menthol | Cyclohexanol, 5-methyl-2-(1-methylethyl)- | 3302.1 | |
149022-20-8 | Adenosine 5′-monophosphate sodium salt | Disodium [(2R,3S,4R,5R)-5-(6-aminopurin-9-yl)-3,4-dihydroxyoxolan-2-yl]methyl phosphate;hydrate | 2934.99 | |
14919-77-8 | Benserazide hydrochloride | 2-Amino-3-hydroxy-N'-[(2,3,4-trihydroxyphenyl)methyl]propanehydrazide;hydrochloride | 2928 | 6 |
1492-18-8 | Leucovorin Calcium | Calcium (2S)-2-[[4-[(2-amino-5-formyl-4-oxo-1,6,7,8-tetrahydropteridin-6-yl)methylamino]benzoyl]amino]pentanedioate | 2936.29 | 6 |
1492-30-4 | 4-Nitrophenyl palmitate | 4-Nitrophenyl palmitate | 2915.7 | |
149-29-1 | Patulin | 4,6-Dihydro-4-hydroxy-2H-furo[3,2-c]pyran-2-one | 2941.9 | |
149-30-4 | Mercaptobenzothiazole | 3H-1,3-benzothiazole-2-thione | ||
14930-96-2 | Cytochalasin B | Cytochalasin B | 2922.49 | |
1493-13-6 | Trifluoromethanesulfonic acid | Trifluoromethanesulfonic acid | 2904.9 | |
149315-82-2 | Reactive blue 235 | 3204.16 | ||
149-32-6 | Erythritol | Erythritol | ||
1493-27-2 | 1-Fluoro-2-nitrobenzene | 1-Fluoro-2-nitrobenzene | 2904.9 | |
149330-25-6 | 2,6 Dihydroxyethylaminotoluene | 2-[3-(2-Hydroxyethylamino)-2-methylanilino]ethanol | 2922.19 | |
149358-73-6 | Chloramine T trihydrate | Chloramine T hydrate | 2933.99 | |
14937-32-7 | Pentagalloylglucose | [(2R,3R,4S,5R,6S)-3,4,5,6-tetrakis[(3,4,5-trihydroxybenzoyl)oxy]oxan-2-yl]methyl 3,4,5-trihydroxybenzoate | 2940 | |
14937-42-9 | Tetrakis (decyl) ammonium bromide | Tetra(decyl)ammonium bromide | 2923.9 | |
149-44-0 | Sodium formaldehyde sulfoxylate | Sodium;hydroxymethanesulfinate | 2831.1 | |
149458-07-1 | Fatty acids, C12-18, Me esters, sulfonated, sodium salts | 3402.11 | ||
149-57-5 | 2-Ethylhexanoic acid | Ethylhexanoic acid | ||
14960-06-6 | Sodium N-(2-carboxyethyl)-N-dodecyl-β-alaninate | 3402.9 | ||
149-64-4 | Hyoscine butylbromide | Butylscopolaminiumbromid | 2939.99 | 6 |
149647-78-9 | N'-hydroxy-N-phenyloctanediamide | Octanedioic acid hydroxyamide phenylamide | 2928 | |
14965-49-2 | Methylammonium iodide | Methanaminium iodide | ||
149-73-5 | Trimethyl orthoformate | Trimethoxymethane | 2915.9 | |
14976-8 | Coal, Bituminous | 2701.12 | ||
14976-80-8 | Chromium(II) acetate | 3204.11 | ||
14984-39-5 | D-Galacturonic acid sodium salt | Sodium;(2S,3R,4S,5R)-3,4,5,6-tetrahydroxyoxane-2-carboxylate | 2932.99 | |
14985-18-3 | Zirconium(IV) oxynitrate hydrate | Oxozirconium(2+);dinitrate;hydrate | 2825.6 | |
149861-22-3 | 2-Amino-5-ethylphenol hydrochloride | 2-Amino-5-ethylphenol;hydrochloride | 2922.29 | |
14986-84-6 | Sodium tetrapolyphosphate | Hexasodium;[oxido-[oxido(phosphonatooxy)phosphoryl]oxyphosphoryl] phosphate | 2835.39 | |
14987-04-3 | Magnesium trisilicate | Dimagnesium;dioxido-bis[[oxido(oxo)silyl]oxy]silane | 2816.1 | |
1498-88-0 | 1',3'-Dihydro-1',3',3'-trimethyl-6-nitrospiro[2H-1-benzopyran-2,2'-[2H]indole] | 1',3'-Dihydro-1',3',3'-trimethyl-6-nitrospiro[2H-1-benzopyran-2,2'-[2H]indole] | 2934.99 | |
14989-29-8 | Magnesium chloride | Magnesium dichloride | 2501 | |
149-91-7 | 3,4,5-Trihydroxybenzoic acid | 3,4,5-Trihydroxybenzoic acid | 2918.29 | |
1499-33-8 | Methyltriphenylarsonium iodide | Methyltriphenylarsonium iodide | 2931.9 | |
15000-59-6 | Basic blue 54 | 3204.9 | ||
150-13-0 | Para amino benzoic acid | 4-Amino-benzoic acid | 2922.49 | |
15022-08-9 | Diallyl carbonate | Diallyl carbonate | 2920.9 | |
15028-10-1 | 2-Oximino-1-indanone | 2-Oximino-1-indanone | 2928 | |
150-30-1 | DL-Phenylalanine | 2-Amino-3-phenylpropanoic acid | 2922.49 | |
150333-69-0 | N1-guanyl-1,7-diamine-heptane | 2-(7-Aminoheptyl)guanidine | 2925.29 | |
150-38-9 | EDTA trisodium salt | Trisodium hydrogen ethylenediaminetetraacetate | 2922.49 | |
150-39-0 | N-(2-Hydroxyethyl)ethylenediamine-N,N′,N′-triacetic acid | N-(2-Hydroxyethyl)ethylenediaminetriacetic acid | 2922.5 | |
1504588-00-4 | N-(2-Chlorobenzyl)-1-(2,5-dimethylphenyl)-1H-benzo[d]imidazole-5-carboxamide | N-[(2-Chlorophenyl)methyl]-1-(2,5-dimethylphenyl)benzimidazole-5-carboxamide | 2933.99 | |
1504-74-1 | 3-(2-Methoxyphenyl)prop-2-enal | (E)-3-(2-Methoxyphenyl)prop-2-enal | 2912.49 | |
1506-02-1 | Fixolide | 1-(3,5,5,6,8,8-Hexamethyl-6,7-dihydronaphthalen-2-yl)ethanone | 2942 | |
150-60-7 | Dibenzyl disulfide | Dibenzyl disulfide | 2930.9 | |
150683-30-0 | Tolvaptan | N-[4-(7-chloro-5-hydroxy-2,3,4,5-tetrahydro-1-benzazepine-1-carbonyl)-3-methylphenyl]-2-methylbenzamide | 2933.99 | |
150-76-5 | 4-Methoxyphenol | 4-Methoxyphenol | 2909.5 | |
150-78-7 | 1,4-Dimethoxybenzene | 1,4-Dimethoxybenzene | 2909.3 | |
150-83-4 | DL-B-Hydroxybutyric acid sodium salt | Sodium;3-hydroxybutanoate | 2918.19 | |
150-84-5 | Citronellyl acetate | 3,7 - Dimethyloct-6-en-1-yl acetate | 2915.39 | |
1508-65-2 | Oxybutynin chloride | 4-(Diethylamino)but-2-yn-1-yl 2-cyclohexyl-2-hydroxy-2-phenylacetate hydrochloride | 2922.5 | |
15086-94-9 | Solvent red 43 | 3204.12 | ||
150-90-3 | Disodium succinate | Disodium succinate | 2917.19 | |
15096-52-3 | Sodium cryolite | Trisodium;hexafluoroaluminum(3-) | 2826.3 | |
151006-60-9 | 1-Dodecene, polymer with 1-decene, hydrogenated | 3403.99 | ||
151030-83-0 | Dipentaerythrityl hexahydroxy stearate | 3404.9 | ||
15103-48-7 | 2-Pyridinesulfonic acid | 2-Pyridinesulfonic acid | 2933.39 | |
151-05-3 | Dimethylbenzylcarbinyl acetate | 1,1-Dimethyl-2-phenylethyl acetate | 2915.39 | |
151-21-3 | Sodium lauryl sulfate | Sodium dodecyl sulfate | ||
1513-66-2 | 2,3-Difluoropyridine | 2,3-Difluoropyridine | 2933.39 | |
151-50-8 | Potassium cyanide | Potassium;cyanide | ||
151-51-9 | Polycarbodiimide | Methanediimine | 2925.19 | |
1515-95-3 | 1-Ethyl-4-methoxybenzene | 1-Ethyl-4-methoxybenzene | 2909.3 | |
15164-44-0 | 4-Iodobenzaldehyde | 4-Iodobenzaldehyde | 2942 | |
15170-57-7 | Platinum(II) acetylacetonate | (Z)-4-oxopent-2-en-2-olate;platinum(2+) | 2843.9 | |
151756-26-2 | Carbocysteine Lysine Monohydrate | (2R)-2-amino-3-(carboxymethylsulfanyl)propanoic acid (2S)-2,6-diaminohexanoic acid hydrate | 2930.9 | |
151767-02-1 | Montelukast sodium | Montelukast sodium | 2930.9 | |
1517-69-7 | (1R)-1-phenylethanol | (1R)-1-phenylethanol | 2906.29 | |
151841-65-5 | Hydroxy aluminium bis(2,4,8,10-tetra-tert-butyl-6-hydroxy-12H-dibenzo[d,g][1.3.2]dioxaphosphocin-6-oxide) | Aluminum hydroxide bis(2,4,8,10-tetra-tert-butyl-12H-dibenzo[d,g][1,3,2]dioxaphosphocin-6-olate 6-oxide) | 3812.3 | |
151900-44-6 | 1,6-bis((dibenzylthiocarbamoyl)disulfanyl)hexane | 3812.1 | ||
15191-80-7 | Dicopper pyrophosphate | Dicopper pyrophosphate | 3402.9 | |
15206-55-0 | Methyl benzoylformate | Methyl benzoylformate | 2918.3 | |
152-11-4 | Verapamil hydrochloride | Verapamil hydrochloride | 2926.9 | |
152121-47-6 | 4-(4-Fluorophenyl)-2-(4-methylsulfinylphenyl)-5-(4-pyridyl)-1H-imidazole | 4-[4-(4-Fluorophenyl)-2-(4-methylsulfinylphenyl)-1H-imidazol-5-yl]pyridine | 2933.39 | |
15214-89-8 | 2-Acrylamido-2-methyl propane sulphonic acid ; acrylamido-tertiary-butylsulphonic acid | 2-Methyl-2-(prop-2-enoylamino)propane-1-sulfonic acid | 2904.9 | |
152165-67-8 | Disperse red 356 | 3204.11 | ||
1523-11-1 | Beta-naphthyl acetate | 2-Naphthyl acetate | 2915.39 | |
15231-44-4 | Dioctyltin | Dioctyltin | 2931.9 | |
15233-47-3 | N-( 1 -Methylhepty1)-N'-phenyl-p-phenylenediamine | 4-N-octan-2-yl-1-N-phenylbenzene-1,4-diamine | ||
15244-10-7 | Iron(III) sulfate | Carboxymethyl(phosphonomethyl)azanium | 2833.29 | |
15244-35-9 | Sulfuric acid | Cadmium(II) sulfate | 2833.29 | |
15244-38-9 | Chromic sulfate | Chromium(3+) trisulfate hydrate | 2833.29 | |
15245-12-2 | Calcium nitrate | Azanium calcium nitrate | 3102.9 | 4 |
152521-11-4 | Acid black 242 | 3204.12 | ||
15263-52-2 | Cartap hydrochloride | Cartap hydrochloride | 2930.2 | 8 |
152824-70-9 | Sodium 7-[2-(2-amino-1,3-thiazol-4-yl)pent-2-enoylamino]-3-(carbamoyloxymethyl)-8-oxo-5-thia-1-azabicyclo[4.2.0]oct-2-ene-2-carboxylate | Sodium 7-[2-(2-amino-1,3-thiazol-4-yl)pent-2-enoylamino]-3-(carbamoyloxymethyl)-8-oxo-5-thia-1-azabicyclo[4.2.0]oct-2-ene-2-carboxylate | 2941.9 | |
1530-32-1 | Ethyltriphenylphosphonium bromide | Ethyltriphenylfosfonium bromide | ||
15305-07-4 | N-Nitroso-N-phenylhydroxylamine aluminum salt | Aluminum N-oxido-N-phenylnitrous amide | 2928 | |
15307-79-6 | Diclofenac sodium | (2-(2,6-Dichloroanilino)phenyl)acetic acid sodium salt | 2922.49 | |
15307-81-0 | Diclofenac potassium | Diclofenac potassium | 2922.49 | |
153-18-4 | Rutin | 2-(3,4-dihydroxyphenyl)-5,7-dihydroxy-3-[(2S,3R,4S,5S,6R)-3,4,5-trihydroxy-6-[[(2R,3R,4R,5R,6S)-3,4,5-trihydroxy-6-methyloxan-2-yl]oxymethyl]oxan-2-yl]oxychromen-4-one | 2938.1 | |
15318-45-3 | Thiamphenicol | Thiamphenicol | 2941.9 | |
153197-14-9 | Oxaziclomefone | 3-[1-(3,5-dichlorophenyl)-1-methylethyl]-6-methyl-5-phenyl-2,3-dihydro-4H-1,3-oxazin-4-one | 2934.99 | 8 |
153277-35-1 |  9,10-Dihydro-9,10-dioxo-2-anthracenesulfonic acid sodium salt monohydrate ; Sodium anthraquinone-2-sulfonate | Sodium 9,10-dihydro-9,10-dioxoanthracene-2-sulphonate monohydrate | 2914.7 | |
1533-45-5 | 4-4'-Bis (2-benzoxazolyl) stilbene | 2,2'-(Vinylenedi-p-phenylene)bisbenzoxazole | ||
1533-78-4 | Disperse red 167:1 ; N-[5-[Bis[2-(acetyloxy)ethyl]amino]-2-[(2-chloro-4-nitrophenyl)azo]phenyl]-acetamide | 3204.11 | ||
153439-40-8 | Fexofenadine hydrochloride | Fexofenadine hydrochloride | 2933.99 | 6 |
153519-44-9 | 1,3-Benzenediol, 4-(4,6-bis(2,4-dimethylphenyl)-1,3,5-triazin-2-yl)-, reaction products with 2-((dodecyloxy)methyl)oxirane and 2-((C10-16-alkyloxy)methyl)oxirane | 3812.3 | ||
153531-96-5 | Tri-Magnesium dicitrate nonahydrate | Trimagnesium 2-hydroxypropane-1,2,3-tricarboxylate nonahydrate | 2918.15 | |
15362-40-0 | N-(2,6-Dichlorophenyl)-2-indolinone | 1-(2,6-Dichlorophenyl)-1,3-dihydro-2H-indol-2-one | 2933.79 | |
153719-23-4 | Thiamethoxam | 3-[(2-chloro-1,3-thiazol-5-yl)methyl]-5-methyl-N-nitro-1,3,5-oxadiazinan-4-imine | 2934.1 | 8 |
15375-84-5 | Ethylenediaminetetraacetic acid, manganese-disodium complex | EDTA manganese | ||
1538-09-6 | Penicillin G benzathine | Benzathine benzylpenicillin | 2941.1 | 6 |
1538-75-6 | Trimethylacetic anhydride | Trimethylacetic anhydride | 2915.9 | |
1539266-15-3 | 2-(4-Bromo-2,5-dimethoxyphenyl)-N-(2-methoxybenzyl)ethanaminium chloride | 2-(4-Bromo-2,5-dimethoxyphenyl)-N-[(2-methoxyphenyl)methyl]ethanamine;hydrochloride | 2922.29 | |
153-98-0 | 5-Hydroxytryptamine hydrochloride | 3-(2-Aminoethyl)-indol-5-ol hydrochloride | 2933.99 | |
15-39-9 | Bromophenol blue | 2934.99 | ||
154-17-6 | Deoxyglucose | (3R,4S,5R)-3,4,5,6-tetrahydroxyhexanal | 2940 | |
15418-16-3 | Direct red 83 | 3204.14 | ||
154248-98-3 | Glycols, 1,2-, C12-16, ethoxylated propoxylated | 3402.13 | ||
154445-77-9 | Fmoc-Arg(Pbf)-OH | (2S)-2-({[(9H-Fluoren-9-yl)methoxy]carbonyl}amino)-5-{N'-[(2,2,4,6,7-pentamethyl-2,3-dihydro-1-benzofuran-5-yl)sulfonyl]carbamimidamido}pentanoic acid | 2937.9 | |
1544-68-9 | 4-Fluorophenyl isothiocyanate | 4-Fluorophenyl isothiocyanate | 2930.9 | |
15454-54-3 | 5-Aminotetrazole monohydrate | 2H-tetrazol-5-amine;hydrate | 2933.99 | |
15454-74-7 | Copper 5-oxopyrrolidine-2-carboxylate | Copper 5-oxopyrrolidine-2-carboxylate | 2933.79 | |
15454-75-8 | Zinc pidolate | Zinc (2S)-5-oxopyrrolidine-2-carboxylate | 2933.79 | |
154592-20-8 | Copper pyrithione | 2933.39 | ||
154598-52-4 | Efavirenz | (4S)-6-Chloro-4-(2-cyclopropylethynyl)-4-(trifluoromethyl)-1H-3,1-benzoxazin-2-one | 2942 | 6 |
154702-15-5 | Diethylhexylbutamido triazone | 2-Ethylhexyl 4-[[4-[4-(tert-butylcarbamoyl)anilino]-6-[4-(2-ethylhexoxycarbonyl)anilino]-1,3,5-triazin-2-yl]amino]benzoate | 2933.69 | |
15471-17-7 | 3-(1-Pyridinio)-1-propanesulfonate | 3-Pyridin-1-ium-1-ylpropane-1-sulfonate | ||
154801-32-8 | Phytosphingosine hydrochloride | (2S,3S,4R)-2-Aminooctadecane-1,3,4-triol;hydrochloride | 2922.19 | |
154804-51-0 | β-Glycerophosphate disodium salt hydrate | 2919.9 | ||
15489-90-4 | Hematin porcine | Dihydrogen hydroxy[3,8,13,17-tetramethyl-7,12-divinyl-21H,23H-porphine-2,18-dipropionato(4-)-N21,N22,N23,N24]ferrate(2-) | 2934.99 | |
155-04-4 | Zinc 2-mercaptobenzothiazole | Zinc di(benzothiazol-2-yl) disulphide | ||
155148-31-5 | Octahydrochloride hydrate | 1-[[4-(1,4,8,11-Tetrazacyclotetradec-1-ylmethyl)phenyl]methyl]-1,4,8,11-tetrazacyclotetradecane octahydrochloride | 2933.99 | |
15520-10-2 | 1,5-Diamino-2-methylpentane | 1,5-Pentanediamine, 2-methyl | 2921.29 | |
15520-11-3 | Di(4-tert-butylcyclohexyl) peroxydicarbonate | Bis(4-tert-butylcyclohexyl) peroxydicarbonate | 2920.9 | |
155206-00-1 | Bimatoprost | (Z)-7-[(1R,2R,3R,5S)-3,5-dihydroxy-2-[(E,3S)-3-hydroxy-5-phenylpent-1-enyl]cyclopentyl]-N-ethylhept-5-enamide | 2937.5 | |
1552-12-1 | Cis,cis-1,5-Cyclooctadiene | (Z,Z)-Cycloocta-1,5-diene | 2902.19 | |
155213-67-5 | Ritonavir | Ritonavir | 2934.1 | 6 |
15523-24-7 | Sodium tetraethylborate | Sodium tetraethylborate | 2931.9 | |
1552-42-7 | 6-(Dimethyl)-3,3-bis[4-(dimethylamino)phenyl]-1(3H)-isobenzofuranone | 6-Dimethylamino-3,3-bis(4-dimethylaminophenyl)phthalide | 2922.5 | |
15532-75-9 | Trifluoromethylphenylpipera zine/3-Trifluoromethyl phenylpiperazine ; TFMPP | 1-[3-(trifluoromethyl) phenyl]piperazine | 2933.59 | 7 |
15541-56-7 | Pigment yellow 12 | 3204.17 | ||
1555-56-2 | Glycerophosphate disodium salt | Disodium 3-(phosphonooxy)propane-1,2-diol | 2919.9 | |
155569-91-8 | Emamectin benzoate | 8 | ||
155601-30-2 | 1-Hydroxyethyl 4,5-diamino pyrazole sulfate | 2-(4,5-diamino-1H-pyrazol-1-yl)ethanol—sulfuric acid (1:1) | ||
15571-58-1 | Pigment violet 32 ; 2-ethylhexyl 10-ethyl-4,4-dioctyl-7-oxo-8-oxa-3,5-dithia-4-stannatetradecanoate | 2-ethylhexyl 10-ethyl-4,4-dioctyl-7-oxo-8-oxa-3,5-dithia-4-stannatetradecan-1-oate | ||
15588-95-1 | STP ; DOM | 2,5-dimethoxy-α,4-dimethylphenethylamine | 7 | |
15593-29-0 | Sodium persulfate | 3402.9 | ||
1559-35-9 | 2-(2-Ethylhexyloxy)ethanol | 2-(2-Ethylhexyloxy)ethanol | 2909.49 | |
1559-36-0 | 2-[2-(2-Ethylhexyloxy)ethoxy]ethanol | 2-[2-(2-Ethylhexyloxy)ethoxy]ethanol | ||
156028-14-7 | Sodium Lauroamphoacetate | 3402.19 | ||
156153-06-9 | Polyglyceryl-2 Caprate | 3402.13 | ||
1561-92-8 | Sodium 2-methylprop-2-ene-1-sulfonate | Sodium 2-methylprop-2-ene-1-sulfonate | 2904.1 | |
15623-45-7 | Radium-223 | Radium-223 | 2844.4 | 5 |
15625-89-5 | Trimethylolpropane triacrylate | 2,2-Bis(prop-2-enoyloxymethyl)butyl prop-2-enoate | 3 | |
156-28-5 | B-Phenylethylamine hydrochloride | Phenethylammonium chloride | 2921.49 | |
15630-89-4 | Sodium percabonate | Tetrasodium hydrogen peroxide dicarbonate | ||
1563-38-8 | Carbofuranphenol | 2,3-Dihydro-2,2-dimethyl-7-hydroxybenzofuran | 2932.99 | |
1563-66-2 | Carbofuran | Carbofuran | 2932.99 | |
156-38-7 | 4-Hydroxyphenylacetic acid | p-Hydroxyphenylacetic acid | 2918.29 | |
156-43-4 | P-Phenetidine | 4-Ethoxyaniline | 2922.29 | 3 |
15647-08-2 | Diphenyl octyl phosphite | 2-Ethylhexyl diphenyl phosphite | ||
156-54-7 | Sodium butyrate | Butyric acid sodium salt | 2915.6 | |
156-57-0 | Mercaptamine hydrochloride ; Cysteamine hydrochloride | Ethanethiol, 2-amino-, hydrochloride | 6 | |
1565-80-6 | (2S)-2-Methylbutan-1-ol | (S)-2-Methylbutan-1-ol | 2909.49 | |
156-62-7 | Calcium carbimide | Cyanamide | 3102.9 | |
15667-10-4 | 1,1-Bis(tert-amylperoxy)cyclohexane | 1,1-bis[(2-methylbutan-2-yl)peroxy]cyclohexane | 3815.9 | |
156679-41-3 | Dimethylpabamidopropyl laurdimonium tosylate | 3-[[4-(Dimethylamino)benzoyl]amino]propyl-dodecyl-dimethylazanium;4-methylbenzenesulfonate | ||
156715-40-1 | Hydrolyzed rice protein | 3505.1 | ||
15679-12-6 | Fragrance of 2-Ethyl-4-methylthiazole | 3302.1 | ||
15679-13-7 | Fragrance of 2-isopropyl-4-methylthiazole | 3302.1 | ||
15686-71-2 | Cephalexin | Cefalexin | 2942 | 6 |
15687-27-1 | 2-(4-Isobutylphenyl)propanoic acid | 2-(4-Isobutylphenyl)propanoic acid | 2916.39 | |
156-87-6 | 3-Aminopropanol | 3-aminopropan-1-ol | 2922.29 | |
1569-01-3 | 1-Propoxypropan-2-ol | 2-Propoxypropanol | 2909.19 | |
1569-02-4  | 1-Ethoxypropan-2-ol | 1-Ethoxy-2-propanol | ||
15708-41-5 | Sodium Feredetate | Sodium 2-[2-[bis(carboxylatomethyl)amino]ethyl-(carboxylatomethyl)amino]acetate iron(3+) | 2922.49 | |
15708-48-2 | Ethylendiamintetraacetic acid magnesium dipotassium salt | Dipotassium [[N,N'-ethylenebis[N-(carboxymethyl)glycinato]](4-)-N,N',O,O',ON,ON']magnesate(2-) | 2922.49 | |
1571-08-0 | Methyl 4-formylbenzoate | Methyl 4-formylbenzoate | 2918.3 | |
1571-33-1 | Phenyl phosphonic acid | Phenylphosphonic acid | 2942 | |
157185-86-9 | Phosphinal PZ 04 | ไม่พบข้อมูล | 2835.29 | |
15750-15-9 | Indium-111 | Indium-111 | 2844.4 | 5 |
1575-37-7 | 4-Bromo-1,2-diaminobenzene | 4-Bromobenzene-1,2-diamine | 2921.51 | |
15757-14-9 | Gallium-68 | Gallium-68 | 2844.4 | 5 |
157577-99-6 | Acid black 234 | 3204.12 | ||
157627-86-6 | Alcohols, C13-15, branched and linear, ethoxylated (1 - 2.5 moles ethoxylated) | 3402.13 | ||
1576-35-8 | P-Toluenesulfonyl hydrazide | 4-Methylbenzenesulfonohydrazide | 2935 | |
1576-37-0 | N-Benzyl-p-toluenesulphonamide | N-Benzyl-4-methylbenzenesulfonamide | 2942 | |
157707-88-5 | C12-14-Alkyl glycosides | 3402.13 | ||
15782-05-5 | Pigment red 48:3 | strontium 4-[(5-chloro-4-methyl-2-sulfonatophenyl)azo]-3-hydroxynaphthalene-2-carboxylate | 3206.2 | |
15788-16-6 | 1H-Benzimidazole-5-carboxylic acid | 3H-Benzimidazole-5-carboxylic acid | 2933.99 | |
157905-74-3 | Methyl bis[ethyl (tallowate)] -2- hydroxyethyl ammonium methyl sulfate | 3402.9 | ||
15791-78-3 | Disperse blue 27 | 3204.11 | ||
15792-43-5 | Acid red 138 | 3204.12 | ||
15793-72-4 | Synox iron oxide orange 960 iron oxide | ไม่พบข้อมูล | 2821.1 | |
15793-73-4 | Pigment orange 34 | 3H-Pyrazol-3-one, 4,4'-[(3,3'-dichloro[1,1'-biphenyl]-4,4'-diyl)bis(azo)]bis[2,4-dihydro-5-methyl-2-(4-methylphenyl)- | 3204.17 | |
158129-94-3 | Disperse red 362 | 3204.11 | ||
1582-09-8 | Trifluralin | 2,6-Dinitro-N,N-dipropyl-4-(trifluoromethyl)aniline | 2921.43 | 8 |
15827-60-8 | Diethylenetriaminepenta(methylene-phosphonic acid) | [Bis[2-[bis(phosphonomethyl)amino]ethyl]amino]methylphosphonic acid | 2931.9 | |
15834-04-5 | Pentaerythritol tetravalerate | [3-Pentanoyloxy-2,2-bis(pentanoyloxymethyl)propyl] pentanoate | 2915.6 | |
158353-15-2 | Pyraclonil | 1-(3-chloro-4,5,6,7-tetrahydropyrazolo[1,5-a]pyridin-2-yl)-5-[methyl(prop-2-yn-1-yl)amino]-1H-pyrazole-4-carbonitrile | 2933.19 | |
158358-22-6 | GE 68 | 1-[3-(2-phenylethyl)-1-benzofuran-2-yl]-2-(propylamino)ethanol | 2844.4 | 5 |
158563-45-2 | Melanostatine - 5 | 3504 | ||
15859-24-2 | Sodium silicate | Disodium oxosilanebis(olate) | ||
15875-13-5 | 1,3,5-Tris[3-(dimethylamino)propyl]hexahydro-1,3,5-triazine | 3-[3,5-Bis[3-(dimethylamino)propyl]-1,3,5-triazinan-1-yl]-N,N-dimethylpropan-1-amine | ||
158765-79-8 | Micrococcus lysate | 3504 | ||
15876-58-1 | Pigment red 174 | 3205 | ||
158778-85-9 | 1,1,1,2,2,3,3,4,4,5,5-Undecadeuterio-5-deuteriooxypentane | 1,1,1,2,2,3,3,4,4,5,5-Undecadeuterio-5-deuteriooxypentane | 2905.19 | |
15878-77-0 | Praseodymium(III) nitrate hexahydrate | Praseodymium(3+);trinitrate;hexahydrate | 2846.9 | |
15905-32-5 | Solvent red 140 | 3204.12 | ||
159202-75-2 | Acid blue 277:1 | 3204.12 | ||
1592-20-7 | 1-(Chloromethyl)-4-ethenylbenzene | 1-(Chloromethyl)-4-ethenylbenzene | 2903.99 | |
1592-23-0 | Calcium stearate | Calcium octadecanoate | ||
1594-08-7 | 1-Hydroxy-4-[[4-[(methylsulfonyl)oxy]phenyl]amino]anthraquinon | 3204.11 | ||
15956-58-8 | Manganese octoate | |||
15968-01-1 | Sodium phthalate | Disodium phthalate | 2918.3 | |
15972-60-8 | Alachlor | 2-Chloro-N-(2,6-diethylphenyl)-N-(methoxymethyl)acetamide | 2924.29 | |
15990-43-9 | Benzyl pyridinium carboxylate | 1-Benzylpyridin-1-ium-3-carboxylate | 2933.99 | |
1600-27-7 | Mercury acetate | Mercury(2+);diacetate | ||
16005-17-7 | Acetylenediol | 2931.9 | ||
16009-13-5 | Hemin | 3-[(2Z,7Z,11Z,16Z)-5-(2-Carboxyethyl)-22-chloro-14,19-diethenyl-4,10,15,20-tetramethyl-21,23,24,25-tetraaza-22-ferrahexacyclo[9.9.3.1³,⁶.1¹³,¹⁶.0⁸,²³.0¹⁸,²¹]pentacosa-1(20),2,4,6(25),7,9,11,13(24),14,16,18-undecaen-9-yl]propanoic acid | 2934.99 | |
16015-69-3 | 1-(3-Trifluoromethylphenyl)piperazine hydrochloride | 1-[3-(Trifluoromethyl)phenyl]piperazinium chloride | 2933.91 | |
160337-95-1 | Insulin Glargine | 2937.12 | ||
160391-93-5 | Polyglyceryl-4 Caprate | Polyglyceryl-4 Caprate | ||
16039-53-5 | Zinc dilactate | 2-Hydroxypropanoic acid; zinc | 2918.11 | |
16051-77-7 | Isosorbide mononitrate | Isosorbide mononitrate | 2942 | |
16056-11-4 | Phenyltrimethylammonium bromide | Phenyltrimethylammonium bromide | 2923.9 | |
160611-47-2 | Maltohydrolase | 3507.9 | ||
1606-49-1 | 1,4,5,6-Tetrahydropyrimidine | 1,4,5,6-Tetrahydropyrimidine | 2933.59 | |
16065-83-1 | Trivalent Chromium | Chromium III | 2942 | |
1606-67-3 | 1-Aminopyrene | 1-Aminopyrene | 2921.49 | |
1606-79-7 | 5-oxa-2-octyne-1,7-diol | 3824.9 | ||
16068-37-4 | 1,2-Bis(Triethoxysilyl)ethane | 3,8-Dioxa-4,7-disiladecane, 4,4,7,7-tetraethoxy- | 3207.3 | |
1606-85-5 | 1,4-Bis(2-hydroxyethoxy)-2-butyne | Ethanol, 2,2'-(2-butyne-1,4-diylbis(oxy))bis- | 2905.39 | |
16069-36-6 | Crown ether ; dicyclohexyl-18-crown-6 (mixture of cis-and trans-isomers) | Icosahydrodibenzo[b,k][1,4,7,10,13,16]hexaoxacyclooctadecin | 2932.99 | |
160699-86-5 | Immunoglobulin G | (2S)-2-[[(2S)-1-[(2S)-6-amino-2-[[(2S,3R)-2-[[(2S)-6-amino-2-[[(2S)-2-[[(2S)-4-amino-2-[[(2S)-2-amino-3-(1H-indol-3-yl)propanoyl]amino]-4-oxobutanoyl]amino]propanoyl]amino]hexanoyl]amino]-3-hydroxybutanoyl]amino]hexanoyl]pyrrolidine-2-carbonyl]amino]-5-(d | 3502.9 | 6 |
16079-88-2 | 1-bromo-3-chloro-5,5-dimethylimidazolidine-2,4-dione | 1-bromo-3-chloro-5,5-dimethylimidazolidine-2,4-dione | 2801.3 | |
1608-26-0 | Hexamethyltriaminophosphine | Tris(dimethylamino)phosphine | 2929.9 | |
160875-66-1 | PEG-10 propylheptyl ether ; Poly(oxy-1,2-ethanediyl), .alpha.-(2-propylheptyl)-.omega.- hydroxy | 3402.13 | ||
16090-02-1 | Fluorescent brightener 71 ; Benzenesulfonic acid, 2,2'-(1,2-ethenediyl)bis[5-[[4-(4-morpholinyl)-6-(phenylamino)-1,3,5-triazin-2-yl]amino]-, sodium salt (1:2) | 3204.2 | ||
1609-47-8 | Diethyl pyrocarbonate | Diethyl oxydiformate | 2920.9 | |
16096-31-4 | 1,6-Hexanediol diglycidyl ether | 2-[6-(Oxiran-2-ylmethoxy)hexoxymethyl]oxirane | 2910.9 | |
160970-54-7 | Silodosin | 1-(3-Hydroxypropyl)-5-[(2R)-2-[2-[2-(2,2,2-trifluoroethoxy)phenoxy]ethylamino]propyl]-2,3-dihydroindole-7-carboxamide | 2924.29 | |
161025-21-4 | Alcohols, C12-16, ethoxylated | 3402.11 | ||
16111-62-9 | Di(2-ethylhexyl) peroxydicarbonate | 2-Ethylhexoxycarbonyloxy 2-ethylhexyl carbonate | 2918.99 | |
1611-35-4 | 2-[[5-[3-[3-[[Bis(carboxymethyl)amino]methyl]-4-hydroxy-5-methylphenyl]-1,1-dioxo-2,1$l^{6}-benzoxathiol-3-yl]-2-hydroxy-3-methylphenyl]methyl-(carboxymethyl)amino]acetic acid | 2-[[5-[3-[3-[[Bis(carboxymethyl)amino]methyl]-4-hydroxy-5-methylphenyl]-1,1-dioxo-2,1$l^{6}-benzoxathiol-3-yl]-2-hydroxy-3-methylphenyl]methyl-(carboxymethyl)amino]acetic acid | 2908.99 | |
1611-56-9 | 11-Bromoundecanol | 11-bromoundecan-1-ol | 2905.59 | |
161258-30-6 | Hexapeptide-11 | (2S)-1-[(2S)-2-[[(2S)-1-[(2S)-2-[[(2S)-2-[[(2S)-2-amino-3-phenylpropanoyl]amino]-3-methylbutanoyl]amino]propanoyl]pyrrolidine-2-carbonyl]amino]-3-phenylpropanoyl]pyrrolidine-2-carboxylic acid | 3504 | |
16126-82-0 | Herbanate | 2916.39 | ||
161326-34-7 | Fenamidone | (5S)-3-anilino-5-methyl-2-(methylthio)-5-phenyl-3,5-dihydro-4H-imidazol-4-one | 2933.29 | 8 |
161403-66-3 | Glyceryl oleate | 2,3-Diacetyloxypropyl (Z)-octadec-9-enoate | ||
161713-86-6 | Alpha glucosyl hesperidin | (2R)-7-[3,4-dihydroxy-5-[3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxy-6-[(3,4,5-trihydroxy-6-methyloxan-2-yl)oxymethyl]oxan-2-yl]oxy-5-hydroxy-2-(3-hydroxy-4-methoxyphenyl)-2,3-dihydrochromen-4-one | 2938.9 | |
161735-79-1 | Rasagiline mesylate | Methanesulfonic acid;(1R)-N-prop-2-ynyl-2,3-dihydro-1H-inden-1-amine | 2933.79 | |
161756-30-5 | Lauryl (7) OE citrate | 3402.9 | ||
161907-80-8 | Ethanol, 2-methoxy- | 2710.19 | ||
1622-61-3 | Clonazepam | 5-(o-chlorophenyl)-1,3-dihydro-7-nitro-2H-1,4- benzodiazepin-2-one | 9 | |
1622-62-4 | Flunitrazepam | 5-(2-Fluorophenyl)-1-methyl-7-nitro-3H-1,4-benzodiazepin-2-one | 2933.91 | 9 |
1623-15-0 | N-Butylphosphate | Butyl dihydrogen phosphate | 2919.9 | |
1623-24-1 | Propan-2-yl dihydrogen phosphate | Propan-2-yl dihydrogen phosphate | 2906.29 | |
16245-77-5 | p-Phenylenediamine sulfate | Benzene-1,4-diamine;sulfuric acid | 2921.59 | |
162650-77-3 | Ethaboxam | N-[cyano(2-thienyl)methyl]-4-ethyl-2-(ethylamino)-1,3-thiazole-5-carboxamide | 2934.1 | 8 |
16283-36-6 | Zinc salicylate | Zinc 2-hydroxybenzoate | 2918.19 | |
162874-54-6 | Liquitint blue HP | 3204.9 | ||
162881-26-7 | Phenyl bis(2,4,6-trimethylbenzoyl)-phosphine oxide | (phenylphosphoryl)bis[(2,4,6-trimethylphenyl)methanone] | ||
16294-75-0 | Solvent orange 63 | 14H-Anthra[2,1,9-mna]thioxanthen-14-one | 3204.9 | |
163222-33-1 | Ezetimibe | (3R,4S)-1-(4-Fluorophenyl)-3-[(3S)-3-(4-fluorophenyl)-3-hydroxypropyl]-4-(4-hydroxyphenyl)azetidin-2-one | 2933.79 | 6 |
1633-05-2 | Strontium carbonate | Strontium;carbonate | ||
1634-02-2 | Tetrabutylthioperoxydicarbamic acid | N,N-dibutyl[(dibutylcarbamothioyl)disulfanyl]carbothioamide | 3812.1 | |
1634-04-4 | 2-Methoxy-2-methylpropane ; methyl tert-butyl ether | 2-Methoxy-2-methylpropane | 2909.19 | |
1634-82-8 | 2-(4-Hydroxyphenylazo)benzoic acid | 2-[2-(4-Oxocyclohexa-2,5-dien-1-ylidene)hydrazinyl]benzoic acid | 2927 | |
163520-33-0 | Isoxadifen-ethyl | Ethyl 5,5-diphenyl-4H-1,2-oxazole-3-carboxylate | 2934.99 | |
163702-01-0 | Oligo[2-hydroxy-2-methyl-1-[4-(1-methylvinyl)phenyl]propanone] | 2,3-Dihydro-6-(2-hydroxy-2-methyl-1-oxopropyl)-1,1,3-trimethyl-3-[4-(2-hydroxy-2-methyl-1-oxopropyl)phenyl]-1H-indene | 2931.9 | |
163702-06-5 | Ethyl perfluorobutyl ether  | 1-Ethoxy-1,1,2,2,3,3,4,4,4-nonafluorobutane | 2909.19 | |
163702-07-6 | 1,1,1,2,2,3,3,4,4-Nonafluoro-4-methoxybutane | 1,1,1,2,2,3,3,4,4-Nonafluoro-4-methoxybutane | 2909.19 | |
163702-08-7 | 1,1,2,3,3,3-Hexafluoro-1-methoxy-2-(trifluoromethyl)propane | Hydrofluor ether | 2909.19 | |
16389-88-1 | Dolomite | Calcium magnesium dicarbonate | ||
1639-66-3 | Dicapryl sodium sulfosuccinate | Sodium 1,4-bis(octyloxy)-1,4-dioxobutane-2-sulfonate | 3402.11 | |
16409-34-0 | Sodium glycodeoxycholate | Sodium [(3,12-dihydroxy-24-oxocholan-24-yl)amino]acetate | 2924.29 | |
16409-43-1 | Rose oxide | 4-Methyl-2-(2-methylprop-1-enyl)oxane | 2932.99 | |
16415-12-6 | Hexadecyltrimethoxysilane | Hexadecyl(trimethoxy)silane | 2931.9 | |
16423-68-0 | Acid Red 51 ; Erythrosine | 2-(6-Hydroxy-2,4,5,7-tetraiodo-3-oxo-xanthen-9-yl)benzoic acid | 3205 | |
164251-88-1 | Solvent red 195 | 3204.19 | ||
1642-54-2 | Diethylcarbamazine citrate | N,N-diethyl-4-methylpiperazine-1-carboxamide;2-hydroxypropane-1,2,3-tricarboxylic acid | 2933.59 | |
1642-81-5 | 4-(Chloromethyl)benzoic acid | 4-(Chloromethyl)benzoic acid | 2916.39 | |
1643-19-2 | Tetra-n-butylammonium bromide | 1-Butanaminium, N,N,N-tributyl-, bromide | 2923.9 | |
1643-20-5 | Dodecyldimethylamine oxide | Dodecyldimethylamine oxide | 3402.13 | |
164462-16-2 | Methylglycinediacetic acid, trisodium salt | Trisodium methylglycine-N,N-diacetic acid | 2922.49 | |
16454-60-7 | Neodymium(III) nitrate hexahydrate | Neodymium(3+);trinitrate;hexahydrate | 2846.9 | |
16455-61-1 | Sodium Ferric EDDHA | Sodium 2-[carboxy-[2-[[carboxy-(2-hydroxyphenyl)methyl]amino]ethylamino]methyl]phenolate iron | 2922.5 | |
1645-65-4 | 4-(Trifluoromethyl)phenyl isothiocyanate | 1-Isothiocyanato-4-(trifluoromethyl)benzene | 2930.9 | |
164578-37-4 | Disperse yellow 184:1 | 3204.11 | ||
164579-32-2 | Pantoprazole sodium sesquihydrate | Sodium-5-(difluormethoxy)-2- [(3,4-dimethoxy-2-pyridyl) methylsulfinyl]-1H-benzimidazol sesquihydrat | 2933.39 | 6 |
164581-28-6 | 2,7-Bis(2-sulfophenylazo)chromotropic acid tetrasodium salt | Tetrasodium;(3Z,6E)-4,5-dioxo-3,6-bis[(2-sulfonatophenyl)hydrazinylidene]naphthalene-2,7-disulfonate | 2927 | |
16470-24-9 | Fluorescent Brightener 220 | Tetrasodium 2,2'-ethene-1,2-diylbis[5-({4-[bis(2-hydroxyethyl)amino]-6-[(4-sulfonatophenyl)amino]-1,3,5-triazin-2-yl}amino)benzenesulfonate] | 3204.2 | |
16485-10-2 | DL-Panthenol | 2,4-Dihydroxy-N-(3-hydroxypropyl)-3,3-dimethylbutanamide | ||
16491-36-4 | Fragrance of cis-3-Hexenyl butyrate | cis-hex-3-enyl butyrate | 3301.9 | |
1649-18-9 | Azaperone | Azaperone | 2942 | |
16493-80-4 | 4-Ethyloctanoic acid | 4-Ethyloctanoic acid | 2915.9 | |
16521-38-3 | Food Blue 1:1 ; C.I. 73015 | 3204.9 | ||
165252-70-0 | Dinotefuran | 1-methyl-2-nitro-3-(tetrahydrofuran-3-ylmethyl)guanidine | 2932.19 | |
165450-17-9 | Neotame | (3S)-3-(3,3-Dimethylbutylamino)-4-[[(2S)-1-methoxy-1-oxo-3-phenylpropan-2-yl]amino]-4-oxobutanoic acid | 2924.29 | |
16545-54-3 | Dimyristyl thiodipropionate | Tetradecyl 3-(3-oxo-3-tetradecoxypropyl)sulfanylpropanoate | ||
16561-29-8 | Phorbol 12-myristate 13-acetate | 2915.39 | ||
1656-44-6 | 2,4-Dinitrobenzenesulfonyl chloride | 2,4-Dinitrobenzenesulfonyl chloride | 2904.9 | |
165660-27-5 | Hydroxy naphthol blue disodium salt | Hydroxynaphthol blue disodium | 2927 | |
165800-03-3 | Linezolid | Linezolid | 2922.19 | 6 |
16587-71-6 | 4-Tertiary-pentyl cyclohexanone | Orivone | 2914.29 | |
16593-81-0 | 4-(2-Pyridylazo)resorcinol monosodium salt hydrate | Resorcinol, 4-(2-pyridylazo)-, monosodium salt, monohydrate | 2933.99 | |
16595-80-5 | Levamisole hydrochloride | (6S)-6-phenyl-2,3,5,6-tetrahydroimidazo[2,1-b][1,3]thiazole hydrochloride | 2934.99 | |
1662-01-7 | Bathophenanthroline | 4,7-Diphenyl-1,10-phenanthroline | 2933.99 | |
16630-52-7 | 3-(Methylthio) butanal | 3-(Methylthio)butyraldehyde | 2930.9 | |
1663-39-4 | Tert-butyl acrylate | Tert-butyl prop-2-enoate | 2916.12 | |
1663-45-2 | 1,2-Bis(diphenylphosphino)ethane | 1,2-Bis(diphenylphosphino)ethane | 2931.9 | |
166412-78-8 | Diisononyl cyclohexane-1,2-dicarboxylate | Bis(7-methyloctyl) cyclohexane-1,2-dicarboxylate | 2917.12 | |
166-46-7 | D-Tetramethrin | 2925.19 | ||
16672-87-0 | Ethephon | (2-chloroethyl)phosphonic acid | 8 | |
166736-08-9 | Oxirane, 2-methyl-, polymer with oxirane, mono(2-propylheptyl) ether | 3402.13 | ||
16674-78-5 | Magnesium acetate tetrahydrate | Magnesium;diacetate;tetrahydrate | 2915.29 | |
16676-75-8 | Vitamin E Nicotinate | [(2R)-2,5,7,8-tetramethyl-2-[(4R,8R)-4,8,12-trimethyltridecyl]-3,4-dihydrochromen-6-yl] pyridine-3-carboxylate | 2936.28 | 6 |
1667-99-8 | Chromeazurol S | Benzoic acid, 5-[(3-carboxy-5-methyl-4-oxo-2,5-cyclohexadien-1-ylidene)(2,6-dichloro-3-sulfophenyl)methyl]-2-hydroxy-3-methyl-, trisodium salt | 2918.99 | |
16691-43-3 | 3-Amino 5-mercapto-1,2,4-triazole | 5-Amino-1,2-dihydro-1,2,4-triazole-3-thione | 2933.99 | |
1669-44-9 | (E)-Oct-3-en-2-one | 3-Octen-2-one | 2914.19 | |
16700-97-3 | Zinc stearyl phosphate | Zinc;dioctadecyl phosphate | 2919.9 | |
167078-06-0 | 2,2,6,6-Tetramethyl-4-piperidinyl stearate | 3812.3 | ||
16712-20-2 | Aluminium phosphate | Lithium;chloride;hydrate | 2835.29 | |
16721-80-5 | Sodium hydrosulfide | Sodium;sulfanide | 2830.1 | |
16728-61-3 | 3-(Hexyloxy)propylamine | 3-Hexoxypropan-1-amine | 2921.19 | |
16731-55-8 | Potassium metabisulfite | Dipotassium disulphite | ||
16754-68-0 | Zinc monoglycerolate | 3812.3 | ||
16774-21-3 | Ammonium cerium(IV) nitrate | Azane; cerium(4+); nitric acid; tetranitrate | 2846.1 | |
167869-21-8 | 2'-Amino-3'-methoxyflavone | 2'-Amino-3'-methoxyflavone | 2932.2 | |
16788-57-1 | Potassium monohydrogen phosphate | Dipotassium;hydrogen phosphate;trihydrate | 2835.24 | |
1678-91-7 | Ethylcyclohexane | Ethylcyclohexane | ||
1678-92-8 | Propylcyclohexane | Propylcyclohexane | 2902.19 | |
1680-31-5 | Dicaprylyl carbonate | Dioctyl carbonate | 2920.9 | |
16803-97-7 | 4,4 Diamino sulfanilide | 4-Amino-N-(4-aminophenyl)benzene-1-sulfonamide | 2935 | |
16805-91-7 | Catanitto-C | 3815.9 | ||
168088-61-7 | Pyribenzoxim | Diphenylmethanone O-{2,6-bis[(4,6-dimethoxypyrimidin-2-yl)oxy]benzoyl}oxime | 2933.59 | 8 |
16809-88-4 | Methacrylic acid calcium salt | Calcium bis(2-methylprop-2-enoate) | 2916.13 | |
16823-51-1 | Reactive blue 5 | 3204.16 | ||
16830-15-2 | Asiaticoside | Asiaticoside | 2938.9 | |
1684-40-8 | 9-Amino-1,2,3,4-tetrahydroacridine hydrochloride | 1,2,3,4-Tetrahydroacridin-9-amine hydrochloride | 2933.99 | |
168456-53-9 | Poria cocos extract | 3302.9 | ||
16853-85-3 | Lithium aluminium hydride | Lithium aluminium hydride | 3 | |
16856-18-1 | L-Arginine alpha ketoglutarate | (2S)-2-Amino-5-carbamimidamidopentanoic acid; 2-oxopentanedioic acid | 2925.29 | |
16867-03-1 | 2-Amino-3-hydroxypyridine | 2-Amino-3-hydroxypyridine | 2933.31 | |
16871-90-2 | Potassium fluorosilicate | Dipotassium;hexafluorosilicon(2-) | 2826.9 | 8 |
16872-11-0 | Fluoroboric acid | Hydron;tetrafluoroborate | 2811.19 | |
16883-83-3 | 1-O-benzyl 2-O-[2,2,4-trimethyl-1-(2-methylpropanoyloxy)pentan-3-yl] benzene-1,2-dicarboxylate | enzyl 3-isobutyryloxy-1-isopropyl-2,2-dimethylpropyl phthalate | 3812.2 | |
16889-10-4 | Disperse red 73 | 3204.11 | ||
16893-85-9 | Sodium fluorosilicate | Disodium;hexafluorosilicon(2-) | 2826.9 | 8 |
1689-64-1 | 9H-Fluoren-9-ol | 9-Fluorenol | 2906.29 | |
169117-72-0 | 2,5,8,11 Tetramethyl 6 dodecyn-5,8 Diol Ethoxylate | 3402.13 | ||
16919-19-0 | Ammonium silicofluoride | Diazanium;hexafluorosilicon(2-) | 2826.9 | 8 |
16919-27-0 | Potassium hexafluorotitanate | Dipotassium;hexafluorotitanium(2-) | 2826.9 | |
16919-31-6 | Ammonium hexafluorozirconate | Diazanium;hexafluorozirconium(2-) | 2826.9 | |
169202-06-6 | Iminoctadine tris (albesilate) | 2925.29 | 8 | |
16921-30-5 | Potassium hexachloroplatinate (IV) | Dipotassium;hexachloroplatinum(2-) | 2842.9 | |
16923-95-8 | Potassium hexafluorozirconate | Dipotassium;hexafluorozirconium(2-) | 2826.9 | |
16924-00-8 | Potassium tantalum fluoride | Dipotassium;heptafluorotantalum(2-) | 2826.9 | |
169314-88-9 | Aluminum magnesium zinc carbonate hydroxide | Aluminum magnesium zinc carbonate hydroxide | 2836.99 | |
16940-66-2 | Sodium borohydride | Sodium boranuide | 2850 | |
1694-09-3 | Acid violet 49 | 3204.12 | ||
16941-12-1 | Hydrogen hexachloroplatinate(IV) | Hexachloro platinum(2-); hydron | 2843.9 | |
1694-31-1 | tert-Butyl acetoacetate | tert-Butyl 3-oxobutanoate | 2905.39 | |
16949-15-8 | Lithium tetrahydroborate | Lithium boranuide | 2850 | |
16958-92-2 | Ditridecyl adipate | Ditridecyl adipate | 2917.12 | |
169590-42-5 | Celecoxib | 4-(5-(4-Methylphenyl)-3-(trifluoromethyl)-1H-pyrazol-1-yl)benzenesulfonamide | 2935 | 6 |
169590-59-4 | Hydrolyzed potato protein | 3504 | ||
16961-25-4 | Hydrogen tetrachloroaurate(III), trihydrate | |||
16961-83-4 | Hydrofluorosilicic acid | Tetrafluorosilane; dihydrofluoride | ||
16971-82-7 | N,N-Bis-(2-methylphenyl)guanidiniumbiscatecholborat | Boron(3+) ion hydrogen (E)-1,2-bis(2-methylphenyl)guanidine bis(benzene-1,2-bis(olate)) | 2925.29 | |
16984-48-8 | Fluoride | Fluoride | 2826.19 | |
17013-01-3 | Sodium fumarate | Disodium fumarate | 2917.19 | |
1701-93-5 | Silver thiocyanate | Silver;thiocyanate | 2843.29 | |
17026-85-6 | Potassium cetyl phosphate | 3824.9 | ||
1703-58-8 | 1,2,3,4-Butanetetracarboxylic acid | 1,2,3,4-Butanetetracarboxylic acid | 2917.19 | |
1704-62-7 | Dimethylaminoethoxyethanol | 2-[2-(dimethylamino)ethoxy]ethanol | 2922.19 | |
17095-24-8 | Reactive black 5 | Tetrasodium 4-amino-5-hydroxy-3,6-bis[(4-{[2-(sulfonatooxy)ethyl]sulfonyl}phenyl)azo]naphthalene-2,7-disulfonate | 3204.16 | |
1709-70-2 | Tris-bht mesitylene | 4-[[3,5-bis[(3,5-ditert-butyl-4-hydroxyphenyl)methyl]-2,4,6-trimethylphenyl]methyl]-2,6-ditert-butylphenol | ||
17099-81-9 | EDTA Fe | Iron(3+) 2-[2-[bis(2-oxido-2-oxoethyl)amino]ethyl-(carboxymethyl)amino]acetate | 2922.49 | |
171228-49-2 | Posaconazole | 4-[4-[4-[4-[[(3R,5R)-5-(2,4-Difluorophenyl)-5-(1,2,4-triazol-1-ylmethyl)oxolan-3-yl]methoxy]phenyl]piperazin-1-yl]phenyl]-2-[(2S,3S)-2-hydroxypentan-3-yl]-1,2,4-triazol-3-one | 2934.99 | 6 |
1713-15-1 | 2,4-D-isobutyl | Isobutyl 2,4-dichlorophenoxyacetate | 2918.99 | 8 |
171408-84-7 | 2,7-Dibromo-9,9′-spirobifluorene | 2',7'-Dibromo-9,9'-spirobi[fluorene] | 2903.99 | |
171596-29-5 | Tadalafil | (2R,8R)-2-(2H-1,3-Benzodioxol-5-yl)-6-methyl-3,6,17-triazatetracyclo[8.7.0.0³,⁸.0¹¹,¹⁶]heptadeca-1(10),11,13,15-tetraene-4,7-dione | 2942 | 6 |
171599-83-0 | Sildenafil citrate | 5-[2-ethoxy-5-(4-methylpiperazin-1-yl)sulfonylphenyl]-1-methyl-3-propyl-4H-pyrazolo[4,3-d]pyrimidin-7-one;2-hydroxypropane-1,2,3-tricarboxylic acid | 2935 | 6 |
171599-84-1 | Reactive yellow 205 | 3204.16 | ||
1717-00-6 | 1,1-Dichloro-1-fluoroethane; dichlorofluoroethane | 1,1-Dichloro-1-fluoroethane | 2903.99 | 12 |
17194-00-2 | Barium hydroxide | Barium(2+);dihydroxide | 2816.4 | |
17199-54-1 | Alphamethadol | α-6-dimethylamino-4,4-diphenyl-3-heptanol | 2922.19 | 7 |
1720-32-7 | 1,6-Diphenyl-1,3,5-hexatriene | 1,6-Diphenyl-1,3,5-hexatriene | 2902.9 | |
1722-12-9 | 2-Chloropyrimidine | 2-Chloropyrimidine | 2933.59 | |
1722-62-9 | Mepivacaine hydrochloride | Mepivacaine hydrochloride | 2933.39 | 6 |
17230-88-5 | Danazol | Danazol | 2922.42 | 6 |
1724-39-6 | Cyclododecanol | Cyclododecanol | 2906.19 | |
17264-53-8 | Sodium p-tert-butylbenzoate | Sodium 4-tert-butylbenzoate | 2916.31 | |
17265-14-4 | Disodium sebacate | Disodium decanedioate | 2917.13 | |
17283-81-7 | Dihydro-beta-ionone | 4-(2,6,6-trimethylcyclohexen-1-yl)butan-2-one | 2914.23 | |
172944-28-4 | Dihexyldecyl Lauroyl Glutamate | Bis(2-hexyldecyl) (2S)-2-(dodecanoylamino)pentanedioate | 3824.9 | |
17301-53-0 | Docosyltrimethylammonium chloride | N,N,N-trimethyldocosan-1-aminium chloride | 3402.9 | |
17316-67-5 | Butafosfan | 2-(butylamino)propan-2-yl-hydroxy-oxophosphanium | 2931.9 | |
1731-86-8 | Methyl Undecanoate | Methyl Undecanoate | 2915.9 | |
1731-88-0 | Methyl Tridecanoate | Methyl Tridecanoate | 2915.9 | |
1731-92-6 | Methyl Margarate | Methyl heptadecanoate | 2915.9 | |
1731-94-8 | Methyl nonadecan-1-oate | Methyl nonadecanoate | 2915.9 | |
17321-77-6 | Clomipramine hydrochloride | 3-(2-chloro-5,6-dihydrobenzo[b][1]benzazepin-11-yl)-N,N-dimethylpropan-1-amine hydrochloride | 2933.99 | |
1733-12-6 | Cresol Red | 4-[3-(4-hydroxy-3-methylphenyl)-1,1-dioxo-2,1$l^{6}-benzoxathiol-3-yl]-2-methylphenol | 2934.99 | |
17334-58-6 | Pelargonin chloride | (3R,4S,5S,6R)-2-[7-hydroxy-2-(4-hydroxyphenyl)-3-[(3R,4S,5S,6R)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxychromenylium-5-yl]oxy-6-(hydroxymethyl)oxane-3,4,5-triol chloride | 2938.9 | |
17354-14-2 | Solvent blue 35 | 9,10-Anthracenedione, 1,4-bis(butylamino)- | 3208.9 | |
173584-44-6 | Indoxacarb | Methyl (4aS)-7-chloro-2-{(methoxycarbonyl)[4-(trifluoromethoxy)phenyl]carbamoyl}-2,5-dihydroindeno[1,2-e][1,3,4]oxadiazine-4a(3H)-carboxylate | 2934.99 | 8 |
17372-87-1 | Acid red 87 | Spiro[isobenzofuran-1(3H),9'-[9H]xanthen]-3-one, 2',4',5',7'-tetrabromo-3',6'-dihydroxy-, disodium salt | 3204.12 | |
17374-26-4 | 4,5,6,7-Tetrabromo-2H-benzotriazole | 4,5,6,7-Tetrabromo-2H-benzotriazole | 2920.9 | |
17375-41-6 | Ferrous sulfate monohydrate | Iron(2+);sulfate;hydrate | 2833.299 | |
1739-84-0 | 1,2-Dimethylimidazole | 1,2-dimethylimidazole | 3815.9 | 3 |
17418-58-5 | Disperse red 60 | 3204.11 | ||
17439-11-1 | Fluorotitanic acid | Tetrafluorotitanium; dihydrofluoride | 2811.199 | |
174493-24-4 | Edenol 344 | 3812.2 | ||
174501-64-5 | Butylmethylimidazolium Hexafluorophosphate | 1-butyl-3-methylimidazol-3-ium hexafluorophosphate | 2933.29 | |
174501-65-6 | Butylmethylimidazolium Tetrafluoroborate | 1-butyl-3-methylimidazol-3-ium tetrafluoroborate | 2933.29 | |
174514-58-0 | Aluminum zirconium octachlorohydrex glycine | 3824.9 | ||
17455-13-9 | Ethylene oxide cyclic hexamer | 1,4,7,10,13,16-hexaoxacyclooctadecane | 2932.99 | |
1746-03-8 | Vinylphosphonic acid | Ethenylphosphonic acid | 2931.9 | |
17465-86-0 | Gamma Cyclodextrin | 2940 | ||
174722-31-7 | Rituximab | 2933.39 | 6 | |
17479-19-5 | Dihydroergocristine | (2R,4R,7R)-N-[(1S,2S,4R, 7S)-7-benzyl-2-hydroxy-5,8-dioxo-4-(propan-2-yl)-3-oxa-6,9-diazatricyclo [7.3.0.0]dodecan-4-yl]-2,6-dimethyl-6,11-diazatetra cyclo [7.6.1.0.0]hexadeca-1(16),9,12,14-tetraene-4-carboxamide | 2939.69 | 7 |
174882-69-0 | Pycnogenol | 2936.29 | ||
174899-83-3 | 1-Butyl-3-methylimidazolium bis(trifluoromethylsulfonyl)imide | 1-Butyl-3-methylimidazolium Bis(trifluoromethanesulfonyl)imide | 2935 | |
175013-18-0 | Pyraclostrobin | Methyl [2-({[1-(4-chlorophenyl)-1H-pyrazol-3-yl]oxy}methyl)phenyl]methoxycarbamate | 2933.19 | 8 |
17501-44-9 | Zirconium(IV) 2,4-pentanedionate | 2914.4 | ||
17501-79-0 | Titanium acetylacetonate | (Z)-4-hydroxypent-3-en-2-one titanium | 2914.19 | |
17517-01-0 | Stearoxypropyl Dimethylamine | N,N-dimethyl-3-octadecoxypropan-1-amine | 2921.19 | |
17526-94-2 | 2,4-Bis(3,3-dimethylureido)toluene | 3-[3-(dimethylcarbamoylamino)-4-methylphenyl]-1,1-dimethylurea | 2924.21 | |
175357-18-3 | Undecylenoyl phenylalanine | 3-phenyl-2-(undec-10-enamido)propanoic acid | 2922.49 | |
175481-36-4 | Lacosamide | (2R)-2-acetamido-N-benzyl-3-methoxypropanamide | 2924.19 | |
1758-73-2 | Formamidine Sulfinic Acid | Amino(imino)methanesulfinic acid | 2930.9 | |
1758-88-9 | 2-Ethyl-1,4-dimethylbenzene | 2-Ethyl-1,4-dimethylbenzene | 2902.9 | |
1759-28-0 | 4-Methyl-5-vinylthiazole | 5-Ethenyl-4-methyl-1,3-thiazole | 2934.1 | |
176023-34-0 | Reactive yellow 105 | 3204.16 | ||
1760-24-3 | (Trimethoxysilylpropyl)Ethylenediamine | N'-(3-trimethoxysilylpropyl)ethane-1,2-diamine | 2931.9 | |
1761-71-3 | 4,4'-Methylenebiscyclohexanamine | 4-[(4-aminocyclohexyl)methyl]cyclohexan-1-amine | 2921.3 | |
17617-23-1 | Flurazepam | 7-chloro-1-[2-(diethylamino)ethyl]-5-(o-fluorophenyl)-1,3- dihydro-2H-1,4-benzodiazepin-2-one | 2933.91 | 9 |
17629-30-0 | D-Raffinose Pentahydrate | (3R,4S,5R,6R)-2-[[(2R,3S,4S,5R)-6-[(2S,3S,4S,5R)-3,4-dihydroxy-2,5-bis(hydroxymethyl)oxolan-2-yl]oxy-3,4,5-trihydroxyoxan-2-yl]methoxy]-6-(hydroxymethyl)oxane-3,4,5-triol pentahydrate | ||
1762-95-4 | Ammonium thiocyanate | Azanium;thiocyanate | ||
17636-10-1 | Sodium 3-mercaptopropanesulphonate | Sodium 3-sulfanylpropane-1-sulfonate | 2921.42 | |
1765-93-1 | (4-Fluorophenyl)boronic acid | (4-fluorophenyl)boronic acid | 2932.99 | |
17671-50-0 | Betaine citrate | 3206.41 | ||
17673-56-2 | Oleyl erucate | [(Z)-octadec-9-enyl] (Z)-docos-13-enoate | ||
17689-77-9 | Ethyltriacetoxysilane | [diacetyloxy(ethyl)silyl] acetate | 2931.9 | |
17695-46-4 | Butyryl 4-methylumbelliferone | (4-methyl-2-oxochromen-7-yl) butanoate | 2932.2 | |
17762-90-2 | Butylone hydrochloride | 1-(1,3-benzodioxol-5-yl)-2-(methylamino)butan-1-one hydrochloride | 2932.99 | |
17766-26-6 | Trithiocyanuric acid trisodium salt hydrate | 1,3,5-triazine-2,4,6 (1H,3H,5H)-trithione, trisodium salt | 2933.69 | |
1777-82-8 | Dichlorobenzyl alcohol | (2,4-dichlorophenyl)methanol | 2906.29 | |
17796-82-6 | N-cyclohexylthiophthalimide | 2-cyclohexylsulfanylisoindole-1,3-dione | ||
17804-35-2 | Benomyl ; Methyl 1-(butylcarbamoyl)benzimidazol-2-ylcarbamate | 2933.99 | ||
178326-57-3 | Zinc citrate trihydrate | Trizinc 2-hydroxypropane-1,2,3-tricarboxylate trihydrate | 2918.15 | |
1784-03-8 | Methyl N2-[(p-tolyl)sulphonyl]-L-argininate monohydrochloride | Methyl (2S)-5-carbamimidamido-2-(4-methylbenzenesulfonamido)pentanoate hydrochloride | 2935 | |
17852-98-1 | Pigment red 57, barium salt (1:1) | Barium(2+);(4Z)-4-[(4-methyl-2-sulfonatophenyl)hydrazinylidene]-3-oxonaphthalene-2-carboxylate | 3204.12 | |
178535-25-6 | Premium ds g | Ethylbenzene | 2827.392 | |
17865-07-5 | Propylsilanetriyl Triacetate | [diacetyloxy(propyl)silyl] acetate | 2931.9 | |
17865-32-6 | Cyclohexyl-dimethoxy-methylsilane | Cyclohexyl-dimethoxy-methylsilane | ||
178671-58-4 | 2-Propenoic acid, 2-cyano-3,3-diphenyl-2,2-bis(((2-cyano-1-oxo-3,3-diphenyl-2-propenyl)oxy)methyl)-1,3-propanediyl ester | 2926.9 | ||
1787-61-7 | Eriochrome Black T | Sodium (4Z)-4-[(1-hydroxynaphthalen-2-yl)hydrazinylidene]-7-nitro-3-oxonaphthalene-1-sulfonate | ||
178804-18-7 | 6-OH-BTA-0 (GMP) | 2-(4-aminophenyl)-1,3-benzothiazol-6-ol | 2845.9 | |
178949-82-1 | L-Aspartic acid, N,N'-1,2-ethanediylbis-, trisodium salt | Trisodium (2S)-2-[2-[[(1S)-2-carboxy-1-carboxylatoethyl]amino]ethylamino]butanedioate | 2922.49 | |
17927-72-9 | Bis(pentane-2,4-dionato-O,O')bis(propan-2-olato)titanium | 3815.9 | ||
179308-96-4 | Magnesium lactate dihydrate | Magnesium 2-hydroxypropanoate dihydrate | 2918.11 | |
17949-65-4 | Zinc Picolinate | Zinc pyridine-2-carboxylate | 2933.31 | |
17980-47-1 | Triethoxy(2-methylpropyl)silane | Triethoxy(2-methylpropyl)silane | 2931.9 | |
17997-47-6 | 2-(Tributylstannyl)pyridine | Tributyl(pyridin-2-yl)stannane | 2933.39 | |
180254-52-8 | PEG-10 Sunflower glycerides | 3402.13 | ||
18096-62-3 | Indolarome | 4,4a,5,9b-tetrahydroindeno[1,2-d][1,3]dioxine | 2932.99 | |
181028-79-5 | (1-methylethylidene)di-4,1-phenylene tetraphenyl diphosphate | 3824.9 | ||
18107-18-1 | Trimethylsilyldiazomethane | Diazomethyl(trimethyl)silane | 2931.9 | |
18109-81-4 | Butamirate citrate | 2-[2-(diethylamino)ethoxy]ethyl 2-phenylbutanoate;2-hydroxypropane-1,2,3-tricarboxylic acid | 2922.19 | |
1811-28-5 | Proflavine Hemisulfate | Acridine-3,6-diamine sulfuric acid | 2933.99 | 6 |
1812-30-2 | Bromazepam | 7-bromo-1,3-dihydro-5-(2-pyridyl)-2H-1,4-benzodiazepin-2-one | 9 | |
1812-53-9 | Dihexadecyldimethylammonium chloride | 3402.9 | ||
18138-04-0 | 2,3-Diethyl-5-methylpyrazine | 2,3-diethyl-5-methylpyrazine | 2933.99 | |
18144-43-9 | Isopropyl 4-aminobenzoate | Propan-2-yl 4-aminobenzoate | 2922.49 | |
18156-74-6 | N-(Trimethylsilyl)imidazole | Imidazol-1-yl(trimethyl)silane | 2933.29 | |
181587-01-9 | Ethiprole | 5-amino-1-[2,6-dichloro-4-(trifluoromethyl)phenyl]-4-(ethylsulfinyl)-1H-pyrazole-3-carbonitrile | 2933.19 | 8 |
18162-48-6 | Tert-butyldimethylchlorosilane | Tert-butyl-chloro-dimethylsilane | 2931.9 | |
181828-06-8 | Sodium of polyaspartic acid | 3402.9 | ||
18194-24-6 | 1,2-Dimyristoyl-SN-glycero-3-phosphocholine | [(2R)-2,3-di(tetradecanoyloxy)propyl] 2-(trimethylazaniumyl)ethyl phosphate | 2923.2 | |
18200-72-1 | Sodium 1-carboxylatoethyl stearate | Sodium 2-octadecanoyloxypropanoate | 2938.9 | |
1820-80-0 | 3-Aminopyrazole | 1H-pyrazol-5-amine | 2933.19 | |
1822-00-0 | (Trimethylsilyl)methyllithium | Lithium methanidyl(trimethyl)silane | 2931.9 | |
182410-00-0 | beta-Cyclodextrin sulfobutyl ethers sodium salts | 2940 | ||
18241-31-1 | Bis(4-methylbenzyl) oxalate | Bis(4-methylbenzyl) ethanedioate | 3815.9 | |
18267-08-8 | Zirconium(IV) Ethoxide | Ethanolate zirconium (4+) | 2905.19 | |
18282-10-5 | Pigment White 15 | Tin(IV) oxide | ||
18323-44-9 | Clindamycin | (2S,4R)-N-[(1S,2S)-2-chloro-1-[(2R,3R,4S,5R,6R)-3,4,5-trihydroxy-6-methylsulfanyloxan-2-yl]propyl]-1-methyl-4-propylpyrrolidine-2-carboxamide | 2941.9 | 6 |
183293-62-1 | 5-Amino-2-methylphenol sulfate | 5-amino-2-methylphenol sulfuric acid | 2922.29 | |
183476-82-6 | Ascorbyl Tetraisopalmitate | [(2S)-2-[(2R)-3,4-bis(2-hexyldecanoyloxy)-5-oxo-2H-furan-2-yl]-2-(2-hexyldecanoyloxy)ethyl] 2-hexyldecanoate | 2936.27 | |
183675-82-3 | Penthiopyrad | N-[2-(1,3-dimethylbutyl)-3-thienyl]-1-methyl-3-(trifluoromethyl)-1H-pyrazole-4-carboxamide | 2934.99 | |
18368-80-4 | Niobium isopropoxide | Niobium propan-2-ol | 2905.19 | |
18406-41-2 | Trimethoxy(2-trimethoxysilylethyl)silane | Trimethoxy(2-trimethoxysilylethyl)silane | 2931.9 | |
18423-43-3 | Thymidine 5'-triphosphate sodium salt | Trisodium [[[(2R,3S,5R)-3-hydroxy-5-(5-methyl-2,4-dioxopyrimidin-1-yl)oxolan-2-yl]methoxy-oxidophosphoryl]oxy-oxidophosphoryl] hydrogen phosphate | 2934.99 | |
1843-03-4 | 4-[4,4-bis(5-tert-butyl-4-hydroxy-2-methylphenyl)butan-2-yl]-2-tert-butyl-5-methylphenol | 4-[4,4-bis(5-tert-butyl-4-hydroxy-2-methylphenyl)butan-2-yl]-2-tert-butyl-5-methylphenol | 2907.19 | |
1843-05-6 | Octabenzone | (2-hydroxy-4-octoxyphenyl)-phenylmethanone | 2914.19 | |
18437281-03-2 | Synthetic paraffins | 2710.19 | ||
18437-66-6 | Tert-butyl N-(4-chlorophenyl)carbamate | Tert-butyl N-(4-chlorophenyl)carbamate | 2924.29 | |
18439-24-2 | Coenzyme A Trilithium Salt | Trilithium [(2R,3S,4R,5R)-5-(6-aminopurin-9-yl)-4-hydroxy-2-[[[[3-hydroxy-2,2-dimethyl-4-oxo-4-[[3-oxo-3-(2-sulfanylethylamino)propyl]amino]butoxy]-oxidophosphoryl]oxy-oxidophosphoryl]oxymethyl]oxolan-3-yl] hydrogen phosphate | 2934.99 | |
18466-51-8 | Pelargonidin 3-glucoside | (2S,3R,4S,5S,6R)-2-[5,7-dihydroxy-2-(4-hydroxyphenyl)chromenylium-3-yl]oxy-6-(hydroxymethyl)oxane-3,4,5-triol chloride | 2938.9 | |
184706-97-6 | Dibutyloctyl Sebacate | Decanedioic acid,1,10-bis(2-butyloctyl) ester | 2917.13 | |
18472-51-0 | Chlorhexidine Gluconate | (1E)-2-[6-[[amino-[(E)-[amino-(4-chloroanilino)methylidene]amino]methylidene]amino]hexyl]-1-[amino-(4-chloroanilino)methylidene]guanidine;(2R,3S,4R,5R)-2,3,4,5,6-pentahydroxyhexanoic acid | 2925.29 | 6 |
18472-87-2 | Acid red 92 ; Phloxin B | 3,4,5,6-tetrachloro-2-(1,4,5,8-tetrabromo-6-hydroxy-3-oxoxanthen-9-yl)benzoic acid | ||
1847-58-1 | Sodium lauryl sulfoacetate | Sodium 2-(dodecyloxy)-2-oxoethanesulfonate | 3402.19 | |
18479-58-8 | Dihydromyrcenol | 2,6-dimethyloct-7-en-2-ol | 2905.29 | |
184830-08-8 | Tetrasodium Cystinyl Disuccinate | Tetrasodium 4-[[(1R)-1-carboxylato-2-[[(2R)-2-carboxylato-2-(3-carboxylatopropanoylamino)ethyl]disulfanyl]ethyl]amino]-4-oxobutanoate | 2930.9 | |
1849-36-1 | 4-Nitrobenzenethiol | 4-Nitrobenzenethiol | 2930.9 | |
18496-40-7 | Platinum nitrate | Platinum(2+);dinitrate | 2843.9 | |
18497-13-7 | Hexachloroplatinic(IV) acid hexahydrate | Tetrachloroplatinum ; hydrate; dihydrochloride | 2843.9 | |
18503-90-7 | 1,1-Dibutoxy-N,N-dimethylmethanamine | 1,1-dibutoxy-N,N-dimethylmethanamine | 2924.19 | |
185041-05-8 | Methyl 2-chloro-4-iodopyridine-3-carboxylate | Methyl 2-chloro-4-iodopyridine-3-carboxylate | 2933.39 | |
1852-04-6 | Undecanedioic Acid | Undecanedioic Acid | 2917.19 | |
1852-16-0 | N-(Butoxymethyl)acrylamide | N-(butoxymethyl)prop-2-enamide | 2924.19 | |
18531-94-7 | Binol | 1-(2-hydroxynaphthalen-1-yl)naphthalen-2-ol | 2907.29 | |
1854-26-8 | Dimethylol dihydroxyethyleneurea | 4,5-dihydroxy-1,3-bis(hydroxymethyl)imidazolidin-2-one | 3824.9 | |
185630-72-2 | Hazelnut oil | 3301.9 | ||
18600-59-4 | 2,2'-(1,4-Phenylene)bis(3,1-benzoxazin-4-one) | 2-[4-(4-oxo-3,1-benzoxazin-2-yl)phenyl]-3,1-benzoxazin-4-one | 2934.99 | |
18602-17-0 | [3-(dodecyloxy)-2-hydroxypropyl]bis(2-hydroxyethyl)methylammonium methyl sulphate | 3824.9 | ||
186028-79-5 | Methylone (Beta-keto-MDMA) | (RS)- 2-methylamino-1- (3,4-methylenedioxy phenyl)propan-1-one | 2932.99 | 7 |
186028-80-8 | Methylone Hydrochloride | 1-(1,3-benzodioxol-5-yl)-2-(methylamino)propan-1-one;hydrochloride | 2933.91 | |
18618-55-8 | Cerium(III) chloride heptahydrate | Trichlorocerium; heptahydrate | 2846.1 | |
1862-07-3 | 6-Dimethylamino-1-hexanol | 6-(dimethylamino)hexan-1-ol | 2922.19 | |
1863-63-4 | Ammonium benzoate | Ammonium benzoate | 3402.9 | |
186511-05-7 | PEG-10 Sunflower glycerides | 3402.13 | ||
1866-15-5 | Acetylthiocholine Iodide | 2-acetylsulfanylethyl(trimethyl)azanium iodide | 2930.9 | |
186692-46-6 | Roscovitine | (2R)-2-[[6-(benzylamino)-9-propan-2-ylpurin-2-yl]amino]butan-1-ol | 2933.59 | |
1867-66-9 | Ketamine Hydrochloride | 2-(2-chlorophenyl)-2-(methylamino)cyclohexan-1-one hydrochloride | 9 | |
186826-86-8 | Moxifloxacin Hydrochloride | 7-[(4aS,7aS)-1,2,3,4,4a,5,7,7a-octahydropyrrolo[3,4-b]pyridin-6-yl]-1-cyclopropyl-6-fluoro-8-methoxy-4-oxoquinoline-3-carboxylic acid;hydrochloride | 2941.9 | |
18686-82-3 | 3H-1,3,4-Thiadiazole-2-thione | 3H-1,3,4-thiadiazole-2-thione | 2934.99 | |
18711-16-5 | 6,7-Dichloro-3-(hydroxyamino)indol-2-one | 6,7-dichloro-3-(hydroxyamino)indol-2-one | 2933.79 | |
1871-22-3 | Tetrazolium Blue ; 2-[4-[4-(3,5-diphenyltetrazol-2-ium-2-yl)-3-methoxyphenyl]-2-methoxyphenyl]-3,5-diphenyltetrazol-2-ium;dichloride | 3,3'-(3,3'-dimethoxy-4,4'-biphenylene)bis(2,5-diphenyl-2H-tetrazolium) chloride | ||
1871-89-2 | N,N'-Bis(2-hydroxyethyl)oxamide | N,N'-bis(2-hydroxyethyl)oxamide | 2924.19 | |
18719-76-1 | Keracyanin | (2R,3R,4R,5R,6S)-2-[[(2R,3S,4S,5R,6S)-6-[2-(3,4-dihydroxyphenyl)-5,7-dihydroxychromenylium-3-yl]oxy-3,4,5-trihydroxyoxan-2-yl]methoxy]-6-methyloxane-3,4,5-triol;chloride | 2938.9 | |
1873-55-8 | 3-Methyl-1-oxidoquinolin-1-ium | 3-methyl-1-oxidoquinolin-1-ium | 2933.49 | |
187393-00-6 | Bemotrizinol | (6E)-3-(2-ethylhexoxy)-6-[(4Z)-4-[4-(2-ethylhexoxy)-6-oxocyclohexa-2,4-dien-1-ylidene]-6-(4-methoxyphenyl)-1H-1,3,5-triazin-2-ylidene]cyclohexa-2,4-dien-1-one | ||
18744-58-6 | Barium disodium ethylenediaminetetraacetate hydrate | 3824.9 | ||
1879-09-0 | Butylated Xylenol | 2-tert-butyl-4,6-dimethylphenol | 2907.19 | |
18791-02-1 | 2,3-Dibromopropionyl chloride | 2,3-dibromopropanoyl chloride | 2915.9 | |
188012-57-9 | Amine modified polyether acrylate | 2-[2,2-bis({[2-(prop-2-enoyloxy)ethoxy]methyl})butoxy]ethyl prop-2-enoate | 2916.12 | |
188023-86-1 | Phenothrin | (3-phenoxyphenyl)methyl 2,2-dimethyl-3-(2-methylprop-1-enyl)cyclopropane-1-carboxylate | 2916.2 | |
188062-50-2 | Abacavir Sulfate | [(1S,4R)-4-[2-amino-6-(cyclopropylamino)purin-9-yl]cyclopent-2-en-1-yl]methanol sulfuric acid | 2942 | 6 |
18810-58-7 | Barium azide (Ba(N3)2) | Barium(2+);diazide | 2850 | 3 |
18819-89-1 | Tetrabutylammonium Benzoate | Tetrabutylazanium benzoate | 2923.9 | |
18820-29-6 | Manganese sulfide | Sulfanylidenemanganese | 2830.9 | |
18820-82-1 | Pyridine Hydrobromide | Pyridine hydrobromide | 2933.31 | |
1882-69-5 | 5-Methoxy-2-nitrobenzoic acid | 5-Methoxy-2-nitrobenzoic acid | 2918.99 | |
18829-55-5 | Butylacrolein | (E)-hept-2-enal | 2912.19 | |
18829-70-4 | Cianidanol | (2S,3R)-2-(3,4-dihydroxyphenyl)-3,4-dihydro-2H-chromene-3,5,7-triol | 2932.99 | |
1885-14-9 | Phenyl Chloroformate | Phenyl carbonochloridate | 2915.9 | |
1885-38-7 | Cinnamonitrile | (E)-3-phenylprop-2-enenitrile | 2926.9 | |
18871-14-2 | (3-Pentyloxan-4-yl) acetate | (3-pentyloxan-4-yl) acetate | 2942 | |
18883-66-4 | Streptozotocin | 1-methyl-1-nitroso-3-[2,4,5-trihydroxy-6-(hydroxymethyl)oxan-3-yl]urea | 2941.9 | |
18908-20-8 | Polyisobutylene succinic anhydride | 3-(2-methylprop-2-enyl)oxolane-2,5-dione | 2917.19 | |
18917-91-4 | Aluminium trilactate | 3824.9 | ||
18917-93-6 | Magnesium Lactate | Magnesium 2-hydroxypropanoate | 2918.11 | |
18925-10-5 | Allylzinc bromide | 2931.9 | ||
1892-57-5 | 1-Ethyl-3-(3-dimethylaminopropyl)carbodiimide | 3-(ethyliminomethylideneamino)-N,N-dimethylpropan-1-amine | 2933.99 | |
18940-57-3 | 1-(4-Acetylpiperazin-1-yl)ethanone | 1-(4-acetylpiperazin-1-yl)ethanone | 2933.59 | |
1897-45-6 | Chlorothalonil | 2,4,5,6-tetrachlorobenzene-1,3-dicarbonitrile | 2926.9 | 8 |
18979-61-8 | 4-Butylresorcinol | 4-butylbenzene-1,3-diol | ||
1898-66-4 | 2,2-Diphenyl-1-picrylhydrazyl | 2,2-Diphenyl-1-picrylhydrazyl | ||
19004-19-4 | Calcium nitrate | Dicopper; tetranitrate; pentahydrate | 2834.29 | |
190085-41-7 | 2-Butyloctyl 2-hydroxybenzoate | 2-Butyloctyl 2-hydroxybenzoate | 2918.23 | |
190086-12-5 | Solvent yellow 93 | (4E)-5-methyl-4-[(3-methyl-5-oxo-1-phenyl-4H-pyrazol-4-yl)methylidene]-2-phenylpyrazol-3-one | 3204.9 | |
19035-79-1 | Potassium hexadecyl hydrogen phosphate | |||
19046-64-1 | Dibenzylidene D-Sorbitol | (1R)-1-[(4R,4aR,8aS)-2,6-diphenyl-4,4a,8,8a-tetrahydro-[1,3]dioxino[5,4-d][1,3]dioxin-4-yl]ethane-1,2-diol | 2905.44 | |
1908-87-8 | 3-methylthiazolidine-2-thione | 3-methylthiazolidine-2-thione | 3812.1 | |
19090-60-9 | Ammonium adipate | Diazanium;hexanedioate | 2836.99 | |
1910-42-5 | Paraquat dichloride | 1,1'-dimethyl-4,4'-bipyridinium dichloride | 2933.39 | 8 |
191-07-1 | Coronene | Coronene | 2902.9 | |
191217-81-9 | Pramipexole Dihydrochloride | (6S)-6-N-propyl-4,5,6,7-tetrahydro-1,3-benzothiazole-2,6-diamine;hydrate;dihydrochloride | 2934.2 | |
1912-24-9 | Atrazine | 2933.69 | 8 | |
191-26-4 | Anthranthrene | 2902.9 | ||
19154-63-3 | Zinc nitrate tetrahydrate | Zinc;dinitrate;tetrahydrate | 2834.29 | |
192139-92-7 | RuCl(p-cymene)[(R,R)-Ts-DPEN] | Dichlororuthenium;1-methyl-4-propan-2-ylbenzene | 2843.9 | |
19223-55-3 | Lauramidopropyl hydroxysultaine | 3402.11 | ||
19224-26-1 | Propylene Glycol Dibenzoate | 2-benzoyloxypropyl benzoate | 2916.31 | |
192268-64-7 | 1,6-Hexanediamine, N1,N6-bis(2,2,6,6-tetramethyl-4-piperidinyl)-, polymer with 2,4,6-trichloro-1,3,5-triazine, reaction products with, N-butyl-1-butanamine and N-butyl-2,2,6,6-tetramethyl-4-piperidinamine | 3812.3 | ||
19237-84-4 | Prazosin Hydrochloride | [4-(4-amino-6,7-dimethoxyquinazolin-2-yl)piperazin-1-yl]-(furan-2-yl)methanone;hydrochloride | 2934.99 | 6 |
192725-17-0 | Lopinavir | (2S)-N-[(2S,4S,5S)-5-[[2-(2,6-dimethylphenoxy)acetyl]amino]-4-hydroxy-1,6-diphenylhexan-2-yl]-3-methyl-2-(2-oxo-1,3-diazinan-1-yl)butanamide | 2942 | 6 |
192927-63-2 | Moxifloxacin Hydrochloride Monohydrate | 7-[(4aS,7aS)-1,2,3,4,4a,5,7,7a-octahydropyrrolo[3,4-b]pyridin-6-yl]-1-cyclopropyl-6-fluoro-8-methoxy-4-oxoquinoline-3-carboxylic acid;hydrate;hydrochloride | 2941.9 | |
1929-82-4 | Nitrapyrin | 2-chloro-6-(trichloromethyl)pyridine | 2933.99 | |
19315-93-6 | 6-Hydroxyquinoline | 6-hydroxy-1H-quinolin-2-one | 2933.79 | |
1932110-67-2 | Norepinephrine Impurity D | 4-[(1R)-2-Amino-1-methoxyethyl]benzene-1,2-diol | 2922.5 | |
19337-97-4 | 3-Pyridylacrylic acid | (E)-3-pyridin-3-ylprop-2-enoic acid | 2933.39 | |
1934-21-0 | Tartrazine ; Acid yellow 23 | Trisodium 5-hydroxy-1-(4-sulfonatophenyl)-4-(4-sulfonatophenylazo)pyrazole-3-carboxylate | 3212.9 | |
1934-75-4 | Sodium Dicyanamide | Sodium dicyanoazanide | 2926.9 | |
1936-15-8 | Acid Orange 10 ; C.I. 16230 | Disodium 7-hydroxy-8-phenylazonaphthalene-1,3-disulfonate | 3204.12 | |
1937-19-5 | Pimagedine Hydrochloride | 2-aminoguanidine hydrochloride | 2928 | |
19372-44-2 | Bis(pentane-2,4-dionato)calcium; calcium acetylacetonate | calcium bis(2,4-dioxopentan-3-ide) | 3812.3 | |
1937-35-5 | Direct red 13 | 3204.14 | ||
1937-37-7 | Direct black 38 | 3204.14 | ||
1937-62-8 | Methyl Elaidate | Methyl (E)-octadec-9-enoate | 2916.19 | |
19381-50-1 | Acid green 1 | 3204.16 | ||
19387-91-8 | Tinidazole | 1-(2-ethylsulfonylethyl)-2-methyl-5-nitroimidazole | 2933.29 | |
1939-36-2 | Trimethylenediaminetetraacetic Acid | 2-[3-[bis(carboxymethyl)amino]propyl-(carboxymethyl)amino]acetic acid | 2922.49 | |
19395-40-5 | 2-Phenyl-2-piperidin-2-ylacetic acid hydrochloride | 2-phenyl-2-piperidin-2-ylacetic acid hydrochloride | 2933.39 | |
194043-92-0 | Shea butter | 3302.9 | ||
19408-46-9 | Kasugamycin hydrochloride hydrate | 3808.92 | 8 | |
1941-30-6 | Tetrapropylammonium Bromide | Tetrapropylazanium bromide | 2923.9 | |
19438-60-9 | 4-Methylhexahydrophthalic anhydride | 5-methyl-3a,4,5,6,7,7a-hexahydro-2-benzofuran-1,3-dione | 2917.39 | |
19438-61-0 | 4-Methylphthalic anhydride | 5-methyl-2-benzofuran-1,3-dione | 2917.39 | |
19438-64-3 | 4-Methyl-delta-3-tetrahydrophthalic anhydride | 6-methyl-3a,4,5,7a-tetrahydro-2-benzofuran-1,3-dione | 2917.39 | |
1944-12-3 | Fenoterol Hydrobromide | 5-[1-hydroxy-2-[1-(4-hydroxyphenyl)propan-2-ylamino]ethyl]benzene-1,3-diol;hydrobromide | 2922.5 | 6 |
1945-77-3 | Methylthymol Blue | 2934.99 | ||
1948-33-0 | Tert-butylhydroquinone | 2-tert-butylbenzene-1,4-diol | 2907.29 | |
19493-44-8 | 1-Chloroisoquinoline | 1-chloroisoquinoline | 2933.49 | |
19524-06-2 | 4-Bromopyridinium chloride | 4-bromopyridine hydrochloride | 2933.39 | |
1953-04-4 | Galantamine Hydrobromide | (4aS,6R,8aS)-3-Methoxy-11-methyl-5,6,9,10,11,12-hexahydro-4aH-benzo[2,3]benzofuro[4,3-cd]azepin-6-ol hydrobromide | 2939.99 | |
1953-54-4 | 5-Hydroxyindole | 1H-indol-5-ol | 2933.99 | |
1955-67-5 | Glutamine Hydroxamate | (2S)-2-amino-5-(hydroxyamino)-5-oxopentanoic acid | 2922.42 | |
1956-09-8 | 4-Nitrophenyl decanoate | (4-nitrophenyl) decanoate | 2915.9 | |
1956-10-1 | 4-Nitrophenyl octanoate | (4-nitrophenyl) octanoate | 2915.9 | |
1956-11-2 | 4-Nitrophenyl laurate | (4-nitrophenyl) dodecanoate | 2915.9 | |
19598-90-4 | Gadolinium(III) nitrate hexahydrate | Gadolinium(3+); trinitrate; hexahydrate | 2846.9 | |
196212-27-8 | 1,3-Phenyldiboronic acid, bis(pinacol) ester | 4,4,5,5-tetramethyl-2-[3-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]-1,3,2-dioxaborolane | 2942 | |
196309-76-9 | (2E)-3-(4-tert-butylbenzenesulfonyl)prop-2-enenitrile | (2E)-3-(4-tert-butylbenzenesulfonyl)prop-2-enenitrile | 2930.9 | |
19666-30-9 | Oxadiazon | 5-tert-butyl-3-(2,4-dichloro-5-propan-2-yloxyphenyl)-1,3,4-oxadiazol-2-one | 2934.99 | 8 |
1972-08-3 | Dronabinol | (6aR,10aR)-6,6,9-trimethyl-3-pentyl-6a,7,8,10a-tetrahydrobenzo[c]chromen-1-ol | 2933.91 | |
19800-42-1 | Disperse orange 29 | 3204.11 | ||
1981-58-4 | Sulfamethazine Sodium | Sodium (4-aminophenyl)sulfonyl-(4,6-dimethylpyrimidin-2-yl)azanide | 2935 | |
1984-06-1 | Sodium caprylate | Sodium octanoate | 2915.9 | |
19847-12-2 | Pyrazinecarbonitrile | Pyrazine-2-carbonitrile | 2933.99 | |
1985-12-2 | 4-Bromophenyl isothiocyanate | 1-bromo-4-isothiocyanatobenzene | 2930.9 | |
198-55-0 | Perylene | Perylene | 2902.9 | |
1985-51-9 | Neopentyl glycol dimethacrylate | [2,2-dimethyl-3-(2-methylprop-2-enoyloxy)propyl] 2-methylprop-2-enoate | 2916.14 | |
1987-71-9 | Niacinamide ascorbate | (2R)-2-[(1S)-1,2-dihydroxyethyl]-3,4-dihydroxy-2H-furan-5-one;pyridine-3-carboxamide | 2936.9 | |
199119-58-9 | Trifloxysulfuron-sodium | Sodium 4,6-dimethoxy-2-[({[3-(2,2,2-trifluoroethoxy)pyridin-2-yl]sulfonyl}carbamoyl)imino]-2H-pyrimidin-1-ide | 2935.9 | |
1991-80-6 | 4-Bromo-L-phenylalanine | (2S)-2-amino-3-(4-bromophenyl)propanoic acid | 2922.49 | |
20018-09-1 | Diiodomethyl-p-tolyl sulfone | 2930.9 | ||
2001-95-8 | Potassium ionophore I | 2941.9 | ||
2001-96-9 | P-Nitrophenyl B, D-xylopyranoside | 2940 | ||
20038-12-4 | 4-bromo-2-methylbut-1-ene | 2903.39 | ||
20039-37-6 | Pyridinium dichromate | Pyridinium dichromate | 2933.31 | |
20069-09-4 | Piperlongumine | 2933.79 | ||
2008-39-1 | 2,4-D-dimethylammonium | Dimethylammonium 2,4-dichlorophenoxyacetate | 2921.11 | 8 |
2011-67-8 | Nimetazepam | 1,3-dihydro-1-methyl-7-nitro-5-phenyl-2H-1,4- benzodiazepin-2-one | 2933.99 | 9 |
20120-33-6 | Flame retardant FRC-2 | 3-dimethoxyphosphoryl-N-(hydroxymethyl)propanamide | ||
201290-01-9 | Silanamine, N-[3-(diethoxymethylsilyl)propyl]-1,1,1-trimethyl-N-(trimethylsilyl)- | 2931.1 | ||
201363-52-2 | PPG-2 Hydroxyethyl Cocamide | 3402.19 | ||
201422-03-9 | Protein kinase A inhibitor 14-22 amide, cell-permeable, myristoylated | 2925.29 | ||
2014-23-5 | [2-(2,6-dimethylphenoxy)-2-oxoethyl]-diethylazanium;chloride | 2909.6 | ||
201530-41-8 | Deferasirox | 4-[3,5-bis(2-hydroxyphenyl)-1H-1,2,4-triazol-1-yl]benzoic acid | 2933.99 | |
201611-92-9 | 4-Cyano-4-(phenylcarbonothioylthio)pentanoic acid | 2930.9 | ||
2016-88-8 | Amiloride hydrochloride | 2922.5 | ||
201802-67-7 | 4-(Diphenylamino)phenylboronic acid | 2931.9 | ||
20182-63-2 | Stearamidopropyl dimethylamine | N-[3-(dimethylamino)propyl]octadecanamide | 3404.9 | |
20211-76-1 | Lanthanum chloride heptahydrate | Trichlorolanthanum; hydrate | 2827.39 | |
202138-50-9 | Tenofovir disoproxil fumarate | Bis[(isopropyloxycarbonyloxy)methyl [(R)-2-(6-amino-9H-purin-9-yl)-1-methylethoxy]methylphosphonate—fumaric acid (1:1) | 2933.99 | 6 |
2022-85-7 | 5-Fluorocytosine | 4-amino-5-fluoropyrimidin-2(1H)-one | 2933.59 | |
202409-33-4 | Etoricoxib | 2933.99 | ||
202420-04-0 | Chlorotolyl triazole sodium salt | 2933.99 | ||
202483-55-4 | 7-Oxa-3,20-diazadispiro[5.1.11.2]heneicosan-21-one, 2,2,4,4-tetramethyl-, hydrochloride (1:?), reaction products with epichlorohydrin, hydrolyzed, polymd. | 3812.3 | ||
20263-06-3 | DL-2-Amino-3-phosphonopropionic acid | 2931.9 | ||
20265-97-8 | P-Anisidine hydrochloride | p-anisidine hydrochloride | 2922.29 | |
202667-65-0 | Synthetic wax copolymer of α-olefin and maleic anhydride | 3404.9 | ||
2027-47-6 | 9-Octadecenoic acid | (9E)-octadec-9-enoic acid | 3823.12 | |
20277-92-3 | N,N'-Diphenyl guanidine | |||
20283-92-5 | Rosmarinic acid | 2918.99 | ||
20296-29-1 | Fragrance of 3-Octanol | Octan-3-ol | 3302.9 | |
2030-63-9 | Clofazimine | (3E)-N,5-bis(4-chlorophenyl)-3-(propan-2-ylimino)-3,5-dihydrophenazin-2-amine | 2922.19 | 6 |
2031-67-6 | Triethoxymethylsilane | Triethoxy(methyl)silane | 2931.9 | |
20317-19-5 | Reactive yellow 17 | 3204.16 | ||
20325-40-0 | O-Dianisidine dihydrochloride | 3,3'-dimethoxybiphenyl-4,4'-ylenediammonium dichloride | ||
203255-81-6 | 2-tert-butyl-6-methyl-4-[3-(2,4,8,10-tetratert-butylbenzo[d][1,3,2]benzodioxaphosphepin-6-yl)oxypropyl]phenol | |||
203313-25-1 | Spirotetramat | (5s,8s)-3-(2,5-dimethylphenyl)-8-methoxy-2-oxo-1-azaspiro[4.5]dec-3-en-4-yl ethyl carbonate | 2933.79 | |
20344-49-4 | Iron hydroxide oxide | Hydroxy(oxo)iron | 2821.1 | |
2037-26-5 | Toluene-d8 | 1,2,3,4,5-pentadeuterio-6-(trideuteriomethyl)benzene | 2845.9 | |
20395-16-8 | 1,3,5-Triazine-2,4,6(1H,3H,5H)-trione, 1-(2-oxiranylMethyl)-3,5-di-2-propen-1-yl- | 2933.39 | ||
20398-34-9 | Adenosine 5′-diphosphate sodium salt | 2934.99 | ||
2039-88-5 | 1-bromo-2-ethenylbenzene | 2-bromostyrene | 2903.99 | |
2042-37-7 | 2-Bromobenzonitrile | 2-bromobenzonitrile | 2926.9 | |
204255-11-8 | Oseltamivir phosphate | 2924.29 | 6 | |
20427-59-2 | Copper(II) hydroxide | Copper dihydroxide | 2825.5 | 8 |
2043-61-0 | Cyclohexanecarbaldehyde | Cyclohexanecarbaldehyde | 2912.29 | |
20445-33-4 | (S)-(+)-alpha-Methoxy-alpha-(trifluoromethyl)phenylacetyl chloride | 2921.11 | ||
2044-64-6 | N,N-dimethylacetoacetamide | N,N-dimethylacetoacetamide | 2924.19 | |
204583-39-1 | Phenol, 2-[4,6-bis([1,1'-biphenyl]-4-yl)-1,3,5-triazin-2-yl]-5-[(2-ethylhexyl)oxy]- | 2933.99 | ||
20461-70-5 | Sodium methyl caproyl taurate | 3402.11 | ||
204848-45-3 | Propanoic acid,2-[4-[4,6-bis([1,1'-biphenyl]-4-yl)-1,3,5-triazin-2-yl]-3-hydroxyphenoxy]-,isooctyl ester | 2933.69 | ||
2050-08-0 | Amyl salicylate | Pentyl salicylate | 2918.23 | |
2051-49-2 | Hexanoic anhydride | Hexanoic anhydride | 2915.9 | |
2052-49-5 | Tetrabutylamminonium hydroxide | Tetrabutylammonium hydroxide | 2923.9 | |
20559-55-1 | Oxibendazole | Methyl (5-propoxy-1H-benzimidazol-2-yl)carbamate | 2933.99 | |
20562-02-1 | α-Solanine | Solanine | 2939.99 | |
20570-96-1 | Benzylhydrazine dihydrochloride | Benzylhydrazine dihydrochloride | 2928 | |
205-82-3 | Benzo[j]fluoranthene | Benzo[j]fluoranthene | 2902.9 | |
2058-46-0 | Oxytetracycline hydrochloride | 2941.3 | 8 | |
20603-88-7 | Manganese(II) chloride dihydrate | Dichloromanganese | 2827.39 | |
20624-25-3 | Sodium diethyldithiocarbamate trihydrate | 2930.2 | ||
2062-78-4 | Pimozide | 1-{1-[4,4-bis(4-fluorophenyl)butyl]piperidin-4-yl}-1,3-dihydro-2H-benzimidazol-2-one | 2933.39 | |
20629-90-7 | 1-(3'-Chlorophenyl)-3-methyl-5-pyrazolone | 2931.9 | ||
20634-12-2 | Tetraammineplatinum(II) nitrate | Azane; nitric acid; platinum | 2843.9 | |
20642-05-1 | Potassium Diformate | 2942 | ||
206-44-0 | Fluoranthene | Fluoranthene | 2902.9 | |
2065-66-9 | Methyltriphenylphosphonium iodide | 2931.9 | ||
20661-21-6 | Indium hydroxide | Indium(3+) trihydroxide | 2829.9 | |
20667-12-3 | Silver(I) oxide | Argentiooxysilver | 2843.29 | |
206752-32-1 | Azaomethin-H monosodium salt hydrate | 2929.9 | ||
206986-87-0 | Sodium cholate hydrate | 2918.19 | ||
206996-60-3 | Cerium(III) acetate | Cerium(3+); triacetate; hydrate | 2846.1 | |
20701-68-2 | Octadecenedioic acid | 2917.19 | ||
2071-20-7 | Bis(diphenylphosphino)methane | 2931.9 | ||
207300-90-1 | 1-Heptanesulfonic acid sodium salt monohydrate ; Sodium 1-heptanesulfonate monohydrate | 2904.1 | ||
207300-91-2 | Sodium 1-hexanesulfonate monohydrate ; 1-Hexanesulfonic acid sodium salt monohydrate | 2904.1 | ||
20734-58-1 | 1,8-Bis(Dimetylamino)naphthalene | 2921.59 | ||
207386-83-2 | Hippuryl-His-Leu | 2933.29 | ||
207386-91-2 | 8-Hydroxyquinoline sulfate monohydrate | Quinolin-8-ol sulfuric acid hydrate | ||
207398-97-8 | Indium(III) nitrate hydrate | Indium(+3) trinitrate hydrate | 2834.29 | |
20749-68-2 | Solvent red 135 | 8,9,10,11-tetrachloro-12H-isoindolo[2,1-a]perimidin-12-one | 3206.11 | |
207511-10-2 | Melezitose monohydrate | (2R,3R,4S,5S,6R)-2-[(2S,3S,4R,5R)-4-hydroxy-2,5-bis(hydroxymethyl)-2-[(2R,3R,4S,5S,6R)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxyoxolan-3-yl]oxy-6-(hydroxymethyl)oxane-3,4,5-triol hydrate | 3821 | |
207569-04-8 | 2-Naphthalenecarboxamide, 7-bromo-N-(2-methoxyphenyl)-3-(phosphonooxy)-, disodium salt hydrate | 2924.29 | ||
207596-29-0 | Sodium 1-octanesulfonate monohydrate | 2904.1 | ||
207596-32-5 | Palladium(II) nitrate hydrate | Palladium(2+); dinitrate; hydrate | 2843.9 | |
207605-40-1 | Sodium 1-pentanesulfonate monohydrate | 2904.1 | ||
20765-98-4 | Rhodium(III) chloride hydrate | Trichlororhodium; hydrate | 2843.9 | |
207671-42-9 | 2,4-Pyridinedicarboxylic acid monohydrate | 2933.39 | ||
207683-19-0 | Sodium hydrosulfide hydrate | Sodium; sulfanide; hydrate | 2830.1 | |
207683-22-5 | Sodium tetrakis(4-fluorophenyl)borate dihydrate | 2931.9 | ||
20769-85-1 | 2-bromo-2-methylpropanoyl bromide | 2-bromo-2-methylpropionyl bromide | 2914.7 | |
20770-40-5 | Citronellyl seneciate | Citronellyl 3-methylcrotonate | ||
207739-72-8 | N2,N2,N2′,N2′,N7,N7,N7′,N7′-octakis(4-methoxyphenyl)-9,9′-spirobi[9H-fluorene]-2,2′,7,7′-tetramine | 2922.29 | ||
20777-49-5 | Dihydrocarvyl acetate | 2915.39 | ||
20779-13-9 | 1,5-Naphthalenedisulfonic acid dimethyl ester | 2904.1 | ||
20780-76-1 | 5-Iodoisatin | 2933.79 | ||
20786-60-1 | Potassium borate | Potassium;dihydrogen borate | 3707.1 | |
2078-71-9 | 2-Hydroxyethyl urea | 2924.19 | ||
20816-12-0 | Osmium tetraoxide | Tetraoxoosmium | 2843.9 | 3 |
20824-56-0 | Diammonium EDTA | Diammonium dihydrogen ethylenediaminetetraacetate | 2922.49 | |
208255-51-0 | γ-Secretase Inhibitor XVI | 2922.5 | ||
208255-80-5 | N-[N-(3,5-Difluorophenacetyl)-L-alanyl]-S-phenylglycine t-butyl ester | 2924.29 | ||
2082-79-3 | Octadecyl 3-(3,5-di-tert-butyl-4-hydroxyphenyl)propionate | Octadecyl 3-(3,5-di-tert-butyl-4-hydroxyphenyl)propionate | ||
2082-81-7 | 1,4 Butanediol dimethacrylate | Tetramethylene dimethacrylate | ||
20830-75-5 | Digoxin | (3β,5β,12β)-3-{[2,6-dideoxy-β-D-ribo-hexopyranosyl-(1→4)-2,6-dideoxy-β-D-ribo-hexopyranosyl-(1→4)-2,6-dideoxy-β-D-ribo-hexopyranosyl]oxy}-12,14-dihydroxycard-20(22)-enolide | 2938.9 | |
2084-19-7 | 2-Pentanethiol | 2930.9 | ||
20859-73-8 | Aluminium phosphide | Aluminium phosphide | 2853.9 | |
2092-56-0 | Pigment red 53 | Benzenesulfonic acid, 5-chloro-2-[(2-hydroxy-1-naphthalenyl)azo]-4-methyl-, monosodium salt | 3212.9 | |
2092991-05-2 | Modified phenol-formaldehyde condensate | 3202.9 | ||
209414-07-3 | JWH-018 | Naphthalene-1-yl(1-pentyl-1H-indol-3-yl)methanone | 2933.99 | 9 |
20941-65-5 | Tellurium diethyldithiocarbamate | Tetrakis(diethyldithiocarbamato-S,S')tellurium | ||
2094-72-6 | 1-Adamantanecarbonyl chloride | Tricyclo[3.3.1.1'3,7]decane-1-carbonyl chloride | 2916.2 | |
2094-98-6 | 1,1'-Azobis(cyclohexane-1-carbonitrile)(V-40)V-40 | 2927 | ||
2094-99-7 | a,a -Dimethyl meta-Isopropenyl benzyl isocyanate | 1-(2-isocyanatopropan-2-yl)-3-(prop-1-en-2-yl)benzene | 2929.1 | |
2095-03-6 | Fragrance of bisphenol F Diglycidyl Ether | 2,2'-[methanediylbis(benzene-4,1-diyloxymethanediyl)]dioxirane | 3301.9 | |
209986-17-4 | (S,S)- 2-[2-(3,5-Difluorophenyl)-acetylamino]-N-(1-methyl-2-oxo-5-phenyl-2,3-dihydro-1H-benzo[e][1,4]diazepin-3-yl)-propionamide, Compound E | 2933.99 | ||
210345-03-2 | Caspase-9 substrate L fluorogenic | 3822 | ||
21041-93-0 | Cobalt(II) hydroxide | Cobalt(2+) dihydroxide | 2822 | |
2104695-66-9 | (2-Bromo-4,5-dimethoxyphenoxy)trimethylsilane | 2917.19 | ||
21050-13-5 | Bis(triphenylphosphoranylidene)ammonium chloride | 2931.9 | ||
2105-43-3 | Fursultiamine hydrochloride | 2936.22 | ||
21087-64-9 | Metribuzin ; 4-amino-6-tert-butyl-3-methylthio-1,2,4-triazin-5-one | 2933.69 | 8 | |
210880-92-5 | Clothianidin | 1-[(2-chloro-1,3-thiazol-5-yl)methyl]-2-methyl-3-nitroguanidine | 8 | |
21104-28-9 | Mahanimbine | 2939.99 | ||
2110-78-3 | Methyl 2-hydroxyisobutyrate | Methyl 2-hydroxy-2-methylpropionate | 2918.19 | |
21145-77-7 | 1-(5,6,7,8-tetrahydro-3,5,5,6,8,8-hexamethyl-2-naphthyl)ethan-1-one | 1-(3,5,5,6,8,8-hexamethyl-5,6,7,8-tetrahydronaphthalen-2-yl)ethanone | 2914.29 | |
211510-16-6 | Benzeneacetic acid, a-oxo-,1,1'-(oxydi-2,1-ethanediyl) ester | 2-[2-(2-oxo-2-phenylacetyl)oxyethoxy]ethyl 2-oxo-2-phenylacetate | 3824.9 | |
211519-85-6 | Polysulfides, bis(3-(triethoxysilyl)propyl) | 3812.1 | ||
21187-98-4 | Gliclazide | N-(hexahydrocyclopenta[c]pyrrol-2(1H)-ylcarbamoyl)-4-methylbenzenesulfonamide | 2935 | 6 |
2123-88-8 | T-Butylperoxylaurate | 2915.9 | ||
21245-02-3 | 2-Ethylhexyl 4-(dimethylamino)benzoate | 2-ethylhexyl 4-dimethylaminobenzoate | 2922.49 | |
2124-57-4 | (all-E)–2-(3,7,11,15,19,23,27-Heptamethyl-2,6,10,14,18,22,26-octacosaheptaenyl)-3-methyl-1,4-naphthalenedione | 2936.9 | ||
2127-03-9 | 2,2'-Dithiodipyridine | 2,2'-dithiodipyridine | 2933.39 | |
21282-97-3 | 2-(acetoacetoxy)ethyl methacrylate | 2924.29 | ||
2128-93-0 | 4-Phenylbenzophenone | 4-phenylbenzophenone | 2914.39 | |
212908-67-3 | Salicyloyl Phytosphingosine | 2922.29 | ||
21293-29-8 | Abscisic acid | (2Z,4E)-5-[(1S)-1-hydroxy-2,6,6-trimethyl-4-oxocyclohex-2-en-1-yl]-3-methylpenta-2,4-dienoic acid | 2918.99 | |
212955-32-3 | Disperse violet 99 | 3204.11 | ||
21295-57-8 | Solvent red 149 | 6-(Cyclohexylamino)-3-N-methylanthrapyridone;6-(cyclohexylamino)-3-methyl-3H-dibenz[f,ij]isoquinoline-2,7-dione | ||
2131-55-7 | 4-Chlorophenyl isothiocyanate | 2930.9 | ||
2131-61-5 | 4-Nitrophenyl isothiocyanate | 4-nitrobenzyl thiocyanate | 2930.9 | |
213318-44-6 | N-Boc-indole-2-boronic acid | 2933.99 | ||
21392-57-4 | 5,7-Dimethoxyflavone | 3822 | ||
2142-70-3 | 1-(2-iodophenyl)ethanone | 2914.7 | ||
21442-01-3 | N-(2-Hydroxypropyl)methacrylamide | 2931.9 | ||
21462-39-5 | Clindamycin hydrochloride | 2933.99 | 6 | |
215173-66-3 | Calfa BAS | 2934.1 | ||
2152-44-5 | Betamethasone valerate | (11β,16β)-9-fluoro-11,21-dihydroxy-16-methyl-3,20-dioxopregna-1,4-dien-17-yl pentanoate | 2937.29 | 6 |
215247-95-3 | Pigment violet 23 | 3204.17 | ||
215313-35-2 | Acid yellow 250 | 3204.12 | ||
21535-47-7 | Mianserin hydrochloride | 2933.59 | ||
21535-97-7 | 3-Methylbenzofuran | 2942 | ||
21539-58-2 | Sodium lauroyl methylaminopropionate | 3402.11 | ||
2153-98-2 | d-Cathine hydrochloride | (1S,2S)-2-amino-1-phenylpropan-1-ol hydrochloride | 2939.49 | |
215543-92-3 | 3-[4-Methyl-2-(2-oxo-1,2-dihydro-indol-3-ylidenemethyl)-1H-pyrrol-3-yl]-propionic acid | 2933.79 | ||
21564-17-0 | 2-(Thiocyanomethylthio)benzothiazole | (1,3-benzothiazol-2-ylsulfanyl)methyl thiocyanate | 2934.2 | 8 |
21598-06-1 | 5-Hydroxyindole-2-carboxylic acid | 5-hydroxyindole-2-carboxylic acid | 2933.99 | |
21615-49-6 | 2-(2’-Hydroxy-3’,5’-di-t-amylphenyl) benzotriazole | 2903.39 | ||
2162-74-5 | Bis(2,6-diisopropylphenyl)carbodiimide | Bis(2,6-diisopropylphenyl)carbodiimide | 2925.29 | |
2163-42-0 | 2-Methyl-1,3-propanediol | 2-methylpropane-1,3-diol | ||
21635-69-8 | Vinyl Sulfone Para Cresidine Ester | 2930.9 | ||
2163-80-6 | MSMA ; Sodium hydrogen methylarsonate | Sodium methylarsonate | 2931.9 | 8 |
21645-51-2 | Aluminium hydroxide | Aluminum trihydroxide | ||
21651-19-4 | Tin (II) oxide | Oxotin | 2825.9 | |
21653-40-7 | Nα-Benzoyl-L-arginine p-nitroanilide hydrochloride | 2925.29 | ||
216597-12-5 | Poly[oxy(methyl-1,2-ethanediyl)],a-[[[3-(trimethoxysilyl)propyl]amino]carbonyl]-w-[[[[3-(trimethoxysilyl)propyl]amino]carbonyl]oxy]- | 3815.9 | ||
216698-07-6 | 2(3H)-Benzofuranone, 3-[2-(acetyloxy)-5-(1,1,3,3-tetramethylbutyl)phenyl]-5-(1,1,3,3-tetramethylbutyl)- | 3812.3 | ||
216699-44-4 | D-Glucosamine sulfate potassium chloride | 2933.99 | ||
2172-33-0 | Vat orange 11 | 3204.15 | ||
217437-44-0 | 2-[(3,5-dimethylpyrazolyl)carboxyamino]ethyl methacrylate | 2930.9 | ||
21743-75-9 | 1H-Tetrazole-5-acetic acid | 2933.99 | ||
217500-96-4 | Tulathromycin | 2941.9 | 6 | |
2177-70-0 | Phenyl methacrylate | 2916.14 | ||
2179-57-9 | Diallyl disulfide | Diallyl disulfide | 2930.9 | |
218-01-9 | Chrysene | Chrysene | 2902.9 | |
2181-42-2 | Trimethylsulfonium iodide | Trimethylsulfonium iodide | 2930.9 | |
218269-34-2 | Carboxymethyl beta cyclodextrin | 2940 | ||
21829-25-4 | Nifedipine | Dimethyl 2,6-dimethyl-4-(2-nitrophenyl)-1,4-dihydropyridine-3,5-dicarboxylate | 2933.39 | 6 |
2183-17-7 | alpha-Naphthyl Phosphate Disodium Salt | 2919.9 | ||
21834-92-4 | Fragrance of 5-methyl-2-phenyl-2-hexenal | 5-methyl-2-phenylhex-2-enal | 3302.1 | |
21835-01-8 | 3-ethyl-2-hydroxycyclopent-2-en-1-one | 2914.29 | ||
218441-99-7 | Brain derived neurotrophic factor | 3504 | ||
21850-44-2 | Tetrabromobisphenol A-bis(2,3 dibromopropyl ether)(BDDP) | 1,1'-propane-2,2-diylbis[3,5-dibromo-4-(2,3-dibromopropoxy)benzene] | ||
218768-84-4 | Melamine-polyphosphate | 2933.69 | ||
2190-04-7 | Octadecylamine acetate | Octadecylammonium acetate | 2921.19 | |
2191-10-8 | Cadmium(2+);octanoate | 3812.2 | ||
2192-20-3 | Hydroxyzine hydrochloride | 2933.59 | 6 | |
219714-96-2 | Penoxsulam | 2-(2,2-difluoroethoxy)-N-(5,8-dimethoxy[1,2,4]triazolo[1,5-c]pyrimidin-2-yl)-6-(trifluoromethyl)benzenesulfonamide | 2935.9 | |
2197-63-9 | Dicetyl phosphate | 2919.9 | ||
21982-43-4 | Ethoxyethyl 2-cyanoacrylate | 2-ethoxyethyl 2-cyanoprop-2-enoate | 3505.2 | |
219828-87-2 | Manuka oil | 3301.19 | ||
2198-53-0 | 2,6-Dimethyl acetanilide | 2924.29 | ||
219861-08-2 | Escitalopram oxalate | 2933.99 | 6 | |
219916-67-3 | Silane, ethenyltriethoxy-, reaction products with silica | 3812.1 | ||
22002-87-5 | Lysophosphatidic acid | 2923.2 | ||
220037-02-5 | Castor oil, ethoxylated, oleate | 3402.13 | ||
22004-32-6 | 2,5-dimethoxy-4-ethylamphetamine (DOET) | 2,5-dimethoxy-4-ethylamphetamine | 2922.29 | 7 |
22026-63-7 | S-Butyryl thiocholine iodide | 2930.9 | ||
2203-80-7 | 5-methylhex-1-yne | 5-methylhex-1-yne | 2901.29 | |
22047-25-2 | 2-Acetylpyrazine ; Fragrance of 2-Acetylpyrazine | |||
22047-49-0 | Ethylhexyl Stearate | 2-ethylhexyl stearate | 2917.19 | |
22059-21-8 | 1-Aminocyclopropane-1-carboxylic acid | 1-aminocyclopropanecarboxylic acid | 2922.49 | |
220620-09-7 | 2-Naphthacenecarboxamide | (4S,4aS,5aR,12aS)-4,7-bis(dimethylamino)-9-[[[(1,1-dimethylethyl)amino]acetyl]amino]-3,10,12,12a-tetrahydroxy-1,11-dioxo-1,4,4a,5,5a,6,11,12a-octahydrotetracene-2-carboxamide | 2912.49 | |
2206-27-1 | Dimethyl sulfoxide-d6 | Trideuterio(trideuteriomethylsulfinyl)methane | 2845.9 | |
22071-15-4 | Ketoprofen ; 2-(3-Benzoylphenyl)propanoic acid | 2-[3-(phenylcarbonyl)phenyl]propanoic acid | 2918.3 | 6 |
220727-26-4 | S-(Octanoyl)mercaptopropyltriethoxysilane | 2931.1 | ||
22094-93-5 | Pigment yellow 81 | 3204.17 | ||
2210-25-5 | N-Isopropylacrylamide | 2924.19 | ||
2210-79-9 | o-Cresol glycidyl ether | 2,3-epoxypropyl o-tolyl ether | 3812.3 | |
221227-05-0 | Palmitoyl tetrapeptide-7 | 2924.29 | ||
2212-32-0 | 2-[[2-(Dimethylamino)ethyl]methylamino]ethanol | 2-[2-(dimethylamino)ethyl(methyl)amino]ethanol | 3815.9 | |
2212-81-9 | Di(tert-butylperoxyisopropyl)benzene | 1,3-bis[2-(tert-butylperoxy)propan-2-yl]benzene | 3812.3 | |
22155-91-5 | L-Pyroglutamic acid B-naphthylamide | 2933.79 | ||
2215-89-6 | 4,4'-Oxybis(benzoic acid) | 2918.99 | ||
2216-51-5 | Levomenthol ; (1R,2S,5R)-5-methyl-2-propan-2-ylcyclohexan-1-ol ; L-menthol | 1R,2S,5R)-2-isopropyl-5-methylcyclohexanol | 6 | |
22189-32-8 | Spectinomycin dihydrochloride pentahydrate | 2941.9 | ||
2218-94-2 | 1,4-Diphenyl-3-phenylamino-1,2,4-triazolium hydroxide inner salt | 2933.99 | ||
22199-08-2 | Sulfadiazine silver; silver sulfadiazine | [4-amino-N-(pyrimidin-2(1H)-ylidene-κN1)benzenesulfonamidato-κO]silver | 2942 | 6 |
22204-24-6 | Pyrantel pamoate | 2941.9 | ||
22204-53-1 | Naproxen | (2S)-2-(6-methoxynaphthalen-2-yl)propanoic acid | 2942 | 6 |
2223-82-7 | Neopentyl glycol diacrylate | 2,2-dimethyltrimethylene diacrylate | 2916.12 | 3 |
222400-16-0 | C20-40 alkyl stearate | 3823.7 | ||
222400-29-5 | Pea protein | 3504 | ||
222400-33-1 | Hydrolyzed extensin | 3504 | ||
2224-15-9 | Ethylene glycol diglycidyl ether | 2,2'-[ethane-1,2-diylbis(oxymethanediyl)]dioxirane | 2909.44 | |
2224-33-1 | Vinyltris(2-butanoneoxime)silane | (E)-N-[bis[[(E)-butan-2-ylideneamino]oxy]-ethenylsilyl]oxybutan-2-imine | ||
22254-24-6 | Ipratropium bromide | 2939.69 | 6 | |
22260-51-1 | Bromocriptine mesylate | 2939.69 | 6 | |
2226-96-2 | 4-Hydroxy-2,2,6,6-tetramethylpiperidine 1-oxyl | 4-hydroxy-2,2,6,6-tetramethylpiperidinoxyl | ||
222722-18-1 | C18-38 alkyl hydroxystearoyl stearate | Octadecanoic acid, 12-(12-hydroxy-1-oxooctadecyloxy) | 3404.9 | |
22288-43-3 | 1,1,3,3-tetramethylbutyl 2-ethylperoxyhexanoate | 3824.9 | ||
222984-54-9 | Methyltris(methylethylketoxime)silane | 2931.9 | ||
22302-43-8 | Calcium Arachinate | 2916.19 | ||
22306-37-2 | Bismuth acetate | 2915.29 | ||
223106-41-0 | Bruggolite | Disodium;2-hydroxy-2-sulfinatoacetate | 2831.1 | |
2231-57-4 | Thiocarbohydrazide | Thiocarbonohydrazide | 2930.9 | 8 |
22316-47-8 | Clobazam | 7-chloro-1-methyl-5-phenyl-1H-1,5-benzodiazepine- 2,4(3H,5H)-dione | 9 | |
22326-55-2 | Barium hydroxide monohydrate | Barium(2+);dihydroxide;hydrate | 2816.4 | |
22331-70-0 | Paramethoxymethampheta -mine ; PMMA | para-methoxymethyl amphetamine | 2922.29 | 7 |
22345-47-7 | Tofisopam | 1-(3,4-dimethoxyphenyl)-5-ethyl-7,8-dimethoxy-4-methyl-5H-2,3-benzodiazepine | 2933.99 | 9 |
22346-43-6 | 1-Hydroxy-6-(methylamino)-3-naphthalenesulfonicacid | 2922.29 | ||
22350-41-0 | Trans-Vitamin D3; 5,6-trans-Vitamin D3 | (1S,3Z)-3-[(2E)-2-[(1R,3aS,7aR)-7a-methyl-1-[(2R)-6-methylheptan-2-yl]-2,3,3a,5,6,7-hexahydro-1H-inden-4-ylidene]ethylidene]-4-methylidenecyclohexan-1-ol | 2845.9 | |
22352-81-4 | Norfentanyl hydrochloride | 2934.99 | ||
2235-43-0 | Amino tri (methylene phosphonic acid) pentasodium salt | 2931.9 | ||
2235-54-3 | Ammonium lauryl sulfate | Ammonium dodecyl sulfate | ||
223671-18-9 | 7-Bromoisoquinolone n-oxide | 2933.99 | ||
223706-40-9 | Sorbitan olivate | 3404.9 | ||
223747-87-3 | Argan oil | 3302.9 | ||
223748-32-1 | Chrysanthemum sinense flower extract | 3302.9 | ||
223749-44-8 | Manuka oil | 3301.29 | ||
223749-83-5 | Chlorella vulgaris extract | 3504 | ||
223751-82-4 | Lingzhi extract | 2938.9 | ||
2237-62-6 | Pigment violet 27 | 3204.17 | ||
2238-07-5 | 2,2’-[Oxybis(methylene)]dioxirane | 2,2'-(oxydimethanediyl)dioxirane | 2910.9 | 8 |
22422-34-0 | (1R,2R,3S,5R)-(-)-2,3-Pinanediol | 2905.41 | ||
22428-48-4 | Benzyl-3.4-dihydrocyclohexylidenemethylether | ({[cyclohex-3-en-1-ylidenemethyl]oxy}methyl)benzene | 3812.3 | |
2243-42-7 | 2-Phenoxybenzoic acid | 2-phenoxybenzoic acid | 2918.99 | |
2243-62-1 | 1,5-Diaminonaphthalene | 1,5-naphthylenediamine | 2921.59 | |
2243-83-6 | 2-Naphthoyl chloride | 2-naphthoyl chloride | 2916.39 | |
2244-16-8 | (5S)-2-methyl-5-prop-1-en-2-ylcyclohex-2-en-1-one | 2914.29 | ||
22457-89-2 | Benfotiamine | S-[(2Z)-2-{[(4-amino-2-methylpyrimidin-5-yl)methyl](formyl)amino}-5-(phosphonooxy)pent-2-en-3-yl] benzenecarbothioate | 2936.22 | |
22464-99-9 | Zirconium octoate | 3211 | ||
22494-42-4 | Diflunisal | 2',4'-difluoro-4-hydroxybiphenyl-3-carboxylic acid | 2918.29 | 6 |
22504-50-3 | Glycol di(3-mercaptopropionate) | 2930.9 | ||
22519-64-8 | Indium(III) chloride tetrahydrate | Trichloroindigane;tetrahydrate | 2827.39 | |
225234-03-7 | Sea Buckthorn ; Hippophae rhamnoides oil | 3301.29 | ||
22526-47-2 | (3)-3,3-Dimethyl-2-butylamine | 2921.19 | ||
2252-84-8 | HFC-227ca | 2903.39 | 8 | |
22556-62-3 | Oleoyl-L-α-lysophosphatidic acid sodium salt | 2919.9 | ||
2257-09-2 | 2-Phenethyl isothiocyanate | 2930.9 | ||
225937-10-0 | Catechin hydrate | 2932.99 | ||
22607-31-4 | 1,3-Benzenediol,4-(2H-benzotriazol-2-yl) | 2934.2 | ||
226416-05-3 | Fatty acids, olive-oil, esters with polyethylene glycol mono(carboxymethyl) ether, sodium salts | 3402.11 | ||
22673-19-4 | Dibutyltin bis(acetylacetonate) | Dibutyl{bis[4-(hydroxy-κO)pent-3-en-2-onato-κO]}tin | 3815.9 | |
22688-79-5 | Quercetin 3-glucuronide | 2938.9 | ||
2269-22-9 | Aluminium butyrate | Aluminum tributan-2-olate | ||
226995-92-2 | PEG-2 Dimeadowfoamamidoethylmonium methosulfate | Poly(oxy-1,2-ethanediyl), .alpha.-[2-[bis(2-aminoethyl)methylammonio]ethyl]-.omega.-hydroxy, N,N'-di-Limnanthes alba seed oil acyl derivatives, methyl sulfates mol EO average molar ratio)(salts) (2  | 3403.99 | |
2273-43-0 | Butylstannoic Acid | Butyl(oxo)stannanol | 2922.19 | |
22766-82-1 | Octyldodecyl stearate | 2915.7 | ||
22766-83-2 | 2-octyldodecyl myristate | 2-octyldodecyl tetradecanoate | ||
22767-49-3 | Sodium pentane-1-sulfonate ; Sodium pentanesulfonate | sodium pentane-1-sulfonate monohydrate | 2904.1 | |
22767-50-6 | Sodium 1-heptanesulfonate; 1-Heptanesulfonic acid sodium salt | sodium heptane-1-sulfonate | ||
2280-49-1 | N-phenyl-N-[(trichloromethyl)thio]benzenesulphonamide | N-phenyl-N-[(trichloromethyl)sulfanyl]benzenesulfonamide | ||
22832-87-7 | Miconazole nitrate | 2933.29 | 6 | |
22839-47-0 | Aspartame | Methyl L-α-aspartyl-L-phenylalaninate | 2924.29 | |
2284-20-0 | 4-Methoxyphenyl isothiocyanate | 2930.9 | ||
22888-70-6 | Silibinin | (2R,3R)-3,5,7-trihydroxy-2-[(2R,3R)-3-(4-hydroxy-3-methoxyphenyl)-2-(hydroxymethyl)-2,3-dihydro-1,4-benzodioxin-6-yl]-2,3-dihydro-4H-chromen-4-one | 2932.99 | |
22916-47-8 | Miconazole | 1-{2-[(2,4-dichlorobenzyl)oxy]-2-(2,4-dichlorophenyl)ethyl}-1H-imidazole | 2923.29 | 6 |
22919-26-2 | 4-Methylumbelliferyl phosphate disodium salt | 2932.2 | ||
22984-54-9 | Methyltris(methylethylketoxime)silane | |||
229975-97-7 | Atazanavir sulfate | 2942 | 6 | |
2302-25-2 | 5-bromo-1H-imidazole | 2903.99 | ||
2303-01-7 | m-Cresol purple | 4,4'-(1,1-dioxido-3H-2,1-benzoxathiole-3,3-diyl)bis(3-methylphenol) | ||
230309-38-3 | Isopropyl n-lauroyl sarcosinate | 2922.49 | ||
23031-32-5 | Terbutaline sulphate | 2922.5 | ||
23031-36-9 | Prallethrin | 2916.2 | ||
2305-05-7 | Gamma dodecalactone ; Fragrance of gamma-Dodecalactone | |||
23076-35-9 | Xylazine hydrochloride | 2942 | ||
23089-26-1 | (−)-6-Methyl-2-(4-methyl-3-cyclohexen-1-yl)-5-hepten-2-ol | 2906.19 | ||
2309-94-6 | Disperse ylue 183:1 | 3204.11 | ||
2312-35-8 | Propargite | 2920.9 | 8 | |
23128-74-7 | N,N'-Hexamethylenebis(3,5-di-tert-butyl-4-hydroxyhydrocinnamamide) | 3,3'-bis(3,5-di-tert-butyl-4-hydroxyphenyl)-N,N'-hexamethylenedipropionamide | ||
23142-01-0 | Pentoxyverine citrate | 2922.5 | ||
2315-02-8 | Oxymetazoline hydrochloride | Oxymetazoline hydrochloride | 2907.29 | |
2315-20-0 | Difurazone hydrochloride | 2941.1 | ||
23155-02-4 | Fosfomycin | [(2R,3S)-3-methyloxiran-2-yl]phosphonic acid | 2941.9 | 6 |
2315-68-6 | Propyl benzoate | Propyl benzoate | 2916.31 | |
23165-29-9 | 3,5-Bis(trifluoromethyl)phenyl isothiocyanate | 2930.9 | ||
23184-66-9 | Butachlor | N-(butoxymethyl)-2-chloro-N-(2,6-diethylphenyl)acetamide | 2924.29 | 8 |
231937-89-6 | D-Allethrin | 2916.2 | ||
23239-32-9 | Paramethoxyamphetamine ; PMA | p-methoxy-α-methylphenethylamine | 2922.29 | 7 |
23283-97-8 | (1S,2R,5R)-2-Isopropyl-5-methylcyclohexanol | 2906.19 | ||
232938-43-1 | 3-(3-Tosylureido)phenyl 4-Methylbenzenesulfonate | 2935 | ||
233-047-2 | Antimony(III) chloride | Trichlorostibane | 2827.39 | |
23313-12-4 | L-ascorbyl-2-phosphate | 2936.27 | ||
23325-78-2 | Cefalexin monohydrate | 2941.9 | 6 | |
23328-53-2 | Phenol, 2-(2H-benzotriazole-2-yl)-6-dodecyl-4- methyl | 2933.99 | ||
23328-87-2 | 2-Heptadecyl-1H-imidazole | |||
23354-52-1 | Reactive red 194 | 3204.16 | ||
23354-53-2 | Reactive red 240 | 3204.16 | ||
233683-84-6 | Yuzu leaf oil | 3301.9 | ||
23389-33-5 | Magnesium carbonate | Magnesium carbonate hydrate | 2836.99 | |
23411-34-9 | Calcium disodium ethylenediaminetetraacetate dihydrate | |||
23511-73-1 | Phenoxyethyl caprylate | 2915.9 | ||
23513-08-8 | (5S)-5-hydroxy-1-(4-hydroxy-3-methoxyphenyl)dodecan-3-one | 2914.5 | ||
23513-14-6 | (5S)-5-hydroxy-1-(4-hydroxy-3-methoxyphenyl)decan-3-one | 2914.5 | ||
23519-77-9 | Zirconium(IV) propoxide | Zirconium tetrapropanolate | 2931.9 | |
2353-33-5 | 5-Aza-2'-Deoxycytidine | 4-amino-1-(2-deoxy-β-D-erythro-pentofuranosyl)-1,3,5-triazin-2(1H)-on | 2934.99 | |
2353-45-9 | Fast green FCF | Benzenemethanaminium, N-ethyl-N-[4-[[4-[ethyl[(3-sulfophenyl)methyl]amino]phenyl](4-hydroxy-2-sulfophenyl)methylene]-2,5-cyclohexadien-1-ylidene]-3-sulfo-, inner salt, disodium salt | ||
23564-05-8 | Thiophanate methyl | Dimethyl (benzene-1,2-diyldicarbamothioyl)biscarbamate | 2930.9 | 8 |
23593-75-1 | Clotrimazole | 1-[(2-chlorophenyl)(diphenyl)methyl]-1H-imidazole | 2933.29 | 6 |
23616-79-7 | Benzyl tributyl ammonium chloride | 2923.9 | ||
2363-71-5 | Heneicosanoic acid | 2915.9 | ||
2363-89-5 | Oct-2-enal | 2912.19 | ||
236391-76-7 | 2-[1-(3,3-dimethylcyclohexyl)ethoxy]-2-oxoethyl propanoate | 2918.91 | ||
23647-14-5 | 2-(4-Sulfophenylazo)-1,8-dihydroxy-3,6-naphthalenedisulfonic acid trisodium salt | 2929.1 | ||
2365-48-2 | Methyl thioglycolate; methoxy-methanethio | Methyl mercaptoacetate | 2930.9 | |
23655-65-4 | Methylphenidate Hydrochloride | 2933.33 | ||
23696-85-7 | (E)-1-(2,6,6-trimethylcyclohexa-1,3-dien-1-yl)but-2-en-1-one | 2914.5 | ||
2370-63-0 | 2-Ethoxyethyl methacrylate | 2916.14 | ||
2372-21-6 | Tert-butylperoxy isopropyl carbonate | O,O-tert-butyl isopropyl monoperoxycarbonate | ||
23726-91-2 | (E)-1-(2,6,6-trimethylcyclohexen-1-yl)but-2-en-1-one ; beta-Damascone | 2914.29 | ||
2373-38-8 | Sodium 1,4-bis(1,3-dimethylbutyl) sulphonatosuccinate | 3402.9 | ||
237429-33-3 | 4-Mercaptophenylboronic acid | 2930.9 | ||
23761-23-1 | 3-Oxocyclobutanecarboxylic acid | 2918.3 | ||
23783-26-8 | 2-Hydroxy phosphonocarboxylic acid | 2931.9 | ||
23787-80-6 | 2-Acetyl-3-ethylpyrazine | 2933.99 | ||
2379-74-0 | Pigment red 181 | 3205 | ||
2379-79-5 | Vat red 10 ; C.I. 67000 | 3204.15 | ||
23814-12-2 | Benzotriazole-2-carboxylic acid | 2933.99 | ||
23828-92-4 | Ambroxol hydrochloride | 2922.5 | 6 | |
23832-18-0 | 2-,3-,10-Mercaptopinane | 2930.9 | ||
23847-08-7 | 1,1'-Dithiobis[hexahydro-2H-azepin-2-on] | 1,1'-dithiodi(azepan-2-one) | 3812.3 | |
23850-94-4 | Butyltin tris(2-ethylhexanoate) | 2931.9 | ||
2386-54-1 | Sodium;butane-1-sulfonate | Sodium butane-1-sulfonate | 2904.9 | |
2386-57-4 | Sodium;methanesulfonate | Sodium methanesulfonate | 2904.1 | |
2386-87-0 | 3,4-Epoxycyclohexylmethyl 3,4-epoxycyclohexanecarboxylate | 3,4-epoxycyclohexylmethyl 3,4-epoxycyclohexanecarboxylate | 2918.99 | |
23887-31-2 | Clorazepate dipotassium | 7-chloro-2,3-dihydro-2-oxo-5-phenyl-1H-1,4- benzodiazepine-3-carboxylic acid | 2933.91 | 9 |
2390-09-2 | Methyl cis-11-eicosenoate | 2916.19 | ||
2390-60-5 | Basic blue 7 | 3204.19 | ||
2390-68-3 | Basic violet 11 | Didecyldimethylammonium bromide | ||
2392-39-4 | Dexamethasone sodium phosphate | Disodium (11β,16α)-9-fluoro-11,17-dihydroxy-16-methyl-3,20-dioxopregna-1,4-dien-21-yl phosphate | 2937.29 | 6 |
23949-66-8 | Oxanilide derivative ; N-(2-ethoxyphenyl)-N'-(2-ethylphenyl)oxamide | |||
2398-96-1 | Tolnaftate ; 2-Naphthyl N-methyl-N-(3-tolyl)thionocarbamate | O-naphthalen-2-yl methyl(3-methylphenyl)carbamothioate | 2930.9 | |
2399-48-6 | Tetrahydrofurfuryl acrylate | 2932.19 | ||
23996-16-9 | 1H-Imidazole-1-propanenitrile,2-undecyl- | 2933.29 | ||
2399-85-1 | Potassium nitrilotriacetate | Tripotassium nitrilotriacetate | 2922.49 | |
24017-47-8 | Triazophos | 2933.99 | 8 | |
240494-70-6 | Metofluthrin | 2,3,5,6-tetrafluoro-4-(methoxymethyl)benzyl 2,2-dimethyl-3-(prop-1-en-1-yl)cyclopropanecarboxylate | 2916.2 | |
241148-25-4 | Calophylluminophyllum oil | 3301.29 | ||
241153-84-4 | Castoryl maleate ; Stannous octoate | 2915.9 | ||
2411-89-4 | Phthalein purple | 1,3-dihydro-3-oxoisobenzofuran-1-ylidenebis(6-hydroxy-5-methyl-m-phenylenemethylenenitrilo)tetraacetic acid | 2932.2 | |
24124-40-1 | 1-Amino-4-(5-amino-2,4,6-trimethyl-3-sulfoanilino)-9,10-dihydro-9,10-dioxoanthracene-2-sulfonic acid | 2922.39 | ||
24143-17-7 | Oxazepam | 7-chloro-1,3-dihydro-3-hydroxy-5-phenyl-2H-1,4- benzodiazepin-2-one | 2933.91 | 9 |
2414-98-4 | Magnesium;ethanolate | Magnesium diethanolate | 2905.19 | |
2417-90-5 | 3-bromopropiononitrile | 3-bromopropiononitrile | 2926.9 | |
24198-97-8 | (±)-Taxifolin | 2932.99 | ||
2420-87-3 | 3,3',4,4'-Biphenyltetracarboxylic dianhydride | 2917.39 | ||
2420-94-2 | 2-Aminoethyl methacrylate hydrochloride | 2933.99 | ||
24211-36-7 | ORAI 1 inhibitor ANCOA4 | 2932.99 | ||
2425-77-6 | 2-Hexyl-1-decanol | 2-hexyldecan-1-ol | ||
2425-79-8 | 2-[4-(oxiran-2-ylmethoxy)butoxymethyl]oxirane | 1,4-bis(2,3-epoxypropoxy)butane | 3 | |
2425-85-6 | Pigment red 3 | (1Z)-1-[(4-methyl-2-nitrophenyl)hydrazinylidene]naphthalen-2-one | 3204.17 | |
2426-08-6 | 2-(Butoxymethyl)oxirane ; n-Butyl glycidyl ether | Butyl 2,3-epoxypropyl ether | 2910.9 | 3 |
24292-60-2 | β-Nicotinamide adenine dinucleotide phosphate disodium salt | 2934.99 | ||
24295-03-2 | 2-Acetylthiazole | methyl thiazol-2-yl ketone | 2934.1 | |
2429-73-4 | Chlorazol black BH | 3204.14 | ||
2429-74-5 | Direct blue 15 | 3204.14 | ||
2429-82-5 | Direct brown 2 | Benzoic acid, 5-[[4'-[(7-amino-1-hydroxy-3-sulfo-2-naphthalenyl)azo][1,1'-biphenyl]-4-yl]azo]-2-hydroxy-, disodium salt | 3204.14 | |
2430-22-0 | 7-methyloctan-1-ol | 2905.19 | ||
24304-00-5 | Aluminum nitride powder | Azanylidynealumane | 2850 | |
24307-26-4 | Mepiquat chloride | 1,1-dimethylpiperidinium chloride | 2933.39 | 8 |
24308-84-7 | Zinc benzenesulfinate | zinc bisbenzenesulfinate | 2927 | |
2432-12-4 | 2,6-Dichloro-4-methylphenol | 2907.29 | ||
2432-87-3 | Dioctyl sebacate | dioctyl sebacate | 2917.34 | |
2433-97-8 | Methyl tricosanoate | 2915.9 | ||
24345-16-2 | Bee venom | 3504 | ||
24352-85-0 | 4-(2-Chloro ethyl sulfonyl) butyryl chloride | 2930.9 | ||
2437-29-8 | C.I.42000 ; Malachite green oxalate | 3206.49 | 8 | |
2438-10-0 | (1S)-4-methyl-1-propan-2-ylcyclohex-3-en-1-ol | 2906.19 | ||
2438-32-6 | Dexchlorpheniramine maleate ; [γ-(4-chlorophenyl)-pyridine-2-propyl](dimethyl)ammonium hydrogen (Z)-maleate | 2933.39 | ||
2438-80-4 | L-(-)-Fucose | 6-deoxy-L-β-galactose | 2940 | |
2439-01-2 | Chinomethionat ; 1,3-Dithiolo[4,5-b]quinoxalin-2-one, 6-methyl- ; Chinomethionate | 6-methyl[1,3]dithiolo[4,5-b]quinoxalin-2-one | 3812.1 | 8 |
24390-14-5 | Doxycycline hyclate | 4S,4aR,5S,5aR,6R,12aS)-4-(dimethylamino)-1,4,4a,5,5a,6,11,12a-octahydro-3,5,10,12,12a-pentahydroxy-6-methyl-1,11-dioxonaphthacene-2-carboxamide –- ethanol (2:1) dihydrochloride monohydrate | 2941.9 | 6 |
2439-04-5 | 5-Hydroxyisoquinoline | Isoquinolin-5-ol | 2933.49 | |
2439-35-2 | 2-(Dimethylamino)ethyl acrylate | 2-(dimethylamino)ethyl acrylate | 2916.12 | |
2440-22-4 | Drometrizole ; 2-(2-hydroxy-5-methylphenyl)benzotriazole | 2-(2H-benzotriazol-2-yl)-4-methylphenol | ||
2442-49-1 | Methyl tetracosanoate | 2915.9 | ||
24424-99-5 | Di-tert-butyl dicarbonate | Di-tert-butyl dicarbonate | 2920.9 | |
2446-83-5 | Diisopropyl azodicarboxylate | Dipropan-2-yl diazene-1,2-dicarboxylate | 2929.9 | |
2447-57-6 | Sulfadoxine | 4-amino-N-(5,6-dimethoxypyrimidin-4-yl)benzenesulfonamide | 2935 | |
2451-01-6 | 4-(2-hydroxypropan-2-yl)-1-methylcyclohexan-1-ol;hydrate | 2906.19 | ||
2451-62-9 | 1,3,5-Triglycidyl Isocyanurate | 1,3,5-tris(oxiran-2-ylmethyl)-1,3,5-triazinane-2,4,6-trione | 2924.19 | |
2455-24-5 | Tetrahydrofurfuryl Methacrylate | Tetrahydrofurfuryl methacrylate | 2932.19 | |
24567-76-8 | 4-(n-ethyl-n-2-methane sulfonylamino ethyl)-2- phenylene diamine | 2935 | ||
24577-34-2 | Dioctyltin dicarboxylate | 3815.9 | ||
24589-78-4 | N-Methyl-N-(trimethylsilyl)trifluoroacetamide | 2931.9 | ||
246047-72-3 | Grubbs Catalyst™ 2nd Generation | Benzylidene-[1,3-bis(2,4,6-trimethylphenyl)imidazolidin-2-ylidene]-dichlororuthenium; tricyclohexylphosphane | 2843.9 | |
2460-59-5 | 3,5-dinitrosalicylaldehyde | 2-hydroxy-3,5-dinitrobenzaldehyde | 2913 | |
2461-15-6 | 2-Ethyl-Hexyl -glycidylether | 2,3-epoxypropyl 2-ethylhexyl ether | 2910.9 | |
24615-84-7 | 2-Carboxyethyl acrylate | 3-prop-2-enoyloxypropanoic acid | 3824.9 | |
246159-33-1 | Cetearyl glucoside | D-Glucopyranose, C16-18 alkyl glycosides | 3402.13 | |
24622-62-6 | 3,4-Methylenedioxypyrovalerone hydrochloride | 2933.91 | ||
24623-77-6 | Aluminium hydroxide oxide | Aluminium hydroxide oxide | 3815.9 | |
24634-61-5 | Potassium sorbate | Potassium (E,E)-hexa-2,4-dienoate | 2916.2 | |
24650-42-8 | 2,2-Dimethoxy-2-phenyl acetophenone | 2,2-dimethoxy-2-phenylacetophenone | 2914.5 | |
2465-27-2 | Auramine hydrochloride | 4,4'-carbonimidoylbis(N,N-dimethylaniline) monohydrochloride | 3212.9 | |
2465-32-9 | Glycerol 1,3-dioleate | 2916.15 | ||
2466-09-3 | Pyrophosphoric acid | Phosphono dihydrogen phosphate | 2809.2 | 8 |
24677-78-9 | 2,3-dihydroxybenzaldehyde | 2912.49 | ||
24683-00-9 | 2-Isobutyl-3-methoxypyrazine | 2933.99 | ||
246864-88-0 | C30-45 alkyl methicone | 3404.9 | ||
24729-96-2 | Clindamycin phosphate | 2933.99 | 6 | |
24748-23-0 | 3,6,9-Triethyl-3,6,9-trimethyl-1,4,7-triperoxonane | 2909.6 | ||
2475-33-4 | Vat brown 1 | 3204.15 | ||
2475-44-7 | Disperse blue 14 | 3204.11 | ||
2478-10-6 | 4-Hydroxybutyl acrylate | 4-hydroxybutyl acrylate | ||
2478-38-8 | 3',5'-Dimethoxy-4'-hydroxyacetophenone | 4'-hydroxy-3',5'-dimethoxyacetophenone | 2914.5 | |
24800-44-0 | Tripropylene glycol mixture of isomers | 2914.5 | ||
24801-88-5 | 3-isocyanatopropyltriethoxysilane | 2931.9 | ||
24804-31-7 | Calcium oxalate hydrate | 2917.11 | ||
24851-98-7 | Methyl dihydrojasmonate | 2918.99 | ||
24871-34-9 | 3,6,9,12,15,18,21,24,27,30-Decaoxaoctatetracont-39-en-1-ol,(39Z)- | 3402.13 | ||
2489-77-2 | Trimethylthiourea | Trimethyl-2-thiourea | ||
2492-26-4 | Sodium Mercaptobenzothiazole | Sodium benzothiazol-2-yl sulfide | 2934.2 | |
249278-28-2 | 1-(2,4,6-trihydroxyphenyl)ethanone;hydrate | 2914.5 | ||
2492-87-7 | 4-Nitrophenyl-B-D-glucopyranosine | 4-nitrophenyl β-D-glucopyranoside | 2940 | |
24937-78-8 | Ethylene-vinyl acetate copolymer | Poly(ethylene-co-ethenyl acetate) | ||
24937-93-7 | Hexanedioic acid, polymer with 1,3-butanediol | 3812.2 | ||
24938-91-8 | 1-Tridecanol, monoether with polyethylene glycol | 3402.13 | ||
2494-89-5 | 2-[(4-Aminophenyl)sulfonyl]ethyl hydrogen sulfate | 2-[(p-aminophenyl)sulfonyl]ethyl hydrogen sulfate | ||
2495-25-2 | Tridecyl methacrylate | 2916.14 | ||
2495-37-6 | Benzyl methacrylate | 2916.14 | ||
2495-39-8 | Sodium allyl sulfonate | Sodium prop-2-ene-1-sulfonate | 2942 | |
2497-18-9 | Trans-2-hexenyl acetate | Trans-hex-2-enyl acetate | 2915.39 | |
2500-88-1 | Distearyl-disulfide | Dioctadecyl disulfide | 2930.9 | |
25013-15-4 | Vinyltoluene mixture of isomers | 2902.9 | ||
25013-16-5 | Butylated hydroxy-anisole ; 2-tert-butyl-4-methoxyphenol ; 3-tert-butyl-4-methoxyphenol | 2909.5 | ||
250249-75-3 | Rutin trihydrate | 2938.1 | ||
2503-73-3 | Direct blue 78 | 3204.12 | ||
25038-04-4 | Epichlorohydrin-Glycerololigomer | 2910.9 | ||
25038-54-4 | Poly(iminocarbonylpentamethylene), Polyamide 6 | Poly[imino(1-oxohexane-1,6-diyl)] | 3809.1 | |
25038-59-9 | Polyethylene Terephthalate | 3907.69 | ||
250640-08-5 | Pigment orange 79 | 3204.17 | ||
25067-34-9 | Ethylene Vinyl Alcohol Copolymer (EVOH) | 3809.1 | ||
25068-38-6 | Bisphenol A Diglycidyléther | 2917.2 | 3 | |
2508-19-2 | 2,4,6-trinitrobenzenesulfonic acid | 2,4,6-trinitrobenzenesulfonic acid | 2904.9 | |
25085-50-1 | 4-tert-butylphenol formaldehyde resin | 3812.1 | ||
25086-62-8 | Sodium methacrylate | Sodium 2-methylprop-2-enoate | 3824.9 | |
2508-72-7 | Antazoline hydrochloride | 2933.29 | ||
25102-12-9 | Ethylenedinitrilo)tetraacetic acid dipotassium salt | 2921.29 | ||
25103-23-5 | Triisooctyl phosphate | 2919.9 | ||
25103-58-6 | Tert-dodecyl mercaptan | 2930.9 | ||
25114-58-3 | Indium acetate | Indium triacetate | 2915.29 | |
25122-46-7 | Clobetasol propionate | 2937.22 | 6 | |
2512-29-0 | Pigment yellow 1 | 2-[(4-Methyl-2-nitrophenyl)azo]-3-oxo-N-phenylbutanamide | 3204.17 | |
25133-97-5 | Acrylates copolymer | 3809.91 | ||
25133-98-6 | Poly(methyl methacrylate/2-ethylhexyl) | 3824.9 | ||
25134-21-8 | Nadic methyl anhydride | 2931.9 | ||
25136-75-8 | Polyquaternium-39 | Dimethyl-bis(prop-2-enyl)azanium prop-2-enamide prop-2-enoic acid chloride | ||
25152-85-6 | Cis-3-Hexenyl benzoate | 2916.31 | ||
25154-52-3 | n-Nonylphenol | 2907.13 | ||
25155-23-1 | Trixylyl phosphate | 2919.9 | ||
25155-25-3 | Bis(tert-butyldioxyisopropyl)benzene | 1,4-bis(2-tert-butylperoxypropan-2-yl)benzene | ||
25155-30-0 | Sodium dodecylbenzenesulfonate | Benzenesulfonic acid, dodecyl-, sodium salt | ||
251554-90-2 | Fatty acids, C>14 | 3404.9 | ||
25168-73-4 | Sucrose stearic acid ester | [(2S,3S,4S,5R)-3,4-dihydroxy-5-(hydroxymethyl)-2-[(2R,3R,4S,5S,6R)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxyoxolan-2-yl]methyl octadecanoate | ||
25189-83-7 | 1-ethenylazepan-2-one | 3824.9 | ||
25190-06-1 | Polytetramethylene ether glycol | Poly(oxy-1,4-butanediyl), alpha-hydro-omega-hydroxy- | 3404.2 | |
25231-21-4 | PPG-15 Stearyl ether | 1-octadecoxypropan-2-ol | ||
2524-49-4 | 3-Buten-1-amine | 2921.19 | ||
25251-42-7 | Meta sulfo phenyl gamma acid | 4-hydroxy-6-[(3-sulfophenyl)amino]naphthalene-2-sulfonic acid | 2930.9 | |
25265-71-8 | Mixture of three isomer 4-oxa-2,6-heptandiol, 2-(2-hydroxy-propoxy)-propan-1-ol, and 2-(2-hydroxy-1-methyl-ethoxy)-propan-1-ol | 2909.49 | ||
25265-77-4 | Texanol | 2,2,4-trimethylpentane-1,3-diol isobutyrate | ||
25276-70-4 | 1-Pentadecanethiol | Pentadecane-1-thiol | 2930.9 | |
2528-36-1 | Dibutylphenylphosphate | Dibutyl phenyl phosphate | 2710.19 | |
252917-06-9 | 6-(2-(4-(2,4-Dichlorophenyl)-5-(4-methyl-1H-imidazol-2-yl)-pyrimidin-2-ylamino)ethyl-amino)-nicotinonitrile | 2926.9 | ||
25304-14-7 | 1-Acetyl-3,3-dimethylcyclohexane | 2914.29 | ||
25306-75-6 | Sodium butyl xanthate | Sodium O-(2-methylpropyl) carbonodithioate | 2930.9 | |
25307-17-9 | 2,2'-(octadec-9-enylimino)bisethanol | 2,2'-(octadec-9-en-1-ylimino)diethanol | 3402.13 | |
2530-83-8 | 3-glycidyl-oxypropyl-trimethoxy-silane | 3-(2,3-epoxypropoxy)propyltrimethoxysilane | ||
2530-85-0 | 3-Methacryloxypropyltrimethoxysilane | 3-trimethoxysilylpropyl methacrylate | 2930.9 | |
2530-87-2 | (3-Chloropropyl)trimethoxysilane | 3-chloropropyltrimethoxysilane | 2931.9 | |
25312-34-9 | (E)-4-(2,6,6-trimethylcyclohex-2-en-1-yl)but-3-en-2-ol | 4-(2,6,6-trimethylcyclohex-2-en-1-yl)but-3-en-2-ol | 2906.19 | |
25316-40-9 | Doxorubicin hydrochloride | 2942 | 6 | |
25322-17-2 | Dinonylnaphthalenesulfonic acid | Dinonylnaphthalenesulfonic acid | 3815.9 | |
25322-68-3 | Polyethylene glycol ; Macrogol ; Fragrance of polyethylene glycol | 2-[2-[2-[2-[2-[2-[2-(2-hydroxyethoxy)ethoxy]ethoxy]ethoxy]ethoxy]ethoxy]ethoxy]ethanol | 6 | |
25322-69-4 | Polyglycol | Ethane-1,2-diol;propane-1,2-diol;propane-1,2,3-triol | 3403.99 | |
25332-39-2 | Trazodone hydrochloride | 2942 | 6 | |
25339-09-7 | Isocetyl stearate | 2915.7 | ||
253430-12-5 | Benzamide, 3,3'-[(2-chloro-1,4-phenylene)bis[imino(1-acetyl-2-oxo-2,1-ethanediyl)-2,1-diazenediyl]]bis[4-methyl- | 3204.17 | ||
253-52-1 | Phthalazine | Phthalazine | 2933.99 | |
2537-48-6 | Diethyl cyanomethylphosphonate | 2926.9 | ||
2537-62-4 | Disperse blue 183.1 | 3204.11 | ||
25376-45-8 | M-Toluenediamine | 2921.51 | ||
25377-73-5 | Dodecenylsuccinic anhydride | 3-[(E)-dodec-1-enyl]oxolane-2,5-dione | ||
25383-99-7 | Sodium stearoyl lactylate | Sodium;2-(2-octadecanoyloxypropanoyloxy)propanoate | ||
2538-85-4 | C.I. Mordant Black 17 | Sodium 3-hydroxy-4-(2-hydroxy-1-naphthylazo)-1-naphthalenesulfonate | 2927 | |
25389-94-0 | Kanamycin Sulfate ; Kanamycin sulfate from Streptomyces kanamyceticus | 6 | ||
25395-31-7 | Glyceryl diacetate | Glycerol 1,3-diacetate | 2915.39 | |
25409-36-3 | Furonol | 2932.19 | ||
25414-22-6 | 2-Methoxyfuran | 2932.19 | ||
25415-62-7 | Fragrance of amyl isovalerate | Pentyl isovalerate | 3302.1 | |
25417-20-3 | Sodium dibutylnaphthalenesulphonate | Sodium dibutylnaphthalenesulfonate | 3402.11 | |
2542-01-9 | Zinc laurate | 2915.9 | ||
25446-78-0 | Sodium 2-[2-[2-(tridecyloxy)ethoxy]ethoxy]ethyl sulphate | Sodium 2-{2-[2-(tridecyloxy)ethoxy]ethoxy}ethyl sulfate | 3402.11 | |
25446-80-4 | sodium 2-[2-(2-tetradecoxyethoxy)ethoxy]ethyl sulfate ; Sodium myreth sulfate | 3402.11 | ||
25448-25-3 | Triisodecyl phosphite | 2920.9 | ||
25486-55-9 | (2,3-epoxyphytyl)menaquinone | 3824.9 | ||
2548-87-0 | (E)-oct-2-enal | 2912.19 | ||
25496-72-4 | Glyceryl monooleate | Glycerol oleate | ||
25498-49-1 | 2-[1-(1-methoxypropan-2-yloxy)propan-2-yloxy]propan-1-ol | |||
2550-02-9 | n-Propyltriethoxysilane | 2931.9 | ||
25505-65-1 | 2,5-Dimethoxy-4-methylphenethylamine | 2942 | ||
25513-46-6 | Polyglutamic acid | 2922.42 | ||
25513-64-8 | Trimethylhexamethylenediamine | 2921.29 | ||
2551-62-4 | Sulfur hexafluoride | Hexafluoro-$l^{6}-sulfane | 2812.9 | 8 |
2551-83-9 | Allyltrimethoxysilane | 2931.9 | ||
25535-16-4 | 3,8-Diamino-5-(3-diethylaminopropyl)-6-phenylphenanthridinium iodide methiodide | |||
25550-51-0 | Hexahydromethylphthalic anhydride | Hexahydromethylphthalic anhydride | 3812.2 | |
25550-98-5 | Phenyl Diisodecyl Phosphite | 2920.9 | ||
25561-30-2 | N,O-Bis(trimethylsilyl)trifluoroacetamide | 2931.9 | ||
25583-20-4 | Titanium nitride, (TiN) | Azanylidynetitanium | 2850 | |
25606-41-1 | Propamocarb hydrochloride | Propyl [3-(dimethylamino)propyl]carbamate hydrochloride | 2924.19 | 8 |
25619-56-1 | Barium dinonylnaphthalene sulfonate | Barium(2+);2,3-di(nonyl)naphthalene-1-sulfonate | 2836.99 | |
25620-58-0 | Meta-xylylenediamine ; 2,2,4(2,4,4)-Trimethyl-1,6-hexanediamine | 2921.59 | ||
25634-93-9 | 2-Methyl-5-Phenylpentanol | 2942 | ||
25637-84-7 | Diolein (C18:1,(CIS)-9) | 2916.15 | ||
2564-83-2 | 2,2,6,6-Tetramethyl-1-piperidinyloxy, free radical | 2933.99 | ||
2568-33-4 | Isopentyldiol | 3-methylbutane-1,3-diol | 2905.39 | |
25704-18-1 | Poly(sodium-4-styrenesulfonate) | 3402.11 | ||
25721-92-0 | Lanthanum acetate | Lanthanum(3+) triacetate | 2846.9 | |
25723-16-4 | Trimethylolpropanepropoxylate | 3812.3 | ||
25728-82-9 | Octacosanoic acid,sodium salt | 3812.2 | ||
2576-47-8 | 2-Bromoethylammonium bromide | 2-bromoethylammonium bromide | 2921.19 | |
25791-96-2 | Poly[oxy(methyl-1,2-ethanediyl)], α,α',α''-1,2,3-propanetriyltris[ω-hydroxy- | 2909.49 | ||
2579-20-6 | 1,3-Cyclohexanedimethanamine | Cyclohexane-1,3-diyldimethanamine | 2921.3 | |
2580-56-5 | Basic blue 26 ; Victoria blue B | N-(4-{[4-(dimethylamino)phenyl][4-(phenylamino)naphthalen-1-yl]methylidene}cyclohexa-2,5-dien-1-ylidene)-N-methylmethanaminium chloride | 2934.99 | |
2580-78-1 | Reactive blue 19 | 2-(3-(4-amino-9,10-dihydro-3-sulfo-9,10-dioxoanthracen-4-yl)aminobenzenesulfonyl)vinyl disodium sulfate | 3204.9 | |
25808-74-6 | Lead fluorosilicate | lead(2+) hexafluoridosilicate(2−) | 2826.9 | 3 |
25812-30-0 | 5-(2,5-Dimethylphenoxy)-2,2- dimethylpentanoicacid | 2918.99 | ||
25843-45-2 | Azoxymethane | 2929.9 | ||
25852-47-5 | Polyglycol dimethacrylate | 2-(2-methylprop-2-enoyloxy)ethyl 2-methylprop-2-enoate | ||
25895-60-7 | Sodium cyanoborohydride | Sodium; cyanoboranuide | 2837.2 | |
2593-15-9 | Etridiazole | 5-ethoxy-3-(trichloromethyl)-1,2,4-thiadiazole | 2934.99 | 8 |
25952-53-8 | N-(3-Dimethylaminopropyl)-N′-ethylcarbodiimide hydrochloride | 2925.29 | ||
25956-17-6 | Allura red ; food red 17 | Disodium 6-hydroxy-5-[(2-methoxy-5-methyl-4-sulfophenyl)azo]-2-naphthalenesulfonate | 3205 | |
2597-03-7 | Phenthoate | Ethyl [(dimethoxyphosphorothioyl)sulfanyl](phenyl)acetate | 2930.9 | |
25973-55-1 | 2-(2H-benzotriazol-2-yl)-4,6-ditertpentylphenol | 2-(2H-benzotriazol-2-yl)-4,6-di-tert-pentylphenol | ||
25988-63-0 | Poly-L-lysine | 2922.29 | ||
26002-80-2 | d-Phenothrin | 3-phenoxybenzyl 2,2-dimethyl-3-(2-methylprop-1-en-1-yl)cyclopropanecarboxylate | 2916.2 | |
26016-99-9 | Fosfomycin sodium | 2941.9 | 6 | |
26022-00-4 | Phenolic resin | 3806.9 | ||
2602-34-8 | (3-Glycidyloxypropyl)triethoxysilane ; Epoxy Silane | 2931.9 | ||
26023-84-7 | Chloroplatinic acid hydrate | Tetrachloroplatinum; hydrate; dihydrochloride | 2843.9 | |
26027-38-3 | 2-[2-(4-nonylphenoxy)ethoxy]ethanol | 3402.13 | ||
260359-57-7 | Allethrin | 2916.2 | ||
26040-51-7 | Bis(2-ethylhexyl) tetrabromophthalate | 2917.39 | ||
26046-85-5 | D-Phenothrin | 3-phenoxybenzyl (1R,3R)-2,2-dimethyl-3-(2-methylprop-1-en-1-yl)cyclopropanecarboxylate | 2925.19 | |
2605-79-0 | Decylamine oxide | |||
26062-79-3 | Polyquaternium-6 ; 2-Propen-1-aminium, N,N-dimethyl-N-2-propen-1-yl-, chloride (1:1), homopolymer | |||
260779-88-2 | Cisapride monohydrate | 2933.39 | 6 | |
26086-33-9 | Trimethylolpropane triethylhexanoate | Propylidynetrimethyl tris(2-ethylhexanoate) | 2915.9 | |
26099-09-2 | Polymaleic Acid ; Hydrolyed Polymaleic Anhydride | 2917.19 | ||
2610-05-1 | Direct blue 1 | 3204.14 | ||
2610-10-8 | Direct red 80 ; C.I. 35780 | 3212.9 | ||
2610-11-9 | Direct red 81 ; C.I. 28160 | 3204.16 | ||
26115-70-8 | Tris-(trimethoxysilylpropyl)isocyanurate | 2931.9 | ||
2611-67-8 | Cyanin chloride | 2-(3,4-dihydroxyphenyl)-3-(β-D-glucopyranosyloxy)-7-hydroxychromenium-5-yl β-D-glucopyranoside chloride | 2938.9 | |
2611-82-7 | Acid red 18 | Trisodium 7-hydroxy-8-(4-sulfonato-1-naphthylazo)naphthalene-1,3-disulfonate | 3212.9 | |
26143-11-3 | Ethanol ; tungsten | 2905.19 | ||
26159-34-2 | (S)-6-Methoxy-α-methyl-2-naphthaleneacetic acid sodium salt | 2918.99 | ||
26172-55-4 | 5-Chloro-2-methyl-1,2-thiazol-3(2H)-one | 2905.59 | ||
26177-86-6 | D-Fructose-6-phosphate disodium salt | 2940 | ||
26182-60-5 | Potassium polyvinyl sulfate | 2917.19 | ||
26183-52-8 | Decan-1-ol, ethoxylated (1 - 2.5 moles ethoxylated) | 3402.9 | ||
2622-14-2 | Tricyclohexylphosphine | 2931.9 | ||
2623-23-6 | L-Menthyl acetate | (1R,2S,5R)-5-methyl-2-(propan-2-yl)cyclohexyl acetate | 2915.39 | |
2623-85-9 | Lubricating oils (petroleum), C20-50, hydrotreated neutral oil based, high viscosity | 2710.19 | ||
26260-02-6 | 2-Iodobenzaldehyde | 2942 | ||
26264-06-2 | Calcium dodecylbenzenesulphonate | 3824.9 | ||
26264-58-4 | Magnesium hypophosphite | Sodium 2-methylnaphthalene-1-sulfonate | 2835.1 | |
26266-58-0 | Sorbitan trioleate | [(2R)-2-[(3R,4S)-4-hydroxy-3-[(Z)-octadec-9-enoyl]oxyoxolan-2-yl]-2-[(Z)-octadec-9-enoyl]oxyethyl] (Z)-octadec-9-enoate | ||
2627-95-4 | 1,3-Divinyltetramethyldisiloxane | |||
26299-14-9 | Pyridinium chlorochromate | Pyridinium chlorochromate | 2933.31 | |
26305-03-3 | Pepstatin A | 3-hydroxy-4-[2-[[3-hydroxy-6-methyl-4-[[3-methyl-2-[[3-methyl-2-(3-methylbutanoylamino)butanoyl]amino]butanoyl]amino]heptanoyl]amino]propanoylamino]-6-methylheptanoic acid | 6 | |
2631-40-5 | Isoprocarb | 2924.29 | 8 | |
26316-40-5 | Oxirane, 2-methyl-, polymer with oxirane, 1,2-ethanediylbis(nitrilodialkylene) ether | 3402.13 | ||
2632-99-7 | 4,4'-Azopyridine | 2933.11 | ||
26335-74-0 | Poly(isobutyl acrylate) | 2933.29 | ||
2634-33-5 | 1,2-Benzisothiazolin-3-one | 1,2-benzisothiazol-3(2H)-one | 2925.11 | |
26352-16-9 | Silicic acid tetraethylester homopolymer | 2916.14 | ||
2635-84-9 | P-Nitrophenyl butyrate | 2915.6 | ||
2637-34-5 | 2-Mercaptopyridine | Pyridine-2-thiol | 2933.39 | |
26386-88-9 | Diphenyl azidophosphate | 2929.9 | ||
2638-94-0 | 4,4′-Azobis(4-cyanopentanoic acid) | 4,4'-dicyano-4,4'-azodivaleric acid | 2927 | |
2639-63-6 | Fragrance of hexyl butyrate | Hexyl butyrate | 3302.1 | |
26399-02-0 | 2-ethylhexyl oleate | 2-ethylhexyl oleate | 2916.15 | |
26401-35-4 | Diisotridecyl adipate | Diisotridecyl adipate | 2917.12 | |
26402-26-6 | Glyceryl caprylate | |||
26412-87-3 | Sulfur trioxide pyridine complex | 2942 | ||
26444-49-5 | Diphenyl tolyl phosphate | Diphenyl tolyl phosphate | 3815.9 | |
26446-35-5 | Glycerol monoacetate | Glycerol acetate | 2915.39 | |
26446-38-8 | Sucrose palmitate | 3-O-palmitoyl-beta-D-fructofuranosyl alpha-D-glucopyranoside | ||
26447-10-9 | Ammonium xylenesulfonate | ammonium dimethylbenzenesulfonate | 3402.11 | |
26447-40-5 | Methylenediphenyl diisocyanate, mixture of isomers | Methylenediphenyl diisocyanate | 2715 | 8 |
2646-71-1 | NADPH tetrasodium salt hydrate | 2933.99 | ||
26468-86-0 | Poly(oxy-1,2-ethanediyl) | 1-[2-[2-[2-[2-(2-butoxyethoxy)ethoxy]ethoxy]ethoxy]ethoxy]octane | 3402.9 | |
26471-62-5 | Toluene-diisocyanate, mixture of toluene-2,4-di-isocyanate and toluene-2,6-di-isocyanate | 2929.1 | ||
2650-17-1 | Acid blue 147 | 1,3-benzenedisulfonic acid, 4-[[4-(ethylamino)-3-methylphenyl][4-(ethylimino)-3-methyl-2,5- cyclohexadien-1-ylidene]methyl]-, monosodium salt | 3212.9 | |
2650-18-2 | Acid blue 9 | Diammonium 2-[{4-[ethyl(3-sulfonatobenzyl)amino]phenyl}{4-[ethyl(3-sulfonatobenzyl)iminio]cyclohexa-2,5-dien-1-ylidene}methyl]benzenesulfonate | 3204.12 | |
26523-78-4 | Tris (nonylphenyl) phosphite | Tris(nonylphenyl) phosphite | ||
2653-20-1 | 2-Octyl-4-Isothiazolin-3-One | 2934.1 | ||
26536-12-9 | Glyceryl tritridecanoate | 2915.9 | ||
26536-13-0 | Glyceryl trinonadecanoate | 2915.9 | ||
26538-44-3 | α-Zearalanol | (3S,7R)-7,14,16-trihydroxy-3-methyl-3,4,5,6,7,8,9,10,11,12-decahydro-1H-2-benzoxacyclotetradecin-1-one | 2932.2 | |
26544-23-0 | Di-Phenyl isodecyl Phosphite | |||
26544-38-7 | Dodecenyl succinic anhydride | Tetraprop-1-enesuccinic anhydride | 2917.19 | |
26571-11-9 | 2-[2-[2-[2-[2-[2-[2-[2-[2-(4-nonylphenoxy)ethoxy]ethoxy]ethoxy]ethoxy]ethoxy]ethoxy]ethoxy]ethoxy]ethanol | 26-(nonylphenoxy)-3,6,9,12,15,18,21,24-octaoxahexacosan-1-ol | 2909.49 | |
26585-57-9 | 1,4-Benzenedisulfonicacid, 2-amino-5-methyl- | 2922.29 | ||
26590-05-6 | Polyquaternium 7 ; 2-Propen-1-aminium, N,N-Dimethyl-N-2-Propenyl-, chloride polymer with 2-propenamide | |||
26590-20-5 | Methyltetrahydrophthalic anhydride | 2917.2 | ||
26601-63-8 | 2,5-Diethyl-4-methyl-1,3-benzenediamine | 2909.11 | ||
26616-35-3 | Vinylbenzyl trimethylammonium chloride | 2923.9 | ||
26628-22-8 | Sodium azide | Sodium;azide | 2850 | 3 |
26635-92-7 | Octadecyl amine ethoxylate ether | 3402.13 | ||
26635-93-8 | Oleylaminethoxylate | 3402.9 | ||
26636-40-8 | Polyoxyethylene Behenyl Ethers ; Docosanol, ethoxylated, 30 mol EO (average molar ratio) ; Beheneth-30 | 3402.13 | ||
26638-28-8 | Methyl pentachlorooctadecanoate | |||
26643-91-4 | (Z)-4-methyl-2-phenylpent-2-enal | 4-methyl-2-phenylpent-2-enal | 2912.29 | |
26644-46-2 | Triforine | 2933.59 | 8 | |
26658-19-5 | Sorbitan tristearate | 1,3,6-tri-O-stearoylhexitol | ||
26672-22-0 | 2-[(4-amino-3-methoxyphenyl)sulphonyl]ethyl hydrogen sulphate | 2-[(4-amino-3-methoxyphenyl)sulfonyl]ethyl hydrogen sulfate | 2930.9 | |
26678-93-3 | para-tert-octylphenol formaldehyde resin | 3812.1 | ||
26680-54-6 | Octenylsuccinic Anhydride | Octylsuccinic anhydride | 2917.19 | |
2673-22-5 | Sodium 1,2-bis(tridecyloxycarbonyl)ethanesulphonate | Sodium 1,2-bis(tridecyloxycarbonyl)ethanesulfonate | 3402.11 | |
26741-53-7 | Bis(2,4-di-tert-butylphenyl)pentaerythritol diphosphite | Pentaerythritol O,O-bis(2,4-di-tert-butylphenyl)bis(phosphite) | ||
26747-90-0 | Dimeric 2,4-toluene diisocyanate ; 2,4-dioxo-1,3-diazetidine-1,3-bis(methyl-m-phenylene)diisocyanate | 1,3-bis[3-isocyanato(methyl)phenyl]-1,3-diazetidine-2,4-dione | 2929.9 | |
26748-41-4 | tert-Butyl peroxyneodecanoate | |||
26748-47-0 | Cumyl peroxyneodecanoate | 2915.9 | ||
26761-40-0 | Diisodecyl phthalate | |||
26761-45-5 | Glycidyl Neodecanoate | 2915.9 | ||
26780-96-1 | 2,2,4-Trimethyl-1,2-Dihydroquinoline polymer | |||
26787-78-0 | Amoxicillin | (2S,5R,6R)-6-{[(2R)-2-amino-2-(4-hydroxyphenyl)acetyl]amino}-3,3-dimethyl-7-oxo-4-thia-1-azabicyclo[3.2.0]heptane-2-carboxylic acid | 2941.1 | 6 |
2680-03-7 | N,N-Dimethyl acrylamide | N,N-dimethylacrylamide | 2924.19 | |
2682-20-4 | 2-Methyl-4-isothiazolin-3-one ; Methylisothiazolinone | 2930.9 | ||
26838-05-1 | Disodium C-dodecyl sulphonatosuccinate | 3402.11 | ||
26850-12-4 | Disperse red 167 | 3204.11 | ||
2687-25-4 | o-Toluenediamine | 2921.51 | ||
2687-44-7 | N-Methyl pyrrolidone | 3402.9 | ||
2687-91-4 | N-Ethylpyrrolidone-2 | 1-ethylpyrrolidin-2-one | 2933.79 | |
2687-96-9 | N-Dodecyl-2-Pyrrolidone | 1-dodecylpyrrolidin-2-one | 2933.79 | |
26896-20-8 | Neodecanoic acid | 7,7-dimethyloctanoic acid | ||
26921-17-5 | Timolol maleate | 2934.99 | 6 | |
26936-40-3 | Polycytidylic acid (5')- Potassium | 2934.99 | ||
26942-95-0 | Triisostearin | Propane-1,2,3-triyl tris(16-methylheptadecanoate) | 2915.9 | |
26951-52-0 | Poly(tetramethylenoxid)-diglycidylether | 2910.9 | ||
2695-37-6 | Sodium p-Styrenesulfonate; Sodium 4-vinylbenzenesulfonate | Sodium p-styrenesulfonate | 2904.1 | |
26970-82-1 | Sodium selenite pentahydrate | Disodium; selenite; pentahydrate | 2842.901 | |
2698-41-1 | [(2-Chlorophenyl)methylidene]propanedinitrile | (2-chlorobenzylidene)propanedinitrile | 2903.12 | |
27025-41-8 | Glutathione, oxidized, free Acid | (2S,2'S)-5,5'-[disulfanediylbis({(2R)-3-[(carboxymethyl)amino]-3-oxopropane-1,2-diyl}imino)]bis(2-amino-5-oxopentanoic acid) | 2930.9 | |
2702-72-9 | 2,4-D-sodium | Sodium 2,4-dichlorophenoxyacetate | 2918.99 | 8 |
27028-82-6 | Triethanolamine polyoxyethylene lauryl ether sulfate | 3402.11 | ||
270573-71-2 | Disodium 4,5-dihydroxybenzene-1,3-disulphonate monohydrate | 2908.99 | ||
2705-87-5 | Fragrance of allyl cyclohexylpropionate | Allyl 3-cyclohexylpropionate | ||
2706-50-5 | DL-Amphetamine hydrochloride | 1-phenylpropan-2-amine hydrochloride | 2929.9 | |
27083-27-8 | Polyaminopropyl-biguanide | 2921.22 | ||
27115-36-2 | Chromium formate | Chromium triformate | 2915.12 | |
27115-49-7 | 3-Methylhippuric acid | 2924.29 | ||
27115-50-0 | 4-Methylhippuric acid | 2924.29 | ||
27126-76-7 | [Hydroxy(tosyloxy)iodo]benzene | 2931.9 | ||
27138-31-4 | Dipropylene glycol dibenzoate | |||
27164-46-1 | Cefazolin sodium | 2941.9 | 6 | |
27176-87-0 | Dodecylbenzenesulphonic acid | Dodecylbenzenesulfonic acid | ||
27178-16-1 | Diisodecyl Adipate | Diisodecyl hexanedioate | ||
27194-74-7 | Polypropylene Glycol Monolaurate | 3402.13 | ||
27195-16-0 | Sucrose distearate | [(2S,3R,4S,5S,6R)-2-[(2S,3S,4S,5R)-3,4-dihydroxy-2,5-bis(hydroxymethyl)oxolan-2-yl]-4,5-dihydroxy-6-(hydroxymethyl)-2-octadecanoyloxyoxan-3-yl] octadecanoate | 3823.19 | |
27200-12-0 | Dihydromyricetin | 2932.99 | ||
2721-22-4 | D-Tetradecalactone | 2932.19 | ||
27214-00-2 | Calcium glycerophosphate | Calcium glycerophosphate | 2919.9 | |
272451-65-7 | Flubendiamide | N1-[1,1-dimethyl-2-(methylsulfonyl)ethyl]-3-iodo-N2-{2-methyl-4-[1,2,2,2-tetrafluoro-1-(trifluoromethyl)ethyl]phenyl}phthalamide | 2930.9 | 8 |
2724-58-5 | Isostearic acid | 2915.9 | ||
27246-55-4 | Solvent yellow 185 | 3204.9 | ||
27247-96-7 | 2-ethylhexyl nitrate | 2-ethylhexyl nitrate | 2920.9 | |
2725-22-6 | 2,4-Bis(2,4-dimethylphenyl)-6-(2-hydroxy-4-n-octyloxyphenyl)-1,3,5-triazine | 3812.3 | ||
27252-75-1 | Polyethyleneglycol 300 monooctylether (fractionated) | 3402.13 | ||
27253-29-8 | Zinc neodecanoate | 3815.9 | ||
27253-31-2 | Cobalt neodecanoate ; Neodecanoicacid, cobalt salt | |||
27253-33-4 | Calcium octoate | 3211 | ||
27253-58-3 | Diisononyl phosphate | 3812.2 | ||
2730-43-0 | 1-Chloro-3,3,3-trifluoroprop-1-ene | 1-chloro-3,3,3-trifluoroprop-1-ene | 2903.39 | |
27306-90-7 | Polyoxyethylene lauryl ether carboxylic acid | 3402.11 | ||
273-13-2 | 2,1,3-Benzothiadiazole | 2,1,3-benzothiadiazole | 2934.99 | |
27321-72-8 | Triglycerol octadecanoate | |||
2733-88-2 | Methyl cis-15-Tetracosenoate | 2916.19 | ||
27344-41-8 | Fluorescent brightener 351 ; 2,2'-[(1,1'-Biphenyl)-4,4'-diyldi-2,1-ethenediyl] | Benzenesulfonic acid, 2,2'-([1,1'-biphenyl]-4,4'-diyldi-2,1-ethenediyl)bis-, sodium salt (1:2) | 3206.11 | |
27348-32-9 | Lysine aspartate | 2922.41 | ||
27421-51-8 | 1-Methylindole-2-Carboxaldehyde | 2933.99 | ||
27425-55-4 | Solvent yellow 145 | 3204.9 | ||
2744-50-5 | Solvent green 5 | 3,9-Perylenedicarboxylicacid,bis(2-methylpropyl)ester | 3204.11 | |
2745-26-8 | 2-Furanacetic acid | 2932.19 | ||
27458-92-0 | Isotridecan-1-ol | 3402.9 | ||
27458-93-1 | Isooctadecan-1-ol ; Isostearyl alcohol | 16-methylheptadecan-1-ol | 2905.19 | |
274693-27-5 | Ticagrelor | (1S,2S,3R,5S)-3-(7-{[(1R,2S)-2-(3,4-difluorophenyl)cyclopropyl]amino}-5-(propylsulfanyl)-3H-[1,2,3]triazolo[4,5-d]pyrimidin-3-yl)-5-(2-hydroxyethoxy)cyclopentane-1,2-diol | 2933.99 | |
274901-16-5 | Vildagliptin | (2S)-{[(3-hydroxyadamantan-1-yl)amino]acetyl}pyrrolidine-2-carbonitrile | 2933.99 | 6 |
27503-81-7 | 2-phenyl-1H-benzimidazole-5-sulfonic acid ; Ensulizole | 2933.99 | ||
2753-45-9 | Mebeverine hydrochloride | 2922.5 | ||
27538-10-9 | 2-Ethyl-4-hydroxy-5-methyl-3(2H)-furanone | 2932.19 | ||
27546-07-2 | Ammonium dimolybdate | Azane; hydroxy-(hydroxy(dioxo)molybdenio)oxy-dioxomolybdenum | 2841.7 | |
275-51-4 | Azulene | Azulene | 2902.19 | |
27578-60-5 | 1-(2-Aminoethyl)piperidine | N-(2-aminoethyl)piperidine | 2933.39 | |
2759-28-6 | Benzylpiperazine (BZP) | 1-benzylpiperazine | 2933.59 | 7 |
27607-77-8 | Trimethylsilyl trifluoromethanesulfonate | Trimethylsilyl trifluoromethanesulfonate | 2931.9 | |
2760-98-7 | Isophthalic dihydrazide | |||
27610-92-0 | 2-Butyloctanoic acid | 2-Butyloctanoic acid | ||
27638-00-2 | Glyceryl dilaurate | 2915.9 | ||
2763-96-4 | Muscimol | 5-(aminomethyl)isoxazol-3-ol hydrate | 2934.99 | |
2764-13-8 | 1-Propanaminium, N-(2-hydroxyethyl)-N,N-dimethyl-3-(1- oxooctadecyl) amino]-, nitrate (salt) | 2-hydroxyethyldimethyl-3-stearamidopropylammonium nitrate | 2923.9 | |
27676-62-6 | Tris(3,5-di-tertbutyl-4-hydroxybenzyl) isocyanate | 1,3,5-tris(3,5-di-tert-butyl-4-hydroxybenzyl)-1,3,5-triazinane-2,4,6-trione | ||
2768-02-7 | Vinyltrimethoxysilan | Trimethoxy(vinyl)silane | 2931.9 | |
27697-00-3 | 2-Methacryloyloxyethyl phthalic acid | 2917.2 | ||
27774-13-6 | Basic vanadium(IV) sulfate | Oxovanadium(2+);sulfate | 2833.29 | |
27776-21-2 | 2,2'-(Diazene-1,2-diyldipropane-2,2-diyl]bis-4,5-dihydro-1H-imidazole dihydrochloride | 2,2'-(diazene-1,2-diyldipropane-2,2-diyl]bis-4,5-dihydro-1H-imidazole dihydrochloride | 2927 | |
2778-96-3 | Stearyl stearate | Octadecyl octadecanoate | 2915.7 | |
2781-00-2 | 1,4-bis[1-(tert-butylperoxy)-1-methylethyl]benzene | Di-tert-butyl α,α,α',α'-tetramethyl-(p-phenylenedimethylene) diperoxide | 3812.1 | |
27813-02-1 | Hydroxypropyl methacrylate | 2916.14 | 3 | |
2782-57-2 | Dichloroisocyanuric acid | 2933.69 | 3 | |
2783-94-0 | Sunset yellow | Disodium 6-hydroxy-5-[(4-sulfophenyl)azo]-2-naphthalenesulfonate | 3212.9 | |
27841-06-1 | Neopentyl glycol dicaprate | 2915.9 | ||
27848-80-2 | Lithium L-lactate | 2918.11 | ||
27848-81-3 | Lithium D-lactate | Lithium D-(-)-lactate | 2918.11 | |
27848-84-6 | Nicergoline | [(8β)-10-methoxy-1,6-dimethylergolin-8-yl]methyl 5-bromopyridine-3-carboxylate | 2939.69 | |
2785-89-9 | 4-Ethyl-2-methoxyphenol | 4-ethylguaiacol | 2918.19 | |
2786-76-7 | Pigment red 170 | 2-Naphthalenecarboxamide, 4-[[4-(aminocarbonyl)phenyl] azo]-N-(2-ethoxyphenyl)-3- hydroxy- | 3212.9 | |
2787-91-9 | Basic blue 3 | 3204.16 | ||
27918-14-5 | 2-Aminoacridone | 3204.9 | ||
27925-02-6 | 9-Octadecenoic Acid, 12-Hydroxy-, (R-(Z))-, Homopolymer | 3823.19 | ||
2795-39-3 | Perfluorooctanesulfonic acid potassium salt | Potassium;1,1,2,2,3,3,4,4,5,5,6,6,7,7,8,8,8-heptadecafluorooctane-1-sulfonate | 2826.9 | |
27987-25-3 | Dimethyl cyclohexyl phthalate | Bis(methylcyclohexyl) phthalate | 2917.34 | |
27988-77-8 | Gold(III) chloride hydrate | Trichlorogold;hydrate;hydrochloride | 2843.3 | |
2801-68-5 | Dimethoxyamphetamine ; DMA | (±)-2,5-dimethoxy-α-methylphenethylamine | 2921.46 | 7 |
28048-33-1 | 3-(2-Pyridyl)-5,6-bis(4-phenylsulfonic acid)-1,2,4-triazine disodium salt | 2933.69 | ||
28053-08-9 | Uridine 5′-diphosphoglucose disodium salt | Uridine(5')disodiodiphospho(1)-α-D-glucose | 2940 | |
280-57-9 | Triethylene diamine ; 1,4-Diazabicyclo[2.2.2]octane | 1,4-diazabicyclo[2.2.2]octane | ||
28063-42-5 | (Z)-Docos-13-enoic acid, monoester with glycerol | 3402.13 | ||
28064-14-4 | 2-(chloromethyl)oxirane; Formaldehyde; Phenol | 2910.9 | ||
28069-72-9 | (2E,6Z)-nona-2,6-dien-1-ol | (2E,6Z)-nona-2,6-dien-1-ol | 2905.29 | |
2807-30-9 | 2-Propoxyethanol ; Ethylene Glycol Monopropyl Ether | 2-propoxyethanol | ||
2809-21-4 | Etidronic acid ; 1-Hydroxyl ethylidene -1,1,-diphosphonic acid | (1-hydroxyethane-1,1-diyl)bis(phosphonic acid) | 2931.9 | |
281-23-2 | Adamantane | Tricyclo[3.3.1.1'3,7]decane | 2902.19 | 6 |
2814-77-9 | Pigment red 4 ; C.I. 12085 ; 1-(2-chloro-4-nitrophenylazo)-2-naphthol | 3204.12 | ||
2815-50-1 | Fast scarlet LG base ; 5-(benzylsulfonyl)-2-methoxyaniline | 5-benzylsulfonyl-o-anisidine | 2924.29 | |
28159-98-0 | N’-tert-butyl-N-cyclopropyl-6-(methylthio)-1,3,5-triazine-2,4-diamine | N-tert-butyl-N'-cyclopropyl-6-(methylthio)-1,3,5-triazine-2,4-diamine | 2933.69 | |
28166-41-8 | Alpha-Cyano-4-Hydroxycinnamic acid | 2926.9 | ||
28182-81-2 | Modified polyisocyanate ; 1,6-HexamethyleneDiisocyanate Based Polyisocyanate | |||
28198-05-2 | Solvent green 28 | 3204.19 | ||
28212-48-8 | Poly(bis(phenoxy)phosphazene) | 2931.9 | ||
28219-61-6 | 2-Ethyl-4-(2,2,3-trimethylcyclopent-3-en-yl)-but-2-en-1-ol | 2-ethyl-4-(2,2,3-trimethylcyclopent-3-en-1-yl)but-2-en-1-ol | 2906.19 | |
28249-77-6 | Thiobencarb | 2930.9 | 8 | |
2827-56-7 | 1-Aminohydantoin hydrochloride | 1-aminoimidazolidine-2,4-dione monohydrochloride | 2933.21 | |
28289-54-5 | 1-Methyl-4-phenyl-1,2,3,6-tetrahydropyridine | 1-methyl-4-phenyl-1,2,3,6-tetrahydropyridine | 2933.39 | |
2829-42-7 | Direct yellow 26 | 3204.14 | ||
28300-74-5 | Antimony potassium tartrate | Antimony potassium tartrate | 2918.13 | |
28302-36-5 | Natural sodium copper chlorophyllin | 3203 | ||
28304-74-7 | Benzothiazolium,2-[[4-[ethyl(2-hydroxyethyl)- amino]phenyl]azo]-6-methoxy-3-methyl-,trichlorozincate(1-) | 3204.13 | ||
28305-25-1 | Calcium lactate | Calcium di-L-(-)-lactate | 2918.11 | |
2832-40-8 | Disperse yellow 3 | 3204.9 | ||
28324-52-9 | Pinanyl hydroperoxide | Pinanyl hydroperoxide | 3815.9 | 3 |
2832-45-3 | Sodium hexanesulfonate | Sodium hexane-1-sulfonate | ||
28348-53-0 | Sodium cumenesulphonate | Sodium cumenesulfonate | 3402.11 | |
2835-81-6 | DL-2-Aminobutyric acid | (±)-2-aminobutyric acid | 2922.49 | |
283594-90-1 | Spiromesifen | 3-mesityl-2-oxo-1-oxaspiro[4.4]non-3-en-4-yl 3,3-dimethylbutanoate | 2932.2 | 8 |
2835-95-2 | 4-Amino-2-Hydroxytoluene ; 5-Amino-O-cresol | 5-amino-o-cresol | 2922.29 | |
2835-99-6 | 4-Amino-m-cresol | 4-amino-m-cresol | 2922.29 | |
283-872-7 | Anise oil ; Pimpinella anisum L. | 3302.9 | ||
2840-24-6 | Trimethylammonium bromide | Trimethylammonium bromide | 2923.9 | |
28434-00-6 | S-Bioallethrin | (1S)-2-methyl-4-oxo-3-(prop-2-en-1-yl)cyclopent-2-en-1-yl (1R,3R)-2,2-dimethyl-3-(2-methylprop-1-en-1-yl)cyclopropanecarboxylate | 2925.19 | |
28472-89-1 | Polyester resin | 1,3-Benzenedicarboxylic acid, polymer with 2,5-furandione, hexanedioic acid and 2,2'-oxybis[ethanol] | 3506.91 | |
28510-23-8 | Neopentyl Glycol Diethylhexanoate | 2918.19 | ||
28537-85-1 | Dibutylamine caprylate | 2921.19 | ||
2854-40-2 | Cyclo(-pro-val) | 2933.59 | ||
2855-13-2 | Isophorone diamine ; (1-amino-3-aminoethyl-3,5,5-trimethyl cyclohexane) | 3-aminomethyl-3,5,5-trimethylcyclohexylamine | 2929.1 | 3 |
28553-12-0 | Di-isononyl phthalate | Bis(7-methyloctyl) benzene-1,2-dicarboxylate | ||
2857-97-8 | Bromotrimethylsilane | Bromotrimethylsilane | 2931.9 | |
28588-74-1 | 2-Methyl-3- furanthiol ; Fragrance of 2-Methyl-3-furanthiol | |||
2859-16-7 | Codeine impurity A | (5α,6α)-3,6-dimethoxy-17-methyl-7,8-didehydro-4,5-epoxymorphinan | 2939.11 | |
2861-02-1 | Acid blue 45 | Disodium 4,8-diamino-1,5-dihydroxy-9,10-dioxoanthracene-2,6-disulfonate | 3204.11 | |
286-20-4 | 7-oxabicyclo[4.1.0]heptane ; Cyclohexene oxide | 7-oxabicyclo[4.1.0]heptane | 2910.9 | |
28664-35-9 | 4,5-Dimethyl-3-hydroxy-2,5-dihydrofuran-2-one | 2932.2 | ||
2867-47-2 | 2-(Dimethylamino)ethyl methacrylate | 2-(dimethylamino)ethyl methacrylate | 2922.49 | 3 |
28697-53-2 | D-Arabinose | (3S,4R,5R)-oxane-2,3,4,5-tetrol | 3821 | |
2870-32-8 | Direct yellow 12 | 3212.9 | ||
28718-90-3 | 4′,6-Diamidine-2′-phenylindole dihydrochloride | 2-phenylindole-4',6-dicarboxamidine dihydrochloride hydrate | ||
2872-48-2 | Solvent violet 26 ; C.I. 62015 | 1,4-diamino-2-methoxyanthracene-9,10-dione | 3204.19 | |
2873-97-4 | Diacetone acrylamide | N-(1,1-dimethyl-3-oxobutyl)acrylamide | 2924.19 | |
287714-41-4 | Rosuvastatin | 2935.9 | 6 | |
287-92-3 | Cyclopentane | Cyclopentane | 2902.9 | 3 |
288-13-1 | Pyrazole | Pyrazole | 2933.19 | |
2882-20-4 | 2-Methyl-3-methyl thio pyrazine | 2933.99 | ||
28822-58-4 | 3-Isobutyl-1-methylxanthine | 3,7-dihydro-3-isobutyl-1-methyl-1H-purine-2,6-dione | 2933.59 | |
288-32-4 | Imidazole | Imidazole | 3402.2 | 6 |
2883-98-9 | 1,2,4-trimethoxy-5-[(E)-prop-1-enyl]benzene | 1,2,4-trimethoxy-5-[(1E)-prop-1-en-1-yl]benzene | 2909.3 | |
2885-00-9 | 1-Octadecanethiol | Octadecane-1-thiol | 2930.9 | |
28860-95-9 | Carbidopa | (2S)-3-(3,4-dihydroxyphenyl)-2-hydrazinyl-2-methylpropanoic acid | 2928 | 6 |
28872-01-7 | Oleyldipropylenetriamine | 3402.12 | ||
28874-51-3 | Sodium L-pyroglutamate ; Fragrance of Sodium pyrrolidone carboxylic acid | |||
288-88-0 | 1,2,4-Triazole | 1,2,4-triazole | 2933.99 | |
28911-01-5 | Triazolam | 8-chloro-6-(o-chlorophenyl)-1-methyl-4H-s-triazolo[4,3- a][1,4] benzodiazepine | 2933.91 | 9 |
28920-43-6 | 9-Fluorenylmethyl chloroformate | 2915.9 | ||
2892-51-5 | 3,4-Dihydroxy-3-cyclobutene-1,2-dione | 2914.4 | ||
28928-97-4 | Nonenyl succinic anhydride | |||
2893-78-9 | Sodium dichloroisocyanurate | 2933.69 | 3 | |
28940-11-6 | 7-Methyl-2H-benzo-1,5-dioxepin-3(4H)-one | 7-methyl-2H-1,5-benzodioxepin-3(4H)-one | 2914.5 | |
28961-43-5 | Trimethylolpropane ethoxytriacrylate | 2-[2,2-bis(2-prop-2-enoyloxyethoxymethyl)butoxy]ethyl prop-2-enoate | ||
2896-70-0 | 4-Oxo-2,2,6,6-tetramethyl-1-piperidinyloxy, free radical | 2902.6 | ||
2897-60-1 | 3-Glycidoxypropyl methyldiethoxysilane | Oxirane, 2-[[3-(diethoxymethylsilyl)propoxy]methyl]- | ||
2898-12-6 | Medazepam | 9-chloro-2-methyl-6-phenyl-2,5-diazabicyclo[5.4.0]undeca-5,8,10,12-tetraene | 2933.91 | 9 |
28981-97-7 | Alprazolam | 8-Chloro-1-methyl-6-phenyl-4H-[1,2,4]triazolo[4,3-a][1,4]benzodiazepine | 2933.91 | 9 |
28983-56-4 | Acid blue 93 | 3204.17 | ||
29022-11-5 | N-[(9H-Fluoren-9-ylmethoxy)carbonyl]-glycine | 2924.29 | ||
290-37-9 | Pyrazine | Pyrazine | 2933.99 | |
29063-28-3 | Octanol | 3824.9 | ||
290-87-9 | Triazine | 2933.69 | ||
29094-61-9 | Glipizide | N-(2-{4-[(cyclohexylcarbamoyl)sulfamoyl]phenyl}ethyl)-5-methylpyrazine-2-carboxamide | 2942 | 6 |
29117-02-0 | ppg-3 caprylyl ether ; Poly(oxy(methyl-1,2-ethanediyl)), alpha-octyl-omega-hydroxy- (ppg-3) | 3402.13 | ||
29122-68-7 | Atenolol | 2-{4-[2-hydroxy-3-(propan-2-ylamino)propoxy]phenyl}acetamide | 2924.29 | 6 |
2915-57-3 | Diethylhexyl Succinate | bis(2-ethylhexyl) succinate | 2917.19 | |
2915-72-2 | Alkyl (C12-15) benzoate | 2916.31 | ||
2917-47-7 | 3-(Trimethylsilyl)-1-propanol | 3-(trimethylsilyl)propan-1-ol | 2931.9 | |
29196-72-3 | Aluminium tripolyphosphate | Aluminum butan-2-olate | ||
2921-88-2 | Chlorpyrifos | O,O-diethyl O-(3,5,6-trichloropyridin-2-yl) phosphorothioate | 2933.39 | |
2922-83-0 | L-Kynurenine | 2922.49 | ||
2923-18-4 | Sodium trifluoroacetate | Sodium trifluoroacetate | 2915.9 | |
2923-28-6 | Silver trifluoromethanesulfonate | Silver;trifluoromethanesulfonate | 2843.29 | |
29232-93-7 | Pirimiphos-methyl | 2933.59 | 8 | |
2926-30-9 | Sodium trifluoromethanesulfonate | 2930.9 | ||
2929-86-4 | Phosphorous acid, tridecyl ester | 3402.11 | ||
29329-71-3 | 1-Hydroxyethanediphosphonic acid sodium salt | 2931.9 | ||
293-51-6 | Cyclotetrasiloxane | 2931.9 | ||
2935-90-2 | Methyl 3-mercaptopropionate | Methyl 3-mercaptopropionate | 2930.9 | |
29385-43-1 | Tolyltriazole | 2933.99 | ||
29387-86-8 | 1-Butoxy-2-Propanol | Butoxypropanol | 2905.39 | |
29388-59-8 | (2R,3R)-2,3-bis[(4-hydroxy-3-methoxyphenyl)methyl]butane-1,4-diol | (2R,3R)-2,3-bis(4-hydroxy-3-methoxybenzyl)butane-1,4-diol | 2909.5 | |
29420-49-3 | 1,1,2,2,3,3,4,4,4-Nonafluorobutane-1-sulfonicacid,potassiumsalt | potassium 1,1,2,2,3,3,4,4,4-nonafluorobutane-1-sulfonate | 2904.9 | |
2942-42-9 | 7-Nitroindazole | 2933.99 | ||
2943-75-1 | Triethoxy(octyl)silane | Triethoxy(octyl)silane | 2931.9 | |
294-40-6 | Cyclopentasiloxane | 2931.9 | ||
2944-28-7 | Disperse red 22 | 3204.11 | ||
2944-68-5 | Ferric tartrate | Diiron tritartrate | 2918.13 | |
29463-06-7 | Tris(2-hydroxyethyl)methylammonium methyl sulphate | 2923.9 | ||
2947-64-0 | Mordant violet 16 | 3204.11 | ||
29512-49-0 | 2'-anilino-6'-(diethylamino)-3'-methylspiro[isobenzofuran-1(3H),9'-[9H]xanthene]-3-one | 6'-(diethylamino)-3'-methyl-2'-(phenylamino)-3H-spiro[2-benzofuran-1,9'-xanthen]-3-one | 2922.5 | |
2955-38-6 | Prazepam | 7-chloro-1-(cyclopropylmethyl)-5-phenyl-1,3-dihydro-2H-1,4-benzodiazepin-2-one | 2933.91 | 9 |
29570-58-9 | Dipentaerythritol hexaacrylate ; DPHA | 2917.12 | ||
29589-57-9 | Jarytherm dbt | Dibenzyl(methyl)benzene | 2710.19 | |
29598-76-3 | Pentaerythrityl tetrakis(3-laurylthiopropionate) | 3-{[3-(dodecylsulfanyl)propanoyl]oxy}-2,2-bis({[3-(dodecylsulfanyl)propanoyl]oxy}methyl)propyl 3-(dodecylsulfanyl)propanoate | 2930.9 | |
29700-22-9 | 2,3',4,5'-Tetrahydroxy-trans-stilbene ; Oxyresveratrol | 2907.29 | ||
2973-19-5 | 2-(chloromethyl)-4-nitrophenol | α-chloro-4-nitro-o-cresol | 2908.99 | |
2973-59-3 | 2-Bromo-5-hydroxy-4-methoxybenzaldehyde | 2913 | ||
29736-24-1 | Disodium;2-hydroxy-2-sulfonatoacetate | 3815.9 | ||
29736-75-2 | Diantimony tris (ethylene glycolate) | 2942 | ||
2973-78-6 | 3-bromo-4-hydroxybenzaldehyde | 2913 | ||
29743-21-3 | Terephthalylidene bis(p-butylaniline) | 2916.39 | ||
29761-21-5 | Isodecyl diphenyl phosphate | 3812.2 | ||
29772-02-9 | 1-chloro-4-[[(3-iodo-2-propynyl)oxy]methoxy]benzene | 1-chloro-4-{[(3-iodoprop-2-yn-1-yl)oxy]methoxy}benzene | 2909.3 | |
297730-93-9 | 3-ethoxy-1,1,1,2,3,4,4,5,5,6,6,6-dodecafluoro-2- trifluoromethyl-hexane | 1,1,1,2,3,4,4,5,5,6,6,6-dodecafluoro-2-(trifluoromethyl)hexan-3-yl ethyl ether | 2909.19 | |
29806-73-3 | 2-Ethylhexyl palmitate | 2-Ethylhexyl hexadecanoate | ||
298-07-7 | Diethylhexyl phosphate | Bis(2-ethylhexyl) hydrogen phosphate | 2919.9 | |
298-12-4 | Glyoxylic acid | Glyoxylic acid | 2918.3 | |
298-14-6 | Potassium bicarbonate | Potassium;hydrogen carbonate | ||
29836-26-8 | Octyl hexopyranoside | Octyl β-D-glucoside | 2940 | |
29838-67-3 | Astilbin | (2R,3R)-2-(3,4-dihydroxyphenyl)-5,7-dihydroxy-4-oxo-3,4-dihydro-2H-chromen-3-yl 6-deoxy-α-L-mannopyranoside | 2938.9 | |
298-46-4 | Carbamazepine | 5H-dibenzo[b,f]azepine-5-carboxamide | 2933.99 | 6 |
2985-59-3 | 4-dodecyloxy-2-hydroxybenzophenone | 4-dodecyloxy-2-hydroxybenzophenone | 2914.5 | |
298-57-7 | Cinnarizine | 1-(diphenylmethyl)-4-[(2E)-3-phenylprop-2-en-1-yl]piperazine | 2933.59 | 6 |
298-59-9 | Methylphenidate hydrochloride | Methyl phenyl(piperidin-2-yl)acetate hydrochloride | 2933.99 | 9 |
2986-17-6 | 1,3-Diisopropyl-2-thiourea | 1,3-diisopropyl-2-thiourea | 2930.9 | |
298-83-9 | p-Nitroblue tetrazolium chloride | 5,5'-diphenyl-3,3'-bis(4-nitrophenyl)-2,2'-(3,3'-dimethoxybiphenyl-4,4'-ylene)ditetrazolium dichloride | ||
298-93-1 | (3-(4,5-dimethylthiazol- 2-yl)-2,5-diphenyltetrazolium bromide) | 2-(4,5-dimethylthiazol-2-yl)-3,5-diphenyl-2H-tetrazolium bromide | ||
29894-35-7 | Polyglycerol Polyricinoleate | 2915.7 | ||
298-96-4 | Tetrazolium red ; 2,3,5-triphenyltetrazolium chloride | 2,3,5-triphenyltetrazolium chloride | ||
29911-27-1 | Di(propylene glycol) propyl ether, mixture of isomers | 2909.49 | ||
29911-28-2 | PPG-14 Butyl ether | 1-(1-butoxypropan-2-yloxy)propan-2-ol | ||
299-11-6 | Phenazine methosulfate | 5-methylphenazinium methyl sulfate | 2933.99 | |
2991-42-6 | 4-(Trifluoromethyl)benzenesulfonyl chloride | 2904.9 | ||
29915-38-6 | 3-(tris(hydroxymethyl)methylamino)propane-1-sulphonic acid | 3-(tris(hydroxymethyl)methylamino)propane-1-sulfonic acid | 2922.19 | |
29920-31-8 | Pigment yellow 120 | 3204.17 | ||
29923-31-7 | Sodium hydrogen N-(1-oxododecyl)-L-glutamate | 3402.11 | ||
299-28-5 | Calcium gluconate | Calcium gluconate | 2918.16 | |
299-29-6 | Iron gluconate | Iron digluconate | 2918.16 | |
299-42-3 | Ephedrine | ([R-(R*,S*)]-α-[1-(methylamino)ethyl]-benzenemethanol) | 2939.41 | |
29943-42-8 | 4-oxacyclohexanone | Tetrahydro-4H-pyran-4-one | 2932.99 | |
2996-92-1 | Trimethoxyphenylsilane | 2931.9 | ||
2997-92-4 | 2,2′-Azobis(2-methylpropionamidine) dihydrochloride | 2,2'-azo-1,2-diylbis(2-methylpropanimidamide) dihydrochloride | 2927 | |
2999-46-4 | Ethyl isocyanoacetate | Ethyl isocyanoacetate | 2929.9 | |
30007-47-7 | 5-Brom-5-nitro-1,3-dioxane | 5-bromo-5-nitro-1,3-dioxolane | 2932.99 | |
300364-84-5 | Trans-2-[3-(4-tert-Butylphenyl)-2-methyl-2-propenylidene]malononitrile | 2926.9 | ||
300-42-5 | N,α-dimethylphenethylamine hydrochloride | N-methyl-1-phenylpropan-2-amine hydrochloride | 2921.49 | |
3006-15-3 | Sodium 1,4-dihexyl sulphonatosuccinate | |||
300-62-9 | Amphetamine | (±)-α-methylphene thylamine | 2921.46 | 7 |
3006-82-4 | t-Butyl peroxy 2-ethyl hexanoate | |||
3006-86-8 | Cyclohexylidenebis[tert-butyl] peroxide | 1,1-bis(tert-butylperoxy)cyclohexane | 3 | |
3006-93-7 | N,N'-1,3-Phenylene bismaleimide ; m-phenylene bismaleimide | N,N'-(m-phenylene)dimaleimide | 2925.19 | |
300711-04-0 | Transglutaminase | 3507.9 | ||
300-85-6 | 3-hydroxybutyric acid | 3-hydroxybutanoic acid | 2918.19 | |
300-92-5 | Aluminium distearate | 2915.7 | ||
301-00-8 | Methyl linolenate | 2916.15 | ||
301-02-0 | Oleamide ; 9-Octadecenamide | (Z)-Octadec-9-enamide | ||
301-04-2 | Lead (II) acetate | Lead diacetate | 2915.29 | |
301-08-6 | Lead bis(2-ethylhexanoate) | Lead bis(2-ethylhexanoate) | 3815.9 | |
301-10-0 | Tin(II) bis(2-ethylhexanoate) | Tin bis(2-ethylhexanoate) | ||
30112-70-0 | Acid orange 60 | 3204.11 | ||
301-13-3 | Tris(2-ethylhexyl) phosphite | tris(2-ethylhexyl) phosphite | 3812.3 | |
30124-94-8 | Disperse red 82 | 3204.11 | ||
30125-47-4 | Pigment yellow 138 | 1H-Isoindole-1,3(2H)-dione, 4,5,6,7-tetrachloro-2-[2-(4,5,6,7-tetrachloro-2,3-dihydro-1,3-dioxo-1H-inden-2-yl)-8-quinolinyl]- | 3206.19 | |
3012-65-5 | Diammonium hydrogen citrate | Diammonium hydrogen citrate | 2918.15 | |
301341-58-2 | Potassium cocoyl glycinate | |||
3016-76-0 | 4,4′-(Hexafluoroisopropylidene)diphthalic acid | 2917.39 | ||
3017-60-5 | Cobalt(II) thiocyanate | Cobalt(2+); dithiocyanate | 2842.9 | |
301836-41-9 | TGF-β RI kinase Inhibitor VI | 2934.99 | ||
302-01-2 | Hydrazine | Hydrazine | 2825.1 | 3 |
302-17-0 | Chloral Hydrate | 2,2,2-trichloroethane-1,1-diol | 2905.59 | |
3025-30-7 | Ethyl (2E,4Z)-2,4-decadienoate ; Fragrance of 2,4-Decadienoic acid | (2E,4E)-deca-2,4-dienoic acid | ||
302-72-7 | DL-Alanine | DL-alanine | 2922.49 | |
302776-68-7 | Diethylamino hydroxybenzoyl hexyl benzoate | 2922.5 | ||
302-79-4 | Retinoic acid | Retinoic acid | 2936.21 | 6 |
302-84-1 | DL-Serine | DL-serine | 2922.5 | |
302933-83-1 | Surfactin, sodium salt | 3402.11 | ||
302-95-4 | Sodium deoxycholate ; Deoxycholic acid sodium salt | Sodium 3α,12α-dihydroxy-5β-cholan-24-oate | 2918.19 | |
3030-47-5 | N,N,N’,N’,N”-Pentamethyldiethylenetriamine | Bis(2-dimethylaminoethyl)(methyl)amine | ||
3030-80-6 | Zinc salt of 2-mercaptobenzimidazole | Zinc di(benzimidazol-2-yl) disulfide | 2933.99 | |
3031-66-1 | 3-Hexyne-2,5-diol | Hex-3-yne-2,5-diol | ||
3031-94-5 | 5-Aminoimidazole-4-carboxamide-1-β-D-ribofuranosyl 5′-monophosphate | 2934.99 | ||
303-26-4 | 1-(4-Chlorobenzhydryl)piperazine | N-(4-chlorobenzhydryl)piperazine | 2933.59 | |
3033-62-3 | Bis(2-dimethylaminoethyl)ether | N,N,N',N'-tetramethyl-2,2'-oxybis(ethylamine) | ||
3033-77-0 | Epoxypropyltrimethylammonium chloride | 2,3-epoxypropyltrimethylammonium chloride | 2923.9 | |
303-47-9 | Ochratoxin A | (R)-N-[(5-chloro-3,4-dihydro-8-hydroxy-3-methyl-1-oxo-1H-benzo[c]pyran-7-yl)carbonyl]-3-phenylalanine | 2932.2 | |
30361-29-6 | (2E,4E)-undeca-2,4-dienal | 2912.19 | ||
30374-01-7 | Iso-octyl 3-mercaptopropionate | 2930.9 | ||
303-98-0 | Coenzyme Q10 ; ubidecarenone | 2-[(2E,6E,10E,14E,18E,22E,26E,30E,34E)-3,7,11,15,19,23,27,31,35,39-Decamethyltetraconta-2,6,10,14,18,22,26,30,34,38-decaenyl]-5,6-dimethoxy-3-methylcyclohexa-2,5-diene-1,4-dione | 6 | |
3039-83-6 | Vinylsulfonic acid sodium salt solution | Sodium ethylenesulfonate | 2904.1 | |
30399-84-9 | Isostearic acid | 16-methylheptadecanoic acid | 3823.11 | |
304-20-1 | Hydralazine hydrochloride | 2933.99 | 6 | |
304-59-6 | Potassium sodium L(+)-tartrate | Potassium sodium tartrate | 2918.13 | |
30459-70-2 | 2-Methyl-4-Nitrobenzoyl chloride | 2921.51 | ||
30484-77-6 | Flunarizine Hydrochloride | 2933.59 | 6 | |
304851-84-1 | 5-Sulfosalicylic acid hydrate | 2918.29 | ||
304909-07-7 | (4-Benzyl-piperazin-1-yl)-(3,5-dimethyl-1-phenyl-1H-pyrazol-4-ylmethylene)-amine | 2933.59 | ||
3049-71-6 | Pigment red 178 | 3204.17 | ||
3051-09-0 | Murexide ; Ammonium purpurate | Ammonium 5-(2,4,6-trioxoperhydropyrimidin-5-ylideneamino)barbiturate | 2925.29 | |
30516-87-1 | Zidovudine | Thymidine, 3'-azido-3'-deoxy- | 6 | |
30525-89-4 | Polyoxymethylene ; Paraformaldehyde | 2912.6 | ||
3054-47-5 | S-Acetyl-L-glutathione | S-acetylglutathione | 2930.9 | |
305-53-3 | Sodium iodoacetate | Sodium iodoacetate | 2915.9 | |
3055-93-4 | Laureth-2 | 3402.13 | ||
3055-94-5 | Laureth-3 ; Triethylene glycol monododecyl ether | 2-{2-[2-(dodecyloxy)ethoxy]ethoxy}ethanol | 3402.13 | |
3055-96-7 | Laureth-6 | 3,6,9,12,15,18-hexaoxatriacontan-1-ol | 3402.13 | |
3055-97-8 | Laureth-7 ; Polyoxyethylene (7) lauryl ether ; 2-[2-[2-[2-[2-[2-(2-dodecoxyethoxy)ethoxy]ethoxy]ethoxy]ethoxy]ethoxy]ethanol | 3,6,9,12,15,18,21-heptaoxatritriacontan-1-ol | 3402.19 | |
3055-98-9 | Laureth-8 | 3402.13 | ||
3055-99-0 | Laureth-9 | 3402.13 | ||
3056-00-6 | Laureth-12 | 3402.13 | ||
30560-19-1 | Acephate | 2930.9 | ||
30580-75-7 | 1-tert-butylperoxy-2-propan-2-ylbenzene | |||
305834-79-1 | 2-Amino-6-chloro-α-cyano-3-(ethoxycarbonyl)-4H-1-benzopyran-4-acetic acid ethyl ester | 2915.31 | ||
30583-72-3 | 4,4'-Isopropylidenedicyclohexanol, oligomeric reaction products with 1-chloro-2,3-epoxypropane | 2910.9 | ||
3058-39-7 | 4-Iodobenzonitrile | 2926.9 | ||
30599-15-6 | Ethoxylated pentaerythritol | 3402.13 | ||
306-08-1 | Homovanillic acid | 4-hydroxy-3-methoxyphenylacetic acid | 2918.99 | |
3061-75-4 | Behenamide | Docosanamide | 2924.29 | |
30652-11-0 | 1,2-dimethyl-3-hydroxy-4-pyridone ; Deferidone | 3-hydroxy-1,2-dimethylpyridin-4(1H)-one | 2942 | |
306-67-2 | Spermine tetrahydrochloride | 4,9-diazoniadodecamethylenediammonium tetrachloride | 2923.9 | |
306-83-2 | 2,2-Dichloro-1,1,1-trifluoroethane | Dichloro-1,1,1-trifluoroethane | 2903.72 | 12 |
3068-39-1 | Basic red 1:1 | 3204.9 | ||
3068-76-6 | N-Phenyl-3-aminopropyltrimethoxysilane | 2931.9 | ||
3069-19-0 | Hexyltrimethoxysilane | 2931.9 | ||
3069-21-4 | Dodecyl trimethoxysilane | 2931.9 | ||
3069-25-8 | n-Methylaminopropyltrimethoxysilane | N-methyl-3-trimethoxysilylpropan-1-amine | 3208.9 | |
3069-29-2 | N-(2-Aminoethyl)-3-aminopropylmethyldimethoxysilane | N-(3-(dimethoxymethylsilyl)propyl)ethylenediamine | 2931.9 | |
30693-53-9 | 2-Amino-5-nitrobenzenesulfonic acid sodium salt;4-Nitroaniline-2-sulfonic acidsodium salt | Sodium 2-amino-5-nitrobenzenesulfonate | 2921.42 | |
3069-42-9 | Octadecyltrimethoxysilane | 2931.9 | ||
3071-73-6 | Acid black 24 | 1-Naphthalenesulfonic acid, 8-(phenylamino)-5-[[4-[(5-sulfo-1-naphthalenyl)azo]-1-naphthalenyl]azo]-, disodium salt | 3204.12 | |
307510-92-5 | 5-[(4-Carboxyphenyl)methylene]-2-thioxo-3-[(3-trifluoromethyl)phenyl-4-thiazolidinone | 2934.1 | ||
308062-82-0 | Bituminous coal | 2701.11 | ||
308064-12-2 | Collagen type I | [2-[[(2S)-2-[[(2S)-2-[[2-[[(2S)-2-[[(2S)-2-[[2-[[(2S)-6-amino-2-[[(2S)-2-[[2-[[(2S,4R)-4-hydroxypyrrolidine-2-carbonyl]amino]acetyl]amino]hexanoyl]amino]-5,6-ditritiohexanoyl]amino]acetyl]amino]-3-(4H-imidazol-4-yl)propanoyl]amino]-5-(diaminomethylideneam | ||
308064-69-9 | Epichlorohydrin rubber | 2931.9 | ||
308067-66-5 | Interleukin - 6 | 3504 | 6 | |
308068-21-5 | Marble | Calcium carbonate | 2515.12 | |
308068-91-9 | Onium compounds,1-(carboxymethyl)-4,5-dihydro-1-(2-hydroxyethyl)-2-norcoco alkyl imidazolium,hydroxides, sodium salts / Sodiumcocoamphoacetate | 3402.19 | ||
308069-41-2 | Natipide II | 2923.2 | ||
308072-74-4 | Polysiloxanes, di-Me,polyoxyalkylene- | 3402.13 | ||
308076-68-8 | Potassium titanate fibers | ไม่พบข้อมูล | 2841.9 | |
308079-78-9 | Tumor necrosis factor - alpha | 3504 | ||
308080-99-1 | Zeolite sieves | Aluminum;sodium;dioxido(oxo)silane | 2842.1 | |
3081-14-9 | N,N'-bis(1,4-dimethylpentyl)-p-phenylenediamine | N,N'-bis(1,4-dimethylpentyl)-p-phenylenediamine | 3812.3 | |
3081-61-6 | L-Theanine | 2924.19 | ||
30827-99-7 | 4-(2-Aminoethyl)-Benzolsulfonyfluorid-hydrochloride | 2921.49 | ||
3084-40-0 | Diethyl (hydroxymethyl)phosphonate | 2931.9 | ||
3087-36-3 | Ethanolate; titanium(4+) | Titanium(4+) tetraethanolate | 2905.19 | |
3087-37-4 | Tetrapropyl orthotitanate | Titanium tetrapropanolate | 2905.19 | |
3089-11-0 | Hexa(methoxymethyl)melamine | 2-N,2-N,4-N,4-N,6-N,6-N-hexakis(methoxymethyl)-1,3,5-triazine-2,4,6-triamine | 3824.9 | |
3089-17-6 | Pigment red 202 | 3206.49 | ||
3089-19-8 | N-(2-Methacrylamidoethyl)ethylene urea | 2-methyl-N-[2-(2-oxoimidazolidin-1-yl)ethyl]prop-2-enamide | 3824.9 | |
30931-67-0 | 2,2′-Azino-bis(3-ethylbenzothiazoline-6-sulfonic acid) diammonium salt | 2934.2 | ||
30964-13-7 | Cynarin | 2918.29 | ||
30989-05-0 | Tris(2-(2-(2-methoxyethoxy)ethoxy)ethyl) orthoborate | Tris{2-[2-(2-methoxyethoxy)ethoxy]ethyl} borate | 2920.9 | |
3100-04-7 | 1-methylcyclopropene | 1-methylcyclopropene | 2902.19 | |
31001-77-1 | (3-Mercaptopropyl)methyldimethoxysilane | 3-[dimethoxy(methyl)silyl]propane-1-thiol | 2930.9 | |
310-077-5 | Co-Si blue pigment | 3207.1 | ||
31014-78-5 | Arginine/Lysine polypeptide | 2921.59 | ||
31024-56-3 | N-[3-(trimethoxysilyl)propyl]butylamine | 2931.9 | ||
3109-63-5 | Tetra-N-butyammonium hexafluorophosphate | 2929.9 | ||
31096-47-6 | IRON(III) PHOSPHATE TETRAHYDRATE | Iron(3+); phosphate; tetrahydrate | 2835.29 | |
311-28-4 | Tetra-N-butulammonium iodide | Tetrabutylammonium iodide | 2923.9 | |
3112-85-4 | Methylsulfonylbenzene | 2904.1 | ||
31138-65-5 | Sodium glucoheptonate | Sodium glucoheptonate | 2918.19 | |
3115-49-9 | Isononylphenoxyacetic acid | 2918.99 | ||
3115-68-2 | Tetra-N-butylphosphonium bromide | Tetrabutylphosphonium bromide | 2931.9 | |
3116-76-5 | Dicloxacillin | (2S,5R,6R)-6-({[3-(2,6-dichlorophenyl)-5-methyl-1,2-oxazol-4-yl]carbonyl}amino)-3,3-dimethyl-7-oxo-4-thia-1-azabicyclo[3.2.0]heptane-2-carboxylic acid | 2941.1 | 6 |
3121-61-7 | 2-Methoxyethyl acrylate | 2-methoxyethyl acrylate | 2916.12 | |
31218-83-4 | Propetamphos | 2926.9 | 8 | |
3126-80-5 | Tetrakis(2-ethylhexyl) benzene-1,2,4,5-tetracarboxylate | Tetrakis(2-ethylhexyl) 1,2,4,5-benzenetetracarboxylate | 2917.39 | |
31274-51-8 | Tris-biphenyltriazine | 2,4,6-tris(4-phenylphenyl)-1,3,5-triazine | 3824.9 | |
31282-04-9 | Hygromycin B streptomyces SP | (3'R,3aS,4S,4'R,5'R,6R,6'R,7S,7aS)-4-{[(1R,2R,3S,5R,6S)-3-amino-2,6-dihydroxy-5-(methylamino)cyclohexyl]oxy}-6'-[(1S)-1-amino-2-hydroxyethyl]-6-(hydroxymethyl)octahydro-4H-spiro[1,3-dioxolo[4,5-c]pyran-2,2'-pyran]-3',4',5',7-tetrol | 2941.9 | |
312-84-5 | L-Serine | D-Serine | 2922.5 | |
313-06-4 | Estradiol cypionate | 2937.23 | ||
3130-87-8 | DL-Asparagine monohydrate | DL-asparagine | 2924.19 | |
313-67-7 | Aristolochic acid, mixture of I and II | 2932.99 | ||
31377-05-6 | Calcium Pidolate | Calcium bis[(2S)-5-oxopyrrolidine-2-carboxylate] | 2933.79 | |
314041-08-2 | Ellagic acid hydrate | 2933.99 | ||
314041-10-6 | Potassium tellurate hydrate | Dipotassium; tellurate | 2842.9 | |
3140-73-6 | 2-Chloro-4,6-dimethoxy-1,3,5-triazine | 2-chloro-4,6-dimethoxy-1,3,5-triazine | 2933.69 | |
31430-15-6 | Flubendazole | Methyl {5-[(4-fluorophenyl)carbonyl]-1H-benzimidazol-2-yl}carbamate | 2933.99 | 6 |
31430-18-9 | Nocodazole | Methyl [5-(thiophen-2-ylcarbonyl)-1H-benzimidazol-2-yl]carbamate | 2934.99 | 6 |
31431-39-7 | Mebendazole | Methyl [5-(phenylcarbonyl)-1H-benzimidazol-2-yl]carbamate | 2933.99 | 6 |
314-40-9 | Bromacil ; 5-bromo-3-sec-butyl-6-methyluracil | 2933.59 | ||
3144-16-9 | (1S)-(+)-Camphor-10-sulfonic acid | [(1S,4R)-7,7-dimethyl-2-oxobicyclo[2.2.1]hept-1-yl]methanesulfonic acid | 2914.7 | |
3147-75-9 | Octrizole ; 2-(2-Hydroxy-5-tert-octylphenyl) benzotriazole | 2-(2H-benzotriazol-2-yl)-4-(2,4,4-trimethylpentan-2-yl)phenol | 6 | |
3147-76-0 | 2-(2H-benzotriazole-2-yl)-4-tert-butylphenol | |||
3147-77-1 | 2-(2-hydroxy-4-octyloxyphenyl)-2H-benzotriazole | 2933.99 | ||
31482-56-1 | Disperse orange 25 | 3204.11 | ||
31501-11-8 | Cis-3-hexenyl hexanoate | 2942 | ||
31519-22-9 | 1,4-Dihydroxy-2-naphthoic acid | 2918.29 | ||
315-30-0 | Allopurinol | 1H-pyrazolo[3,4-d]pyrimidin-4-ol | 2925.19 | 6 |
3153-26-2 | Vanadyl acetylacetonate ; (E)-4-hydroxypent-3-en-2-one ; Oxovanadium | 2942 | ||
31556-45-3 | Tridecyl stearate | Tridecyl octadecanoate | 3403.99 | |
31566-31-1 | Stearic acid, monoester with glycerol | 1,3-dihydroxypropan-2-yl octadecanoate 2,3-dihydroxypropyl octadecanoate | ||
31568-06-6 | Polyether Polyol | 3402.13 | ||
315689-16-8 | Aluminum magnesium oxide | Dialuminum; magnesium; oxygen(2-) | 2816.1 | |
31570-04-4 | Tris(2,4-di-tert-butylphenyl)phosphite | Tris(2,4-di-tert-butylphenyl) phosphite | ||
31587-11-8 | Propanoic acid, 2-hydroxy-, homopolymer | 2915.5 | ||
3164-29-2 | Ammonium tartrate | Diammonium tartrate | 2918.13 | |
3164-85-0 | Potassium 2-ethylhexanoate | Potassium 2-ethylhexanoate | ||
31692-85-0 | Tetraglycol | 2932.19 | ||
31694-55-0 | Glycerine ethoxylate | |||
317-34-0 | Aminophylline | 1,3-dimethyl-7H-purine-2,6-dione ethane-1,2-diamine | 2939.59 | 6 |
3177-22-8 | m-Phenylenediamine-4-sulfonic acid, sodium salt | 2921.51 | ||
31775-89-0 | 3-[(3-sulfanylbutanoyl)oxy]-2,2-bis{[(3-sulfanylbutanoyl)oxy]methyl}propyl 3-sulfanylbutanoate | 2930.9 | ||
31778-10-6 | Pigment red 208 | 3204.17 | ||
3179-31-5 | 3-Mercapto-1,2,4-triazole | 1,2,4-triazole-3-thiol | 2933.99 | |
31795-24-1 | Potassiam methyl silicate | 2931.9 | ||
3179-63-3 | 3-(Dimethylamino)-1propanol | 3-dimethylaminopropan-1-ol | 2922.19 | |
3179-80-4 | N-[3-(dimethylamino)propyl]lauramide | N-[3-(dimethylamino)propyl]dodecanamide | 3402.9 | |
31800-90-5 | Trilaureth 4-phosphate | 3402.11 | ||
31807-55-3 | Isododecane ; 2,2,4,6,6-pentamethylheptane | |||
31810-89-6 | 1,5-Diaminobromo-4,8-dihydroxyanthraquinone | 3204.11 | ||
31837-42-0 | Pigment yellow 151 | Benzoic acid, 2-[[1-[[(2,3-dihydro-2-oxo- 1H-benzimidazol-5-yl)amino] carbonyl]-2-oxopropyl]azo]- | 3212.9 | |
3184-13-2 | L-Ornithine monohydrochloride ; L-(+)-2,5-diaminopentanoic acid | L-(+)-2,5-diaminopentanoic acid | ||
31871-95-1 | Poly-L-aspartic acid sodium salt | 2931.9 | ||
3188-00-9 | 2-methyltetrahydrofuran-3-one | 2932.99 | ||
318-98-9 | DL-Propranolol hydrochloride | 2922.5 | ||
31906-04-4 | 4-(4-hydroxy-4-methylpentyl)cyclohex-3-ene-1-carbaldehyde | 4-(4-hydroxy-4-methylpentyl)cyclohex-3-enecarbaldehyde | 2912.29 | |
3194-55-6 | 1,2,5,6,9,10-Hexabromocyclododecane ; Hexabromocyclododecane | 1,2,5,6,9,10-hexabromocyclododecane | 2903.89 | 14 |
319-78-8 | D-Isoleucine | D-isoleucine | 2922.49 | |
32005-36-0 | Bis(dibenzylideneacetone)palladium | (1E,4E)-1,5-diphenylpenta-1,4-dien-3-one; palladium | 2843.9 | |
320573-06-6 | Sodium (R)-homocitrate tribasic | 2918.19 | ||
320-67-2 | 5-Azacytidine | 4-amino-1-(β-D-ribofuranosyl)-1,3,5-triazin-2(1H)-one | 2934.99 | |
32073-22-6 | Sodium cumene sulfonate | |||
321-14-2 | 5-Chlorosalicylic acid | 5-chlorosalicylic acid | 2918.29 | |
32128-65-7 | Octyldodeceth 25 | 4-Octyldodecylcyclopentane | 3402.13 | |
321-30-2 | Adenine sulfate | 2933.59 | ||
3213-29-4 | 2,3-Dimethoxyphenethylamine | 2933.99 | ||
321-60-8 | 1-fluoro-2-phenylbenzene | 2-fluorobiphenyl | 2903.99 | |
321912-24-7 | Everzol red ED | 3204.16 | ||
32210-23-4 | 4-tert-Butylcyclohexyl acetate | 4-tert-butylcyclohexyl acetate | 2916.39 | |
32222-06-3 | Calcitriol | (1S,3R,5Z,7E)-9,10-secocholesta-5,7,10-triene-1,3,25-triol | 2936.29 | 6 |
3228-02-2 | Isopropylmethylphenol | 3-methyl-4-(propan-2-yl)phenol | 2921.49 | |
3228-27-1 | Formaldehyde-13C | Methanone | 2845.9 | |
3230-94-2 | L-Ornithine L-Aspartate | 2922.49 | ||
323194-76-9 | L-Aspartic acid sodium salt monohydrate | 2922.49 | ||
3234-02-4 | Trans-2,3-Dibromo-2-butene-1,4-diol | 2,3-dibromobut-2-ene-1,4-diol | 2905.59 | |
3234-85-3 | Myristyl myristate | Tetradecyl tetradecanoate | ||
32348-81-5 | 5-Chloro-4-benzamido-2-methylbenzenediazonium chloride hemi(zinc chloride) salt | 3204.9 | ||
32360-05-7 | Stearyl methacrylate | Octadecyl methacrylate | 2916.14 | |
3236-82-6 | Niobium(V) ethoxide | Niobium(5+) pentaethanolate | 2905.19 | |
32388-55-9 | 1-((3R,3aS,6S,7R,8aS)-Octahydro-3,6,8,8-tetramethyl-1H-3a,7-methanoazulen-6-yl)ethanone | 1-(cedr-8-en-9-yl)ethanone | 2914.29 | |
32432-55-6 | 2,4,6-Trimethyl-3,5-diaminobenzenesulfonic Acid | 2924.29 | ||
32435-46-4 | Bis(2-methacryloxyethyl) phosphate | 2919.9 | ||
3244-41-5 | Potassium tetraphenylborate | 2931.9 | ||
3244-88-0 | Acid violet 19 ; C.I. 42685 | Disodium 2-amino-5-[(4-amino-3-sulfonatophenyl)(4-imino-3-sulfocyclohexa-2,5-dien-1-ylidene)methyl]-3-methylbenzenesulfonate | 3204.12 | |
32449-92-6 | D-(+)-Glucuronolactone | (3aR,5R,6R,6aR)-3,5,6-trihydroxytetrahydrofuro[3,2-b]furan-2(3H)-one | 2936.27 | |
32477-35-3 | 1-(Heptafluorobutyryl)imidazole | 2933.29 | ||
3248-91-7 | Basic violet 2 | 4,4'-[(4-imino-3-methylcyclohexa-2,5-dien-1-ylidene)methanediyl]bis(2-methylaniline) hydrochloride | 3212.9 | |
3248-93-9 | Solvent red 41 | 3204.19 | ||
32492-61-8 | Poly(oxy-1,2-ethanediyl), alpha,alpha'-((1-methylethylidene)di-4,1-phenylene)bis(omega-hydroxy- | 2909.49 | ||
32503-27-8 | Tetrabutylammonium hydrogen sulfate | Tetrabutylammonium hydrogen sulfate | 2923.9 | |
32509-66-3 | Bis-(3,3-bis-(4'-hydroxy-3'-tert butylphenyl) butanoic acid)-glycol ester | Ethylene bis(3-(3-tert-butyl-4-hydroxyphenyl)butyrate) | 2918.29 | |
3251-23-8 | Cupric nitrate | Copper;dinitrate | ||
32517-36-5 | Solvent black 34 | Chromate(1-),bis[1-[(2-hydroxy-4-nitrophenyl)azo]-2-naphthalenolato(2-)]-, hydrogen,(OC-6-22')- | 3204.19 | |
3254-89-5 | Diphenidol hydrochloride | 2933.39 | ||
32612-48-9 | Ammonium laureth sulfate | 3402.11 | ||
3263-31-8 | Vat orange 5 | 3204.11 | ||
32647-67-9 | 1,3:2,4-bis-O-benzylidene-D-glucitol (dibenzylidene sorbitol) | [(4S,5R)-5-[(4R,5R)-5-(hydroxymethyl)-2-phenyl-1,3-dioxolan-4-yl]-2-phenyl-1,3-dioxolan-4-yl]methanol | 2932.99 | |
3268-49-3 | Methional | 3-(methylthio)propionaldehyde | 2930.9 | |
32687-78-8 | 3-(3,5-ditert-butyl-4-hydroxyphenyl)-N'-[3-(3,5-ditert-butyl-4-hydroxyphenyl)propanoyl]propanehydrazide | 3-(3,5-di-tert-butyl-4-hydroxyphenyl)-N'-[3-(3,5-di-tert-butyl-4-hydroxyphenyl)propanoyl]propanehydrazide | ||
32724-62-2 | Solvent blue 97 | 3204.19 | ||
327-57-1 | L-Norleucine | Norleucine | 2922.49 | |
3277-26-7 | 1,1,3,3-Tetramethyldisiloxane | 2931.9 | ||
327-78-6 | 4-Chloro-3-(trifluoromethyl)phenyl isocyanate | 2929.1 | ||
3279-54-7 | Sodium phenyl phosphate dibasic dihydrate | Disodium phenyl phosphate | 2919.9 | |
327-97-9 | Chlorogenic acid ; Fragrance of chlorogenic acid | 5-O-(3,4-dihydroxycinnamoyl)-L-quinic acid | ||
32804-77-6 | 2-Ethoxyethyl cyanoacetate | 2926.9 | ||
32809-16-8 | Procymidone ; N-(3,5-dichlorophenyl)-1,2-dimethylcyclopropane-1,2-dicarboxamide | 2925.19 | 8 | |
328-50-7 | 2-Ketoglutaric acid | 2-oxoglutaric acid | 2918.3 | |
328-53-6 | Pigment geen 7 | Cu phthalocyanine | 3204.17 | |
328541-79-3 | N-(2-Naphthalenyl)-((3,5-dibromo-2,4-dihydroxyphenyl)methylene)glycine hydrazide | 2928 | ||
3286-27-0 | N,N-DiMethyl amphetaMine hydrochloride | 2921.49 | ||
3290-92-4 | Trimethylolpropane trimethacrylate (TMPTMA) | Propylidynetrimethyl trimethacrylate | ||
32916-07-7 | Palladium(II) nitrate dihydrate | Palladium(2+);dinitrate;dihydrate | ||
329-56-6 | L-Norepinephrine hydrochloride | L-α-(aminomethyl)-3,4-dihydroxybenzyl alcohol hydrochloride | 2937.9 | |
329-71-5 | 2,5-dinitrophenol | 2,5-dinitrophenol | 2908.99 | |
329-98-6 | α-Toluenesulfonyl fluoride | α-toluenesulfonyl fluoride | 2904.1 | |
33007-83-9 | Trimethylolpropane Tri(3-mercaptopropionate) | 2-ethyl-2-(3-mercaptopropionyloxymethyl)trimethylene bis(3-mercaptopropionate) | 2930.9 | |
330-13-2 | P-nitrophenyl phosphate | 2919.9 | ||
3301-94-8 | Delta nonalactone | Nonan-5-olide | 2932.2 | |
3302-10-1 | Isononanoic acid | 3,5,5-trimethylhexanoic acid | 2915.9 | |
33036-62-3 | 4-Bromobutan-1-ol | 2905.59 | ||
3303-84-2 | Boc-β-alanine | 2924.19 | ||
330-54-1 | Diuron | 3-(3,4-dichlorophenyl)-1,1-dimethylurea | 2924.21 | |
33069-62-4 | Paclitaxel | (2α,5β,7β,10β,13α)-4,10-bis(acetyloxy)-1,7-dihydroxy-13-({(2R,3S)-2-hydroxy-3-phenyl-3-[(phenylcarbonyl)amino]propanoyl}oxy)-9-oxo-5,20-epoxytax-11-en-2-yl benzoate | 2933.99 | 6 |
33089-61-1 | Amitraz | 2925.29 | 8 | |
33100-27-5 | 1,4,7,10,13-pentaoxacyclopentadecane | 1,4,7,10,13-pentaoxacyclopentadecane | 2905.59 | |
331-39-5 | Caffeic acid ; 3,4-Dihydroxycinnamic acid | 3-(3,4-dihydroxyphenyl)prop-2-enoic acid | 2918.29 | |
33155-60-1 | Fragrance of methyl 4-tert-butylphenylacetate | 3302.1 | ||
331717-45-4 | 3-[(3-Cholamidopropyl)dimethylammonio]-1-propanesulfonate hydrate | 2924.29 | ||
3317-61-1 | 5,5-Dimethyl-1-pyrroline n-oxide | 2933.99 | ||
3319-31-1 | Tri-2-ethylhexyl trimellitate | Tris(2-ethylhexyl) benzene-1,2,4-tricarboxylate | ||
33229-34-4 | 2,2'-[[4-[(2-hydroxyethyl)amino]-3-nitrophenyl]imino]bisethanol | 2,2'-({4-[(2-hydroxyethyl)amino]-3-nitrophenyl}imino)diethanol | 2922.19 | |
3323-53-3 | Hexamethylene diamine adipic acid salt | Adipic acid—hexamethylenediamine (1:1) | 2921.22 | |
33270-70-1 | Solvent red 8 | Chromate(1-), bis[2,4-dihydro-4-[[2-(hydroxy-.kappa.O)-4-nitrophenyl]azo-.kappa.N1]-5-methyl-2-phenyl-3H-pyrazol-3-onato(2-)-.kappa.O3]-, hydrogen | 3204.19 | |
3327-22-8 | 3-chloro-2-hydroxypropyl)trimethylammonium chloride | (3-chloro-2-hydroxypropyl)trimethylammonium chloride | 2923.9 | |
33286-22-5 | Diltiazem hydrochloride | 2934.99 | 6 | |
33286-27-0 | N,N-Dimethylamphetamine hydrochloride | 2942 | ||
333-20-0 | Potassium thiocyanate | Potassium;thiocyanate | 4 | |
33329-35-0 | Tris(3-Dimethylamino)propylamine | 3,3',3''-tris(dimethylamino)tripropylamine | ||
3333-67-3 | Nickelous carbonate | Nickel(2+);carbonate | 2836.99 | |
333-41-5 | Diazinon | O,O-diethyl O-[6-methyl-2-(propan-2-yl)pyrimidin-4-yl] phosphorothioate | 2933.59 | 8 |
3338-55-4 | (3Z)-3,7-dimethylocta-1,3,6-triene | (3Z)-3,7-dimethylocta-1,3,6-triene | 2901.29 | |
333-93-7 | Putrescine dihydrochloride | Tetramethylenediammonium dichloride | 2921.29 | |
33419-42-0 | Etoposide | (8aR,9R)-9-(4-hydroxy-3,5-dimethoxyphenyl)-8-oxo-5,5a,6,8,8a,9-hexahydrofuro[3',4':6,7]naphtho[2,3-d][1,3]dioxol-5-yl 4,6-O-[(1R)-ethylidene]-β-D-glucopyranoside | 2938.9 | |
3344-18-1 | Magnesium citrate | Trimagnesium dicitrate | 2918.15 | |
334-48-5 | Decanoic acid ; Capric acid ; Fragrance of decanoic acid | Decanoic acid | ||
334-50-9 | Spermidine trihydrochloride | 4-azoniaoctamethylenediammonium trichloride | 2921.29 | |
3345-29-7 | 1,1,2,2,9,9,10,10-Octafluoro[2.2]paracyclophane | 2903.99 | ||
33454-82-9 | Lithium trifluoromethanesulfonate | 2931.9 | ||
3351-05-1 | Acid blue 113 | 1-Naphthalenesulfonicacid,8-(phenylamino)-5-[[4-[(3-sulfophenyl)azo]-1-naphthalenyl]azo]-,disodiumsalt | ||
335161-24-5 | 1-(5-fluoropentyl)-3-(1-naphthoyl)indole | 1-[(5-fluoropentyl)-1H-indol-3-yl]-(naphthalen-1-yl)methanone | 2933.99 | |
33524-31-1 | (2,5-dimethoxyphenyl)methanol | 2909.49 | ||
3353-69-3 | 1,2-Bis(dichloromethylsilyl)ethane | 2931.9 | ||
33564-30-6 | Cefoxitin sodium | 2941.9 | 6 | |
3356-88-5 | 3-(2-hydroxyethyl)-1,3-oxazolidin-2-one | 3815.9 | ||
33577-16-1 | Methyl(methylthio)methyl sulfoxide | Methyl methylthiomethyl sulfoxide | 2930.9 | |
33629-47-9 | Butralin | N-(butan-2-yl)-4-tert-butyl-2,6-dinitroaniline | 2921.49 | 8 |
336-59-4 | Heptafluorobutyric anhydride | Heptafluorobutyric anhydride | 2915.9 | |
336628-67-2 | 2-Hydroxy-3-(trifluoromethyl)benzaldehyde | 2913 | ||
33665-90-6 | 6-Methyl-2,2-dioxooxathiazin-4-one | 6-methyl-1,2,3-oxathiazin-4(3H)-one 2,2-dioxide | 2905.44 | |
33703-08-1 | Diisononyl adipate | |||
33704-61-9 | (RS)-1,1,2,3,3-Pentamethyl-1,2,3,5,6,7-hexahydro-4H-inden-4-one | 2914.29 | ||
3371-27-5 | Gallocatechin | 2932.99 | ||
3371-50-4 | Isomaltotriose | α-D-glucopyranosyl-(1→6)-α-D-glucopyranosyl-(1→6)-D-glucose | 2940 | |
3374-05-8 | Nalidixate sodium anhydrous | Sodium 1-ethyl-7-methyl-4-oxo-1,8-naphthyridine-3-carboxylate | 3821 | |
3374-22-9 | DL-Cysteine | DL-cysteine | 2930.9 | |
3375-31-3 | Palladium(II) acetate | Palladium(2+);diacetate | 2843.9 | |
3380-30-1 | Soneclosan | 2909.5 | ||
3380-34-5 | Tricosan | 5-chloro-2-(2,4-dichlorophenoxy)phenol | 2909.5 | |
33817-09-3 | Levomethamphetamine | (–)-N,α-dimethylphenethylamine | 2939.91 | 7 |
3383-96-8 | Temephos ; Phosphorothioic acid, O,O'-(thiodi-4,1-phenylene) O,O,O',O'-tetramethyl ester | O,O,O',O'-tetramethyl O,O'-(sulfanediyldibenzene-4,1-diyl) bis(phosphorothioate) | 2930.9 | 8 |
3385-41-9 | Ammonium adipate | 2917.12 | ||
3387-36-8 | Uridine 5'-monophosphate disodium salt | Disodium uridine-5'-monophosphate | 2934.99 | |
3387-41-5 | 4-methylidene-1-propan-2-ylbicyclo[3.1.0]hexane | Thuj-4(10)-ene | 2902.19 | |
3388-04-3 | 2-(3,4-Epoxycyclohexyl)ethyltrimethoxysilane | 2-(3,4-epoxycyclohexyl)ethyltrimethoxysilane | 2931.9 | |
33903-50-3 | (S)-(+)-S-methyl-S-phenylsulfoxime | 2930.9 | ||
3391-86-4 | Oct-1-en-3-ol ; Fragrance of 1-Octen-3-ol | Oct-1-en-3-ol | ||
33939-64-9 | Laureth-11 carboxylic acid ; Sodium laureth-13 carboxylate | 3402.11 | ||
33940-98-6 | Oleic acid, monoester with triglycerol | Bis((9Z)-octadec-9-enoic acid) tris(propane-1,2,3-triol) | 3824.9 | |
3398-68-3 | p-Methoxymethamphetamine hydrochloride | 1-(4-methoxyphenyl)-N-methylpropan-2-amine hydrochloride (1:1) | 2922.29 | |
3407-42-9 | 3-(5,5,6-Trimethylbicyclo[2.2.1]heptan-2-yl)cyclohexanol ; Fragrance of isobornylcyclohexanol | 3-(5,5,6-trimethylbicyclo[2.2.1]hept-2-yl)cyclohexanol | ||
34096-76-1 | Methyltetrahydrophthalic anhydride | 2917.2 | ||
340977-00-6 | Reactive red 245 | 3204.16 | ||
3414-63-9 | Noradrenaline tartrate | 2937.9 | ||
3416-24-8 | Glucosamine | 2-amino-2-deoxy-β-D-glucopyranose | 2932.99 | 6 |
3417-91-2 | L-Tyrosine methyl ester hydrochloride | Methyl tyrosinate hydrochloride | 2922.5 | |
342394-34-7 | Glycerol monostearate | 3402.13 | ||
34256-82-1 | Acetochlor | 2924.29 | 8 | |
342573-75-5 | 1-Ethyl-3-methylimidazolium ethylsulfate | 2933.39 | ||
34316-64-8 | Hexyl laurate | 2915.9 | ||
34335-10-9 | Phenylphosphonic acid, zinc salt | 2931.9 | ||
34345-47-6 | Sodium of polyaspartic acid | 3402.9 | ||
34354-88-6 | N-Octadecanoylphytosphingosine | 2922.29 | ||
34359-86-9 | Disodium Lauriminodiacetate | 3402.19 | ||
34369-07-8 | Adenosine 5′-triphosphate disodium salt | 2934.99 | ||
3437-95-4 | 2-Iodothiophene | 2-iodothiophene | 2933.99 | |
343-94-2 | Tryptamine hydrochloride | 2-(indol-3-yl)ethylamine hydrochloride | 2933.99 | |
34406-66-1 | Polyglyceryl-10 laurate | 3402.13 | ||
3441-14-3 | Direct red 23 | 3204.14 | ||
34413-35-9 | 5-6-7-8-Tetrahydroquinoxalide | 2934.99 | ||
34424-97-0 | Hexaglycerol distearate | Polyglyceryl-6 distearate | 3404.9 | |
3443-45-6 | 1-Pyrenebutyric acid | 2933.99 | ||
34443-12-4 | Tert-Butylperoxy 2-ethylhexyl carbonate | Tert-butylperoxy 2-ethylhexyl carbonate | 2915.9 | |
34447-09-1 | 4,4-Diaminodiphenyl cyclohexane | 2921.59 | ||
34452-51-2 | Potassium thioglycolate | 2930.9 | ||
34487-61-1 | Phenol Red sodium salt | 2934.99 | ||
3452-97-9 | 3,5,5-trimethylhexan-1-ol | 3,5,5-trimethylhexan-1-ol | 2905.19 | |
345352-19-4 | Ethoxilated-Trimethylolpropan Tri(3-Mercaptopropionate) | 2930.9 | ||
34552-83-5 | Loperamide hydrochloride | 2933.39 | 6 | |
3457-61-2 | Tert-butyl cumyl peroxide | Tert-butyl α,α-dimethylbenzyl peroxide | 2909.6 | 3 |
345-78-8 | Pseudoephedrine hydrochloride | (1S,2S)-2-(methylamino)-1-phenylpropan-1-ol hydrochloride | 2939.42 | 6 |
34580-14-8 | Ketotifen fumarate | 2934.99 | 6 | |
3458-28-4 | D-Mannose | 2940 | ||
3458-72-8 | Triammonium citrate tribasic anhydrous | Triammonium citrate | 2918.15 | |
345909-26-4 | Sodium taurocholate hydrate | 2924.29 | ||
34590-94-8 | Dipropylene glycol monomethyl ether (mixture of isomeres) | |||
3459-18-5 | 4-Nitrophenyl N-acetyl-β-D-glucosaminide | 4-nitrophenyl 2-acetamido-2-deoxy-β-glucopyranoside | 2932.99 | |
34620-78-5 | Maltoheptaose | 2940 | ||
346407-77-0 | Polyoxypropylene(1) coconut fatty acid monoisopropanolamide | 3402.13 | ||
34642-77-8 | Amoxicillin sodium | 2941.1 | 6 | |
34643-46-4 | Prothiofos | O-(2,4-dichlorophenyl) O-ethyl S-propyl dithiophosphate | 2930.9 | 8 |
3468-63-1 | Pigment orange 5 | 2-Naphthalenol, 1-[(2,4-dinitrophenyl)azo]- | 3204.17 | |
34701-33-2 | (R)-(-)-2-Amino-3-methylbutan | 2921.19 | ||
34725-61-6 | Bromophenol blue, sodium salt | 2934.99 | ||
34762-90-8 | Boron trichloride dimethyl octylamine | Trichloro(N,N-dimethyloctan-1-amine)boron | 2921.19 | |
34803-66-2 | 1-(2-Pyridyl)piperazine | 1-(2-pyridyl)piperazine | 2933.59 | |
3482-57-3 | P-Nitrophenyl B-D-cellobioside | 2940 | ||
3483-12-3 | Dithiothreitol | (2R,3S)-1,4-disulfanylbutane-2,3-diol | 2930.9 | |
34837-55-3 | Phenylselenyl bromide | Bromoselenobenzene | 2931.9 | |
3485-62-9 | Clidinium bromide | 3-{[hydroxy(diphenyl)acetyl]oxy}-1-methyl-1-azoniabicyclo[2.2.2]octane bromide | 2933.39 | |
3486-35-9 | Zinc carbonate | Zinc;carbonate | ||
3493-12-7 | Methyl methionine sulfonium chloride | 2930.9 | ||
34962-29-3 | Iron(II) ethylenediammonium sulfate tetrahydrate | 2921.21 | ||
34970-00-8 | Bromo-chloro-iodomethane | 2903.19 | ||
34993-56-1 | 1-Ethynylpyrene | 2902.9 | ||
350-03-8 | 3-Acetylpyridine | Methyl 3-pyridyl ketone | 2933.39 | |
3504-40-3 | Samarium(III) isopropoxide | Propan-2-olate;samarium(3+) | 2846.9 | |
35044-57-6 | Ethyl sefranate | 2916.2 | ||
35074-77-2 | Hexamethylene bis[3-(3,5-di-tert-butyl-4-hydroxyphenyl)propionate] | Hexamethylene bis[3-(3,5-di-tert-butyl-4-hydroxyphenyl)propionate] | 2918.29 | |
35120-18-4 | Ethyl 1-bromocyclobutanecarboxylate | Ethyl α-bromocyclobutanecarboxylate | 2916.2 | |
35141-30-1 | N1-(3-Trimethoxysilylpropyl)diethylenetriamine | 2931.9 | ||
35158-25-9 | (E)-5-methyl-2-propan-2-ylhex-2-enal | 2912.19 | ||
351870-33-2 | Bicyclo[2.2.1]heptane-2,3-dicarboxylic acid, sodium salt (1:2), (1R,2R,3S,4S)-rel- | 3812.2 | ||
3520-42-1 | Acid red 52 | Xanthylium, 3,6-bis(diethylamino)-9-(2,4-disulfophenyl)-, inner salt, sodium salt | 3204.12 | |
3520-43-2 | 5,5′,6,6′-Tetrachloro-1,1′,3,3′-tetraethyl-imidacarbocyanine iodide | 2933.99 | ||
3520-72-7 | Pigment orange 13 | (4E)-4-[[2-chloro-4-[3-chloro-4-[(2E)-2-(3-methyl-5-oxo-1-phenylpyrazol-4-ylidene)hydrazinyl]phenyl]phenyl]hydrazinylidene]-5-methyl-2-phenylpyrazol-3-one | 3204.9 | |
3521-62-8 | Erythromycin estolate | 2941.5 | 6 | |
352195-40-5 | Inosine 5'-monophosphate disodium salt hydrate | 2934.99 | ||
3522-50-7 | Ferric citrate | Iron citrate | 2918.15 | |
352-34-1 | 1-Fluoro-4-iodobenzene | 1-fluoro-4-iodobenzene | 2903.99 | |
3524-68-3 | Pentaerythritol triacrylate | Pentaerythritol triacrylate | 2916.14 | 3 |
35274-05-6 | Cetyl lactate | 2918.11 | ||
35285-69-9 | Sodium propylparaben ; Propyl 4-hydroxybenzoate, sodium salt | Sodium 4-propoxycarbonylphenoxide | 2918.29 | |
352-87-4 | Trifluoroethyl methacrylate | 2916.14 | ||
3536-49-0 | Patentblue v ; Acid Blue 3 | Calcium;4-[[4-(diethylamino)phenyl]-(4-diethylazaniumylidenecyclohexa-2,5-dien-1-ylidene)methyl]-6-hydroxybenzene-1,3-disulfonate | 3203 | |
35367-38-5 | Diflubenzuron | N-[(4-chlorophenyl)carbamoyl]-2,6-difluorobenzamide | 2924.21 | 8 |
3536-96-7 | Vinylmagnesium chloride | 2931.9 | ||
3539-43-3 | Hexadecyl dihydrogen phosphate | 3402.11 | ||
354-33-6 | 1,1,1,2,2-Pentafluoroethane | 1,1,1,2,2-pentafluoroethane | 2903.39 | 8 |
35453-19-1 | 5-Amino-2,4,6-triodoisophthalic acid | 5-amino-2,4,6-triiodoisophthalic acid | 2922.49 | |
35457-80-8 | Midecamycin | 2941.9 | 6 | |
354812-41-2 | Moxifloxacin | 2922.19 | ||
3549-23-3 | Fragrance of methyl 4-tert-butylphenylacetate | 3302.1 | ||
35541-81-2 | A mixture of: cis-1,4-Dimethylcyclohexyl dibenzoate and trans-1,4-Dimethylcyclohexyl dibenzoate | 3812.2 | ||
35545-57-4 | Polyoxyethylene 2-naphthylether | 3707.9 | ||
35554-44-0 | Enilconazole ; Imazalil | 1-[2-(2,4-dichlorophenyl)-2-(prop-2-en-1-yloxy)ethyl]-1H-imidazole | 2933.29 | 8 |
35575-96-3 | Azamethiphos | 2924.29 | 8 | |
3558-24-5 | 1-Methyl-2-phenylindole | 1-methyl-2-phenylindole | 2933.99 | |
35602-69-8 | 5-Cholesten-3β-yl octadecanoate ; Cholesteryl stearate | Cholest-5-en-3β-yl stearate | 2915.39 | |
356065-50-4 | Bertholletia excelsa seed oil | 3301.9 | ||
3562-84-3 | Benzbromarone ; (3,5-dibromo-4-hydroxyphenyl)-(2-ethyl-1-benzofuran-3-yl)methanone | (3,5-dibromo-4-hydroxyphenyl)(2-ethyl-1-benzofuran-3-yl)methanone | 2914.29 | |
3564-14-5 | Eriochrome blue-black b | 3204.19 | ||
3564-18-9 | Eriochrome cyanine r | |||
356-42-3 | Pentafluoropropionic anhydride | 2915.9 | ||
35642-64-9 | Reactive orange 12 | 3204.16 | ||
3567-66-6 | Acid red 33 ; Food red 12 | Disodium 5-amino-4-hydroxy-3-(phenylazo)naphthalene-2,7-disulfonate | 3204.14 | |
3567-69-9 | Acid red 14 ; Carmosine | disodium 4-hydroxy-2-[(E)-(4-sulfonato-1-naphthyl)diazenyl]naphthalene-1-sulfonate | 3205 | |
3572-06-3 | 4-(p-Acetoxyphenyl)-2-butanone | 4-(3-oxobutyl)phenyl acetate | 2915.39 | |
35725-34-9 | Ytterbium(III) nitrate pentahydrate | Ytterbium(3+);trinitrate;pentahydrate | 2846.9 | |
35737-10-1 | Fmoc-β-alanine | 2937.9 | ||
357-57-3 | Brucine | 2,3-dimethoxystrychnidin-10-one | 2939.99 | 3 |
3577-63-7 | 5-Sulfo anthranilic acid | 2922.49 | ||
35854-86-5 | (Z)-non-6-en-1-ol | 2905.29 | ||
35869-60-4 | Basic yellow 40 ; 1H-Benzimidazolium,2-[7-(diethylamino)-2-oxo-2H-1-benzopyran-3-yl]-1,3-dimethyl-,methylsulfate | 3204.13 | ||
35869-64-8 | Pigment brown 23 | 3204.17 | ||
358730-93-5 | Etidronic acid-d3 | (2,2,2-trideuterio-1-hydroxy-1-phosphonoethyl)phosphonic acid | 3824.9 | |
3588-17-8 | Trans,trans-Muconic acid | Trans,trans-buta-1,3-diene-1,4-dicarboxylic acid | 2917.19 | |
35908-31-7 | Inosine 5'-triphosphate trisodium salt hydrate | 2934.99 | ||
35935-34-3 | 1-Ethyl-3-methylimidazolium Iodide | 2933.21 | ||
35948-25-5 | 9,10-Dihydro-9-oxa-10-phos phaphenanthrene-10-oxide | 6H-dibenzo[c,e][1,2]oxaphosphinine 6-oxide | 2934.99 | |
35958-30-6 | 2,2-Ethylidenebis(4,6-di-tert-butylphenol) | 2907.29 | ||
359-83-1 | Pentazocine | (2R,6R,11R)-6,11-dimethyl-3-(3-methylbut-2-en-1-yl)-1,2,3,4,5,6-hexahydro-2,6-methano-3-benzazocin-8-ol | 2933.33 | |
3604-90-8 | Citranaxanthin | 3204.19 | ||
36051-31-7 | Guanosine 5′-triphosphate sodium salt hydrate | 2934.99 | ||
36051-68-0 | Cytidine 5'-(disodium dihydrogen triphosphate) | Cytidine 5'-(disodium dihydrogen triphosphate) | 2934.99 | |
360-97-4 | 4-aminoimidazole-5-carboxamide | 4-aminoimidazole-5-carboxamide | 2933.29 | |
361-09-1 | Cholic acid sodium salt | Sodium cholate | 2918.19 | |
361459-38-3 | Glycerides, mixed decanoyl and octanoyl mono-, di- and tri-, ethoxylated | 3402.9 | ||
36148-84-2 | Linoleate tocopherol | 2936.28 | ||
3615-41-6 | alpha-L-Rhamnose ; (2R,3R,4S,5S)-2,3,4,5-tetrahydroxyhexanal | 3821.001 | ||
3618-43-7 | Xylenol orange tetrasodium salt ; 3,3′-Bis[N,N-bis(carboxymethyl)aminomethyl]-o-cresolsulfonephthalein tetrasodium salt | 2902.11 | ||
3618-72-2 | Disperse blue 79:1 | ({5-(acetylamino)-4-[(2-bromo-4,6-dinitrophenyl)azo]-2-methoxyphenyl}imino)diethane-2,1-diyl diacetate | 3204.11 | |
36196-44-8 | Tris[2-(3-mercaptopropionyloxy)ethyl]isocyanurate | 2930.9 | ||
36209-51-5 | 4-Amino-5-(4-pyridyl)-4H-1,2,4-triazole-3-thiol | 2933.99 | ||
3622-84-2 | N-N-Butylbenzenesulphonamide | N-butylbenzenesulfonamide | ||
36239-09-5 | Ethyl 3-chloro-3-oxopropionate | 2917.19 | ||
3625-57-8 | Nile blue A | 2934.99 | ||
3626-36-6 | Direct orange 26 | 3204.14 | ||
36282-47-0 | Tramadol hydrochloride | 2922.5 | ||
36290-04-7 | Naphthalene sulphonate formaldehyde condensates | |||
36291-32-4 | Citric acid esters of mono and diglycerides | 2915.7 | ||
36311-34-9 | Isocetyl alcohol | 2915.6 | ||
36322-90-4 | Piroxicam | 4-hydroxy-2-methyl-N-(pyridin-2-yl)-2H-1,2-benzothiazine-3-carboxamide 1,1-dioxide | 2934.99 | 6 |
3632-91-5 | Magnesium gluconate | Magnesium digluconate | 2918.16 | |
3634-83-1 | M-Xylylene diisocyanate | 1,3-bis(isocyanatomethyl)benzene | 2929.1 | |
36400-98-3 | 2.2.4.8.10.10-Hexamethyl-5-hydroxymethyl-undecan | 2905.19 | ||
3641-13-2 | 3-Amino-1,2,4-triazole-5-carboxylic acid | 2933.99 | ||
36411-52-6 | 3-(Salicyloylamino)-1,2,4-triazole | 2-hydroxy-N-(1H-1,2,4-triazol-5-yl)benzamide | ||
36431-72-8 | (±)-Theaspirane ; Fragrance of (+/-)-theaspirane | |||
36443-68-2 | Benzenepropanoic acid, 3-(1,1-dimethylethyl)-4- hydroxy-5-methyl-, 1,2-ethanediylbis(oxy-2,1- ethanediyl) ester | Ethylenebis(oxyethylene) bis(3-(5-tert-butyl-4-hydroxy-m-tolyl)propionate) | ||
3644-61-9 | Tolperisone hydrochloride | 2933.99 | 6 | |
364590-63-6 | Smoothened agonist SAG | 2934.99 | ||
364-62-5 | Metoclopramide | 4-amino-5-chloro-N-[2-(diethylamino)ethyl]-2-methoxybenzamide | 2924.29 | 6 |
364782-34-3 | Cinacalcet hydrochloride | 2921.49 | ||
3648-18-8 | Dioctyltin dilaurate | Dioctyltin dilaurate | 3815.9 | |
3648-20-2 | Diundecyl phthalate; diundecyl benzene-1,2-dicarboxylate | Diundecyl phthalate | 2917.34 | |
3650-09-7 | Rosemary oleoresin | 3302.1 | ||
36536-42-2 | Bis[OO,OO'-tert-butyl] O,O'-hexane-1,6-diyl bis[peroxycarbonate] | 3815.9 | ||
3658-77-3 | Furaneol ; 4-hydroxy-2,5-dimethylfuran-3(2H)-one | |||
3658-80-8 | Dimethyl trisulfide ; Fragrance of dimethyltrisulfide | (methyltrisulfanyl)methane | ||
366-18-7 | 2,2'-Bipyridine | 2,2'-bipyridine | 2933.99 | |
36631-30-8 | Triisodecyl trimellitate | 2917.39 | ||
36653-82-4 | Hexadecanol | Hexadecan-1-ol | ||
366789-02-8 | Rivaroxaban | 5-chloro-N-({(5S)-2-oxo-3-[4-(3-oxomorpholin-4-yl)phenyl]-1,3-oxazolidin-5-yl}methyl)thiophene-2-carboxamide | 2934.99 | |
36687-82-8 | L-Carnitine Tartrate | 2923.9 | ||
3671-99-6 | D-Glucose 6-phosphate disodium salt hydrate | D-glucose 6-(disodium phosphate) | 2940 | |
36734-19-7 | Iprodione | 3-(3,5-dichlorophenyl)-2,4-dioxo-N-(propan-2-yl)imidazolidine-1-carboxamide | 2933.21 | 8 |
367-51-1 | Sodium mercaptoacetate | Sodium mercaptoacetate | 2930.9 | |
36768-62-4 | 4-Amino-2,2,6,6-tetramethylpiridine | 2,2,6,6-tetramethyl-4-piperidylamine | 2922.39 | |
367-86-2 | 1-Fluoro-2-nitro-4-(trifluoromethyl)benzene | 3-nitro-α,α,α,4-tetrafluorotoluene | 2904.9 | |
36791-04-5 | Ribavirin | 1-(β-D-ribofuranosyl)-1H-1,2,4-triazole-3-carboxamide | 2934.99 | 6 |
367-93-1 | Isopropyl-β-D-thiogalactopyranoside | Isopropyl β-D-1-thiogalactoside | ||
3680-02-2 | Methyl vinyl sulfone | 2930.9 | ||
3681-71-8 | Cis-3-Hexenyl acetate ; Fragrance of cis-3-hexenyl acetate | (Z)-hex-3-enyl acetate | ||
3681-93-4 | Vitexin | (1S)-1,5-anhydro-1-[5,7-dihydroxy-2-(4-hydroxyphenyl)-4-oxo-4H-chromen-8-yl]-D-glucito | 2938.9 | |
3681-99-0 | Puerarin | 2938.9 | ||
3682-35-7 | 2,4,6-tris(2-pyridyl)-s-triazine | 2,4,6-tris(2-pyridyl)-s-triazine | 2933.69 | |
36861-47-9 | Enzacamene ; 3-(4'-Methylbenzylidene)camphor | 2914.29 | ||
3687-45-4 | Oleyl oleate | (Z)-octadec-9-enyl oleate | 2916.39 | |
3687-46-5 | Decyl oleate | Decyl (Z)-octadec-9-enoate | ||
36876-13-8 | Isopropyl(isopropylphenyl)benzene | 2924.19 | ||
36877-69-7 | Rhodamine b isothiocyanate | 3212.9 | ||
36888-99-0 | Pigment yellow 139 | 2,4,6(1H,3H,5H)- Pyrimidinetrione, 5,5'-(1H-isoindole-1, 3(2H)-diylidene)bis- | 3204.17 | |
3688-92-4 | Thorin | 2931.9 | ||
369-07-3 | 2-Nitrophenyl-beta-D-galactopyranoside | (2R,3R,4S,5R,6S)-2-(hydroxymethyl)-6-(2-nitrophenoxy)oxane-3,4,5-triol | ||
36913-39-0 | 1-Methyl-4-phenylpyridinium iodide | 2933.39 | ||
36944-85-1 | Pyridoxine cyclic phosphate | 2936.25 | ||
3698-94-0 | Ethyl N-octyl sulfide | Ethyl octyl sulfide | 2930.9 | |
3700-67-2 | Dimethyldistearylammonium bromide | N,N-dimethyl-N-octadecyloctadecan-1-aminium bromide | 2923.9 | |
370865-80-8 | 1-Butyl-1-methylpyrrolidinium dicyanamide | 2933.99 | ||
3710-84-7 | N,N-Diethylhydroxylamine | N,N-diethylhydroxylamine | 2928 | |
371146-04-02 | 2-(4,6-Diphenyl-1,3,5-triazin-2-yl)-5-[2-(2-ethylhexanoyloxy)ethoxy]phenol | 3812.3 | ||
371-40-4 | 4-Fluoroaniline | 4-fluoroaniline | 2921.42 | |
3715-29-5 | 3-Methyl-2-oxobutanoic acid, sodium salt | Sodium 3-methyl-2-oxobutanoate | 2918.3 | |
3717-88-2 | Flavoxate hydrochloride | 2934.99 | ||
37189-34-7 | Bromelain | 3507.9 | ||
37191-38-1 | Albegal B | 3402.9 | ||
37199-81-8 | 2,5-Furandione, polymer with 2,4,4-trimethylpentene, sodium salt | 3402.11 | ||
372-09-8 | Cyanoacetic acid | Cyanoacetic acid | 2933.99 | |
37211-53-3 | Triton CF 21 | 3402.13 | ||
37211-54-4 | Polyoxyethylene polyoxypropylene tert-C12-13-alkyl amine | 3402.13 | ||
37211-65-7 | Polynucleotide kinase | 3507.9 | ||
37244-96-5 | Nepheline syenite | Potassium sodium oxido-oxo-oxoalumanyloxysilane | 2529.3 | |
37247-10-2 | Azure II | 3204.13 | ||
37248-47-8 | Validamycin | (1R,2R,3S,4S,6R)-2,3-dihydroxy-6-(hydroxymethyl)-4-{[(1S,4S,5S,6S)-4,5,6-trihydroxy-3-(hydroxymethyl)cyclohex-2-en-1-yl]amino}cyclohexyl β-D-glucopyranoside | 2941.9 | 8 |
372490-74-9 | 1,3-Dinonadecanoin | 2915.9 | ||
37259-58-8 | Proteinase 6 from Aspergillus sp. | 3507.9 | ||
37267-86-0 | Meta-Phosphoric Acid | 2,4,6-trihydroxy-1,3,5,2$l^{5},4$l^{5},6$l^{5}-trioxatriphosphinane 2,4,6-trioxide | 2809.2 | 8 |
372-75-8 | L-Citrulline | Citrulline | 2924.19 | |
37278-88-9 | Endoglycosidase H | 3507.9 | ||
37278-89-0 | Xylanase | 3507.9 | ||
37280-56-1 | Kitasamycin tartrate | 2941.9 | 6 | |
37281-47-3 | Triton df-12 | 3402.13 | ||
37286-92-3 | Calcium polystyrene sulfonate | 2942 | ||
37287-16-4 | Aluminum silicate | Dialuminum;dioxido(oxo)silane | 2842.1 | |
37290-86-1 | Heparinase III | 3507.9 | ||
373-02-4 | Nickel (II) acetate | Nickel diacetate | 2915.29 | |
37312-62-2 | Serratiopeptidase | |||
3731-51-9 | 2-Pyridylmethylamine | 2-Pyridylmethylamine | 2933.39 | |
37326-33-3 | Hyaluronidase | |||
37329-65-0 | Cellobiohydrolase | 3507.9 | ||
37335-03-8 | Fatty alcohol polyoxyethylene ether | |||
37340-54-8 | Hide powder azure | 3504 | ||
37340-57-1 | Lyticase | Zymolyase | 3507.9 | |
37341-47-2 | Zinc borosilicate | 3207.4 | ||
3734-33-6 | Denatonium benzoate | N-benzyl-2-[(2,6-dimethylphenyl)amino]-N,N-diethyl-2-oxoethanaminium benzoate hydrate | ||
373-49-9 | Palmitoleic acid | (Z)-hexadec-9-enoic acid | 2916.19 | |
373596-08-8 | 6,13-Bis(triisopropylsilylethynyl)pentacene | 2931.9 | ||
3737-95-9 | Calconcarboxylic acid | 2,2'-dihydroxy-4'-sulfo-1,1'-azonaphthalene-3-carboxylic acid | 2927 | |
3739-38-6 | 3-Phenoxybenzoic acid | 3-phenoxybenzoic acid | 2918.99 | |
3740-52-1 | 2-Nitrophenylacetic acid | 2-nitrophenylacetic acid | 2916.39 | |
3740-92-9 | Fenclorim | 4,6-dichloro-2-phenylpyrimidine | 2933.59 | |
37437-20-0 | Cyclohexylamine salt of 2-mercaptobenzothiazole | |||
37437-21-1 | Tetrakis(2-ethylhexyl) thiuram disulfide | 3812.1 | ||
374726-62-2 | Mandipropamid | 2-(4-chlorophenyl)-N-{2-[3-methoxy-4-(prop-2-yn-1-yloxy)phenyl]ethyl}-2-(prop-2-yn-1-yloxy)acetamide | 2924.29 | |
37515-61-0 | 1-Monopalmitoleoyl-rac-glycerol | 2915.7 | ||
375-16-6 | Perfluorobutyryl chloride | Heptafluorobutyryl chloride | 2915.9 | |
375-22-4 | Heptafluorobutyric acid | Heptafluorobutyric acid | 2915.9 | |
375395-33-8 | 1,1,1-Trifluoro-N-trifluoromethanesulfonylmethanesulfonamide; methyltrioctylazanium | 2935 | ||
37558-16-0 | Phorbol-12,13-dibutyrate | 2918.99 | ||
375815-87-5 | Varenicline tartrate | 2924.29 | ||
375-95-1 | Perfluorononanoic acid | Heptadecafluorononanoic acid | 2915.9 | |
37609-25-9 | 5-Cyclohexadecen-1-one | 2914.29 | ||
3761-53-3 | Acid red 26 | Disodium 1-(2,4-dimethylphenylazo)-2-hydroxynaphthalene-3,6-disulfonate | 3203 | 3 |
37640-57-6 | Meramine Cyanurate ; Mixture of 1,3,5-triazine-2,4,6 (1H,3H,5H)-trione, compound and 1,3,5 triazine-2,4,6 | |||
3766-81-2 | Fenobucarb | 2-(butan-2-yl)phenyl methylcarbamate | 2924.29 | 8 |
3767-28-0 | 4-Nitrophenyl α-D-glucopyranoside | 4-nitrophenyl α-D-glucopyranoside | 2933.99 | |
37677-14-8 | 4-(4-Methylpent-3-enyl)cyclohex-3-ene-1-carbaldehyde | 2912.29 | ||
37682-29-4 | 1-Nitro-2-octoxybenzene | 2909.3 | ||
3777-69-3 | 2-Pentylfuran ; Fragrance of 2-Pentyl furan | |||
3784-30-3 | 5-(2-Aminopropyl)indole | 1-(1H-indol-5-yl)propan-2-amine | 2933.99 | |
378-44-9 | Betamethasone | (11β,16β)-9-fluoro-11,17,21-trihydroxy-16-methylpregna-1,4-diene-3,20-dione | 2937.22 | |
378789-58-3 | Dimer dilinoleyl dimer dilinoleate | 8-[6-[10-[8-[4,5-dihexyl-6-(10-hydroxydec-1-enyl)cyclohex-2-en-1-yl]octoxy]-10-oxodec-1-enyl]-4,5-dihexylcyclohex-2-en-1-yl]octanoic acid | 3823.19 | |
3794-83-0 | Tetrasodium etidronate | Tetrasodium (1-hydroxyethane-1,1-diyl)bis(phosphonate) | 2931.9 | |
37955-36-5 | Polyurea | Urea | 3403.99 | |
3796-70-1 | Geranyl acetone | 2942 | ||
37971-36-1 | 2-Phosphonobutane-1,2,4-tricarboxylic acid | 2-phosphonobutane-1,2,4-tricarboxylic acid | ||
379-79-3 | Ergotamine tartrate | (5'α)-5'-benzyl-12'-hydroxy-2'-methyl-3',6',18-trioxoergotaman 2,3-dihydroxybutanedioate (2:1) | 2939.62 | 6 |
38002-45-8 | 3-Bromo-1-(trimethylsilyl)-1-propyne | 2931.9 | ||
38006-08-5 | Sulfamonomethoxine sodium | 2935 | ||
3806-34-6 | Distearyl pentaerythritol diphosphite | O,O'-dioctadecylpentaerythritol bis(phosphite) | ||
38079-62-8 | Disodium stearoyl glutamate | 2922.42 | ||
38083-17-9 | Climbazole | 1-(4-chlorophenoxy)-1-(1H-imidazol-1-yl)-3,3-dimethylbutan-2-one | 2933.29 | 6 |
38099-82-0 | D-Fructose 1,6-bisphosphate trisodium salt hydrate | 2940 | ||
3810-74-0 | Streptomycin sulfate | 2941.9 | 8 | |
3811-04-9 | Potassium chlorate | Potassium;chlorate | 2829.19 | |
3811-73-2 | Pyridine-2-thiol 1-oxide, sodium salt | |||
381718-28-1 | Cranberry seed oil | 3301.29 | ||
38183-12-9 | Fluorescamine | 2936.27 | ||
38186-71-9 | (E)-1-(2-hydroxy-4,6-dimethoxy-phenyl)-3-(3-hydroxy-4-methoxy-phenyl)prop-2-en-1-one | 2914.5 | ||
38194-50-2 | Sulindac | {(1Z)-5-fluoro-2-methyl-1-[4-(methylsulfinyl)benzylidene]-1H-inden-3-yl}acetic acid | 2930.9 | |
382-67-2 | Desoximetasone | (11β,16α)-9-fluoro-11,21-dihydroxy-16-methylpregna-1,4-diene-3,20-dione | 2937.22 | |
38270-90-5 | Strontium chloride | Syrontium-89(2+);dichloride | 2844.4 | 5 |
38304-91-5 | Minoxidil | 6-(piperidin-1-yl)pyrimidine-2,4-diamine 3-oxide | 2933.59 | 6 |
3836-23-5 | Norethisterone enantate | 2937.9 | 6 | |
38404-93-2 | 5-Bromo-4-chloro-3-indolyl phosphate | 2933.39 | ||
3844-45-9 | Acid blue 9 ; Benzenemethaminium, N-ethyl-N-[4-[[4-[ethyl[(3-sulfophenyl)methyl]amino]phenyl](2-sulfophenyl)methylene]-2,5-cyclohexadien-1-ylidene-3-sulfo]-, hydroxide, inner salt, disodium salt | Disodium;2-[[4-[ethyl-[(3-sulfonatophenyl)methyl]amino]phenyl]-[4-[ethyl-[(3-sulfonatophenyl)methyl]azaniumylidene]cyclohexa-2,5-dien-1-ylidene]methyl]benzenesulfonate | 3204.12 | |
3845-76-9 | Dimethyl aminopropyl acrylamide | N-[3-(dimethylamino)propyl]prop-2-enamide | 2924.19 | |
38465-60-0 | Copper fluoroborate | Copper ditetrafluoroborate | 3824.9 | |
3846-71-7 | 2-[3,5-Di-tert-butyl-2-hydroxyphenyl]-2H-benzotriazole | 2-(2H-benzotriazol-2-yl)-4,6-di-tert-butylphenol | 2933.99 | |
3848-24-6 | Hexane-2,3-dione | Hexane-2,3-dione | 2914.19 | |
38517-23-6 | Sodium stearoyl glutamate | |||
3851-87-4 | 3,5,5-Trimethylhexanoyl peroxide | 2918.3 | ||
3855-32-1 | N-[3-(dimethylamino)propyl]-N,N’,N’-trimethyl-1,3-propanediamine | N,N-bis[(3-dimethylamino)propyl]methylamine | 2922.19 | |
3858-78-4 | Butylamine hydrochloride | 2921.19 | ||
3859-41-4 | Cyclopentane-1,3-dione | Cyclopentane-1,3-dione | 2914.29 | |
38613-77-3 | Bis(2.4-di-t-butylphenyl) pentaerythritol diphosphite | Tetrakis(2,4-di-tert-butylphenyl) biphenyl-4,4'-diylbis(phosphonite) | 3812.2 | |
3862-12-2 | Trixylenyl phosphate | 2919.9 | ||
38622-12-7 | Stilbene disulfonic acid | 3204.2 | ||
38622-35-4 | Di-tert-nonylpentasulphide | 2930.9 | ||
38640-62-9 | Bis(1-methylethyl)naphthalene | 2902.9 | ||
38641-94-0 | Glyphosate-isopropylammonium | N-(phosphonomethyl)glycine—propan-2-amine (1:1) | 8 | |
3864-99-1 | 2-(2’-hydroxy-3’,5’-di-tert-butylphenyl)-5-chlorobenzotriazole | 2,4-di-tert-butyl-6-(5-chlorobenzotriazol-2-yl)phenol | ||
38661-72-2 | 1,3-Bis(isocyanatomethyl)cyclohexane | 1,3-bis(isocyanatomethyl)cyclohexane | 2929.1 | |
38668-46-1 | 1,3,5-Triazine-2,4-diamine,6-[2-(2-methyl-1H-imidazol-1-yl)ethyl]- | 2933.9 | ||
38734-69-9 | Ethylenediamine diacetate | 2921.21 | ||
38754-83-5 | Sodium myristoyl glutamate | 3402.11 | ||
38771-21-0 | 4-bromobut-1-yne | 2903.39 | ||
38861-78-8 | 1-[4-(2-methylpropyl)phenyl]ethanone | 4'-isobutylacetophenone | 2914.39 | |
3886-69-9 | (R)-(+)-1-Phenylethylamine | D-α-methylbenzylamine | 2921.49 | |
3886-70-2 | (R)-(+)--1-(1naphthyl)ethylamine | R-(+)-1-(1-naphthyl)ethylamine | 2921.49 | |
38894-11-0 | 3-Methyl-2-benzothiazolinone hydrazone hydrochloride monohydrate | 2934.2 | ||
38899-05-7 | Glucosamine sulfate sodium chloride | 2942 | ||
389-08-2 | Nalidixic acid | 1-ethyl-7-methyl-4-oxo-1,4-dihydro-1,8-naphthyridine-3-carboxylic acid | 2933.99 | 6 |
38937-66-5 | Suberohydroxamic acid | 2928 | ||
3896-11-5 | Bumetrizole | 2-tert-butyl-6-(5-chlorobenzotriazol-2-yl)-4-methylphenol | ||
38969-40-3 | Ecgonine methyl ester hydrochloride | Methyl (1R,2R,3S,5S)-3-hydroxy-8-methyl-8-azabicyclo[3.2.1]octane-2-carboxylate hydrochloride | 2939.91 | |
3905-19-9 | Pigment red 166 | 4-(2,5-Dichlorophenyl)azo-N-[4-[[4-(2,5-dichlorophenyl)azo-3-hydroxy-naphthalene-2-carbonyl]amino]phenyl]-3-hydroxy-naphthalene-2-carboxamide | 3204.17 | |
3913-81-3 | Trans-2-decenal | Methyl (1R,2R,3S,5S)-3-hydroxy-8-methyl-8-azabicyclo[3.2.1]octane-2-carboxylate hydrochloride | 2915.6 | |
39139-87-2 | Tetrabutylammonium cyanate | 2923.9 | ||
39148-24-8 | Fosetyl-aluminium | Aluminum tris(ethyl phosphonate) | 2920.29 | 8 |
39175-72-9 | Glycerylstearatecitrate | 3402.2 | ||
3918-73-8 | Pyridinium, hydroxy-pyridinium-ylpropane-sulfonate | |||
39208-15-6 | Ethylenediaminetetraacetic acid copper(II) disodium salt | 2922.49 | ||
39236-46-9 | Imidazolidinyl urea | 1-[3-(hydroxymethyl)-2,5-dioxoimidazolidin-4-yl]-3-[[[3-(hydroxymethyl)-2,5-dioxoimidazolidin-4-yl]carbamoylamino]methyl]urea | ||
3926-62-3 | Sodium chloroacetate | Sodium chloroacetate | 2915.4 | |
392-67-6 | 4-nitro-N-[(4-phenyldiazenylphenyl)diazenyl]aniline | 2927 | ||
39280-63-2 | Acid red 337 | Sodium;6-imino-4-oxo-5-[2-[2-(trifluoromethyl)phenyl]hydrazinyl]naphthalene-2-sulfonate | 3204.12 | |
39284-88-3 | Potassium octatitanate | Dipotassium;oxygen(2-);titanium(4+) | 2841.9 | |
39290-90-9 | Magnesium potassium titanium oxide | 2842.9 | ||
39315-90-7 | Acid blue 264 | 3204.12 | ||
39318-30-4 | Lithium potassium titanium oxide | Lithium 2,4-dioxo-1H-pyrimidine-6-carboxylate | 2841.9 | |
39341-83-8 | Luteinizing Hormone, Human Pituitary, Iodination Grade | 2937.19 | ||
39354-45-5 | Disodium laureth sulfosuccinate | 3402.11 | ||
39365-88-3 | Potassium sulfide | Tetrapotassium;dioxido-oxo-sulfanylidene-$l^{6}-sulfane;sulfanide | 2830.9 | |
39380-78-4 | Chromic sulfate | Chromium(3+);hydrogen sulfate | ||
39416-48-3 | Pyridinium tribromide | 2933.31 | ||
39445-21-1 | Elastase | 3507.9 | ||
39-44-6 | Trihydroxystearin | 2,3-Bis(12-hydroxyoctadecanoyloxy)propyl 12-hydroxyoctadecanoate | 3404.9 | |
39450-01-6 | Proteinase K | |||
39454-62-1 | Butoxyethyl acid phosphate | 2919.9 | ||
39455-18-0 | Chondrotin sulfate sodium | 2942 | ||
39464-64-7 | Polyoxyethylene dinonylphenyl ether phosphate | 3402.11 | ||
39464-70-5 | Phenol, ethoxylated, phosphated | 3402.11 | ||
39471-52-8 | Phosphoric acid, octadecyl ester ; Stearyl phosphate | Octadecyl phosphate | 2919.9 | |
39511-08-5 | Fragrance of 3-(2-Furyl)acrolein | 3301.29 | ||
39515-40-7 | Cyphenothrin | 2926.9 | ||
39515-41-8 | Fenpropathrin | Cyano(3-phenoxyphenyl)methyl 2,2,3,3-tetramethylcyclopropanecarboxylate | 2926.9 | 8 |
3952-78-1 | Alizarin fluorine blue dihydrate | 3,4-dihydroxyanthraquinon-2-ylmethyliminodiacetic acid | 2922.5 | |
3952-98-5 | Sinigrin | Potassium 1-(β-D-glucopyranosylthio)but-3-enylideneaminooxysulfonate | 2938.9 | |
39562-70-4 | Nitrendipine | Ethyl methyl 2,6-dimethyl-4-(3-nitrophenyl)-1,4-dihydropyridine-3,5-dicarboxylate | 2933.39 | 6 |
3958-60-9 | 1-(bromomethyl)-2-nitrobenzene | Potassium 1-(β-D-glucopyranosylthio)but-3-enylideneaminooxysulfonate | 2904.9 | |
3964-04-3 | 4-Bromoquinoline | 2933.39 | ||
39665-12-8 | L-Lysine monohydrate | 2922.41 | ||
39711-79-0 | Cyclohexanecarboxamide,N-Ethyl-5-Methyl-2-(1-Methylethyl)- | N-ethyl-5-methyl-2-(propan-2-yl)cyclohexanecarboxamide | 2924.29 | |
3977-29-5 | 2-Amino-4-hydroxy-6-methylpyrimidine | 2-amino-6-methylpyrimidin-4-ol | 2933.59 | |
3978-81-2 | 4-tert-butylpyridine | 4-tert-butylpyridine | 2933.39 | |
39831-55-5 | Amikacin sulfate | 2941.9 | 6 | |
39872-57-6 | (E)-1-(2,4,4-trimethylcyclohex-2-en-1-yl)but-2-en-1-one | 2914.29 | ||
3988-03-2 | bis(4-bromophenyl)methanone | 2914.7 | ||
39924-52-2 | Methyl jasmonate | 2918.3 | ||
40018-26-6 | 1,4-Dithiane-2,5-diol | 1,4-Dithiane-2,5-diol | 2934.99 | |
400882-07-7 | Cyflumetofen | 2-methoxyethyl 2-(4-tert-butylphenyl)-2-cyano-3-oxo-3-[2-(trifluoromethyl)phenyl]propanoate | 2926.9 | |
40130-23-4 | European K Acid | 2922.21 | ||
40138-16-7 | 2-Formylphenylboronic acid | 2-Formylphenylboronic acid | 2931.9 | |
4013-94-9 | N,N'-Diisopropylethylenediamine | N,N'-Diisopropylethylenediamine | 2921.29 | |
401788-98-5 | 1-Butyl-3-methylimidazolium methyl sulfate | 1-Butyl-3-methylimidazolium methyl sulfate | 2933.29 | |
402-31-3 | 1,3-Bis(trifluoromethyl)benzene | 1,3-Bis(trifluoromethyl)benzene | 2931.9 | |
4023-65-8 | Trans-Aconitic acid | (E)-1-propene-1,2,3-tricarboxylic acid | 2917.19 | |
402-40-4 | 1,5-Bis(4-allyldimethylammoniumphenyl)pentan-3-one dibromide | [4-[5-[4-[Dimethyl(prop-2-enyl)azaniumyl]phenyl]-3-oxopentyl]phenyl]-dimethyl-prop-2-enylazanium dibromide | 2923.9 | |
402-45-9 | 4-(trifluoromethyl)phenol | 4-(Trifluoromethyl)phenol | 2933.99 | |
40246-10-4 | Glycitin | 3-(4-Hydroxyphenyl)-6-methoxy-7-[(2S,3R,4S,5S,6R)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxychromen-4-one | 2938.9 | |
402-71-1 | N-Tosyl-L-phenylalanine chloromethyl ketone | N-[(2S)-4-chloro-3-oxo-1-phenylbutan-2-yl]-4-methylbenzenesulfonamide | 2935 | |
40290-32-2 | 1,2-Dipalmitoyl-rac-glycerol | (2-Hexadecanoyloxy-3-hydroxypropyl) hexadecanoate | 2915.7 | |
40306-70-5 | 1-ethyl-2-hydroxy-4-methyl-6-oxo-3-sulfomethyl-pyridine-5-carboxamide | (5-Carbamoyl-1-ethyl-2-hydroxy-4-methyl-6-oxopyridin-3-yl)methanesulfonic acid | 2933.39 | |
40372-72-3 | Bis[3-(triethoxysilyl)propyl]tetrasulfide | Triethoxy-[3-(3-triethoxysilylpropyltetrasulfanyl)propyl]silane | ||
4039-32-1 | Lithium bis(trimethylsilyl)amide | Lithium bis(trimethylsilyl)azanide | 2931.9 | |
40400-13-3 | 2-Iodobenzyl bromide | 1-(Bromomethyl)-2-iodobenzene | 2903.99 | |
404362-22-7 | Gaskamine 240 | 1,3-Benzenedimethanamine, N-(2-phenylethyl) derivs. | ||
40445-72-5 | Cholesteryl hydroxystearate | Cholest-5-en-3-ol (3.beta.)-, 12-hydroxyoctadecanoate | 3404.9 | |
40470-68-6 | 4,4'-Bis[2-Methoxyphenyl)ethenyl]-1,1'-Biphenyl | 1,1'-Biphenyl, 4,4'-bis[2-(2-methoxyphenyl)ethenyl]- | 3204.2 | |
404-86-4 | Capsaicin ; Chili Pepper Extract | (E)-N-[(4-hydroxy-3-methoxyphenyl)methyl]-8-methylnon-6-enamide | 8 | |
40487-42-1 | Pendimethalin | 3,4-dimethyl-2,6-dinitro-N-(pentan-3-yl)aniline | 2921.49 | 8 |
4051-63-2 | Pigment red 177 | 3204.17 | ||
40596-69-8 | Methoprene | Propan-2-yl (2E,4E)-11-methoxy-3,7,11-trimethyldodeca-2,4-dienoate | 2918.99 | 8 |
40601-76-1 | 1,3,5-Tris[(4-tert-butyl-3-hydroxy-2,6-dimethylphenyl)methyl]-1,3,5-triazinane-2,4,6-trione | 1,3,5-Tris[(4-tert-butyl-3-hydroxy-2,6-dimethylphenyl)methyl]-1,3,5-triazinane-2,4,6-trione | ||
4065-45-6 | Sulisobenzone | 5-Benzoyl-4-hydroxy-2-methoxybenzenesulfonic acid | ||
406-58-6 | HFC-365mfc | 1,1,1,3,3-pentafluorobutane | 8 | |
4067-16-7 | Pentaethylenehexamine | N'-[2-[2-[2-(2-aminoethylamino)ethylamino]ethylamino]ethyl]ethane-1,2-diamine | 2921.29 | 3 |
406-78-0 | 1,1,2,2-Tetrafluoroethyl 2,2,2-trifluoroethyl ether | 1,1,2,2-Tetrafluoro-1-(2,2,2-trifluoroethoxy)ethane | ||
40690-89-9 | Disperse orange 73 | 3204.11 | ||
4070-80-8 | Sodium stearyl fumarate | Sodium (E)-4-octadecoxy-4-oxobut-2-enoate | 2917.19 | |
40716-66-3 | Nerolidol | (6E)-3,7,11-trimethyldodeca-1,6,10-trien-3-ol | 2905.22 | |
407-25-0 | Trifluoroacetic anhydride | (2,2,2-Trifluoroacetyl) 2,2,2-trifluoroacetate | 2915.9 | |
40754-59-4 | Disodium laureth sulfosuccinate | 3402.9 | ||
4075-81-4 | Calcium propaonate | Calcium dipropaonate | 2915.5 | |
407587-33-1 | Calcium-Activated Chloride Channels | 6-Tert-butyl-2-(furan-2-carbonylamino)-4,5,6,7-tetrahydro-1-benzothiophene-3-carboxylic acid | 2934.99 | |
4075-96-1 | Dimethylamphetamine | N,N-dimethyl-1-phenylpropan-2-amine | 2921.49 | 7 |
40795-56-0 | Sodium dodecyl diphenyl ether disulfonate | 3402.11 | ||
4080-98-2 | Dodecanedioicacid dihydrazide | Dodecanedihydrazide | 2928 | |
408-35-5 | Palmitic acid sodium salt | Sodium;hexadecanoate | 2836.5 | |
4083-64-1 | Tosyl isocyanate | 4-Methyl-N-(oxomethylidene)benzenesulfonamide | 2929.1 | 3 |
40861-29-8 | Zinc oxide | Diammonium zinc biscarbonate | 2836.99 | |
4086-70-8 | Magnesium myristate | Magnesium tetradecanoate | 2915.9 | |
4089-07-0 | L-Tyrosine ethyl ester hydrochloride | Ethyl (2S)-2-amino-3-(4-hydroxyphenyl)propanoate hydrochloride | 2922.5 | |
4091-99-0 | 2′,7′-Dichlorofluorescin diacetate | 2-(3,6-Diacetyloxy-2,7-dichloro-9H-xanthen-9-yl)benzoic acid | 2932.99 | |
409-21-2 | Silicon carbide | Methanidylidynesilanylium | ||
40957-83-3 | Glycitein | 7-Hydroxy-3-(4-hydroxyphenyl)-6-methoxychromen-4-one | 2932.99 | |
4098-71-9 | Isophorone diisocyanate | 5-Isocyanato-1-(isocyanatomethyl)-1,3,3-trimethylcyclohexane | 2929.1 | |
41100-52-1 | Memantine hydrochloride | 3,5-Dimethyladamantan-1-amine hydrochloride | 2921.3 | |
4111-54-0 | Lithium diisopropylamide | Lithium di(propan-2-yl)azanide | 2921.19 | |
4118-16-5 | Pigment yellow 147 | 3204.17 | ||
41198-08-7 | Profenofos | O-(4-bromo-2-chlorophenyl) O-ethyl S-propyl phosphorothioate | 2930.9 | 8 |
41294-56-8 | Alfacalcidol | (1R,3S,5Z)-5-[(2E)-2-[(1R,3aS,7aR)-7a-methyl-1-[(2R)-6-methylheptan-2-yl]-2,3,3a,5,6,7-hexahydro-1H-inden-4-ylidene]ethylidene]-4-methylidenecyclohexane-1,3-diol | 2936.9 | 6 |
4130-35-2 | Tridecyl Trimellitate | Tris-decyl benzene-1,2,4-tricarboxylate | 2917.39 | |
4131-74-2 | Dimethyl 3,3'-thiodipropionate | Methyl 3-(3-methoxy-3-oxopropyl)sulfanylpropanoate | 2930.9 | |
41340-25-4 | Etodolac | 2-(1,8-Diethyl-4,9-dihydro-3H-pyrano[3,4-b]indol-1-yl)acetic acid | 2934.99 | |
41354-48-7 | Dihydroxyaluminum aminoacetate | (2-aminoacetyl)oxyaluminum;trihydrate | ||
41365-75-7 | 1-Amino-3,3-diethoxypropane | 3,3-Diethoxypropan-1-amine | 2922.19 | |
41372-22-9 | Calcium lactate hydrate | Calcium 2-hydroxypropanoate hydrate | 2918.11 | |
41444-62-6 | Codeine phosphate hemihydrate | (4R,4aR,7S,7aR,12bS)-9-methoxy-3-methyl-2,4,4a,7,7a,13-hexahydro-1H-4,12-methanobenzofuro[3,2-e]isoquinoline-7-ol phosphoric acid hydrate | 2939.11 | |
4146-30-9 | Neomycin trisulfate | (2R,3S,4R,5R,6R)-5-amino-2-(aminomethyl)-6-[(1R,2R,3S,4R,6S)-4,6-diamino-2-[(2S,3R,4S,5R)-4-[(2R,3R,4R,5S,6S)-3-amino-6-(aminomethyl)-4,5-dihydroxyoxan-2-yl]oxy-3-hydroxy-5-(hydroxymethyl)oxolan-2-yl]oxy-3-hydroxycyclohexyl]oxyoxane-3,4-diol sulfuric acid | 2941.9 | 6 |
41468-25-1 | Pyridoxal phosphate | (4-formyl-5-hydroxy-6-methylpyridin-3-yl)methyl dihydrogen phosphate hydrate | 2936.25 | |
41481-66-7 | 3-Allyl-4-hydroxyphenyl sulfone | 4-(4-hydroxy-3-prop-2-enylphenyl)sulfonyl-2-prop-2-enylphenol | 2930.9 | |
41484-35-9 | Thiodiethylene bis[3-(3,5-di-tert-butyl-4-hydroxyphenyl)propionate] | 2-[2-[3-(3,5-ditert-butyl-4-hydroxyphenyl)propanoyloxy]ethylsulfanyl]ethyl 3-(3,5-ditert-butyl-4-hydroxyphenyl)propanoate | 2930.9 | |
41496-43-9 | 2-methyl-3-(p-tolyl)propionaldehyde | 2-Methyl-3-(4-methylphenyl)propanal | 2912.29 | |
41556-26-7 | Bis(1,2,2,6,6-pentamethyl-4-piperidyl) sebacate | Decanedioic acid, 1,10-bis(1,2,2,6,6-pentamethyl-4-piperidinyl) ester | ||
41621-49-2 | Ciclopirox olamine | 2-Aminoethanol 6-cyclohexyl-1-hydroxy-4-methylpyridin-2-one | 2933.79 | |
41642-51-7 | Disperse blue 165 | 3204.11 | ||
41653-21-8 | Ethyl piperidinoacetylaminobenzoate | Ethyl 4-[(2-piperidin-1-ylacetyl)amino]benzoate | 2933.39 | |
4166-20-5 | 4-Acetoxy-2,5-dimethyl-3(2H)furanone | (2,5-Dimethyl-4-oxofuran-3-yl) acetate | 2932.19 | |
41669-30-1 | Isostearyl isostearate | 16-Methylheptadecyl 16-methylheptadecanoate | 2915.7 | |
41672-81-5 | Dipalmitoyl hydroxyproline | (2S,4R)-1-hexadecanoyl-4-hexadecanoyloxypyrrolidine-2-carboxylic acid | 3404.9 | |
4169-04-4 | 2-Phenoxypropanol | 2-Phenoxypropan-1-ol | 2909.49 | |
4175-37-5 | Octylated diphenylamine | 3812.3 | ||
4180-23-8 | Anethole | 1-methoxy-4-[(E)-prop-1-enyl]benzene | 2909.3 | |
41804-96-0 | 3,4-Dichloro-N-[[1-(dimethylamino)cyclohexyl]methyl]benzamide Hydrochloride | 3,4-dichloro-N-[[1-(dimethylamino)cyclohexyl]methyl]benzamide hydrochloride | 2929.9 | |
41814-78-2 | Tricyclazole | 5-methyl[1,2,4]triazolo[3,4-b][1,3]benzothiazole | 2934.99 | 8 |
41816-03-9 | [1,4-methanonaphthalene-2(1H),2’- oxirane], 3,4,4a,5,8,8a-hexahydro-3’,7- dimethyl | 2910.9 | ||
4181-95-7 | Tetracontane | Tetracontane | 2901.1 | |
4182-44-9 | 4-Dodecyldiethylenetriamine | N'-(2-aminoethyl)-N'-dodecylethane-1,2-diamine | 2921.29 | |
41859-67-0 | Bezafibrate | 2-[4-[2-[(4-chlorobenzoyl)amino]ethyl]phenoxy]-2-methylpropanoic acid | 2924.29 | 6 |
41890-92-0 | Methoxyelgenol | 7-Methoxy-3,7-dimethyloctan-2-ol | 2909.49 | |
4191-73-5 | Isopropylparaben | Propan-2-yl 4-hydroxybenzoate | 2918.29 | |
4197-24-4 | Carbol fuchsin, pure 5GR | 4-[(E)-(4-aminophenyl)-(4-imino-3-methylcyclohexa-2,5-dien-1-ylidene)methyl]-2-methylaniline;hydrochloride | ||
4197-25-5 | C.I. 26150 ; Solvent black 3 | 3212.9 | ||
420-04-2 | Hydrogen cyanamide | Cyanamide | 2853.9 | |
42013-20-7 | 2-Methylhippuric acid | 2-[(2-methylbenzoyl)amino]acetic acid | 2924.29 | |
4203-77-4 | Vat red 13 | 1,1'-diethyl-3,3'bidibenzo[cd,g]indazole-6,6'(1H,1H')-dione | 3204.15 | |
42045-86-3 | 3-Methylfentanyl | N-[3-methyl-1-(2-phenylethyl)piperidin-4-yl]-N-phenylpropanamide | 2933.39 | 7 |
420-46-2 | 1,1,1-Trifluoroethane | 1,1,1-Trifluoroethane | 2903.39 | 8 |
42131-25-9 | Isononyl isononanoate | 7-methyloctyl 7-methyloctanoate | ||
42131-27-1 | Isotridecyl Isononanoate | 11-methyldodecyl 7-methyloctanoate | ||
421-50-1 | 1,1,1-Trifluoroacetone | 1,1,1-trifluoropropan-2-one | 2914.7 | |
42203-78-1 | DOI hydrochloride | 1-(4-iodo-2,5-dimethoxyphenyl)propan-2-amine;hydrochloride | 2922.5 | |
42204-14-8 | Rhodium acetate | Rhodium(3+); triacetate | 2843.9 | |
4221-80-1 | Tetrabutyl phenyl hydroxybenzoate | (2,4-ditert-butylphenyl) 3,5-ditert-butyl-4-hydroxybenzoate | ||
4223-03-4 | N-tert-Octylacrylamide | N-(2,4,4-trimethylpentan-2-yl)prop-2-enamide | 2924.19 | |
42234-64-9 | Acid blue 185 | 3204.12 | ||
4229-44-1 | N-Methylhydroxylamine hydrochloride | N-methylhydroxylamine hydrochloride | 2928 | |
4233-96-9 | Gallocatechin gallate | [(2S,3R)-5,7-dihydroxy-2-(3,4,5-trihydroxyphenyl)-3,4-dihydro-2H-chromen-3-yl] 3,4,5-trihydroxybenzoate | 2932.99 | |
4235-95-4 | L-Alpha-phosphatidylcholine | [(2R)-2,3-di(octadec-9-enoyloxy)propyl] 2-(trimethylazaniumyl)ethyl phosphate | 2923.2 | |
42373-04-6 | Basic red 29 | 3204.16 | ||
42422-68-4 | Taleranol | (7S,11S)-7,15,17-trihydroxy-11-methyl-12-oxabicyclo[12.4.0]octadeca-1(14),15,17-trien-13-one | 2932.2 | |
42461-84-7 | Flunixin meglumin | (2R,3R,4R,5S)-6-(methylamino)hexane-1,2,3,4,5-pentol;2-[2-methyl-3-(trifluoromethyl)anilino]pyridine-3-carboxylic acid | 2941.9 | |
4246-51-9 | Diethylene glycol bis(3-aminopropyl) ether  | 2,2'-Oxydiethanol - 3,3'-oxydi(1-propanamine | 3403.99 | |
4247-02-3 | Isobutylparaben | 2-methylpropyl 4-hydroxybenzoate | 2918.29 | |
42482-06-4 | 2-Octenylsuccinic anhydride | 3-[(E)-oct-2-enyl]oxolane-2,5-dione | 2917.19 | |
4250-77-5 | 6-Hydroxyflavanone | 6-hydroxy-2-phenyl-2,3-dihydrochromen-4-one | 2932.99 | |
4253-34-3 | Methyltriacetoxysilane | [diacetyloxy(methyl)silyl] acetate | 2931.9 | |
42542-10-9 | 3,4-Methylenedioxy methamphetamine (MDMA) | (±)-N,α-dimethyl-3,4-(methylenedioxy)phenethylamine | 2932.99 | |
42594-17-2 | Dicyclopentadienedimethanoldiacrylate | Octahydro-1H-4,7-methanoindene-1,1-diylbis(methylene) bisacrylate | 2916.12 | |
4263-52-9 | Sodium bromoethylsulfonate | Sodium 2-bromoethanesulfonate | 2904.9 | |
4264-83-9 | Sodium 4-nitrophenyl phosphate | Disodium (4-nitrophenyl) phosphate | 2919.9 | |
4265-25-2 | 2-Methylbenzofuran | 2-methyl-1-benzofuran | 2932.99 | |
4272-74-6 | N alpha-Tosyl-L-lysine chloromethyl ketone hydrochloride | N-[(3S)-7-amino-1-chloro-2-oxoheptan-3-yl]-4-methylbenzenesulfonamide hydrochloride | 2935 | |
4273-98-7 | 2-(Phenylsulfonyl)aniline | 2-(benzenesulfonyl)aniline | 2930.9 | |
4275-07-4 | n-Butyraldehyde-aniline [condensation products of n-Butylraldehyde and aniline] | Butylideneaniline | 3812.1 | |
427-51-0 | Cyproterone acetate | 9-(3-chloro-4-methoxyphenyl)-3,3,6,6-tetramethyl-2,3,4,4a,5,6,7,8,9,9a-decahydro-1H-xanthene-1,8-dione | 2937.29 | |
42751-79-1 | Bore-HIB stabilizer | 2-(chloromethyl)oxirane;ethane-1,2-diamine;N-methylmethanamine | 2839.9 | |
42757-55-1 | Octabromobisphenol-S | 1,3-dibromo-5-[3,5-dibromo-4-(2,3-dibromopropoxy)phenyl]sulfonyl-2-(2,3-dibromopropoxy)benzene | ||
42774-15-2 | N,N'-bis(2,2,6,6-tetramethyl-4-piperidyl)isophthalamide | 1-N,3-N-bis(2,2,6,6-tetramethylpiperidin-4-yl)benzene-1,3-dicarboxamide | 2933.39 | |
42822-86-6 | P-Menthane-3,8-diol ; Eucalyptus globulus leaf oil | 2-(2-hydroxypropan-2-yl)-5-methylcyclohexan-1-ol | ||
42874-03-3 | Oxyfluorfen | 2-chloro-1-(3-ethoxy-4-nitrophenoxy)-4-(trifluoromethyl)benzene | 2909.3 | 8 |
4292-10-8 | (carboxymethyl)dimethyl-3-[(1-oxododecyl)amino]propylammonium hydroxide | {[3-(dodecanoylamino)propyl](dimethyl)ammonio}acetate | 3402.9 | |
42924-53-8 | Nabumetone | 4-(6-methoxynaphthalen-2-yl)butan-2-one | 2914.69 | 6 |
429-41-4 | Tetrabutylammonium fluoride | Tetrabutylazanium fluoride | 2923.9 | |
429-60-7 | Trifluoropropyltrimethoxysilane | Trimethoxy(3,3,3-trifluoropropyl)silane | 2931.9 | |
42971-09-5 | Vinpocetine | (3α, 16α)- eburnamenine-14- carboxylic acid ethyl ester | 2939.99 | |
42978-66-5 | Tripropylene Glycol Diacrylate | 2-[2-(2-prop-2-enoyloxypropoxy)propoxy]propyl prop-2-enoate | 2916.12 | |
42986-22-1 | 2-amino-5-(2-sulfooxyethylsulfonyl)benzenesulfonic acid | 2-amino-5-(2-sulfooxyethylsulfonyl)benzenesulfonic acid | 2930.9 | |
4299-07-4 | N-butyl-1, 2-benzisothiazolin-3-one | 2-butyl-1,2-benzothiazol-3-one | 2934.99 | |
4301-14-8 | Ethynylmagnesium bromide solution | Magnesium ethyne bromide | 2931.9 | |
43035-18-3 | Pigment red 247 | 3204.17 | ||
43052-87-5 | Alpha-Damascone | (E)-1-(2,6,6-trimethylcyclohex-2-en-1-yl)but-2-en-1-one | 2914.29 | |
431-03-8 | Diacetyl | Butane-2,3-dione | 2914.19 | |
43139-22-6 | Guanosine 5'-diphosphate sodium salt | Sodium [[(2R,3S,4R,5R)-5-(2-amino-6-oxo-3H-purin-9-yl)-3,4-dihydroxyoxolan-2-yl]methoxy-hydroxyphosphoryl] hydrogen phosphate | 2934.99 | |
4314-14-1 | Solvent yellow 16 | 3204.19 | ||
43160-25-4 | Sodium ferrous citrate | Tetrasodium 2-hydroxypropane-1,2,3-tricarboxylate iron(2+) | 2918.15 | |
431-89-0 | Apaflurane | 1,1,1,2,3,3,3-heptafluoropropane | 2909.3 | 8 |
43192-31-0 | 2-Bromo-4-methoxybenzaldehyde | 2-Bromo-4-methoxybenzaldehyde | 2913 | |
43210-67-9 | Fenbendazole | Methyl N-(6-phenylsulfanyl-1H-benzimidazol-2-yl)carbamate | 2933.99 | |
4335-09-5 | Direct green 6 | Disodium;4-amino-3-[(4-nitrophenyl)diazenyl]-5-oxo-6-[[4-[4-[2-(4-oxocyclohexa-2,5-dien-1-ylidene)hydrazinyl]phenyl]phenyl]hydrazinylidene]naphthalene-2,7-disulfonate | 3204.14 | |
4337-75-1 | Sodium 2-[methyl(1-oxododecyl)amino]ethanesulphonate | 3402.9 | ||
434-07-1 | Oxymetholone | (2Z,5S,8R,9S,10S,13S,14S,17S)-17-hydroxy-2-(hydroxymethylidene)-10,13,17-trimethyl-1,4,5,6,7,8,9,11,12,14,15,16-dodecahydrocyclopenta[a]phenanthren-3-one | 2937.9 | |
434-13-9 | Lithocholic acid | (4R)-4-[(3R,5R,8R,9S,10S,13R,14S,17R)-3-hydroxy-10,13-dimethyl-2,3,4,5,6,7,8,9,11,12,14,15,16,17-tetradecahydro-1H-cyclopenta[a]phenanthren-17-yl]pentanoic acid | 2918.19 | |
434-16-2 | 7-Dehydrocholesterol | (3S,9S,10R,13R,14R,17R)-10,13-dimethyl-17-[(2R)-6-methylheptan-2-yl]-2,3,4,9,11,12,14,15,16,17-decahydro-1H-cyclopenta[a]phenanthren-3-ol | 2936.9 | |
4345-03-3 | D-alpha-tocopheryl hydrogen succinate | 4-oxo-4-[[(2R)-2,5,7,8-tetramethyl-2-[(4R,8R)-4,8,12-trimethyltridecyl]-3,4-dihydrochromen-6-yl]oxy]butanoic acid | 2926.9 | |
4347-33-5 | 5-Formyl-2-thienylboronic Acid | (5-formylthiophen-2-yl)boronic acid | 2931.9 | |
4350-09-8 | Oxitriptan | 2-amino-3-(5-hydroxy-1H-indol-3-yl) propanoic acid | 2933.99 | 6 |
4352-49-2 | Cyclohexylethylamine | 1-cyclohexylethanamine | 2921.3 | |
4360-63-8 | 2-Bromomethyl-1,3-dioxolane | 2-(Bromomethyl)-1,3-dioxolane | 2932.99 | |
4361-23-3 | Tetrahydroionol | 4-(2,2,6-trimethylcyclohexyl)butan-2-ol | 2906.19 | |
4368-51-8 | Tetraheptylammonium bromide | Tetraheptylazanium bromide | 2923.9 | |
4373-41-5 | Maslinic acid | (4aS,6aR,6aS,6bR,8aR,10R,11R,12aR,14bS)-10,11-dihydroxy-2,2,6a,6b,9,9,12a-heptamethyl-1,3,4,5,6,6a,7,8,8a,10,11,12,13,14b-tetradecahydropicene-4a-carboxylic acid | 2918.19 | |
437-38-7 | Fentanyl | 1-phenethyl-4-N-propionylanilinopiperidine | 7 | |
4376-20-9 | Mono(2-ethylhexyl) phthalate | 2-(2-ethylhexoxycarbonyl)benzoic acid | 2917.34 | |
4378-61-4 | Pigment red 168 | 3204.17 | ||
438-41-5 | Chlordiazepoxide hydrochloride | 7-chloro-4-hydroxy-N-methyl-5-phenyl-3H-1,4-benzodiazepin-2-imine hydrochloride | 2933.99 | 6 |
4384-82-1 | Carbamodithioate ; Thiurams | 3812.1 | ||
438545-06-3 | Deoxyribonucleic acid sodium salt from salmon testes | 2934.99 | ||
4389-45-1 | 2-Amino-3-methylbenzoic acid | 2-Amino-3-methylbenzoic acid | 2939.99 | |
4390-04-9 | Isohexadecane | 2,2,4,4,6,8,8-heptamethylnonane | 2710.99 | |
439-14-5 | Diazepam | 7-Chloro-1,3-dihydro-1-methyl-5-phenyl-2H-1,4-benzodiazepin-2-one | 2933.91 | 9 |
4392-24-9 | Cinnamyl bromide | [(E)-3-bromoprop-1-enyl]benzene | 2903.99 | |
4394-85-8 | 4-Formylmorpholine | Morpholine-4-carbaldehyde | 2934.99 | |
4399-55-7 | Direct blue 71 | 3204.14 | ||
440-17-5 | Trifluoperazine hydrochloride | 10-[3-(4-methylpiperazin-1-yl)propyl]-2-(trifluoromethyl)phenothiazine dihydrochloride | 2934.3 | |
4402-30-6 | Methyldiisopropamolamine | 1-[2-hydroxypropyl(methyl)amino]propan-2-ol | 2922.19 | |
4403-90-1 | Acid green 25 | 3204.12 | ||
4411-89-6 | 2-Phenyl-2-butenal | 2-Phenylbut-2-enal | 2930.9 | |
4418-26-2 | Sodium dehydroacetate | Sodium 1-(3,4-dihydro-6-methyl-2,4-dioxo-2H-pyran-3-ylidene)ethanolate | 3824.9 | |
4419-11-8 | 2,2'-Azobis(2,4-dimethylvaleronitrile) | 2-[(2-cyano-4-methylpentan-2-yl)diazenyl]-2,4-dimethylpentanenitrile | 2927 | |
4420-74-0 | 3-Mercaptopropyltrimethoxysilane | 3-trimethoxysilylpropane-1-thiol | ||
4422-95-1 | Trimesoyl chloride | Benzene-1,3,5-tricarbonyl chloride | 2917.39 | |
4424-06-0 | Vat orange 7 ; Pigment orange 43 | Dibenzimidazo[2,1-b:2',1'-i]benzo[lmn][3,8]phenanthroline-8,17-dione | 3204.17 | |
4424-87-7 | Vat violet 13 | 3204.15 | ||
4426-47-5 | Butylboronic acid | Butylboronic acid | 2931.9 | |
4430-18-6 | Acid violet 43 | Benzenesulfonic acid, 2-[(9,10-dihydro-4-hydroxy-9,10-dioxo-1-anthracenyl)amino]-5-methyl-, monosodium salt | 3204.12 | |
4430-20-0 | Chlorophenol Red | 2-chloro-4-[3-(3-chloro-4-hydroxyphenyl)-1,1-dioxo-2,1$l^{6}-benzoxathiol-3-yl]phenol | 2933.99 | 8 |
4430-55-1 | Vat blue 26 ; 6,15-Dimethoxydinaphtho[1,2,3-cd:1',2',3'-lm]perylene-9,18-dione | 3204.11 | ||
4432-31-9 | 2-(N-Morpholino)ethanesulfonic Acid | 2-Morpholin-4-ylethanesulfonic acid | 2934.99 | |
4433-56-1 | Ethane-1,1-diol | Ethane-1,1-diol | 2905.39 | |
443-48-1 | Metronidazole | 2-(2-methyl-5-nitroimidazol-1-yl)ethanol | 2932.99 | |
4435-50-1 | Butane-1,2,3-triol | Butane-1,2,3-triol | 2905.49 | |
4435-53-4 | 3-Methoxybutyl acetate | 3-Methoxybutyl acetate | 2918.99 | |
4437-20-1 | Difurfuryl disulfide | 2-[(Furan-2-ylmethyldisulfanyl)methyl]furan | 2933.29 | |
4437-51-8 | Hexane-3,4-dione | Hexane-3,4-dione | 2914.19 | |
444-29-1 | 1-Iodo-2-(trifluoromethyl)benzene | 1-Iodo-2-(trifluoromethyl)benzene | 2903.99 | |
4444-01-3 | Basic blue 3 | 3204.13 | ||
445-30-7 | Homarine | 1-Methylpyridin-1-ium-2-carboxylate | 2933.39 | |
4457-71-0 | 3-Methyl-1,5-pentanediol | 3-Methyl-1,5-pentanediol | 2905.39 | |
446-48-0 | 1-(bromomethyl)-2-fluorobenzene | 1-(bromomethyl)-2-fluorobenzene | 2903.99 | |
4465-65-0 | 4-Epianhydrotetracycline hydrochloride | (4R,4aS,12aR)-4-(dimethylamino)-1,10,11,12a-tetrahydroxy-6-methyl-3,12-dioxo-4a,5-dihydro-4H-tetracene-2-carboxamide;hydrochloride | 2941.3 | |
446-72-0 | Genistein | 5,7-dihydroxy-3-(4-hydroxyphenyl)chromen-4-one | 2933.99 | |
4468-02-4 | Zinc gluconate | Zinc (2R,3S,4R,5R)-2,3,4,5,6-pentahydroxyhexanoate | 2918.16 | |
446859-33-2 | 2-(3-(6-Methylpyridin-2-yl)-1H-pyrazol-4-yl)-1,5-naphthyridine | 2-(3-(6-Methylpyridin-2-yl)-1H-pyrazol-4-yl)-1,5-naphthyridine | 2933.39 | |
446-86-6 | Azathioprine | 6-(3-methyl-5-nitroimidazol-4-yl)sulfanyl-7H-purine | 2933.99 | 6 |
4472-41-7 | N,N-Di(2H3)methyl(2H)formamide | 1-Deuterio-N,N-bis(trideuteriomethyl)formamide | 2924.19 | |
4474-24-2 | Acid blue 80 | Disodium 3,3'-(9,10-dioxoanthracene-1,4-diyldiimino)bis(2,4,6-trimethylbenzenesulfonate) | 3204.12 | |
44745-29-1 | (S)-(+)-2-Aminoheptane | (2S)-Heptan-2-amine | 2921.19 | |
4478-93-7 | Sulforaphane | 1-Isothiocyanato-4-methylsulfinylbutane | 2930.9 | |
4485-12-5 | Lithium stearate | Lithium octadecanoate | ||
4499-86-9 | Tetrapropylammonium hydroxide | Tetrapropylazanium hydroxide | 2923.9 | |
4499-91-6 | Lithium behenate | Lithium docosanoate | 3404.9 | |
4500-29-2 | Cyclohexyldiethanolamine | 2-[Cyclohexyl(2-hydroxyethyl)amino]ethanol | ||
4511-42-6 | L-Lactide | (3S,6S)-3,6-dimethyl-1,4-dioxane-2,5-dione | 2932.2 | |
45172-15-4 | Ethyllysine diisocyanate | Ethyl (2S)-2,6-diisocyanatohexanoate | 2929.1 | |
45245-91-8 | 2-dodecoxyethyl dihydrogen phosphate | 3402.11 | ||
4525-33-1 | Dimethyl dicarbonate | Methoxycarbonyl methyl carbonate | 2920.9 | |
452-58-4 | 2,3-Pyridinediamine | Pyridine-2,3-diamine | 2933.39 | |
452-86-8 | 4-Methylcatechol | 4-Methylbenzene-1,2-diol | 2907.29 | |
4531-49-1 | Pigment yellow 17 | Butanamide, 2,2'-[(3,3'-dichloro[ 1,1'-biphenyl]-4,4'- diyl)bis(azo)]bis[N-(2-methoxyphenyl)- 3-oxo- | 3204.17 | |
4536-23-6 | 2-Methylhexanoic acid | 2-Methylhexanoic acid | 2916.12 | |
4536-30-5 | Polidocanol | 2-dodecyloxyethanol | ||
4547-24-4 | Corosolic acid | (1S,2R,4aS,6aR,6aS,6bR,8aR,10R,11R,12aR,14bS)-10,11-dihydroxy-1,2,6a,6b,9,9,12a-heptamethyl-2,3,4,5,6,6a,7,8,8a,10,11,12,13,14b-tetradecahydro-1H-picene-4a-carboxylic acid | 2918.19 | |
4548-53-2 | Food red 1 | 1-Naphthalenesulfonic acid, 3-[(2,4-dimethyl-5-sulfophenyl)azo]-4-hydroxy-, disodium salt | 3204.12 | |
454-89-7 | 3-(Trifluoromethyl)benzaldehyde | 3-(Trifluoromethyl)benzaldehyde | 2913 | |
454-92-2 | 3-(Trifluoromethyl)benzoic acid | 3-(Trifluoromethyl)benzoic acid | 2916.39 | |
455-13-0 | 1-Iodo-4-(trifluoromethyl)benzene | 1-Iodo-4-(trifluoromethyl)benzene | 2903.99 | |
455-14-1 | 4-(Trifluoromethyl)aniline | 4-(Trifluoromethyl)aniline | 2921.43 | |
455-19-6 | 4-(Trifluoromethyl)benzaldehyde | 4-(Trifluoromethyl)benzaldehyde | 2913 | |
4559-70-0 | Diphenylphosphine oxide | Oxo(diphenyl)phosphanium | 2931.9 | |
4559-86-8 | Tetrabutylurea | 1,1,3,3-tetrabutylurea | 2924.19 | |
456-27-9 | 4-Nitrobenzenediazonium tetrafluoroborate | |||
4569-86-2 | 3-Amino-7-(diethylamino)-5-phenyl phenazinium chloride, 3-Amino-7-(diethylamino)-5-phenylphenazinium chloride, N,N-Diethylphenosafranine | 3204.9 | ||
4574-04-3 | Tetradecyl trimethyl ammonium chloride | Trimethyl(tetradecyl)ammonium chloride | 3402.12 | |
4578-31-8 | Adenosine phosphate disodium | Disodium [(2R,3S,4R,5R)-5-(6-aminopurin-9-yl)-3,4-dihydroxyoxolan-2-yl]methyl phosphate | 2934.99 | |
458-37-7 | Turmeric yellow ; Natural yellow 3 | 1,7-bis(4-hydroxy-3-methoxyphenyl)hepta-1,6-diene-3,5-dione | ||
459-46-1 | 4-Fluorobenzyl bromide | 1-(bromomethyl)-4-fluorobenzene | 2903.99 | |
459-57-4 | 4-Fluorobenzaldehyde | 4-Fluorobenzaldehyde | 2913 | |
4602-84-0 | Fragrance of farnesol, mixture of isomers | 3,7,11-trimethyldodeca-2,6,10-trien-1-ol | 3302.9 | |
460-73-1 | Pentafluoropropane | 1,1,1,3,3-pentafluoropropane | 2903.79 | 8 |
461000-66-8 | Eact | 3,4,5-trimethoxy-N-(2-methoxyethyl)-N-(4-phenyl-1,3-thiazol-2-yl)benzamide | 2934.1 | |
461-05-2 | Carnitine chloride | (3-carboxy-2-hydroxypropyl)-trimethylazanium chloride | 2923.9 | |
4615-31-0 | Zinc octadecyl phosphate | Zinc octadecyl phosphate | 3812.3 | |
461-58-5 | Cyanoguanidine | Cyanoguanidine | 3812.3 | |
4618-18-2 | Lactulose | 2-[4,5-dihydroxy-2,5-bis(hydroxymethyl)oxolan-3-yl]oxy-6-(hydroxymethyl)oxane-3,4,5-triol | 2940 | |
462-43-1 | 3-Fluoropropan-1-ol | 3-Fluoropropan-1-ol | 2942 | |
4630-07-3 | Valencene | (3R,4aS,5R)-4a,5-dimethyl-3-prop-1-en-2-yl-2,3,4,5,6,7-hexahydro-1H-naphthalene | 2902.19 | |
4637-24-5 | N,N-Dimethylformamide dimethyl acetal | 1,1-dimethoxy-N,N-dimethylmethanamine | 2922.19 | |
464-06-2 | 2,2,3-Trimethylbutane | 2,2,3-Trimethylbutane | 2901.1 | |
4648-54-8 | Azidotrimethylsilane | Azido(trimethyl)silane | 2931.9 | |
466691-40-7 | Oligopeptide - 10 | L-phenylalanyl-L-alanyl-L-lysyl-L-alanyl-L-leucyl-L-lysyl-L-alanyl-L-leucyl-L-leucyl-L-lysyl-L-alanyl-L-leucyl-L-lysyl-L-alanyl-L-leucinamide | 3504 | |
4669-26-5 | Diethylene glycol | 2-(2-hydroxyethoxy)ethanol | 2909.41 | |
4673-26-1 | Diphenyleneiodonium chloride | 2934.99 | ||
4674-50-4 | Nootkatone | (4R,4aS,6R)-4,4a-dimethyl-6-prop-1-en-2-yl-3,4,5,6,7,8-hexahydronaphthalen-2-one | 2914.29 | |
4682-36-4 | Orphenadrine citrate | N,N-dimethyl-2-[(2-methylphenyl)-phenylmethoxy]ethanamine;2-hydroxypropane-1,2,3-tricarboxylic acid | 2922.19 | |
4685-14-7 | Paraquat | 1,1'-dimethyl-4,4'-bipyridinium | 2933.39 | |
4691-65-0 | Disodium 5'-inosinate | Disodium [(2R,3S,4R,5R)-3,4-dihydroxy-5-(6-oxo-3H-purin-9-yl)oxolan-2-yl]methyl phosphate | ||
4695-62-9 | D-Fenchone | (1R,4S)-2,2,4-trimethylbicyclo[2.2.1]heptan-3-one | 2914.29 | |
4701-17-1 | 5-Bromothiophene-2-carbaldehyde | 5-Bromothiophene-2-carbaldehyde | 2934.99 | |
4702-90-3 | Solvent yellow 93 | 4,4'-methylylidenebis(5-methyl-2-phenyl-2,4-dihydro-3H-pyrazol-3-one) | 3204.9 | |
4706-17-6 | Tris(hydroxypropyl)phosphine | 3-[bis(3-hydroxypropyl)phosphanyl]propan-1-ol | 2919.9 | |
470-67-7 | 1,4-Cineole | 1-methyl-4-propan-2-yl-7-oxabicyclo[2.2.1]heptane | 2932.19 | |
470-69-9 | 1-Kestose | (2R,3R,4S,5S,6R)-2-[(2S,3S,4S,5R)-2-[[(2R,3S,4S,5R)-3,4-dihydroxy-2,5-bis(hydroxymethyl)oxolan-2-yl]oxymethyl]-3,4-dihydroxy-5-(hydroxymethyl)oxolan-2-yl]oxy-6-(hydroxymethyl)oxane-3,4,5-triol | 2940 | |
4707-47-5 | Methyl 3-methylorsellinate | Methyl 2,4-dihydroxy-3,6-dimethylbenzoate | 2942 | |
470-82-6 | Eucalyptol ; Fragrance of 1,8-Cineole | 1,3,3-trimethyl-2-oxabicyclo[2.2.2]octane | ||
470-99-5 | Isophorol | 3,5,5-trimethylcyclohex-2-en-1-ol | 2914.29 | |
471-05-6 | Zerumbone | (2E,6E,10E)-2,6,9,9-tetramethylcycloundeca-2,6,10-trien-1-one | 2914.29 | |
4712-55-4 | Diphenyl phosphite | Oxo(diphenoxy)phosphanium | 2920.9 | |
471-34-1 | Calcium carbonate | Calcium carbonate | 2836.5 | |
471-53-4 | Glycyrrhetic acid | (2S,4aS,6aR,6aS,6bR,8aR,10S,12aS,14bR)-10-hydroxy-2,4a,6a,6b,9,9,12a-heptamethyl-13-oxo-3,4,5,6,6a,7,8,8a,10,11,12,14b-dodecahydro-1H-picene-2-carboxylic acid | 2938.9 | |
4719-04-4 | Tris(N-hydroxyethyl) hexahydrotriazine | 2-[3,5-bis(2-hydroxyethyl)-1,3,5-triazinan-1-yl]ethanol | 2925.29 | |
4724-47-4 | Octadecylphosphonic acid | Octadecylphosphonic acid | 2931.9 | |
4724-48-5 | Octylphosphonic acid | Octylphosphonic acid | 3823.7 | |
472-61-7 | Astaxanthin | (6S)-6-Hydroxy-3-[(1E,3E,5E,7E,9E,11E,13E,15E,17E)-18-[(4S)-4-hydroxy-2,6,6-trimethyl-3-oxo-1-cyclohexenyl]-3,7,12,16-tetramethyloctadeca-1,3,5,7,9,11,13,15,17-nonaenyl]-2,4,4-trimethyl-1-cyclohex-2-enone | ||
472-66-2 | beta-Homocyclocitral | 2-(2,6,6-trimethylcyclohexen-1-yl)acetaldehyde | 2912.29 | |
4726-85-6 | 3-Aminopropanamide | 3-Aminopropanamide | 2935 | |
4727-49-5 | 1,1'-Diethyl-4,4'-cyanine iodide | (4E)-1-ethyl-4-[(1-ethylquinolin-1-ium-4-yl)methylidene]quinoline iodide | 2933.49 | |
4731-53-7 | Trioctylphosphine | Trioctylphosphine | 2931.9 | |
474-25-9 | Chenodeoxycholic acid | (4R)-4-[(3R,5S,7R,8R,9S,10S,13R,14S,17R)-3,7-dihydroxy-10,13-dimethyl-2,3,4,5,6,7,8,9,11,12,14,15,16,17-tetradecahydro-1H-cyclopenta[a]phenanthren-17-yl]pentanoic acid | 2918.19 | |
474338-68-6 | Sericin | 3504 | ||
474510-57-1 | 2-Hydroxy-1-{4-[4-(2-hydroxy-2-methyl-propionyl)-benzyl]-phenyl}-2-methyl-propan-1-one | 2-Hydroxy-1-{4-[4-(2-hydroxy-2-methyl-propionyl)-benzyl]-phenyl}-2-methyl-propan-1-one | 2914.4 | |
474-62-4 | Campesterol | (3S,8S,9S,10R,13R,14S,17R)-17-[(2R,5R)-5,6-dimethylheptan-2-yl]-10,13-dimethyl-2,3,4,7,8,9,11,12,14,15,16,17-dodecahydro-1H-cyclopenta[a]phenanthren-3-ol | 2906.13 | |
474-67-9 | Brassicasterol | (3S,8S,9S,10R,13R,14S,17R)-17-[(E,2R,5R)-5,6-dimethylhept-3-en-2-yl]-10,13-dimethyl-2,3,4,7,8,9,11,12,14,15,16,17-dodecahydro-1H-cyclopenta[a]phenanthren-3-ol | 2906.13 | |
475-20-7 | Longifolene | (1S,3aR,4S,8aS)-decahydro-4,8,8-trimethyl-9-methylene-1,4-methanoazulene | 2902.19 | |
4759-48-2 | Isotretinoin | (2Z,4E,6E,8E)-3,7-dimethyl-9-(2,6,6-trimethylcyclohexen-1-yl)nona-2,4,6,8-tetraenoic acid | 2916.19 | 6 |
4764-17-4 | Methylenedioxyamphetamine (MDA) หรือ tenamfetamine | α-methyl-3,4-(methylene dioxy) phenethylamine | 2932.99 | 7 |
476-66-4 | Ellagic acid | 4,4′,5,5′,6,6′-Hexahydroxydiphenic acid 2,6,2′,6′-dilactone | 2932.2 | |
476-70-0 | Boldine | (6aS)-1,10-dimethoxy-6-methyl-5,6,6a,7-tetrahydro-4H-dibenzo[de,g]quinoline-2,9-diol | 2939.99 | |
4767-03-7 | Dimethylolpropionic acid | 3-hydroxy-2-(hydroxymethyl)-2-methylpropanoic acid | 2915.5 | |
4773-96-0 | Mangiferin | 1,3,6,7-tetrahydroxy-2-[(2S,3R,4R,5S,6R)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]xanthen-9-one | 2938.9 | |
477-73-6 | Safranin T | 3,7-diamino-2,8-dimethyl-5-phenylphenazinium chloride | 2933.99 | |
477773-67-4 | Potassium azeloyl diglycinate | Potassium 2-[[9-(carboxymethylamino)-9-oxononanoyl]amino]acetate | 2924.19 | |
47931-85-1 | Calcitonin | 1,11-cyclo[L-alanyl-D-alanyl-N-methyl-L-leucyl-N-methyl-L-leucyl-N-methyl-L-valyl-(E)-(2S,3R,4R)-2-amino-3-hydroxy-N,4-dimethyloct-6-enoyl-L-2-aminobutanoyl-N-methylglycyl-N-methyl-L-leucyl-L-valyl-N-methyl-L-leucine] | 2937.19 | 6 |
479-41-4 | Indirubin | (3E)-3-(3-oxo-1H-indol-2-ylidene)-1H-indol-2-one | 2933.79 | |
479-66-3 | Fulvic acid | 3,7,8-trihydroxy-3-methyl-10-oxo-1,4-dihydropyrano[4,3-b]chromene-9-carboxylic acid | ||
479-73-2 | Pararosaniline | 4-[(4-aminophenyl)-(4-iminocyclohexa-2,5-dien-1-ylidene)methyl]aniline | 2933.99 | |
4800-94-6 | Carbenicillin disodium | Disodium (2S,5R,6R)-6-[(2-carboxylato-2-phenylacetyl)amino]-3,3-dimethyl-7-oxo-4-thia-1-azabicyclo[3.2.0]heptane-2-carboxylate | 2941.1 | 6 |
480-10-4 | Astragalin | 5,7-dihydroxy-2-(4-hydroxyphenyl)-3-[(2S,3R,4S,5S,6R)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxychromen-4-one | 2938.9 | |
480-40-0 | Chrysin | 5,7-dihydroxy-2-phenylchromen-4-one | 2932.99 | |
480-41-1 | Naringenin | (2S)-5,7-dihydroxy-2-(4-hydroxyphenyl)-2,3-dihydrochromen-4-one | 2932.99 | |
481-06-1 | Santonin | (3S,3aS,5aS,9bS)-3,5a,9-trimethyl-3a,4,5,9b-tetrahydro-3H-benzo[g][1]benzofuran-2,8-dione | 2932.2 | |
481-21-0 | 5alpha-Cholestane | (5R,8R,9S,10S,13R,14S,17R)-10,13-dimethyl-17-[(2R)-6-methylheptan-2-yl]-2,3,4,5,6,7,8,9,11,12,14,15,16,17-tetradecahydro-1H-cyclopenta[a]phenanthrene | 2902.19 | |
4812-20-8 | 2-Isopropoxyphenol | 2-propan-2-yloxyphenol | 2909.5 | |
481-37-8 | Ecgonine | - | 2939.91 | 7 |
481-39-0 | 5-Hydroxy-1,4-naphthoquinone | 5-hydroxynaphthalene-1,4-dione | 2914.69 | 3 |
481-42-5 | Plumbagin | 5-hydroxy-2-methylnaphthalene-1,4-dione | 2914.69 | |
48145-04-6 | Phenoxyethyl acrylate | 2-phenoxyethyl prop-2-enoate | 2916.12 | |
481-74-3 | Chrysophanol | 1,8-dihydroxy-3-methylanthracene-9,10-dione | 2914.69 | |
482-35-9 | Isoquercetin | 2-(3,4-dihydroxyphenyl)-5,7-dihydroxy-3-[(2S,3R,4S,5S,6R)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxychromen-4-one | 2938.9 | |
4827-59-2 | Glycyrrhetinyl stearate | (2S,4aS,6aR,6aS,6bR,8aR,10S,12aS,14bR)-2,4a,6a,6b,9,9,12a-heptamethyl-10-octadecanoyloxy-13-oxo-3,4,5,6,6a,7,8,8a,10,11,12,14b-dodecahydro-1H-picene-2-carboxylic acid | 2933.99 | |
482-89-3 | Vat blue 1 ; Indigo (synthetic) | 2,2'-Bis(2,3-dihydro-3- oxoindolyliden) | 3204.15 | |
4832-14-5 | Pigment green 7 | 3206.49 | ||
4835-90-9 | Hydroxypivalic acid | 3-hydroxy-2,2-dimethylpropanoic acid | 2918.19 | |
484-11-7 | Neocuproine | 2,9-dimethyl-1,10-phenanthroline | 2933.99 | |
484-47-9 | Lophine | 2,4,5-triphenyl-1H-imidazole | 2933.29 | |
4851-50-7 | Solvaperm green G | 3204.19 | ||
485-35-8 | Cytisine | 2939.99 | ||
485-47-2 | Ninhydrin | 2,2-dihydroxyindene-1,3-dione | 2914.5 | |
4856-87-5 | 1,6-Dimaleimidohexane | 1-[6-(2,5-dioxopyrrol-1-yl)hexyl]pyrrole-2,5-dione | 2928 | |
4857-06-1 | 2-Chlorobenzimidazole | 2-Chloro-1H-benzimidazole | 2933.99 | |
4857-44-7 | Desmeninol calcium | Calcium 2-hydroxy-4-methylsulfanylbutanoate | 2930.9 | |
486-56-6 | Cotinine | (5S)-1-methyl-5-pyridin-3-ylpyrrolidin-2-one | 2939.99 | |
486-66-8 | Daidzein | 7-hydroxy-3-(4-hydroxyphenyl)chromen-4-one | 2925.29 | |
4869-59-4 | 3-Mercaptobenzoic acid | 3-Sulfanylbenzoic acid | 2930.9 | |
487021-52-3 | 1-[(4-methoxyphenyl)methyl]-3-(5-nitro-1,3-thiazol-2-yl)urea | 1-[(4-methoxyphenyl)methyl]-3-(5-nitro-1,3-thiazol-2-yl)urea | 2934.1 | |
487-26-3 | Flavanone | 2-Phenyl-2,3-dihydrochromen-4-one | 2932.99 | |
487-89-8 | Indole-3-carboxaldehyde | 1H-Indole-3-carbaldehyde | 2933.99 | |
4885-02-3 | Dichloro(methoxy)methane | Dichloro(methoxy)methane | 2909.19 | |
488-81-3 | Adonitol | Ribitol | 2905.49 | |
4892-02-8 | Methyl thiosalicylate | Methyl 2-sulfanylbenzoate | 2930.9 | |
489-40-7 | alpha-Gurjunene | (1aR,4R,7bS)-1,1,4,7-tetramethyl-1a,2,3,4,4a,5,6,7b-octahydrocyclopropa[e]azulene | 2902.19 | |
489-84-9 | Guaiazulene | 7-isopropyl-1,4-dimethylazulene | ||
490-46-0 | Epicatechin | (2R,3R)-2-(3,4-dihydroxyphenyl)-3,4-dihydro-2H-chromene-3,5,7-triol | 2932.99 | |
490-91-5 | Thymoquinone | 2-Methyl-5-propan-2-ylcyclohexa-2,5-diene-1,4-dione | 2914.69 | |
491-54-3 | Kaempferide | 3,5,7-Trihydroxy-2-(4-methoxyphenyl)chromen-4-one | 2932.99 | |
491589-22-1 | 1,2-Cyclohexanedicarboxylic acid, calcium salt (1:1) | 3812.2 | ||
491-67-8 | Baicalein | 5,6,7-trihydroxy-2-phenylchromen-4-one | ||
491-70-3 | Luteolin | 2-(3,4-Dihydroxyphenyl)-5,7-dihydroxychromen-4-one | 2938.9 | |
492-39-7 | Cathine | (+)-(S)-α-[(S)-1-aminoethyl]benzyl alcohol | 2939.43 | 9 |
4926-55-0 | HC Yellow no. 2 | 2-(2-Nitroanilino)ethanol | ||
493-52-7 | Methyl red | 2-[[4-(dimethylamino)phenyl]diazenyl]benzoic acid | ||
493-72-1 | 5-Phenylcyclohexane-1,3-dione | 5-Phenylcyclohexane-1,3-dione | 2914.39 | 3 |
4940-11-8 | Ethyl maltol ; Fragrance of ethylmaltol | 2-Ethyl-3-hydroxypyran-4-one | ||
494-19-9 | Iminodibenzyl | 6,11-Dihydro-5H-benzo[b][1]benzazepine | 2933.99 | |
494-38-2 | Acridine orange | 3-N,3-N,6-N,6-N-tetramethylacridine-3,6-diamine | 2921.59 | |
4948-15-6 | Pigment red 149 | 3204.17 | ||
495-40-9 | Butyrophenone | 1-Phenylbutan-1-one | 2914.39 | |
495553-76-6 | Polyglyceryl-2 oleate | 3402.13 | ||
4955-90-2 | Sodium gentisate | Sodium 2,5-dihydroxybenzoate | 2918.29 | |
49562-28-9 | Fenofibrate | Propan-2-yl 2-[4-(4-chlorobenzoyl)phenoxy]-2-methylpropanoate | 2918.99 | 6 |
495-62-5 | Bisabolene | (4Z)-1-methyl-4-(6-methylhept-5-en-2-ylidene)cyclohexene | 2902.19 | |
495-69-2 | Hippuric acid | 2-Benzamidoacetic acid | 2924.29 | |
49625-59-4 | Boroglycerin | Boric acid propane-1,2,3-triol | 2920.9 | |
4964-71-0 | 5-Bromoquinoline | 5-Bromoquinoline | 2933.49 | |
49663-84-5 | Zinc tetroxy chromate | Trizinc dioxido(dioxo)chromium dihydroxide | ||
496-74-2 | Toluene-3,4-dithiol | 4-Methylbenzene-1,2-dithiol | 2930.9 | |
4971-47-5 | Ammonium bis(2-ethylhexyl) phosphate | Azanium bis(2-ethylhexyl) phosphate | 2919.9 | |
497-18-7 | Carbohydrazide | 1,3-diaminourea | 2928 | |
497-19-8 | Sodium carbonate | Disodium;carbonate | 3 | |
497-25-6 | 2-Oxazolidinone | 1,3-oxazolidin-2-one | 2934.99 | |
49745-95-1 | Dobutamine hydrochloride | 4-[2-[4-(4-hydroxyphenyl)butan-2-ylamino]ethyl]benzene-1,2-diol hydrochloride | 2922.29 | |
497-76-7 | Arbutin | (2R,3S,4S,5R,6S)-2-(hydroxymethyl)-6-(4-hydroxyphenoxy)oxane-3,4,5-triol | 2938.9 | |
4979-32-2 | N,N-Dicyclohexyl-2-benzothiazolesulfenamide | N-(1,3-benzothiazol-2-ylsulfanyl)-N-cyclohexylcyclohexanamine | ||
498-00-0 | Vanillyl alcohol | 4-(hydroxymethyl)-2-methoxyphenol | 2909.5 | |
498-02-2 | Apocynin | 1-(4-hydroxy-3-methoxyphenyl)ethanone | 2914.5 | |
498-07-7 | Levoglucosan | (1R,2S,3S,4R,5R)-6,8-dioxabicyclo[3.2.1]octane-2,3,4-triol | 2932.99 | |
499-40-1 | Isomaltose | (3R,4S,5S,6R)-6-[[(2S,3R,4S,5S,6R)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxymethyl]oxane-2,3,4,5-tetrol | 2940 | |
499-83-2 | Dipicolinic acid | Pyridine-2,6-dicarboxylic acid | 2933.99 | |
50-00-0 | Formaldehyde | Formaldehyde | ||
500008-45-7 | Chlorantraniliprole | 3-bromo-N-[4-chloro-2-methyl-6-(methylcarbamoyl)phenyl]-1-(3-chloropyridin-2-yl)-1H-pyrazole-5-carboxamide | 2933.99 | |
5000-75-8 | Sericite mica | Dipotassium dioxosilane oxo (oxoalumanyloxy) alumane oxygen (2-) | 2508.4 | |
50-01-1 | Guanidine hydrochloride | Guanidine hydrochloride | 2925.29 | 3 |
5001-72-9 | Direct red 31 | 3204.16 | ||
50-02-2 | Dexamethasone | (8S,9R,10S,11S,13S,14S,16R,17R)-9-fluoro-11,17-dihydroxy-17-(2-hydroxyacetyl)-10,13,16-trimethyl-6,7,8,11,12,14,15,16-octahydrocyclopenta[a]phenanthren-3-one | 2937.22 | 6 |
5002-47-1 | Fluphenazine decanoate | Fluphenazine decanoate | 2934.99 | 6 |
50-03-3 | Hydrocortisone Acetate | [2-[(8S,9S,10R,11S,13S,14S,17R)-11,17-dihydroxy-10,13-dimethyl-3-oxo-2,6,7,8,9,11,12,14,15,16-decahydro-1H-cyclopenta[a]phenanthren-17-yl]-2-oxoethyl] acetate | 2937.21 | 6 |
500339-24-2 | Alflow H 50 | 3404.9 | ||
50-06-6 | Phenobarbital | 5-ethyl-5-phenylpyrimidine-2,4,6(1H,3H,5H)-trione | 2933.53 | 9 |
500731-87-3 | Methoxycinnamidopropyl hydroxysultaine | 2-Hydroxy-3-[(3-{[3-(4-methoxyphenyl)prop-2-enoyl]amino}propyl)(dimethyl)ammonio]propane-1-sulfonate | 2916.39 | |
50-07-7 | Mitomycin C, Streptomyces caespitosus | Mitomycin C | 2941.9 | 6 |
500-85-6 | Indophenol | N-(4-Hydroxyphenyl)-p-benzoquinone monoimine | 2925.29 | |
501-30-4 | Kojic acid | 5-Hydroxy-2-(hydroxymethyl)-4H-pyran-4-one | 2942 | |
50-13-5 | Pethidine hydrochloride | Pethidine hydrochloride | 2933.39 | |
501-36-0 | 3,4′,5-Trihydroxy-trans-stilbene, 5-[(1E)-2-(4-Hydroxyphenyl)ethenyl]-1,3-benzenediol | 1,3-Benzenediol, 5-[(1E)-2-(4-hydroxyphenyl)ethenyl]- | 2907.29 | |
50-14-6 | Ergocalciferol | 2936.29 | 8 | |
501-52-0 | 3-Phenylpropionic acid | 3-Phenylpropionic acid | 2916.39 | |
501-53-1 | Benzyl chloroformate | 2-Fenoxyacetylchloride | 2915.9 | 3 |
501-97-3 | 3-(4-Hydroxyphenyl)propionic acid | 3-(4-Hydroxyphenyl)propionic Acid | 2918.29 | |
501-98-4 | 4-Hydroxycinnamic acid | (2E)-3-(4-Hydroxyphenyl)prop-2-enoic acid | 2918.29 | |
50-21-5 | Lactic acid | Lactic acid | 2918.11 | |
50-23-7 | Hydrocortisone | (8S,9S,10R,11S,13S,14S,17R)-11,17-dihydroxy-17-(2-hydroxyacetyl)-10,13-dimethyl-2,6,7,8,9,11,12,14,15,16-decahydro-1H-cyclopenta[a]phenanthren-3-one | 2937.21 | 6 |
502-42-1 | Cycloheptanone | Cycloheptanone | 2914.29 | |
502-44-3 | Caprolactone monomer | 2-Oxepanone | ||
502453-61-4 | HC Blue no.16 | 3204.14 | ||
50-24-8 | Prednisolone | (8S,9S,10R,11S,13S,14S,17R)-11,17-dihydroxy-17-(2-hydroxyacetyl)-10,13-dimethyl-7,8,9,11,12,14,15,16-octahydro-6H-cyclopenta[a]phenanthren-3-one | 2937.21 | 6 |
502-65-8 | Lycopene | ψ,ψ-carotene | ||
5026-62-0 | Methyl 4-hydroxybenzoate, sodium salt | Methyl 4-hydroxybenzoate sodium salt | 2918.29 | |
502693-09-6 | Cis-diisothiocyanato-(2,2’-bipyridyl-4,4’-dicarboxylic acid)-(2,2’-bipyridyl-4,4’-dinonyl) ruthenium(II) | Bis(isothiocyanato)(2,2'-bipyridyl-4,4'-dicarboxylato)(4,4'-dinonyl-2,2'-bipyridyl)ruthenium(II) | 2933.39 | |
50-28-2 | Estradiol | (8R,9S,13S,14S,17S)-13-methyl-6,7,8,9,11,12,14,15,16,17-decahydrocyclopenta[a]phenanthrene-3,17-diol | 2937.29 | 6 |
50326-33-5 | Pigment red 243 | 3204.17 | ||
50-32-8 | 3,4-Benzopyrene | 3,4-Benzopyrene | 2902.9 | |
50-33-9 | Phenylbutazone | Phenylbutazone | 2933.99 | |
50358-35-5 | 5-Amino-6-methylquinoline | 5-Amino-6-methylquinoline | 2933.49 | |
503-60-6 | 1-Chloro-3-methylbut-2-ene | 1-Chloro-3-methylbut-2-ene | 2903.99 | |
503612-47-3 | Apixaban | (1-(4-Methoxyphenyl)-7-oxo-6-[4-(2-oxopiperidin-1-yl)phenyl]-4,5-dihydropyrazolo[3,4-c]pyridine-3-carboxamide) | 2942 | |
50-36-2 | Cocaine | methyl (1R,2R,3S,5S)-3- (benzoyloxy)-8-methyl-8-azabicyclo[3.2.1]octane-2-carboxylate | 2939.91 | 7 |
5036-48-6 | 1-(3-Aminopropyl)imidazole | 1-(3-Aminopropyl)imidazole | 2933.29 | |
503-66-2 | 3-Hydroxypropionic acid | 3-Hydroxypropanoic acid | 2918.19 | |
50-37-3 | (+)-Lysergide (LSD) | 9,10-didehydro-N,N-diethyl-6-methylergoline-8β-carboxamide | 2939.63 | 7 |
503-74-2 | Isovaleric acid ; Fragrance of isovaleric acid | 3-Methylbutanoic acid | ||
5039-78-1 | [2-(Methacryloyloxy)ethyl]trimethylammonium chloride | Trimethyl((2-[(2-methylprop-2-enoyl)oxy]ethyl))azanium chloride | 2923.9 | |
504-02-9 | Cyclohexane-1,3-dione | 1,3-Cyclohexanedione | 2914.29 | |
50412-00-5 | 6-Nitro-1-diazo-2-naphthol-4-sulfonic acid | 2-Hydroxy-6-nitro-4-sulfonaphthalene-1-diazonium | 2927 | |
504-15-4 | 5-Methylbenzene-1,3-diol | 5-Methylresorcinol | 2907.29 | |
504-17-6 | 2-Thiobarbituric acid | 2-Mercaptopyrimidine-4,6(1H,5H)-dione | 2933.59 | |
50-41-9 | Clomifene citrate | 2-[4-[(Z)-2-chloro-1,2-diphenylethenyl]phenoxy]-N,N-diethylethanamine;2-hydroxypropane-1,2,3-tricarboxylic acid | 2922.19 | 6 |
504-24-5 | 4-Aminopyridine | 4-Aminopyridine | 2933.39 | |
504-29-0 | 2-Aminopyridine | 2-Aminopyridine | 2933.39 | |
504394-57-4 | Thymol trimethoxycinnamate | (5-Methyl-2-propan-2-ylphenyl) (E)-3-(3,4,5-trimethoxyphenyl)prop-2-enoate | 2924.29 | |
504-63-2 | Propane-1,3-diol | Propane-1,3-diol | 2905.39 | |
504-76-7 | Oxazolidine | Oxazolidine | 3202.9 | |
50-50-0 | Estradiol Benzoate | [(8R,9S,13S,14S,17S)-17-hydroxy-13-methyl-6,7,8,9,11,12,14,15,16,17-decahydrocyclopenta[a]phenanthren-3-yl] benzoate | 2937.23 | 6 |
505-10-2 | 3-Methylthiopropanol | 3-methylsulfanylpropan-1-ol | 2930.9 | |
50512-35-1 | Isoprothiolane | Dipropan-2-yl 1,3-dithiolan-2-ylidenepropanedioate | 2934.99 | 8 |
50525-27-4 | Tris(2,2′-bipyridyl)dichlororuthenium(II) hexahydrate | Dichlororuthenium; 2-pyridin-2-ylpyridine; hexahydrate | 2843.9 | |
50-53-3 | Chlorpromazine HCL | 3-(2-chloro-10H-phenothiazin-10-yl)-N,N-dimethylpropan-1-amine | 2934.3 | 6 |
50541-93-0 | 4-Amino-1-Benzylpiperidin | 1-Benzylpiperidin-4-amine | 2933.39 | |
505-48-6 | Octanedioic acid | Octanedioic acid | 2917.19 | |
50-55-5 | Reserpine | Methyl (1R,15S,17R,18R,19S,20S)-6,18-dimethoxy-17-(3,4,5-trimethoxybenzoyl)oxy-1,3,11,12,14,15,16,17,18,19,20,21-dodecahydroyohimban-19-carboxylate | 2939.99 | |
50-56-6 | Oxytocin | (2S)-2-{[(2S)-1-[(4R,7S,10S,13S,16S,19R)-19-Amino-13-[(2S)-butan-2-yl]-10-(2-carbamoylethyl)-7-(carbamoylmethyl)-16-[(4-hydroxyphenyl)methyl]-6,9,12,15,18-pentaoxo-1,2-dithia-5,8,11,14,17-pentaazacycloicosane-4-carbonyl]pyrrolidin-2-yl]formamido}-N-(carba | 2937.9 | 6 |
505-79-3 | Fragrance of 3-(Methylthio)propyl isothiocyanate | 3302.1 | ||
50586-59-9 | Trimethylolpropane ethoxylate | Propylidynetrimethanol, ethoxylated | 2905.41 | |
506-12-7 | Heptadecanoic acid | Heptadecanoic acid | 2915.9 | |
506-26-3 | Gamma-linolenic acid | Gamma-linolenic acid | 2916.19 | |
506-30-9 | Eicosanoic acid | Icosanoic acid | 2915.9 | |
506-32-1 | Arachidonic acid | (5Z,8Z,11Z,14Z)-Icosa-5,8,11,14-tetraenoic acid | 2916.19 | |
50-63-5 | Chloroquine phosphate | 4-N-(7-Chloroquinolin-4-yl)-1-N,1-N-diethylpentane-1,4-diamine;phosphoric acid | 2933.49 | 6 |
5064-31-3 | Trisodium nitrilotriacetate | Trisodium;2-[bis(carboxylatomethyl)amino]acetate | 2922.49 | |
50647-08-0 | Ginseng extract | 3302.9 | ||
50-65-7 | Niclosamide anhydrous | 5-Chloro-N-(2-chloro-4-nitrophenyl)-2-hydroxybenzamide | 2924.29 | 8 |
506-61-6 | Potassium silver cyanide | Potassium; silver; dicyanide | 2843.29 | 8 |
506-64-9 | Silver cyanide | Silver; cyanide | 2837.19 | |
50-67-9 | Serotonin | 3-(2-Aminoethyl)-1H-indol-5-ol | 2933.99 | |
506-87-6 | Ammonium carbonate | Diazanium;carbonate | 2836.2 | |
50-69-1 | D-Ribose | (2R,3R,4R)-2,3,4,5-tetrahydroxypentanal | ||
5070-13-3 | Bis(4-nitrophenyl) carbonate | Bis(4-nitrophenyl) carbonate | 2920.9 | |
50-70-4 | Sorbitol ; D-glucitol | (2R,3R,4R,5S)-Hexane-1,2,3,4,5,6-hexol | ||
50711-47-2 | 3-Amino-2-chloro-5-nitro-(1,4)naphthoquinone | 3-Amino-2-chloro-5-nitronaphthalene-1,4-dione | 2922.39 | |
507-20-0 | 2-Chloro-2-methylpropane; tert-butyl chloride | 2-Chloro-2-methylpropane | 2903.19 | |
50729-75-4 | 1,3,5-Triazine-2,4-diamine,6-[2-(2-undecyl-1H-imidazol-1-yl)ethyl]- | 6-[2-(2-Undecylimidazol-1-yl)ethyl]-1,3,5-triazine-2,4-diamine | 2933.29 | |
5074-71-5 | Bis(pentafluorophenyl)phenylphosphine | Bis(2,3,4,5,6-pentafluorophenyl)-phenylphosphane | 2931.9 | |
507-70-0 | Endo-1,7,7-trimethyl- bicyclo[2.2.1]heptan-2-ol; borneol | Endo-1,7,7-trimethylbicyclo[2.2.1]heptan-2-ol | 2906.19 | |
50-78-2 | Acetylsalicylic acid | 2-(Acetyloxy)benzoic acid | 2918.22 | 3 |
508-02-1 | Oleanic Acid | (4aS,6aR,6aS,6bR,8aR,10S,12aR,14bS)-10-hydroxy-2,2,6a,6b,9,9,12a-heptamethyl-1,3,4,5,6,6a,7,8,8a,10,11,12,13,14b-tetradecahydropicene-4a-carboxylic acid | 2918.19 | |
5080-22-8 | Isopropyl hydroxylamine | N-Hydroxypropan-2-amine | 2928 | |
5080-50-2 | Acetyl-L-carnitine hydrochloride | [(2R)-2-Acetyloxy-3-carboxypropyl]-trimethylazanium;chloride | 2923.9 | |
50812-17-4 | Galactomannanase | 3507.9 | ||
50-81-7 | L-Ascorbic acid | (2R)-2-[(1S)-1,2-Dihydroxyethyl]-3,4-dihydroxy-2H-furan-5-one | 2936.27 | |
5086-74-8 | Tetramisole hydrochloride | 6-phenyl-2,3,5,6-tetrahydroimidazo[2,1-b][1,3]thiazole hydrochloride | 2934.99 | |
50867-55-5 | 2-Propenoic acid, 2-methyl-, butyl ester, polymer with N-[3-(dimethylamino)propyl]-2-methyl-2-propenamide, dodecyl 2-methyl-2-propenoate and octadecyl 2-methyl-2-propenoate | 3402.12 | ||
5089-22-5 | 2,2'-(1,4-Naphthalenediyl)bis-Benzoxazole | 2,2'-(1,4-naphthalenediyl)bis-benzoxazole | 3204.2 | |
50-89-5 | Thymidine | 1-[(2R,4S,5R)-4-Hydroxy-5-(hydroxymethyl)oxolan-2-yl]-5-methylpyrimidine-2,4-dione | 2934.99 | |
50-91-9 | 5-Fluoro-2'-deoxyuridine | 5-Fluoro-1-[(2R,4S,5R)-4-hydroxy-5-(hydroxymethyl)oxolan-2-yl]pyrimidine-2,4-dione | 2934.99 | |
50925-42-3 | Direct yellow 86 | Tetrasodium 3,3'-[[6-[(2-hydroxyethyl)amino]-1,3,5-triazine-2,4-diyl]bis[imino(2-methyl-4,1-phenylene)azo]]bisnaphthalene-1,5-disulphonate | 3204.14 | |
50925-66-1 | Chromium chloride | Chromium(3+) trichloride | 3824.9 | |
50926-11-9 | Indium tin oxide | Indium oxotin | ||
509-34-2 | Solvent red 49 | 3204.19 | ||
50976-02-8 | Dicyclopentadienyl acrylate | 2916.12 | ||
50984-52-6 | Fragrance of p-Anisaldehyde | 4-methoxybenzaldehyde | 3302.9 | |
50-99-7 | Dextrose | (2R,3S,4R,5R)-2,3,4,5,6-pentahydroxyhexanal | ||
51000-52-3 | Vinyl neodecanoate | Ethenyl 7,7-dimethyloctanoate | 2915.9 | |
51022-70-9 | Salbutamol sulphate | Salbutamol hemisulfate | 2922.5 | 6 |
51026-28-9 | Potassium (hydroxymethyl)methyldithiocarbamate | Potassium N-(hydroxymethyl)-N-methylcarbamodithioate | 3824.9 | |
5102-83-0 | Pigment yellow 12 | 2,2'-[(3,3'-dichlorobiphenyl-4,4'-diyl)diazo-2,1-diyl]bis[N-(2,4-dimethylphenyl)-3-oxobutanamide] | 3204.17 | |
51-03-6 | Piperonyl butoxide | 5-[2-(2-Butoxyethoxy)ethoxymethyl]-6-propyl-1,3-benzodioxole | 2925.19 | |
51040-26-7 | Stearyl titanate | 2915.7 | ||
5104-49-4 | Flurbiprofen | 2-(3-Fluoro-4-phenylphenyl)propanoic acid | 2916.39 | 6 |
51-05-8 | Procaine hydrochloride | 2-(Diethylamino)ethyl 4-aminobenzoate;hydrochloride | 2922.49 | |
5108-96-3 | 1-Pyrrolidinecarbodithioic acid, ammonium salt | 1-Pyrrolidinecarbodithioic acid, ammonium salt | 2933.99 | |
51115-67-4 | Butanamide, N,2,3-trimethyl-2-(1-methylethyl)- | 2-Isopropyl-N,2,3-trimethylbutyramide | 2934.99 | |
51142-18-8 | Bacto peptone | 3504 | ||
51142-51-9 | PEG-15 Glyceryl ricinoleate | 3402.13 | ||
51-15-0 | Pyridine-2-aldoxime methochloride | 2-Hydroxyiminomethyl-1-methylpyridinium chloride | 2933.39 | |
51166-71-3 | Dimethyl-beta-cyclodextrin | 2940 | ||
5117-19-1 | Polyethylene Glycol 400 | 2-[2-[2-[2-[2-[2-[2-(2-hydroxyethoxy)ethoxy]ethoxy]ethoxy]ethoxy]ethoxy]ethoxy]ethanol | 2909.49 | |
51-17-2 | 1,3-Benzodiazole | 1H-Benzimidazole | 2933.19 | |
512-04-9 | Diosgenin | (1'S,2R,2'S,4'S,5R,7'R,8'R,9'S,12'S,13'R,16'S)-5,7',9',13'-Tetramethyl-5'-oxaspiro[oxane-2,6'-pentacyclo[10.8.0.0²,⁹.0⁴,⁸.0¹³,¹⁸]icosan]-18'-en-16'-ol | 2932.99 | |
51-21-8 | 5-Fluorouracil | 2,4-Dihydroxy-5-fluoropyrimidine | 2933.59 | 6 |
51218-45-2 | Metolachlor | 2-chloro-N-(2-ethyl-6-methylphenyl)-N-(1-methoxypropan-2-yl)acetamide | 2924.29 | 8 |
51218-49-6 | Pretilachlor | 2-chloro-N-(2,6-diethylphenyl)-N-(2-propoxyethyl)acetamide | 2924.29 | 8 |
51235-04-2 | Hexazinone | 3-cyclohexyl-6-(dimethylamino)-1-methyl-1,3,5-triazine-2,4(1H,3H)-dione | 2933.69 | 8 |
51240-95-0 | 1,1,3,3-Tetramethylbutylperoxyneodecanoate | 2,4,4-Trimethylpentan-2-yl 2,2,3,5-tetramethylhexaneperoxoate 2,4,4-trimethylpentan-2-yl 2,2-diethylhexaneperoxoate 2,4,4-trimethylpentan-2-yl 2,2-dimethyloctaneperoxoate 2,4,4-trimethylpentan-2-yl 2,4-dimethyl-2-(propan-2-yl)pentaneperoxoate 2,4,4-trimet | 2915.9 | |
5124-30-1 | Dicyclohexylmethane-4,4'-Diisocyanate | 1,1´-Methylenebis(4-isocyanatocyclohexane) | 2929.1 | 3 |
51252-88-1 | 2-Methacryloyloxyethyl hexahydrophthalic acid | 2-[2-(2-Methylprop-2-enoyloxy)ethoxycarbonyl]cyclohexane-1-carboxylic acid | 2916.14 | |
512-56-1 | Trimethyl phosphate | Trimethyl phosphate | ||
51274-00-1 | Iron(III) oxide-hydroxide ; Pigment Yellow 42 | Iron(III) oxide-hydroxide | ||
51277-96-4 | Palmitamidopropyltrimonium chloride | 3402.12 | ||
51-28-5 | 2,4-Dinitrophenol | 2,4-Dinitrophenol | 2908.99 | |
51298-62-5 | N-Nitro-L-arginine methyl ester hydrochloride | Methyl (2S)-2-amino-5-[[amino(nitramido)methylidene]amino]pentanoate;hydrochloride | 2929.9 | |
513-00-8 | Tetraisopropyl pyrophosphoramide | N-[Bis(propan-2-ylamino)phosphoryloxy-(propan-2-ylamino)phosphoryl]propan-2-amine | 2929.9 | |
5131-66-8 | 1-Butoxy-2-propanol | 1-butoxypropan-2-ol | 3 | |
51333-22-3 | Budesonide | 2937.29 | 6 | |
513-35-9 | 2-Methylbut-2-ene | 2-Methylbut-2-ene | ||
513-49-5 | (S)-(+)-Sec-butylamine | Butan-2-amine | 2921.19 | |
51-35-4 | Hydroxyproline ; Trans-4-hydroxy-L-proline | (4R)-4-Hydroxy-L-proline | ||
51364-51-3 | Tris(dibenzylideneacetone)dipalladium | (1E,4E)-1,5-diphenylpenta-1,4-dien-3-one; palladium | 2843.9 | |
5137-55-3 | Methyl(trioctyl)azanium;chloride | Methyltrioctyl ammonium chloride | ||
513-77-9 | Barium carbonate | Barium(+2) cation carbonate | 8 | |
513-78-0 | Cadmium carbonate | Cadmium(+2) cation carbonate | 2836.99 | |
513-79-1 | Cobaltous carbonate | Cobalt(2+); carbonate | ||
513-85-9 | Butane-2,3-diol | Butane-2,3-diol | 2905.39 | |
513-86-0 | 3-Hydroxybutanone ; acetyl methyl carbinol | 1-Hydroxyethyl methyl ketone | 2914.4 | |
513-92-8 | 1,1,2,2-Tetraiodoethene | Tetraiodoethylene | 2903.39 | |
51404-69-4 | Lead(II) acetate basic | Lead acetate basic | 2915.29 | |
514-10-3 | Abietic acid | 3806.1 | ||
51-41-2 | (R)-4-(2-Amino-1-hydroxyethyl)-1,2-benzenediol ; L-Noradrenaline | Norepinephrine | 2914.7 | |
5141-20-8 | Light green sf yellowish | Benzenemethanaminium, N-ethyl-N-[4-[[4-[ethyl[(3-sulfophenyl)methyl]amino]phenyl](4-sulfophenyl)methylene]-2,5-cyclohexadien-1-ylidene]-3-sulfo-, inner salt, disodium salt | 3204.19 | |
5142-23-4 | 3-Methyladenine | 3-Methyladenine | 2933.59 | |
51-42-3 | Epinephrine Bitartrate | (2R,3R)-2,3-dihydroxybutanedioic acid 4-[(1R)-1-hydroxy-2-(methylamino)ethyl]benzene-1,2-diol | 2937.9 | 6 |
51429-74-4 | Phosphomolybdic acid | Phosphoric acid; trioxomolybdenum; hydrate | 2811.19 | |
51-43-4 | Epinephrine ; (-)-adrenaline | Epinephrin | 2937.9 | 6 |
514-36-3 | Fludrocortisone Acetate | [2-[(8S,9R,10S,11S,13S,14S,17R)-9-fluoro-11,17-dihydroxy-10,13-dimethyl-3-oxo-1,2,6,7,8,11,12,14,15,16-decahydrocyclopenta[a]phenanthren-17-yl]-2-oxoethyl] acetate | 2937.22 | 6 |
5144-89-8 | 1,10-Phenanthroline monohydrate | 1,10-phenanthroline;hydrate | 2933.99 | |
51-45-6 | Histamine | 2-(1H-imidazol-5-yl)ethanamine | 2933.29 | |
514-78-3 | Canthaxanthin ; Orobronze; beta,beta-Carotene-4,4'-dione | 2,4,4-Trimetil-3-[(1E,3E,5E,7E,9E,11E,13E,15E,17E)-3,7,12,16-tetrametil-18-(2,6,6-trimetil-3-oxo-1-ciclohexenil)octadeca-1,3,5,7,9,11,13,15,17-nonaenil]-1-ciclohex-2-enona)) | ||
51481-10-8 | Deoxynivalenol | 12,13-Epoxy-3-alpha,7-alpha,15-trihydroxy-9-trichothecen-8-one | 2932.99 | |
51481-61-9 | Cimetidine | 2-Cyan-1-methyl-3-(2-(5-methylimidazol-4-ylmethylsulfany)ethyl)guaridin | 2925.19 | |
51-48-9 | L-thyroxine | (2S)-2-amino-3-[4-(4-hydroxy-3,5-diiodophenoxy)-3,5-diiodophenyl] propanoic acid | 2937.9 | 6 |
51-52-5 | Propylthiouracil | 6-propyl-2-sulfanylidene-1,2,3,4-tetrahydropyrimidin-4-one | 2933.59 | 6 |
51529-01-2 | Flupentixol dihydrochloride | cis-(Z)-Flupenthixol dihydrochloride | 2934.99 | |
515-42-4 | Sodium;benzenesulfonate | Sodium benzenesulphonate | 2904.1 | |
51566-62-2 | 3,7-Dimethyloct-6-enenitrile | 3,7-Dimethyl-6-octenenitrile | 2914.29 | |
515-69-5 | Bisabolol ; Fragrance of alpha-bisabolol | rel-(2R)-6-methyl-2-[(1R)-4-methylcyclohex-3-en-1-yl]hept-5-en-2-ol | ||
51-57-0 | Metamfetamine hydrochloride | Methamphetamine hydrochloride | 2933.91 | 6 |
51570-20-8 | Chitosanase | 3507.9 | ||
51580-86-0 | Sodium dichloroisocyanurate dihydrate | 1,3,5-Triazine-2,4,6(1H,3H,5H)-trione, 1,3-dichloro-, sodium salt, dihydrate | 3 | |
5160-02-1 | Pigment red 53:1 | Barium bis{5-chloro-2-[(2-hydroxynaphthalen-1-yl)diazenyl]-4-methylbenzenesulfonate} | 3206.49 | |
51-60-5 | Neostigmine methylsulfate | (3-Dimethylcarbamoyloxyphenyl)- trimethylammonium methyl sulfate | 2924.29 | 6 |
516-06-3 | DL-valine | 2-amino-3-methylbutanoic acid | 2922.49 | |
516-12-1 | N-iodosuccinimide | 1-Iodopyrrolidine-2,5-dione | 2929.9 | |
51-65-0 | P-fluoro-DL-phenylalanine | 4-Fluoro-DL-phenylalanine | 2922.49 | |
5165-97-9 | Sodium Acryloyldimethyltaurate | Sodium 2-methyl-2-(prop-2-enoylamino)propane-1-sulfonate | 2924.19 | |
51-67-2 | Tyramine | 4-(2-aminoethyl)phenol | 2922.29 | |
51707-55-2 | Thidiazuron | 1-phenyl-3-(thiadiazol-5-yl)urea | ||
517-28-2 | Hematoxylin | Haematoxylin | 3204.9 | |
51728-26-8 | Pentaerythritol, ethoxylated, esters with acrylic acid | Pentaerythritol, ethoxylated, esters with acrylic acid | 2930.9 | |
51745-87-0 | Trititanium oxide | Oxygen(2-) titanium(4+) | 3824.6 | |
51753-57-2 | Phenazepam | 7-bromo-5-(2-chlorophenyl)-1,3-dihydro-2H-1,4- benzodiazepin-2-one | 2933.99 | 9 |
51755-66-9 | 3-(Methylthio)-1-hexanol | 3-methylsulfanylhexan-1-ol | 2930.9 | |
51-79-6 | Urethane | Ethyl carbamate | 3403.99 | |
51803-78-2 | Nimesulide | N-(4-nitro-2-phenoxyphenyl)methanesulfonamide | 2935 | 6 |
51805-45-9 | Tris(2-carboxyethyl)phosphine hydrochloride | 3-[bis(2-carboxyethyl)phosphanyl]propanoic acid;hydrochloride | 2931.9 | |
51811-82-6 | Dimethylthionine ; Giemsa Stain | (7-aminophenothiazin-3-ylidene)-dimethylazanium;chloride | ||
5182-30-9 | Trisodium naphthalene-1,3,6-trisulphonate | Trisodium;naphthalene-1,3,6-trisulfonate | 2904.1 | |
518-47-8 | Acid yellow 73 | Spiro[isobenzofuran-1(3H),9'-[9H]xanthen]-3-one, 3',6'-dihydroxy-, disodium salt | 3212.9 | |
518-67-2 | Dimidium Bromide | 5-methyl-6-phenylphenanthridin-5-ium-3,8-diamine;bromide | 2933.99 | |
5187-37-1 | Tetraacetyl Diborate | [acetyloxy(diacetyloxyboranyloxy)boranyl] acetate | 2942 | |
518-75-2 | Citrinin | (3R,4S)-6-hydroxy-3,4,5-trimethyl-8-oxo-3,4-dihydroisochromene-7-carboxylic acid | 2941.9 | |
518-82-1 | Emodin | 1,3,8-trihydroxy-6-methylanthracene-9,10-dione | 2932.11 | |
51889-44-2 | N-Octylferrocene | Cyclopentane iron octylcyclopentane | 2942 | |
5189-11-7 | Pizotyline Malate | 4-(4,5-dihydrobenzo[1,2]cyclohepta[3,4-b]thiophen-10-ylidene)-1-methylpiperidine;2-hydroxybutanedioic acid | 2934.99 | |
519-09-5 | Benzoylecgonine | (1S,3S,4R,5R)-3-benzoyloxy-8-methyl-8-azabicyclo[3.2.1]octane-4-carboxylic acid | 2939.91 | |
51920-12-8 | Pigment red 185 | 3204.17 | ||
5192-03-0 | 5-Aminoindole | 1H-indol-5-amine | 2933.99 | |
519-23-3 | Ellipticine | 5,11-dimethyl-6H-pyrido[4,3-b]carbazole | 2933.99 | |
51938-28-4 | T-hexyl peroxypivalate | 2-methylpentan-2-yl 2,2-dimethylpropaneperoxoate | 2915.9 | |
519-73-3 | Triphenylmethane | Benzhydrylbenzene | 2902.9 | |
51981-21-6 | Tetrasodium Glutamate Diacetate | Tetrasodium (2S)-2-[bis(carboxylatomethyl)amino]pentanedioate | ||
52009-14-0 | Calcium Pyruvate | Calcium 2-oxopropanoate | 2918.3 | |
52-01-7 | Spironolactone | S-[(7R,8R,9S,10R,13S,14S,17R)-10,13-dimethyl-3,5'-dioxospiro[2,6,7,8,9,11,12,14,15,16-decahydro-1H-cyclopenta[a]phenanthrene-17,2'-oxolane]-7-yl] ethanethioate | 2932.2 | 6 |
520-18-3 | Kaempferol | 3,5,7-trihydroxy-2-(4-hydroxyphenyl)chromen-4-one | 2932.99 | |
52019-78-0 | 2-Hexanol | (2S)-hexan-2-ol | 2905.19 | |
520-26-3 | Hesperidin | (2S)-5-hydroxy-2-(3-hydroxy-4-methoxyphenyl)-7-[(2S,3R,4S,5S,6R)-3,4,5-trihydroxy-6-[[(2R,3R,4R,5R,6S)-3,4,5-trihydroxy-6-methyloxan-2-yl]oxymethyl]oxan-2-yl]oxy-2,3-dihydrochromen-4-one | 2938.9 | |
520-27-4 | Diosmin | 5-hydroxy-2-(3-hydroxy-4-methoxyphenyl)-7-[(2S,3R,4S,5S,6R)-3,4,5-trihydroxy-6-[[(2R,3R,4R,5R,6S)-3,4,5-trihydroxy-6-methyloxan-2-yl]oxymethyl]oxan-2-yl]oxychromen-4-one | 2938.9 | |
520-33-2 | Hesperetin | (2S)-5,7-dihydroxy-2-(3-hydroxy-4-methoxyphenyl)-2,3-dihydrochromen-4-one | 2932.99 | |
520-36-5 | Apigenin | 5,7-dihydroxy-2-(4-hydroxyphenyl)chromen-4-one | 2932.99 | |
520-45-6 | Dehydroacetic Acid | 3-acetyl-6-methylpyran-2,4-dione | ||
5204-74-0 | Triethylammonium Acetate | acetic acid;N,N-diethylethanamine | 2923.9 | |
520-52-5 | Psilocybine | 2939.99 | 9 | |
5206-47-3 | Zirconium octoate ; octanoate;zirconium(4+) | 3815.19 | ||
52080-58-7 | Solvent violet 8 | 3204.9 | ||
52125-53-8 | 1-Ethoxypropan-1-ol | 1-ethoxypropan-1-ol | 2909.44 | |
5212-80-6 | 5-Hexen-1-ol, 5-methyl- | 5-methylhex-5-en-1-ol | 2905.29 | |
521-31-3 | Luminol | 5-amino-2,3-dihydrophthalazine-1,4-dione | 2933.99 | |
5217-47-0 | 1,3-Diethyl-2-thiobarbituric acid | 1,3-diethyl-2-sulfanylidene-1,3-diazinane-4,6-dione | 2937.9 | |
521-78-8 | Trimipramine maleate | (Z)-but-2-enedioic acid;3-(5,6-dihydrobenzo[b][1]benzazepin-11-yl)-N,N,2-trimethylpropan-1-amine | 2933.99 | |
52-21-1 | Prednisolone acetate | [2-[(8S,9S,10R,11S,13S,14S,17R)-11,17-dihydroxy-10,13-dimethyl-3-oxo-7,8,9,11,12,14,15,16-octahydro-6H-cyclopenta[a]phenanthren-17-yl]-2-oxoethyl] acetate | 2937.21 | 6 |
52232-33-4 | Fluorescent Brightener 362 | 3204.2 | ||
52238-68-3 | Bis(3-methoxybutyl) peroxydicarbonate | Bis(3-methoxybutyl) ethanediperoxoate | 2918.99 | |
52238-92-3 | Pigment red 242 | 3204.17 | ||
522-48-5 | Tetrahydrozoline Hydrochloride | 2-(1,2,3,4-tetrahydronaphthalen-1-yl)-4,5-dihydro-1H-imidazole;hydrochloride | 2933.29 | |
52255-49-9 | Poly (Acrylic acid-co-Maleic acid),Sodium Salt | Sodium furan-2,5-dione prop-2-enoate | 2916.19 | |
52256-37-8 | Solvent orange 62 | Chromate(1-),bis[2,4-dihydro-4-[(2-hydroxy-5-nitrophenyl)azo]-5-methyl-2-phenyl-3H-pyrazol-3-onato(2-)]-,hydrogen;Chromate(1-), bis[2,4-dihydro-4-[[2-(hydroxy-kO)-5-nitrophenyl]azo-kN1]-5-methyl-2-phenyl-3H-pyrazol-3-onato(2-)-kO3]-, hydrogen (9CI) | 3204.19 | |
52258-47-6 | Calcium di(octacosanoate) | 3812.2 | ||
522-75-8 | Thioindigo ; C.I. 73300 | 3204.19 | ||
52-28-8 | Codeine Phosphate | (4R,4aR,7S,7aR,12bS)-9-methoxy-3-methyl-2,4,4a,7,7a,13-hexahydro-1H-4,12-methanobenzofuro[3,2-e]isoquinoline-7-ol phosphoric acid | 2939.11 | |
52292-17-8 | Poly(oxy-1,2-ethanediyl),a-isooctadecyl-w-hydroxy- | 3402.2 | ||
52299-14-6 | Succinyl-L-trialanine P-nitroanilide | 4-[[(2S)-1-[[(2S)-1-[[(2S)-1-(4-nitroanilino)-1-oxopropan-2-yl]amino]-1-oxopropan-2-yl]amino]-1-oxopropan-2-yl]amino]-4-oxobutanoic acid | 2924.29 | |
52304-36-6 | Ethyl Butylacetylaminopropionate | Ethyl 3-[acetyl(butyl)amino]propanoate | 2924.19 | |
52315–07–8 | Cypermethrin ; Zeta-cypermethrin | cyano(3-phenoxyphenyl)methyl 3-(2,2-dichloroethenyl)-2,2-dimethylcyclopropanecarboxylate | 2926.9 | 8 |
52315-75-0 | N-alpha-Lauroyl-L-lysine | (2S)-6-amino-2-(dodecanoylamino)hexanoic acid | 2924.29 | |
52320-66-8 | Pigment yellow 75 | 3204.17 | ||
523-21-7 | Sodium Rhodizonate | Disodium 3,4,5,6-tetraoxocyclohexene-1,2-diolate | 2914.4 | |
5232-99-5 | Etocrylene | Ethyl 2-cyano-3,3-diphenylprop-2-enoate | 2926.9 | |
52338-87-1 | N,N'-bis(3-dimethylaminopropyl) urea ; Initiator based on dimethylaminopropyl urea | 3815.9 | ||
5234-68-4 | Carboxin | 2934.99 | 8 | |
52357-70-7 | Iron oxide brown ; C.I. Pigment Brown 6 | Iron oxyde hydrate | ||
52372-36-8 | Solvent red 196 | 3204.9 | ||
52372-39-1 | Solvent red 197 | 3204.9 | ||
52374-36-4 | Amalgamated zinc | 2853 | ||
523-87-5 | Dimenhydrinate | 2-benzhydryloxy-N,N-dimethylethanamine;8-chloro-1,3-dimethyl-7H-purine-2,6-dione | 2939.59 | 6 |
52408-84-1 | Glycerol, Propoxylated, Esters With Acrylic Acid | 3-[2,3-bis(3-prop-2-enoyloxypropoxy)propoxy]propyl prop-2-enoate | 2916.12 | |
5242-49-9 | 4-(2-benzoxazolyl)-4'-(5-methyl-2-benzoxazolyl)stilbene | 3204.2 | ||
52434-90-9 | Tris(2,3-dibromopropyl) isocyanurate | 1,3,5-tris(2,3-dibromopropyl)-1,3,5-triazinane-2,4,6-trione | 2933.69 | |
524-36-7 | Pyridoxamine Dihydrochloride | 4-(aminomethyl)-5-(hydroxymethyl)-2-methylpyridin-3-ol;dihydrochloride | 2936.25 | |
52-43-7 | Allobarbital | 5,5-diallylbarbituric acid | 2933.53 | 9 |
52463-83-9 | Pinazepam | 7-chloro-1,3-dihydro-5-phenyl-1-(2-propynyl)-2H-1,4- benzodiazepin-2-one | 2933.91 | 9 |
52474-60-9 | Precyclemone B | 1-methyl-3-(4-methylpent-3-enyl)cyclohex-3-ene-1-carbaldehyde | 2912.29 | |
52-49-3 | Trihexyphenidyl Hydrochloride | 1-cyclohexyl-1-phenyl-3-piperidin-1-ylpropan-1-ol;hydrochloride | 2933.39 | |
524-95-8 | 2-Aminoethoxydiphenylborate | 2-diphenylboranyloxyethanamine | 2931.9 | |
52497-24-2 | 2-[(2-Hydroxyethyl)octadecylamino]ethyl stearate | 2-[2-hydroxyethyl(octadecyl)amino]ethyl octadecanoate | 2922.12 | |
52497-68-4 | Thymidine-(methyl-3H) | 1-[(2R,4S,5R)-4-hydroxy-5-(hydroxymethyl)oxolan-2-yl]-5-(tritritiomethyl)pyrimidine-2,4-dione | 2844.4 | 5 |
52504-24-2 | PEG-6 Caprylic | Decanoic acid, ester with 1,2,3-propanetriol octanoate, polymer with .alpha.-hydro-.omega.-hydroxypoly(oxy-1,2-ethanediyl) | 3402.13 | |
525-05-3 | Disodium 1-nitroso-2-naphthol-3,6-disulfonate | Disodium 3-hydroxy-4-nitrosonaphthalene-2,7-disulfonate | 2908.99 | |
52-51-7 | Bronopol | 2-bromo-2-nitropropane-1,3-diol | 2905.59 | |
525-66-6 | Propranolol | 1-naphthalen-1-yloxy-3-(propan-2-ylamino)propan-2-ol | 2922.5 | 6 |
525-79-1 | Kinetin | N-(furan-2-ylmethyl)-7H-purin-6-amine | ||
5261-31-4 | 2-[N-(2-cyanoethyl)-4-[(2,6-dichloro-4-nitrophenyl)azo]anilino]ethyl acetate | 3204.11 | ||
52623-75-3 | Disperse red 118 | 3204.11 | ||
52623-95-7 | Poly(oxy-1,2-ethanediyl), .alpha.-[(1,1,3,3-tetramethylbutyl)phenyl]-.omega.-hydroxy-, phosphate | 3402.11 | ||
52625-13-5 | Sorbitol polyoxypropylene ether | 3-[2,3,4,5,6-pentakis(3-hydroxypropoxy)hexoxy]propan-1-ol | 3507.9 | |
52628-03-2 | 2-Hydroxyethyl methacrylate phosphate | 2-hydroxyethyl 2-methylprop-2-enoate;phosphoric acid | 2919.9 | |
5263-02-5 | Zinc carbonate | Dizinc; zinc; dicarbonate; hexahydrate | 2836.99 | |
52645-53-1 | Permethrin | (3-phenoxyphenyl)methyl 3-(2,2-dichloroethenyl)-2,2-dimethylcyclopropane-1-carboxylate | 2916.2 | 8 |
526-73-8 | 1,2,3-Trimethylbenzene | 1,2,3-trimethylbenzene | 2707.5 | |
526-78-3 | 2,3-Dibromosuccinic acid | 2,3-dibromobutanedioic acid | 2917.19 | |
52-68-6 | Trichlorfon | 2,2,2-trichloro-1-dimethoxyphosphorylethanol | 2931.9 | |
526-94-3 | Sodium Bitartrate | Sodium (2R,3R)-2,3,4-trihydroxy-4-oxobutanoate | 2918.13 | |
526-95-4 | Gluconic Acid | (2R,3S,4R,5R)-2,3,4,5,6-pentahydroxyhexanoic acid | 2918.16 | |
52697-38-8 | Disperse violet 9 | 3204.11 | ||
527-07-1 | Sodium Gluconate | Sodium (2R,3S,4R,5R)-2,3,4,5,6-pentahydroxyhexanoate | 2918.16 | |
527-09-3 | Copper Gluconate | Copper (2R,3S,4R,5R)-2,3,4,5,6-pentahydroxyhexanoate | 2918.16 | |
5271-38-5 | 2-(Methylthio)ethanol | 2-methylsulfanylethanol | 2930.9 | |
52715-93-2 | Methionylmethionine | 2-[(2-amino-4-methylsulfanylbutanoyl)amino]-4-methylsulfanylbutanoic acid | 2930.4 | |
52740-56-4 | p-Methoxyamphetamine hydrochloride | 1-(4-methoxyphenyl)propan-2-amine;hydrochloride | 2922.29 | |
5274-65-7 | Oleth-2 | 2-[2-[(Z)-octadec-9-enoxy]ethoxy]ethanol | 2909.44 | |
52-76-6 | Lynestrenol | (8R,9S,10R,13S,14S,17R)-17-ethynyl-13-methyl-2,3,6,7,8,9,10,11,12,14,15,16-dodecahydro-1H-cyclopenta[a]phenanthren-17-ol | 2937.23 | |
527-72-0 | 2-Thiophenecarboxylic acid | Thiophene-2-carboxylic acid | 2934.99 | |
52785-06-5 | Platinum(IV) oxide | Dioxoplatinum; hydrate | 2843.9 | |
5280-66-0 | Pigment red 48:4 | 3204.17 | ||
5280-68-2 | Pigment red 146 | 2-Naphthalenecarboxamide, N-(4-chloro-2,5-dimethoxyphenyl)- 3-hydroxy-4-[[2-methoxy-5-[( phenylamino)carbonyl]phenyl] azo]- | 3204.17 | |
5280-78-4 | Pigment red 144 | 3204.17 | ||
5280-80-8 | 3,3'-[(2,5-dimethyl-p-phenylene)bis[imino(1-acetyl-2-oxoethylene)azo]]bis[4-chloroN-(5-chloro-o-tolyl)benzamide] | 3204.17 | ||
5281-04-9 | Pigment red 57 | Calcium 3-hydroxy-4-[(4-methyl-2-sulfonatophenyl)azo]naphthalene-2-carboxylate | 3205 | |
52814-39-8 | Metesculetol | 2-(7-hydroxy-4-methyl-2-oxochromen-6-yl)oxyacetic acid | 2934.99 | |
5281-84-9 | Pigment red 57:1 | 3204.17 | ||
52829-07-9 | Bis(2,2,6,6-Tetramethyl-4-piperidyl) sebacate | Bis(2,2,6,6-tetramethylpiperidin-4-yl) decanedioate | ||
52846-56-7 | Pigment orange 62 | 3204.17 | ||
528-48-3 | Fisetin | 2-(3,4-dihydroxyphenyl)-3,7-dihydroxychromen-4-one | 2932.99 | |
528-50-7 | Cellobiose | (2R,3S,4S,5R,6S)-2-(hydroxymethyl)-6-[(2R,3S,4R,5R,6R)-4,5,6-trihydroxy-2-(hydroxymethyl)oxan-3-yl]oxyoxane-3,4,5-triol | ||
528-53-0 | Delphinidin Chloride | 2-(3,4,5-trihydroxyphenyl)chromenylium-3,5,7-triol;chloride | 2932.99 | |
5285-60-9 | 4,4'-Methylenebis(N-sec-butylaniline) | N-butan-2-yl-4-[[4-(butan-2-ylamino)phenyl]methyl]aniline | 2921.42 | |
528-58-5 | Cyanidin Chloride | 2-(3,4-dihydroxyphenyl)chromenylium-3,5,7-triol;chloride | 2932.99 | |
52-86-8 | Haloperidol | 4-[4-(4-chlorophenyl)-4-hydroxypiperidin-1-yl]-1-(4-fluorophenyl)butan-1-one | 2933.39 | 6 |
52-89-1 | L-Cysteine hydrochloride | (2R)-2-amino-3-sulfanylpropanoic acid hydrochloride | 2930.9 | |
52-90-4 | Cysteine | (2R)-2-amino-3-sulfanylpropanoic acid | ||
52918-63-5 | Deltamethrin | [Cyano-(3-phenoxyphenyl)methyl] (1R,3S)-3-(2,2-dibromoethenyl)-2,2-dimethylcyclopropane-1-carboxylate | 2926.9 | 8 |
529-28-2 | O-Iodoanisole | 1-iodo-2-methoxybenzene | 2909.3 | |
529-34-0 | 1-Tetralone | 3,4-dihydro-2H-naphthalen-1-one | 2914.39 | |
529-36-2 | 1-Naphthalenethiol | Naphthalene-1-thiol | 2931.9 | |
529-44-2 | Myricetin | 3,5,7-Trihydroxy-2-(3,4,5-trihydroxyphenyl)chromen-4-one | 2933.99 | |
529-59-9 | Genistin | 5-hydroxy-3-(4-hydroxyphenyl)-7-[(2S,3R,4S,5S,6R)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxychromen-4-one | 2938.9 | |
530-57-4 | Syringic Acid | 4-hydroxy-3,5-dimethoxybenzoic acid | 2918.99 | |
530-59-6 | Sinapic Acid | (E)-3-(4-hydroxy-3,5-dimethoxyphenyl)prop-2-enoic acid | 2918.99 | |
530-62-1 | N,N'-Carbonyldiimidazole | Di(imidazol-1-yl)methanone | 2933.29 | |
5306-85-4 | Dimethyl Isosorbide | (3S,3aR,6R,6aR)-3,6-dimethoxy-2,3,3a,5,6,6a-hexahydrofuro[3,2-b]furan | 2909.2 | |
5307-14-2 | 2-Nitro-P-phenylenediamine | 2-nitrobenzene-1,4-diamine | 2921.51 | |
530-93-8 | 3,4-Dihydro-2(1H)-naphthalenone; beta-Tetralone | 3,4-dihydro-1H-naphthalen-2-one | 2914.39 | |
53123-88-9 | Rapamycin ; Sirolimus | (3S,6R,7E,9R,10R,12R,14S,15E,17E,19E,21S,23S,26R,27R,34aS)-9,10,12,13,14,21,22,23,24,25,26,27,32,33,34,34a-Hexadecahydro-9,27-dihydroxy-3-((1R)-2-((1S,3R,4R)-4-hydroxy-3-methoxycyclohexyl)-1-methylethyl)-10,21-dimethoxy-6,8,12,14,20,26-hexamethyl-23,27-ep | 2941.9 | 6 |
53124-00-8 | Hydroxypropyl Distarch Phosphate | 3505.1 | ||
53148-31-5 | 1,4-Cyclohexanediol bis-ethylhexanoate | [4-(2-ethylhexanoyloxy)cyclohexyl] 2-ethylhexanoate | 2918.19 | |
531-52-2 | 1,3,5-Triphenylformazan | N'-anilino-N-phenyliminobenzenecarboximidamide | 2928 | |
531-55-5 | Azure B | 3-methylamino-7-dimethylaminophenothiazin-5-ium chloride | 3204.9 | |
53161-77-6 | Parylene | 2903.99 | ||
53169-24-7 | Cerium(IV)-zirconium(IV) oxide | 3815.9 | ||
531-75-9 | Esculin | 7-hydroxy-6-[(2S,3R,4S,5S,6R)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxychromen-2-one | ||
53188-07-1 | Trolox | 6-hydroxy-2,5,7,8-tetramethyl-3,4-dihydrochromene-2-carboxylic acid | 2932.99 | |
531-91-9 | N,N'-Diphenylbenzidine | 4-(4-anilinophenyl)-N-phenylaniline | 2921.59 | |
53199-31-8 | Bis(tri-tert-butylphosphine)palladium(0 | Palladium; tritert-butylphosphane | 2843.9 | |
532-02-5 | Sodium 2-naphthalenesulfonate | Sodium naphthalene-2-sulfonate | ||
532-03-6 | Methocarbamol | [2-hydroxy-3-(2-methoxyphenoxy)propyl] carbamate | 2924.29 | |
53-21-4 | Cocaine Muriate | Methyl 3-benzoyloxy-8-methyl-8-azabicyclo[3.2.1]octane-4-carboxylate;hydrochloride | 2939.11 | |
5321-63-1 | Benzylpiperazine Dihydrochloride | 1-benzylpiperazine;dihydrochloride | 2933.99 | |
53220-22-7 | Dimyristyl peroxydicarbonate | Tetradecoxycarbonyloxy tetradecyl carbonate | 2920.9 | |
532-32-1 | Sodium benzoate | Sodium benzoate | ||
532-43-4 | Thiamine Mononitrate | 2-[3-[(4-amino-2-methylpyrimidin-5-yl)methyl]-4-methyl-1,3-thiazol-3-ium-5-yl]ethanol;nitrate | 2936.22 | |
5324-84-5 | Sodium Caprylyl Sulfonate | Sodium octane-1-sulfonate | ||
532-59-2 | Amylocaine Hydrochloride | [1-(dimethylamino)-2-methylbutan-2-yl] benzoate;hydrochloride | 2922.19 | |
532-65-0 | Ar-Turmerone | (6S)-2-methyl-6-(4-methylphenyl)hept-2-en-4-one | 2914.39 | |
532-82-1 | Chrysoidine crystal | |||
5328-37-0 | L-Arabinose | (2R,3S,4S)-2,3,4,5-tetrahydroxypentanal | ||
5329-14-6 | Sulfamic acid | Sulfamic acid | 2811.19 | 3 |
532-94-5 | Sodium Hippurate | Sodium 2-benzamidoacetate | 2924.29 | |
53306-54-0 | Bis(2-propylheptyl) phthalate | Bis(2-propylheptyl) benzene-1,2-dicarboxylate | 2917.34 | |
5331-32-8 | Isobornyl methyl ether | (1R,3R,4R)-3-methoxy-4,7,7-trimethylbicyclo[2.2.1]heptane | 2909.2 | |
5331-43-1 | Benzyl carbazate | 3809.91 | ||
53320-86-8 | Laponite rd ; Organophilic smectite | Lithium;magnesium; sodium;dioxido(oxo)silane | ||
5332-73-0 | 3-Methoxypropylamine | 3-methoxypropan-1-amine | 2922.19 | |
533-31-3 | 3,4-Methylenedioxyphenol | 1,3-benzodioxol-5-ol | 2932.99 | |
5333-42-6 | Octyldodecanol | 2-octyldodecan-1-ol | ||
533-67-5 | 2-Deoxy-D-ribose | (3S,4R)-3,4,5-trihydroxypentanal | ||
533-75-5 | Tropolone | 2-hydroxycyclohepta-2,4,6-trien-1-one | 2914.4 | |
53378-51-1 | Sodium O,O-diisobutyl dithiophosphate | 2920.19 | ||
53378-52-2 | Phosphorothioic acid, O,O-bis(2-methylpropyl) ester, sodium salt | 2920.19 | ||
53398-83-7 | Trans-2-Hexenyl butyrate | [(E)-hex-2-enyl] butanoate | 2915.6 | |
53408-94-9 | Stannous Methanesulfonate ; Tin (II) methanesulfonate | Methanesulfonate tin(2+) | ||
534-15-6 | 1,1-Dimethoxyethane | 1,1-Dimethoxyethane | 2911 | 3 |
5341-61-7 | Hydrazine dihydrochloride | Hydrazine;dihydrochloride | 2825.1 | |
534-17-8 | Cesium carbonate | Dicesium carbonate | 2836.99 | |
53-43-0 | Prasterone | (3S,8R,9S,10R,13S,14S)-3-hydroxy-10,13-dimethyl-1,2,3,4,7,8,9,11,12,14,15,16-dodecahydrocyclopenta[a]phenanthren-17-one | 2937.29 | |
5343-92-0 | 1,2-Pentanediol | Pentane-1,2-diol | 2905.39 | |
5345-47-1 | 2-Aminonicotinic acid | 2-aminopyridine-3-carboxylic acid | 2933.39 | |
5350-41-4 | Benzyltrimethylammonium Bromide | Benzyl(trimethyl)azanium;bromide | 2923.9 | |
5355-16-8 | Diaveridine | 5-[(3,4-dimethoxyphenyl)methyl]pyrimidine-2,4-diamine | 2933.59 | |
53563-70-5 | Capryleth-9 carboxylic acid | 3707.9 | ||
53568-66-4 | Polyquaternium 10 / Cellulose 2-hydroxyethyl 2-[2-hydroxy-3- | 3402.12 | ||
53-57-6 | Dihydronicotinamide-adenine dinucleotide phosphate | [[(2R,3R,4R,5R)-5-(6-aminopurin-9-yl)-3-hydroxy-4-phosphonooxyoxolan-2-yl]methoxy-hydroxyphosphoryl] [(2R,3S,4R,5R)-5-(3-carbamoyl-4H-pyridin-1-yl)-3,4-dihydroxyoxolan-2-yl]methyl hydrogen phosphate | 2934.99 | |
535-77-3 | M-Cymene | 1-methyl-3-propan-2-ylbenzene | 2902.9 | |
53585-53-8 | Dibenzyl toluene | 1,2-dibenzyl-3-methylbenzene | 3824.9 | |
535-87-5 | 3,5-Diaminobenzoic acid | 3,5-diaminobenzoic acid | 2922.49 | |
53-59-8 | Nadide phosphate | [[(2R,3R,4R,5R)-5-(6-aminopurin-9-yl)-3-hydroxy-4-phosphonooxyoxolan-2-yl]methoxy-hydroxyphosphoryl] [(2R,3S,4R,5R)-5-(3-carbamoylpyridin-1-ium-1-yl)-3,4-dihydroxyoxolan-2-yl]methyl hydrogen phosphate;sodium | 2934.99 | |
536-17-4 | P-Dimethylaminobenzalrhodanine | 5-[[4-(dimethylamino)phenyl]methylidene]-2-sulfanylidene-1,3-thiazolidin-4-one | 2934.1 | |
536-33-4 | Ethionamide | 2-ethylpyridine-4-carbothioamide | 2933.39 | |
53633-54-8 | Polyquaterium 11 / 2-Propenoic acid, 2-methyl-, 2-(dimethylamino)ethyl ester, polymer with 1-ethenyl-2-pyrrolidinone, compd. with diethyl sulfate | 3402.12 | ||
536-45-8 | Sodium anisate | Sodium 4-methoxybenzoate | 2918.99 | |
536-46-9 | N,N-Dimethylbenzene-1,4-diamine dihydrochloride | 4-N,4-N-dimethylbenzene-1,4-diamine;dihydrochloride | 2921.51 | |
536-47-0 | N,N-Dimethyl-P-phenylenediamine sulfate | 4-N,4-N-dimethylbenzene-1,4-diamine;sulfuric acid | 2921.51 | |
536-69-6 | Fusaric Acid | 5-butylpyridine-2-carboxylic acid | 2933.39 | |
536-74-3 | Ethynylbenzene | Ethynylbenzene | 2902.9 | |
53694-15-8 | Sorbeth-30 / D-Glucitol, ethoxylated 1 - 12.5 moles ethoxylated | 3402.13 | ||
53-70-3 | Dibenz(A,H)Anthracene | Naphtho[1,2-b]phenanthrene | 2902.9 | |
53716-49-7 | Carprofen | 2-(6-chloro-9H-carbazol-2-yl)propanoic acid | 2941.9 | 6 |
5373-11-5 | Luteoloside | 2-(3,4-dihydroxyphenyl)-5-hydroxy-7-[(2S,3R,4S,5S,6R)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxychromen-4-one | 2938.9 | |
537-46-2 | Methamphetamine | (+)-(S)-N,α-dimethylphenethylamine | 2939.91 | 7 |
537-55-3 | N-acetyl-L-tyrosine | (2S)-2-acetamido-3-(4-hydroxyphenyl)propanoic acid | 3824.9 | |
53760-27-3 | 4,4'-Diaminodiphenylamine monosulfate | 4-N-(4-aminophenyl)benzene-1,4-diamine;sulfuric acid | 2935 | |
53770-52-8 | Zinc 3,5-bis(α-methylbenzyl)salicylate | 3809.92 | ||
537-98-4 | Ferulic Acid | (E)-3-(4-hydroxy-3-methoxyphenyl)prop-2-enoic acid | 2918.99 | |
53802-03-2 | Solvent red 109 | 3204.19 | ||
538-23-8 | Glyceryl Tricaprylate | 2,3-di(octanoyloxy)propyl octanoate | 2915.9 | |
538-24-9 | Trilaurin | 2,3-Di(dodecanoyloxy)propyl dodecanoate | 3404.9 | |
53834-70-1 | Fragrance of (E)-3,7-dimethylocta-1,5,7-trien-3-ol | 3302.1 | ||
53-84-9 | Nadide | 1-[(2R,3R,4S,5R)-5-{[({[(2R,3S,4R,5R)-5-(6-amino-9H-purin-9-yl)-3,4-dihydroxyoxolan-2-yl]methoxy}(hydroxy)phosphoryl phosphono)oxy]methyl}-3,4-dihydroxyoxolan-2-yl]-3-carbamoyl-1lambda5-pyridin-1-ylium | 2934.99 | |
53850-34-3 | Thaumatin | 3504 | ||
53-86-1 | Indomethacin | 2-[1-(4-chlorobenzoyl)-5-methoxy-2-methylindol-3-yl]acetic acid | 2933.99 | 6 |
538-62-5 | Diphenylcarbazone | 1-anilino-3-phenyliminourea | 2928 | |
538-75-0 | Dicyclohexylcarbodiimide | N,N'-dicyclohexylmethanediimine | 2925.29 | |
53879-54-2 | Propylidynetrimethanol, propoxylated, esters with acrylic acid | Propylidynetrimethanol, propoxylated, esters with acrylic acid | 2916.12 | |
53880-86-7 | Dimethyldiphenylthioperoxydicarbamic acid | Dimethyldiphenylthioperoxydicarbamic acid | ||
53885-35-1 | Ticlopidine Hydrochloride | 5-[(2-chlorophenyl)methyl]-6,7-dihydro-4H-thieno[3,2-c]pyridine;hydrochloride | 2934.99 | 6 |
53894-23-8 | Tri isononyl trimellitate | 3812.3 | ||
5390-04-5 | Pent-4-yn-1-ol | Pent-4-yn-1-ol | 2905.29 | |
539-03-7 | P-Chloroacetanilide | N-(4-chlorophenyl)acetamide | 2933.99 | |
53916-94-2 | Phenethylammonium bromide | 2-phenylethanamine;hydrobromide | 2827.51 | |
5392-40-5 | Citral, mixture of cis and trans | (2E)-3,7-dimethylocta-2,6-dienal | ||
53936-56-4 | Deoxyarbutin | 4-(oxan-2-yloxy)phenol | 2938.9 | |
53956-04-0 | Glycyrrhizic Acid ; Fragrance of ammonium glycyrrhizinate trihydrate | Ammonium glycyrrhizate | ||
53980-88-4 | Cyclocarboxypropyloleic acid | 5-(7-carboxyheptyl)-2-hexylcyclohex-3-ene-1-carboxylic acid | ||
539-82-2 | Ethyl Valerate | Ethyl pentanoate | 2915.6 | |
5398-34-5 | Sodium 8-amino-6-sulfonaphthalene-1,3-disulfonate | Disodium 8-amino-6-sulfonaphthalene-1,3-disulfonate | 2921.45 | |
53988-10-6 | 4-Methyl-1H-benzimidazole-2-thiol | 4-methyl-1,3-dihydrobenzimidazole-2-thione | ||
53988-60-6 | Aminoxide WS 35 | 3402.19 | ||
539-88-8 | Ethyl Levulinate ; Fragrance of ethyl levulinate | Ethyl 4-oxovalerate | ||
53994-73-3 | Cefaclor | (6R,7R)-7-[[(2R)-2-amino-2-phenylacetyl]amino]-3-chloro-8-oxo-5-thia-1-azabicyclo[4.2.0]oct-2-ene-2-carboxylic acid | 2941.9 | 6 |
540-10-3 | Cetyl palmitate | Hexadecyl hexadecanoate | 2915.7 | |
54010-71-8 | D-Glucose, 6-(dihydrogen phosphate), monosodium salt | Sodium [(2R,3R,4S,5R)-2,3,4,5-tetrahydroxy-6-oxohexyl] hydrogen phosphate | 2940 | |
540-23-8 | P-Toluidine hydrochloride | 4-Methylaniline hydrochloride | 2921.43 | |
54024-22-5 | Desogestrel | (8S,9S,10R,13S,14S,17R)-13-ethyl-17-ethynyl-11-methylidene-1,2,3,6,7,8,9,10,12,14,15,16-dodecahydrocyclopenta[a]phenanthren-17-ol | 2937.23 | 6 |
54052-90-3 | 2,2,3,4,4,4-Hexafluorobutyl acrylate | 2,2,3,4,4,4-hexafluorobutyl prop-2-enoate | 2916.12 | |
5405-41-4 | Ethyl 3-hydroxybutyrate | Ethyl 3-hydroxybutanoate | 2915.6 | |
54060-92-3 | Basic yellow 28 | 3204.13 | ||
540-63-6 | 1,2-Ethanedithiol | Ethane-1,2-dithiol | 2930.9 | |
540-69-2 | Ammonium Formate | Azanium formate | 2915.12 | |
540-72-7 | Sodium rhodanide | Sodium thiocyanate | ||
540-80-7 | Tert-butyl nitrite | Tert-butyl nitrite | 2920.9 | |
540-84-1 | 2,2,4-Trimethylpentane | 2,2,4-Trimethylpentane | ||
5408-75-7 | Pigment yellow 14 | 3204.17 | ||
541-02-6 | Cyclopentasiloxane | 2,2,4,4,6-pentamethyl-1,3,5,7,9,2,4,6,8,10-pentaoxapentasilecane | 3402.19 | |
541-09-3 | Bis(acetato-O)dioxouranium | Acetic Acid; Dioxouranium | 2844.3 | 5 |
54112-23-1 | N,N'-(methylenedi-p-phenylene)bis[hexahydro-2-oxo-1H-azepine-1-carboxamide] | 2-oxo-N-[4-[[4-[(2-oxoazepane-1-carbonyl)amino]phenyl]methyl]phenyl]azepane-1-carboxamide | ||
54-11-5 | Nicotine | 3-[(2S)-1-methylpyrrolidin-2-yl]pyridine | 2939.99 | 3 |
541-15-1 | Levocarnitine | (3R)-3-hydroxy-4-(trimethylazaniumyl)butanoate | 2923.9 | |
54-12-6 | DL-tryptophan | 2-amino-3-(1H-indol-3-yl)propanoic acid | 2933.99 | |
5413-60-5 | Verdyl Acetate | 3a,4,5,6,7,7a-hexahydro-4,7-methanoinden-6-yl acetate | 2915.39 | |
5413-75-2 | Acid red 73 | Sodium 6-hydroxy-5-(4-phenylazophenylazo)naphthalene-2,4-disulfonate | 3204.12 | |
541-41-3 | Ethyl Chloroformate | Ethyl carbonochloridate | 2915.9 | 3 |
541-47-9 | 3-Methyl crotonic acid | 3-methylbut-2-enoic acid | 2916.19 | |
541-59-3 | Maleimide | Pyrrole-2,5-dione | 2925.19 | |
54182-58-0 | Sucralfate | [({[(2R,3R,4S,5R,6R)-2-{[(2S,3S,4R,5R)-3,4-bis({[(dihydroxyalumanyl)oxy]sulfonyl}oxy)-2,5-bis[({[(dihydroxyalumanyl)oxy]sulfonyl}oxy)methyl]oxolan-2-yl]oxy}-4,5-bis({[(dihydroxyalumanyl)oxy]sulfonyl}oxy)-6-[({[(dihydroxyalumanyl)oxy]sulfonyl}oxy)methyl]ox | 2940 | 6 |
5418-63-3 | 1,2,3,3-Tetramethyl-3H-indolium iodide | 1,2,3,3-tetramethylindol-1-ium iodide | 2933.99 | |
541-88-8 | Chloroacetic Anhydride | (2-chloroacetyl) 2-chloroacetate | 2915.9 | |
5419-55-6 | Isopropyl Borate | Tripropan-2-yl borate | 2920.9 | |
542-02-9 | Acetoguanamine | 6-methyl-1,3,5-triazine-2,4-diamine | 2933.69 | |
5421-46-5 | Ammonium thioglycolate | |||
542-16-5 | Dianilinium sulphate | Bis(anilinium) sulfate | 2921.41 | |
54-21-7 | Sodium salicylate | Sodium 2-hydroxybenzoate | 2918.21 | |
542-40-5 | Norbixin | (2E,4E,6E,8E,10E,12E,14E,16E,18E)-4,8,13,17-tetramethylicosa-2,4,6,8,10,12,14,16,18-nonaenedioic acid | 3203 | |
542-42-7 | Calcium palmitate | Calcium hexadecanoate | 2915.7 | |
54261-98-2 | Lupeose | (2S,3R,4S,5R,6R)-2-[[(2R,3R,4S,5R,6S)-6-[[(2R,3S,4S,5R,6R)-6-[(2S,3S,4S,5R)-3,4-dihydroxy-2,5-bis(hydroxymethyl)oxolan-2-yl]oxy-3,4,5-trihydroxyoxan-2-yl]methoxy]-3,4,5-trihydroxyoxan-2-yl]methoxy]-6-(hydroxymethyl)oxane-3,4,5-triol hydrate | 2940 | |
542-69-8 | Butyl Iodide | 1-iodobutane | 2903.39 | |
54-28-4 | Gamma-Tocopherol | (2R)-2,7,8-trimethyl-2-[(4R,8R)-4,8,12-trimethyltridecyl]-3,4-dihydrochromen-6-ol | 2936.28 | |
54301-26-7 | Undecylenoyl Glycine | 2-(undec-10-enoylamino)acetic acid | 2909.49 | |
54-31-9 | Furosemide | 4-chloro-2-(furan-2-ylmethylamino)-5-sulfamoylbenzoic acid | 2935 | 6 |
543-49-7 | 2-Heptanol | Heptan-2-ol | 2905.19 | |
54351-85-8 | Fluorescent Brightener 351 | 3204.2 | ||
543-80-6 | Barium acetate | Barium(2+) diacetate | 2915.29 | |
54381-16-7 | N,N-Bis(2-hydroxyethyl)-P-phenylenediamine sulfate | 2-[4-amino-N-(2-hydroxyethyl)anilino]ethanol;sulfuric acid | 2921.51 | |
543-82-8 | Octodrine | 6-methylheptan-2-amine | 2921.19 | |
543-90-8 | Cadmium Acetate | Cadmium(2+) diacetate | 2915.29 | |
54392-26-6 | Sorbitan, monoisooctadecanoate | [(1R)-1-[(2S,3R,4S)-3,4-dihydroxyoxolan-2-yl]-2-hydroxyethyl] 16-methylheptadecanoate | 3824.6 | |
54392-28-8 | Polyoxyethylene sorbitan triisostearate | 3402.13 | ||
543-94-2 | Strontium acetate | Strontium diacetate | 2915.29 | |
544-17-2 | Calcium Formate | Calcium diformate | 2915.12 | |
544-40-1 | Dibutyl Sulfide | 1-butylsulfanylbutane | 2930.9 | |
5444-75-7 | 2-Ethylhexyl benzoate | 2-Ethylhexyl benzoate | 2916.13 | |
54451-24-0 | Lanthanum carbonate | Lanthanum(3+) tricarbonate | 2846.9 | |
54451-25-1 | Cerium(III) carbonate hydrate | Cerium(3+) tricarbonate | 2846.1 | |
54453-03-1 | Cupric Monoedetate | Copper 2-[2-[bis(carboxylatomethyl)amino]ethyl-(carboxylatomethyl)amino]acetate;hydron | 2922.49 | |
544-62-7 | Batilol | 3-octadecoxypropane-1,2-diol | 2909.49 | |
544-63-8 | Myristic Acid | Tetradecanoic acid | 2915.9 | |
54464-57-2 | Isocyclemone E | 1-(2,3,8,8-tetramethyl-1,3,4,5,6,7-hexahydronaphthalen-2-yl)ethanone | 2914.29 | |
544-76-3 | Hexadecane | Hexadecane | 2901.1 | |
544-92-3 | Copper (I) cyanide | Copper(1+);cyanide | 2837.19 | 8 |
544-97-8 | Dimethylzinc | Zinc carbanide | 2931.9 | |
5451-09-2 | Aminolevulinic Acid Hydrochloride | 5-amino-4-oxopentanoic acid;hydrochloride | 2922.5 | |
545-47-1 | Lupeol | (1R,3aR,5aR,5bR,7aR,9S,11aR,11bR,13aR,13bR)-3a,5a,5b,8,8,11a-hexamethyl-1-prop-1-en-2-yl-1,2,3,4,5,6,7,7a,9,10,11,11b,12,13,13a,13b-hexadecahydrocyclopenta[a]chrysen-9-ol | 2906.19 | |
54549-24-5 | Hexyl D-glucoside ; Alkyl polyglucoside surfactant | Hexyl D-glucopyranoside | 3402.9 | |
54549-25-6 | Decyl D-glucoside | Decyl D-glucopyranoside | 3402.9 | |
54553-90-1 | 2-Phenyl-2-imidazoline pyromellitate | 4,5-dihydro-2-phenyl-1H-imidazole-1,2,4,5-benzene tetracarboxylate | 2933.99 | |
54553-91-2 | Pyromellitic acid di(2-phenyl-2-imidazoline) salt | Benzene-1,2,4,5-tetracarboxylic acid 2-phenyl-4,5-dihydro-1H-imidazole | ||
54571-67-4 | Monosodium 5-oxoproline | Sodium5-oxopyrrolidine-2-carboxylate | 2933.79 | |
5460-09-3 | Sodium 4-amino-5-hydroxy-7-sulfonaphthalene-2-sulfonate | Sodium 4-amino-5-hydroxy-7-sulfonaphthalene-2-sulfonate | 2922.21 | |
54617-29-7 | Palmitoyl isoleucine | (2S,3S)-2-(hexadecanoylamino)-3-methylpentanoic acid | 2922.49 | |
5462-06-6 | 3-(4-Methoxyphenyl)-2-methylpropanal | 3-(4-methoxyphenyl)-2-methylpropanal | 2912.49 | |
546-46-3 | Zinc citrate | Trizinc 2-hydroxypropane-1,2,3-tricarboxylate | 2918.15 | |
54-64-8 | Thimerosal | Sodium (2-carboxylatophenyl)sulfanyl-ethylmercury | ||
5466-77-3 | Octinoxate | 2-Ethylhexyl 3-(4-methoxyphenyl)prop-2-enoate | ||
546-67-8 | Lead Tetraacetate | Lead Tetraacetate | 2915.29 | |
546-68-9 | Titanium Tetraisopropoxide | Propan-2-olate titanium(4+) | ||
54678-23-8 | Bromo(Thiobis(Methane))Copper | Bromocopper methylsulfanylmethane | 2930.9 | |
546-79-2 | 4-Thujanol | 4-Methyl-1-propan-2-ylbicyclo[3.1.0]hexan-4-ol | 2906.19 | |
54686-97-4 | Di-p-methylbenzylidenesorbitol | (1R)-1-[(4R,4aR,8aS)-2,6-bis(4-methylphenyl)-4,4a,8,8a-tetrahydro-[1,3]dioxino[5,4-d][1,3]dioxin-4-yl]ethane-1,2-diol | 2905.49 | |
5468-75-7 | Pigment yellow 14 | 2,2'-[(3,3'-dichlorobiphenyl-4,4'-diyl)diazo-2,1-diyl]bis[N-(2-methylphenyl)-3-oxobutanamide] | 3210 | |
546-89-4 | Lithium Acetate | Lithium acetate | 2915.29 | |
546-93-0 | Magnesium carbonate | Magnesium carbonate | ||
5470-11-1 | Hydroxylamine hydrochloride | Hydroxylamine;hydrochloride | 2825.1 | |
5470-96-2 | Quinoline-2-carbaldehyde | Quinoline-2-carbaldehyde | 2933.49 | |
5471-51-2 | 4-(P-Hydroxyphenyl)-2-butanone | 4-(4-hydroxyphenyl)butan-2-one | 2914.5 | |
547-32-0 | Sulfadiazine Sodium | Sodium (4-aminophenyl)sulfonyl-pyrimidin-2-ylazanide | 2935 | 6 |
547-58-0 | Methyl orange ; Acid orange 52 ; C.I. 13025 | Sodium 4-[[4-(dimethylamino)phenyl]diazenyl]benzenesulfonate | ||
547-63-7 | Methyl Isobutyrate | Methyl 2-methylpropanoate | 2915.6 | |
54814-64-1 | Massoia Lactone | 2-Pentyl-2,3-dihydropyran-6-one | 2932.2 | |
548-24-3 | Acid red 91 ; C.I. 45400 | 4',5'-dibromo-3',6'-dihydroxy-2',7'-dinitro-3H-spiro[2-benzofuran-1,9'-xanthen]-3-one, sodium salt (1:2) | 3212.9 | |
54827-17-7 | 3,3',5,5'-Tetramethylbenzidine | 4-(4-amino-3,5-dimethylphenyl)-2,6-dimethylaniline | ||
548472-68-0 | Nutlin-3 | 4-[4,5-bis(4-chlorophenyl)-2-(4-methoxy-2-propan-2-yloxyphenyl)-4,5-dihydroimidazole-1-carbonyl]piperazin-2-one | 2933.39 | |
54-85-3 | Isoniazid | Pyridine-4-carbohydrazide | 6 | |
54856-23-4 | Betahistine Mesilate | Methanesulfonic acid N-methyl-2-pyridin-2-ylethanamine | 2933.99 | 6 |
548-62-9 | Gentian violet ; Basic Violet 3 ; Methylrosanilinium chloride | N-(4-{bis[4-(dimethylamino)phenyl]methylidene}cyclohexa-2,5-dien-1-ylidene)-N-methylmethanaminium chloride | 6 | |
548-73-2 | Droperidol | 3-[1-[4-(4-fluorophenyl)-4-oxobutyl]-3,6-dihydro-2H-pyridin-4-yl]-1H-benzimidazol-2-one | 2933.39 | 6 |
54897-59-5 | Diaminopropionic Acid | 2,3-diaminopropanoic acid hydrochloride | 2922.49 | |
5489-77-0 | Direct violet 51 | 3204.17 | ||
5490-27-7 | Dihydrostreptomycin Sulfate | 2-[3-(diaminomethylideneamino)-4-[3-[4,5-dihydroxy-6-(hydroxymethyl)-3-(methylamino)oxan-2-yl]oxy-4-hydroxy-4-(hydroxymethyl)-5-methyloxolan-2-yl]oxy-2,5,6-trihydroxycyclohexyl]guanidine sulfuric acid | 2941.2 | 6 |
54914-37-3 | Isophorone diamine isobutyraldimine | 2-Methyl-N-[[1,3,3-trimethyl-5-(2-methylpropylideneamino)cyclohexyl]methyl]propan-1-imine | 2925.29 | |
54914-85-1 | 1,2-bis(3-methylphenoxy)ethane | 1,1'-[ethane-1,2-diylbis(oxy)]bis(3-methylbenzene) | 3809.92 | |
549-18-8 | Amitriptyline Hydrochloride | 3-(5,6-dihydrodibenzo[2,1-b:2',1'-f][7]annulen-11-ylidene)-N,N-dimethylpropan-1-amine;hydrochloride | 2921.49 | |
54925-64-3 | N-Tert-Butyldimethylsilylimidazole | Tert-butyl-imidazol-1-yl-dimethylsilane | 2932.99 | |
54947-74-9 | 4-Methyloctanoic acid | 4-Methyloctanoic acid | 2915.9 | |
5495-84-1 | 2-Isopropylthioxanthone | 2-Propan-2-ylthioxanthen-9-one | 2934.99 | |
54965-21-8 | Albendazole | Methyl N-(6-propylsulfanyl-1H-benzimidazol-2-yl)carbamate | 2933.99 | 6 |
54-96-6 | Amifampridine | Pyridine-3,4-diamine | 2933.39 | 6 |
55008-57-6 | 2-(Dimethylamino)ethyl methacrylate N-vinylpyrrolidone polymer dimethyl sulfate salt | 3402.12 | ||
55028-72-3 | Cloprostenol Sodium | Sodium (Z)-7-[(1R,2R,3R,5S)-2-[(E,3R)-4-(3-chlorophenoxy)-3-hydroxybut-1-enyl]-3,5-dihydroxycyclopentyl]hept-5-enoate | 2918.99 | 6 |
55-03-8 | Levothyroxine Sodium | Sodium (2S)-2-amino-3-[4-(4-hydroxy-3,5-diiodophenoxy)-3,5-diiodophenyl]propanoate | 2937.9 | 6 |
55066-49-4 | 3-Methyl-5-phenylpentanal | 3-Methyl-5-phenylpentanal | 2912.29 | |
55069-42-6 | 2,2,4-trimethyl-1,2-dihydroquinoline | 3812.3 | ||
55073-41-1 | Glycerol phosphate disodium salt hydrate | 2919.9 | ||
5508-58-7 | Andrographolide | (3E,4S)-3-[2-[(1R,4aS,5R,6R,8aS)-6-hydroxy-5-(hydroxymethyl)-5,8a-dimethyl-2-methylidene-3,4,4a,6,7,8-hexahydro-1H-naphthalen-1-yl]ethylidene]-4-hydroxyoxolan-2-one | 2932.2 | |
550-99-2 | Naphazoline Hydrochloride | 2-(naphthalen-1-ylmethyl)-4,5-dihydro-1H-imidazole;hydrochloride | 2933.29 | 6 |
55-10-7 | Vanillylmandelic Acid | 2-hydroxy-2-(4-hydroxy-3-methoxyphenyl)acetic acid | 2918.99 | |
551-08-6 | 3-butylidene phthalide | 3-butylidene-2-benzofuran-1-one | 2932.2 | |
55154-30-8 | AH-7921 | 3,4-dichloro-N-[[1-(dimethylamino)cyclohexyl]methyl]benzamide | 2924.29 | 7 |
551-68-8 | D-Psicose | (3R,4R,5R)-1,3,4,5,6-pentahydroxyhexan-2-one | 2940 | |
55172-29-7 | Thallous chloride | Chlorothallium-201 | 2844.4 | 5 |
551-84-8 | D-Xylulose | (3S,4R)-1,3,4,5-tetrahydroxypentan-2-one | 2940 | |
55-18-5 | N-Nitrosodiethylamine | N,N-diethylnitrous amide | 2929.9 | |
551-93-9 | 2'-Aminoacetophenone | 1-(2-aminophenyl)ethanone | 2922.39 | |
55-21-0 | Benzamide | Benzamide | 2924.29 | |
5521-31-3 | Pigment red 179 | Anthra[2,1,9-def:6,5,10-d'e'f']diisoquinoline-1,3,8,10(2H,9H)-tetrone, 2,9-dimethyl- | 3204.17 | |
55-22-1 | Isonicotinic Acid | Pyridine-4-carboxylic acid | 2933.39 | |
5522-43-0 | 1-Nitropyrene | 1-Nitropyrene | 2904.2 | |
5522-63-4 | Coproporphyrin III Tetramethyl Ester | Methyl 3-[8,13,18-tris(3-methoxy-3-oxopropyl)-3,7,12,17-tetramethyl-21,24-dihydroporphyrin-2-yl]propanoate | 2933.99 | |
5522-66-7 | Protoporphyrin Dimethyl Ester | Methyl 3-[8,13-bis(ethenyl)-18-(3-methoxy-3-oxopropyl)-3,7,12,17-tetramethyl-22,23-dihydroporphyrin-2-yl]propanoate | 2933.99 | |
552-30-7 | Trimellitic Anhydride | 1,3-dioxo-2-benzofuran-5-carboxylic acid | 3 | |
55257-88-0 | 1-Decylpyrrolidin-2-one | 1-Decylpyrrolidin-2-one | 2933.79 | |
552-58-9 | Eriodictyol | (2S)-2-(3,4-dihydroxyphenyl)-5,7-dihydroxy-2,3-dihydrochromen-4-one | 2932.99 | |
55266-18-7 | Manganese (III) Tetrakis (4-Benzoic Acid) Porphyrin chloride | 4-[10,15-bis(4-carboxylatophenyl)-20-(4-carboxyphenyl)-21,24-dihydroporphyrin-5-yl]benzoate;manganese(3+);hydrochloride | 3507.9 | |
552-66-9 | Daidzin | 3-(4-hydroxyphenyl)-7-[(2S,3R,4S,5S,6R)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxychromen-4-one | 2938.9 | |
55268-74-1 | Praziquantel | 2-(cyclohexanecarbonyl)-3,6,7,11b-tetrahydro-1H-pyrazino[2,1-a]isoquinolin-4-one | 2933.59 | 6 |
55285-14-8 | Carbosulfan | (2,2-dimethyl-3H-1-benzofuran-7-yl) N-(dibutylamino)sulfanyl-N-methylcarbamate | 2932.99 | 8 |
552-89-6 | 2-Nitrobenzaldehyde | 2-Nitrobenzaldehyde | 2913 | |
55297-95-5 | Tiamulin | 2941.9 | 6 | |
55297-96-6 | Tiamulin Fumarate | 2941.9 | 6 | |
55302-96-0 | 5-(2-Hydroxyethylamino)-2-methylphenol | 5-(2-hydroxyethylamino)-2-methylphenol | 2922.5 | |
553-24-2 | Basic red 5 : C.I. 50040 | N8,N8,3-trimethylphenazine-2,8-diamine hydrochloride | 3204.13 | |
553-26-4 | 4,4'-Bipyridine | 4-pyridin-4-ylpyridine | 2933.39 | |
5534-09-8 | Beclomethasone Dipropionate | [2-[(8S,9R,10S,11S,13S,14S,16S,17R)-9-chloro-11-hydroxy-10,13,16-trimethyl-3-oxo-17-propanoyloxy-6,7,8,11,12,14,15,16-octahydrocyclopenta[a]phenanthren-17-yl]-2-oxoethyl] propanoate | 2937.9 | 6 |
553664-68-9 | Reaction products of epichlorohydrin, 2-mercaptoethanol, sodium sulfide and thiourea | 2930.9 | ||
55406-53-6 | Iodopropynyl Butylcarbamate | 3-iodoprop-2-ynyl N-butylcarbamate | ||
554-12-1 | Methyl Propionate | Methyl Propionate | 2915.5 | 3 |
554-13-2 | Lithium carbonate | Dilithium;carbonate | 2836.91 | |
554-14-3 | 2-Methylthiophene | 2-Methylthiophene | 2934.99 | |
5541-93-5 | Trisodium Phosphoenolpyruvate | Trisodium 2-phosphonatooxyprop-2-enoate | 2919.9 | |
554-62-1 | Phytosphingosine | (2S,3S,4R)-2-Aminooctadecane-1,3,4-triol | 2922.19 | |
55466-22-3 | Mutanolysin | 3507.9 | ||
554-68-7 | Triethylamine Hydrochloride | N,N-diethylethanamine;hydrochloride | 2921.19 | |
554-95-0 | 1,3,5-Benzenetricarboxylic acid | Benzene-1,3,5-tricarboxylic acid | 2917.39 | |
5550-12-9 | Disodium 5'-guanylate | Disodium[(2R,3S,4R,5R)-5-(2-amino-6-oxo-3H-purin-9-yl)-3,4-dihydroxyoxolan-2-yl]methyl phosphate | 2934.99 | |
555-16-8 | 4-Nitrobenzaldehyde | 4-Nitrobenzaldehyde | 2913 | |
555-30-6 | Methyldopa | H-aMeTyr(3-OH)-OH | 2922.5 | 6 |
555-31-7 | Aluminum Isopropoxide | Aluminum propan-2-olate | 2905.19 | 3 |
555-43-1 | Glyceryl Tristearate | 2,3-di(octadecanoyloxy)propyl octadecanoate | 2916.39 | |
555-44-2 | Tripalmitin | 2,3-di(hexadecanoyloxy)propyl hexadecanoate | 2915.7 | 6 |
55-55-0 | Bis(4-hydroxy-N-methylanilinium) sulphate | Bis(4-hydroxy-N-methylanilinium) sulphate | 2922.29 | |
55-56-1 | Chlorhexidine | (1E)-2-[6-[[amino-[(E)-[amino-(4-chloroanilino)methylidene]amino]methylidene]amino]hexyl]-1-[amino-(4-chloroanilino)methylidene]guanidine | 2925.29 | 6 |
55566-30-8 | Tetrakis(Hydroxymethyl)Phosphonium Sulfate | Tetrakis(Hydroxymethyl)Phosphonium Sulfate | 2931.9 | |
555-66-8 | Shogaol | (E)-1-(4-hydroxy-3-methoxyphenyl)dec-4-en-3-one | 2914.5 | |
555-75-9 | Aluminum Ethanolate | Aluminum Ethanolate | 2931.9 | |
55585-28-9 | Fluorescent brightener 353 | 3204.2 | ||
55589-62-3 | Acesulfame Potassium | Potassium 6-methyl-2,2-dioxo-1-oxa-2$l^{6}-thia-3-azanidacyclohex-5-en-4-one | 2934.99 | |
5560-59-8 | Alverine citrate | N-ethyl-3-phenyl-N-(3-phenylpropyl)propan-1-amine;2-hydroxypropane-1,2,3-tricarboxylic acid | 2921.49 | 6 |
55643-30-6 | Pentazocine | (2R*,6R*,11R*)-1,2,3,4,5,6-hexahydro-6,11-dimethyl-3- (3-methyl-2-butenyl)-2,6-methano-3-benzazocin-8-ol | 2933.33 | 9 |
556-50-3 | Diglycine | 2-[(2-Aminoacetyl)amino]acetic acid | 2924.19 | |
556-67-2 | Octamethyl cyclotetrasiloxane | Octamethylcyclotetrasiloxane | ||
5567-15-7 | Pigment yellow 83 | 2,2'-[(3,3'-dichlorobiphenyl-4,4'-diyl)bis(azo)]bis[N-(4-chloro-2,5-dimethoxyphenyl)-3-oxobutyramide] | 3206.2 | |
556-96-7 | 1-Bromo-3,5-dimethylbenzene | 1-Bromo-3,5-dimethylbenzene | 2903.99 | |
557-04-0. | Magnesium stearate | Magnesium;octadecanoate | ||
557-05-1 | Zince disterate | Zinc;octadecanoate | ||
557-08-4 | Zinc Undecylenate | Zinc undec-10-enoate | 2916.19 | |
55721-31-8 | Coxistal | Sodium 2-[6-[6-[3-(5-ethyl-5-hydroxy-6-methyloxan-2-yl)-15-hydroxy-3,10,12-trimethyl-4,6,8-trioxadispiro[4.1.5^{7}.3^{5}]pentadec-13-en-9-yl]-3-hydroxy-4-methyl-5-oxooctan-2-yl]-5-methyloxan-2-yl]butanoate | 2941.9 | |
557-34-6 | Zinc Acetate | Zinc diacetate | ||
557-48-2 | Trans-2,cis-6-Nonadienal | (2E,6Z)-Nona-2,6-dienal | 2912.19 | |
5574-97-0 | Tetrabutylammonium Dihydrogen Phosphate | Dihydrogen phosphate tetrabutylazanium | 2923.9 | |
55750-53-3 | 6-Maleimidocaproic acid | 6-(2,5-dioxopyrrol-1-yl)hexanoic acid | 2928 | |
5575-48-4 | Decyltrimethoxysilane | Decyl(trimethoxy)silane | 2931.9 | |
557-59-5 | Lignoceric Acid | Tetracosanoic acid | 2915.9 | |
557-61-9 | Octacosanol | Octacosan-1-ol | 3824.9 | |
557-66-4 | Ethylamine Hydrochloride | Ethanamine hydrochloride | 2921.19 | |
5579-81-7 | Aldioxa | {2-[(dihydroxyalumanyl)oxy]-5-oxo-4,5-dihydro-1H-imidazol-4-yl}urea | 2933.29 | |
5579-84-0 | Betahistine Hydrochloride | N-methyl-2-pyridin-2-ylethanamine;dihydrochloride | 2933.39 | 6 |
5580-57-4 | Pigment yellow 93 | 3,3'-[(2-Chloro-5-methyl-1,4-phenylene)bis[imino(1-acetyl-2-oxoethylene)azo]]bis[4-chloro-N-(3-chloro-2-methylphenyl)benzamide] | 3204.17 | |
558-13-4 | Tetrabromomethane | Tetrabromomethane | 2903.39 | |
55818-57-0 | Epoxy Resin | 2-(chloromethyl)oxirane;4-[2-(4-hydroxyphenyl)propan-2-yl]phenol;prop-2-enoic acid | 2916.12 | |
558-37-2 | 3,3-Dimethyl-1-butene | 3,3-Dimethylbut-1-ene | 2901.29 | |
55840-13-6 | 1,2,3-Propanetricarboxylic acid, 2-hydroxy-, ester with 1,2,3-propanetriol monooctadecanoate | |||
5588-84-1 | Vanadium(V) oxytriisopropoxide | Oxovanadium propan-2-ol | 2905.19 | |
55901-03-6 | Polyoxyethylene Styrenated Aryl Ether | 3402.13 | ||
5590-18-1 | Pigment yellow 110 | 3204.17 | ||
5593-20-4 | Betamethasone 17,21-dipropionate | [2-[(8S,10S,11S,13S,14S,16S,17R)-9-fluoro-11-hydroxy-10,13,16-trimethyl-3-oxo-17-propanoyloxy-6,7,8,11,12,14,15,16-octahydrocyclopenta[a]phenanthren-17-yl]-2-oxoethyl] propanoate | 2937.22 | |
5593-70-4 | Tetrabutoxytitanium | Butan-1-ol titanium | ||
55963-33-2 | Distarch phosphate | 3505.1 | ||
55963-78-5 | Sodium polyanetholesulfonate | Sodium 1-methoxy-4-[(E)-prop-1-enyl]benzene sulfite | 2903.39 | |
55965-13-4 | Ammonium phosphatides | 2923.2 | ||
55-97-0 | Hexamethonium Bromide | Trimethyl-[6-(trimethylazaniumyl)hexyl]azanium;dibromide | 2923.9 | |
55981-09-4 | Nitazoxanide | [2-[(5-nitro-1,3-thiazol-2-yl)carbamoyl]phenyl] acetate | 2934.1 | 6 |
56002-14-3 | Poly(oxy-1,2-ethanediyl), α-(1-oxoisooctadecyl)-ω-hydroxy- / PEG-10 Isostearate | 3402.13 | ||
5601-29-6 | Acid yellow 59 | Hydrogen bis[2-{[3-methyl-5-(oxo-κO)-1-phenyl-4,5-dihydro-1H-pyrazol-4-yl]azo-κN1}benzoato(2-)-κO]chromate(1-) | 3204.9 | |
56026-36-9 | Methyl 6-(hydroxymethyl)nicotinate | Methyl 6-(hydroxymethyl)pyridine-3-carboxylate | 2933.39 | |
56030-54-7 | Sufentanil | N-[4-(methoxymethyl)-1-[2-(2-thienyl)ethyl]-4-piperidyl]propionanilide | 2934.91 | 7 |
56038-13-2 | Sucralose | (2R,3R,4R,5R,6R)-2-[(2R,3S,4S,5S)-2,5-bis(chloromethyl)-3,4-dihydroxyoxolan-2-yl]oxy-5-chloro-6-(hydroxymethyl)oxane-3,4-diol | ||
56092-81-0 | Ionomycin | (4R,6S,8S,10Z,12R,14R,16E,18R,19R,20S,21S)-11,19,21-trihydroxy-22-[(2S,5S)-5-[(2R,5S)-5-[(1R)-1-hydroxyethyl]-5-methyloxolan-2-yl]-5-methyloxolan-2-yl]-4,6,8,12,14,18,20-heptamethyl-9-oxodocosa-10,16-dienoic acid | 2932.99 | |
56096-89-0 | 4-Fluoro-2-iodobenzoic acid | 4-Fluoro-2-iodobenzoic acid | 2916.39 | |
56-12-2 | Gamma-Aminobutyric acid | 4-Aminobutanoic acid | 2922.49 | |
561-27-3 | Heroin | diacetylmorphine (derivative of morphine) | 2939.11 | 7 |
56-17-7 | Cystamine Dihydrochloride | 2-(2-Aminoethyldisulfanyl)ethanamine;dihydrochloride | 2930.9 | |
56180-94-0 | Acarbose | (3R,4R,5S,6R)-5-[(2R,3R,4R,5S,6R)-5-[(2R,3R,4S,5S,6R)-3,4-dihydroxy-6-methyl-5-[[(1S,4R,5S,6S)-4,5,6-trihydroxy-3-(hydroxymethyl)cyclohex-2-en-1-yl]amino]oxan-2-yl]oxy-3,4-dihydroxy-6-(hydroxymethyl)oxan-2-yl]oxy-6-(hydroxymethyl)oxane-2,3,4-triol | 2940 | |
56189-09-4 | Lead Octadecanoate | Lead Octadecanoate | ||
56196-53-3 | Ethyl 4-methyloctanoate | Ethyl 4-methyloctanoate | 2915.9 | |
562043-82-7 | L-Ascorbic acid 2-glucoside | (2R)-2-[(1S)-1,2-dihydroxyethyl]-3-hydroxy-4-[(2S,3R,4S,5S,6R)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxy-2H-furan-5-one | 2936.27 | |
562-09-4 | Chlorphenoxamine Hydrochloride | 2-[1-(4-chlorophenyl)-1-phenylethoxy]-N,N-dimethylethanamine;hydrochloride | 2922.19 | 6 |
562-10-7 | Doxylamine Succinate | Butanedioic acid N,N-dimethyl-2-(1-phenyl-1-pyridin-2-ylethoxy)ethanamine | 2933.29 | |
56216-28-5 | 2,6-Dimethoxypyridine-3,5-diamine hydrochloride | 2,6-dimethoxypyridine-3,5-diamine;hydrochloride | 2933.39 | |
56238-63-2 | Cefuroxime Sodium | Sodium (6R,7R)-3-(carbamoyloxymethyl)-7-[[(2Z)-2-(furan-2-yl)-2-methoxyiminoacetyl]amino]-8-oxo-5-thia-1-azabicyclo[4.2.0]oct-2-ene-2-carboxylate | 2941.9 | 6 |
562-46-9 | 4,4-Dimethylcyclohexane-1,3-dione | 4,4-dimethylcyclohexane-1,3-dione | 2914.29 | |
5625-37-6 | 1,4-Piperazinediethanesulfonic acid | 2-[4-(2-sulfoethyl)piperazin-1-yl]ethanesulfonic acid | 2933.59 | |
5625-90-1 | Dimorpholinomethane | 4-(morpholin-4-ylmethyl)morpholine | 2934.99 | |
56265-06-6 | Arginine Pidolate | (2S)-2-amino-5-(diaminomethylideneamino)pentanoic acid;(2S)-5-oxopyrrolidine-2-carboxylic acid | 2933.79 | |
562-74-3 | 4-Carvomenthenol | 4-methyl-1-propan-2-ylcyclohex-3-en-1-ol | 2906.19 | |
56274-75-0 | Stearic acid, ester with pentaerythritol | 2,2-bis(hydroxymethyl)propane-1,3-diol octadecanoic acid | 3823.19 | |
56296-78-7 | Fluoxetine Hydrochloride | N-methyl-3-phenyl-3-[4-(trifluoromethyl)phenoxy]propan-1-amine;hydrochloride | 2922.19 | 6 |
563-12-2 | Ethion | Diethoxyphosphinothioylsulfanylmethylsulfanyl-diethoxy-sulfanylidene-$l^{5}-phosphane | 2930.9 | |
56329-42-1 | Zinc (2+) ion 2-amino-4-(methylsulfanyl)butanoic acid sulfate | Zinc (2+) ion 2-amino-4-(methylsulfanyl)butanoic acid sulfate | 2930.9 | |
563-43-9 | Ethylaluminium dichloride | Ethylaluminium dichloride | 2931.9 | |
56-35-9 | Tributyltin Oxide | Tributyl(tributylstannyloxy)stannane | 2931.1 | |
56360-46-4 | Acid red 91 | 2-(4,5-dibromo-3,6-dihydroxy-2,7-dinitroxanthen-9-yl)benzoic acid | 3204.12 | |
563-68-8 | Thallous Acetate | Thallium(1+) acetate | 2915.29 | |
56-37-1 | Benzyltriethylammonium Chloride | Benzyl(triethyl)azanium;chloride | 2923.9 | |
563-80-4 | Methyl Isopropyl Ketone | 3-Methylbutan-2-one | 2914.19 | 3 |
56388-48-8 | Alkylnaphthalene(C:20) | 2710.19 | ||
56391-57-2 | Netilmicin Sulfate | (2R,3R,4R,5R)-2-[(1S,2S,3R,4S,6R)-4-amino-3-[[(2S,3R)-3-amino-6-(aminomethyl)-3,4-dihydro-2H-pyran-2-yl]oxy]-6-(ethylamino)-2-hydroxycyclohexyl]oxy-5-methyl-4-(methylamino)oxane-3,5-diol;sulfuric acid | 2941.9 | 6 |
56392-14-4 | Metoprolol Acid | 2-[4-[2-hydroxy-3-(propan-2-ylamino)propoxy]phenyl]acetic acid | 2922.5 | 6 |
56392-17-7 | Metoprolol tartrate | (2R,3S)-2,3-dihydroxybutanedioic acid 1-[4-(2-methoxyethyl)phenoxy]-3-(propan-2-ylamino)propan-2-ol | 2922.5 | |
563-96-2 | Glyoxylic Acid Monohydrate | Oxaldehydic acid hydrate | 2930.9 | |
56401-20-8 | Alpha-D-Glucose 1-phosphate disodium salt hydrate | Disodium [(2R,3R,4S,5S,6R)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl] phosphate hydrate | 2940 | |
56-40-6 | Glycine | Glycine | 2922.49 | |
56-41-7 | Alanine | (2S)-2-Aminopropanoic acid | 2922.49 | |
56-45-1 | Serine | 2S)-2-Amino-3-hydroxypropanoic acid | ||
56512-49-3 | p-Dimethylaminoazobenzene-4-sulfonyl chloride | 4-[[4-(Dimethylamino)phenyl]diazenyl]benzenesulfonyl chloride | 2927 | |
56519-68-7 | Heptanoic acid, 1,1’-(1-methy l-1,2-ethanediy l) ester | 2915.9 | ||
56519-71-2 | Propanediol Dicaprylate | 3-Octanoyloxypropyl octanoate | 2915.6 | |
56525-79-2 | 3,6-Diphenyl-9H-carbazole | 3,6-Diphenyl-9H-carbazole | 2928 | |
56-53-1 | Diethylstilbestrol | 4-[(E)-4-(4-Hydroxyphenyl)hex-3-en-3-yl]phenol | 2907.29 | 1 |
56539-66-3 | Methoxymethylbutanol | 3-Methoxy-3-methylbutan-1-ol | 2909.6 | |
565429-75-6 | Poly (oxy-1,2-ethanediyl), .alpha.-hydro-.omega.-hydroxy-mono(dihydrogen 2-hydroxy-1,2,3-propanetricarboxylate), C12-18-alkyl ethers | 3402.9 | ||
56552-80-8 | 1-Benzylglycerol | (2R)-3-Phenylmethoxypropane-1,2-diol | 2909.49 | |
56-55-3 | Tetraphene | Benzo[a]anthracene | 2902.9 | |
56554-53-1 | Triisononanoin | 2,3-bis(3,5,5-trimethylhexanoyloxy)propyl 3,5,5-trimethylhexanoate | 2905.49 | |
5655-61-8 | Bornyl Acetate | [(1R,3S)-4,7,7-Trimethyl-3-bicyclo[2.2.1]heptanyl] acetate | 2915.39 | |
565-70-8 | 2-Hydroxybutyric acid | 2-Hydroxybutyric acid | 2918.19 | |
56578-35-9 | P-Methylcinnamaldehyde | (E)-3-(4-Methylphenyl)prop-2-enal | 2912.49 | |
5662-75-9 | 6-Phosphonohexanoic acid | 3824.6 | ||
566-28-9 | 7-Oxocholesterol | (3S,8S,9S,10R,13R,14S,17R)-3-hydroxy-10,13-dimethyl-17-[(2R)-6-methylheptan-2-yl]-1,2,3,4,8,9,11,12,14,15,16,17-dodecahydrocyclopenta[a]phenanthren-7-one | 2914.4 | |
56-65-5 | Adenosine triphosphate | [[(2R,3S,4R,5R)-5-(6-Aminopurin-9-yl)-3,4-dihydroxyoxolan-2-yl]methoxy-hydroxyphosphoryl] phosphono hydrogen phosphate | 2936.27 | |
56706-10-6 | Bis [3-(triethoxysilyl) propyl] disulfide | 4,4,13,13-Tetraethoxy-3,14-dioxa-8,9-dithia-4,13-disilahexadecane | 3812.3 | |
56-75-7 | Chloramphenicol | 2,2-Dichloro-N-[(1R,2R)-1,3-dihydroxy-1-(4-nitrophenyl)propan-2-yl]acetamide | 6 | |
56797-01-4 | Cerium octoate | Cerium(3+); 2-ethylhexanoate | 2846.1 | |
56802-99-4 | Trisodium orthophosphate | 3402.9 | ||
56803-37-3 | 2-Tert-butylphenyl diphenyl phosphate | (2-Tert-butylphenyl) diphenyl phosphate | ||
56805-23-3 | 3,6-Nonadien-1-OL, (3E,6Z)- | (3E,6Z)-Nona-3,6-dien-1-ol | 2905.19 | |
5680-79-5 | Methyl Glycinate Hydrochloride | Methyl 2-aminoacetate;hydrochloride | 2922.49 | |
56-81-5 | Glycerol ; Fragrance of glycerin | Propane-1,2,3-triol | 2905.45 | 6 |
56839-43-1 | Eperisone Hydrochloride | 1-(4-Ethylphenyl)-2-methyl-3-piperidin-1-ylpropan-1-one;hydrochloride | 2933.39 | |
56-84-8 | Aspartic Acid | (2S)-2-Aminobutanedioic acid | 2922.49 | |
56-85-9 | Levoglutamide | Glutamine | 2924.19 | 6 |
56-86-0 | Glutamic acid | (2S)-2-Aminopentanedioic acid | ||
56-87-1 | Lysine | (2S)-2,6-Diaminohexanoic acid | 2922.41 | |
56-89-3 | Cystine | (2R)-2-amino-3-[[(2R)-2-amino-2-carboxyethyl]disulfanyl]propanoic acid | 3507.9 | |
56-91-7 | Aminomethylbenzoic acid | 4-(Aminomethyl)benzoic acid | 2933.99 | |
56-92-8 | Histamine Dihydrochloride | 2-(1H-imidazol-5-yl)ethanamine;dihydrochloride | 2933.29 | |
56932-43-5 | Naphthylazoxine S | Disodium 8-hydroxy-7-[(E)-2-(6-sulfonaphthalen-2-yl)diazen-1-yl]quinoline-5-sulfonate | 2933.49 | |
56-93-9 | Benzyltrimethylammonium chloride | Benzyl(trimethyl)azanium chloride | 3824.9 | |
56-95-1 | Chlorhexidine Acetate | Acetic acid (1E)-2-[6-[[amino-[(E)-[amino-(4-chloroanilino)methylidene]amino]methylidene]amino]hexyl]-1-[amino-(4-chloroanilino)methylidene]guanidine | 2925.29 | |
569-58-4 | Aluminon | Azane 5-[(3-carboxy-4-hydroxyphenyl)-(3-carboxy-4-oxocyclohexa-2,5-dien-1-ylidene)methyl]-2-hydroxybenzoic acid | 2918.99 | |
569-61-9 | Basic red 9 ; C.I. 42500 | 4,4'-[(4-iminocyclohexa-2,5-dien-1-ylidene)methanediyl]dianiline hydrochloride | 3204.13 | |
569-64-2 | Basic green 4 ; C.I. 42000 | N-(4-{[4-(dimethylamino)phenyl](phenyl)methylidene}cyclohexa-2,5-dien-1-ylidene)-N-methylmethanaminium chloride | 8 | |
56973-85-4 | 1-(5,5-Dimethyl-1-cyclohexen-1-yl)pent-4-en-1-one | 1-(5,5-Dimethylcyclohexen-1-yl)pent-4-en-1-one | 2914.29 | |
56985-40-1 | 9,11-Dideoxy-11α,9α-epoxymethanoprostaglandin F2α | (5Z)-7-[(1R,4S,5S,6R)-6-[(3S)-3-hydroxyoct-1-en-1-yl]-2-oxabicyclo[2.2.1]heptan-5-yl]hept-5-enoic acid | 2937.5 | |
57-00-1 | Creatine | 2-[Carbamimidoyl(methyl)amino]acetic acid | ||
5700-49-2 | Ethylenediamine Dihydriodide | Ethane-1,2-diamine;dihydroiodide | 2921.21 | |
57018-04-9 | Tolclofos-methyl | O-(2,6-dichloro-4-methylphenyl) O,O-dimethyl thiophosphate | 2920.19 | 8 |
5704-04-1 | Tricine | 2-[[1,3-Dihydroxy-2-(hydroxymethyl)propan-2-yl]amino]acetic acid | 2922.19 | |
57-06-7 | Allyl Isothiocyanate | 3-Isothiocyanatoprop-1-ene | 2930.9 | |
57-09-0 | Cetrimonium Bromide | Hexadecyl(trimethyl)azanium;bromide | 2923.9 | 6 |
57-10-3 | Palmitic acid | Hexadecanoic acid | ||
57109-90-7 | Clorazepate Dipotassium | Potassium 7-chloro-2-oxo-5-phenyl-1,3-dihydro-1,4-benzodiazepine-3-carboxylic acid;potassium;hydroxide | 2933.91 | 9 |
57-11-4 | Stearic acid | Octadecanoic acid | ||
57124-87-5 | 2-Methyloxolane-3-thiol | 2-Methyloxolane-3-thiol | 2932.99 | |
57-13-6 | Urea | Urea | 3102.1 | 4 |
57-15-8 | Chlorobutanol | 1,1,1-Trichloro-2-methylpropan-2-ol | 2905.14 | 6 |
5719-73-3 | Hexamethylene-1,6-bis(thiosulphate),disodium salt dihydrate (DHTS) | Disodium S,S'-hexane-1,6-diyl disulfurothioate dihydrate | ||
57219-64-4 | Zirconium carbonate | Dioxozirconium; zirconium(2+); carbonate; dihydrate | ||
57260-73-8 | N-Boc-ethylenediamine | Tert-butyl N-(2-aminoethyl)carbamate | 2924.19 | |
5726-19-2 | 2-Methylcyclohexyl acetate | (2-Methylcyclohexyl) acetate | 2915.39 | |
57-27-2 | Morphine | (5α,6α)-7,8-didehydro- 4,5-epoxy-17-methylmorphi nan-3,6-diol | 7 | |
57308-41-5 | Disperse yellow 119 | 3204.16 | ||
573-58-0 | Direct red 28 ; Congo red | 3204.9 | ||
57365-08-9 | 2-Amino-N-cyclohexyl-N-methylbenzylamine | 2-[[Cyclohexyl(methyl)amino]methyl]aniline | 2921.59 | |
5736-94-7 | 4-Hexoxybenzaldehyde | 4-Hexoxybenzaldehyde | 2912.49 | |
57-41-0 | Phenytoin | 5,5-Diphenylimidazolidine-2,4-dione | 6 | |
57-42-1 | Pethidine | 1-methyl-4-phenylpiperidine-4-carboxylic acid ethyl ester | 2933.33 | 7 |
5743-04-4 | Cadmium Acetate | Cadmium Acetate | 2915.29 | |
57-43-2 | Amobarbital | 5-ethyl-5-(3-methylbutyl)pyrimidine-2,4,6(1H,3H,5H)-trione | 2933.53 | 9 |
5743-26-0 | Calcium acetate monohydrate | Calcium diacetate hydrate | 2915.29 | |
57432-61-8 | Methylergonovine maleate | (6aR,9R)-N-[(2S)-1-hydroxybutan-2-yl]-7-methyl-6,6a,8,9-tetrahydro-4H-indolo[4,3-fg]quinoline-9-carboxamide;(Z)-but-2-enedioic acid | 2939.61 | |
5743-28-2 | Calcium Ascorbate | Calcium (2R)-2-[(1S)-1,2-dihydroxyethyl]-3-hydroxy-5-oxo-2H-furan-4-olate;dihydrate | 2936.27 | |
5743-36-2 | Calcium Butyrate | Calcium butanoate | 2915.6 | |
5743-47-5 | Calcium Lactate Pentahydrate | Calcium 2-hydroxypropanoate;pentahydrate | 2918.11 | |
5743-49-7 | Calcium Levulinate | Calcium 4-oxopentanoate | 2918.3 | |
57-44-3 | Barbital | 5,5-diethylbarbituric acid | 2933.53 | 9 |
57454-67-8 | Cobalt(II) carbonate hydrate | Cobalt(2+); carbonate; hydrate | 2836.99 | |
57455-37-5 | Pigment blue 29 ; C.I. 77007 | 3212.9 | ||
57472-68-1 | Dipropylene glycol diacrylate | Dipropylene glycol diacrylate | 2916.12 | |
57-48-7 | Fructose | (3S,4R,5R)-1,3,4,5,6-pentahydroxyhexan-2-one | ||
57500-00-2 | Furfuryl Methyl Disulfide | 2-[(methyldisulfanyl)methyl]furan | 2932.19 | |
57-50-1 | Sucrose | (2R,3R,4S,5S,6R)-2-[(2S,3S,4S,5R)-3,4-dihydroxy-2,5-bis(hydroxymethyl)oxolan-2-yl]oxy-6-(hydroxymethyl)oxane-3,4,5-triol | ||
57-55-6 | Propylene glycol ; Fragrance of 1,2-Propanediol | Propane-1,2-diol | ||
57583-35-4 | Methyl Tin Mercaptide | 2-Ethylhexyl 2-[[2-(2-ethylhexoxy)-2-oxoethyl]sulfanyl-dimethylstannyl]sulfanylacetate | ||
57583-54-7 | Tetraphenylresorcinol Diphosphate | (3-Diphenoxyphosphoryloxyphenyl) diphenyl phosphate | 2919.9 | |
57584-27-7 | Terbium(III) nitrate pentahydrate | Terbium(3+); trinitrate; pentahydrate | 2846.9 | |
576-26-1 | 2,6-Xylenol | 2,6-Dimethylphenol | 2907.19 | |
57635-48-0 | Glycolic acid ethoxylate oleyl ether | 3402.9 | ||
57-63-6 | Ethinyl Estradiol | (8R,9S,13S,14S,17R)-17-Ethynyl-13-methyl-7,8,9,11,12,14,15,16-octahydro-6H-cyclopenta[a]phenanthrene-3,17-diol | 2937.23 | |
57-66-9 | Probenecid | 4-(Dipropylsulfamoyl)benzoic acid | 2935 | 6 |
57-67-0 | Sulfaguanidine | 2-(4-Aminophenyl)sulfonylguanidine | 2935 | |
57671-19-9 | 1,8-Diazabicyclo[5.4.0]undec-7-ene, compound with phenol | 2,3,4,6,7,8,9,10-Octahydropyrimido[1,2-a]azepine;phenol | 2933.99 | |
57675-44-2 | Trimethylolpropane trioleate | 2,2-bis[[(Z)-Octadec-9-enoyl]oxymethyl]butyl (Z)-octadec-9-enoate | ||
57-68-1 | Sulfamethazine | 4-Amino-N-(4,6-dimethylpyrimidin-2-yl)benzenesulfonamide | 2935 | |
577-11-7 | Docusate sodium ; Bis(2-ethylhexyl) Sulfosuccinate Sodium Salt ; Dioctyl Sulfosuccinate Sodium Salt | |||
57-71-6 | Butanedione monoxime | 3-Hydroxyiminobutan-2-one | 2928 | |
577-16-2 | 1-(2-Methylphenyl)ethanone | 1-(2-Methylphenyl)ethanone | 2914.39 | |
577-19-5 | 1-Bromo-2-nitrobenzene | 1-Bromo-2-nitrobenzene | 2904.9 | |
57808-66-9 | Domperidone | 6-chloro-3-[1-[3-(2-oxo-3H-benzimidazol-1-yl)propyl]piperidin-4-yl]-1H-benzimidazol-2-one | 2922.5 | 6 |
57817-89-7 | Steviol Glycosides | 2938.9 | ||
57-83-0 | Progesterone | (8S,9S,10R,13S,14S,17S)-17-acetyl-10,13-dimethyl-1,2,6,7,8,9,11,12,14,15,16,17-dodecahydrocyclopenta[a]phenanthren-3-one | 2937.23 | 6 |
57834-33-0 | Ethyl 4-[(N-methylanilino)methyleneamino]benzoate | Ethyl 4-[(N-methylanilino)methylideneamino]benzoate | 2925.29 | |
57837-19-1 | Metalaxyl ; Methyl N-(2-methoxyacetyl)-N-(2,6-xylyl)-DL-alaninate | 2924.29 | 8 | |
57843-53-5 | N,N,N',N'-tetrakis(2-hydroxypropyl)hexanediamide | N,N,N',N'-tetrakis(2-hydroxypropyl)hexanediamide | 2924.19 | |
578-54-1 | 2-Ethylaniline | 2-Ethylaniline | 2921.49 | |
5785-44-4 | Calcium citrate  | Tricalcium 2-hydroxypropane-1,2,3-tricarboxylate | 2918.15 | |
5786-21-0 | Clozapine | 3-Chloro-6-(4-methylpiperazin-1-yl)-5H-benzo[b][1,4]benzodiazepine | 2933.59 | 6 |
578-66-5 | 8-Aminoquinoline | Quinolin-8-amine | 2933.49 | |
57-87-4 | Ergosterol | (3S,9S,10R,13R,14R,17R)-17-[(E,2R,5R)-5,6-dimethylhept-3-en-2-yl]-10,13-dimethyl-2,3,4,9,11,12,14,15,16,17-decahydro-1H-cyclopenta[a]phenanthren-3-ol | 2933.59 | 7 |
578-74-5 | Apigetrin | 5-hydroxy-2-(4-hydroxyphenyl)-7-[(2S,3R,4S,5S,6R)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxychromen-4-one | 2938.9 | |
57-88-5 | Cholesterol | (3S,8S,9S,10R,13R,14S,17R)-10,13-dimethyl-17-[(2R)-6-methylheptan-2-yl]-2,3,4,7,8,9,11,12,14,15,16,17-dodecahydro-1H-cyclopenta[a]phenanthren-3-ol | ||
578-85-8 | 4-Hydroxynaphthalene-2,7-disulfonic acid | 4-Hydroxynaphthalene-2,7-disulfonic acid | ||
5793-89-5 | Calcium Saccharate | Calcium (2S,3S,4S,5R)-2,3,4,5-tetrahydroxyhexanedioate;tetrahydrate | 2918.19 | |
5794-03-6 | Camphene | (1S,4R)-3,3-dimethyl-2-methylidenebicyclo[2.2.1]heptane | 2902.19 | |
5794-13-8 | Asparagine | (2S)-2,4-diamino-4-oxobutanoic acid;hydrate | ||
5794-28-5 | Calcium Oxalate Monohydrate | Calcium oxalate hydrate | 2915.9 | |
57981-02-9 | O-(2,3,4,5,6-Pentafluorobenzyl)hydroxylamine hydrochloride | O-[(2,3,4,5,6-pentafluorophenyl)methyl]hydroxylamine;hydrochloride | 2928 | |
580-13-2 | 2-Bromonaphthalene | 2-Bromonaphthalene | 2903.99 | |
580-16-5 | 6-Hydroxyquinoline | Quinolin-6-ol | 2933.49 | |
580-51-8 | 3-Biphenylol | 3-Phenylphenol | 2907.19 | |
58051-98-2 | Disperse red 177 | 3204.9 | ||
58052-80-5 | 2,4,6-Trimethyl-1,3,5-triazinane Trihydrate | 2,4,6-Trimethyl-1,3,5-triazinane Trihydrate | 2933.69 | |
58-08-2 | Caffeine | 1,3,7-trimethylpurine-2,6-dione | ||
5808-22-0 | Disodium Chromotropate Dihydrate | Disodium 4,5-dihydroxynaphthalene-2,7-disulfonate dihydrate | ||
5810-42-4 | Tetrapropylammonium Chloride | Tetrapropylazanium chloride | 2923.9 | |
58109-40-3 | Diphenyliodonium Hexafluorophosphate | Diphenyliodanium hexafluorophosphate | 2931.9 | |
58-14-0 | Pyrimethamine | 5-(4-Chlorophenyl)-6-ethylpyrimidine-2,4-diamine | 2933.59 | |
5818-15-5 | Propanehydrazide | Propanehydrazide | ||
582-17-2 | 2,7-Naphthalenediol | Naphthalene-2,7-diol | 2922.29 | |
58-22-0 | Testosterone | (8R,9S,10R,13S,14S,17S)-17-hydroxy-10,13-dimethyl-1,2,6,7,8,9,11,12,14,15,16,17-dodecahydrocyclopenta[a]phenanthren-3-one | 2933.39 | 6 |
582-25-2 | Potassium Benzoate | Potassium Benzoate | 2916.31 | |
58229-81-5 | Triton DF 16 | 3402.13 | ||
58229-88-2 | Di-n-octyl tin mercaptide | 3812.3 | ||
58-25-3 | Chlordiazepoxide | 7-chloro-2-methylamino-5-phenyl-3H-1,4-benzodiazepine-4-oxide | 2933.91 | 9 |
58-27-5 | Menadione | 2-methylnaphthalene-1,4-dione | 2914.69 | |
58306-30-2 | Febantel | methyl N-[[2-[(2-methoxyacetyl)amino]-4-phenylsulfanylanilino]-(methoxycarbonylamino)methylidene]carbamate | 2930.9 | |
58318-10-8 | Sodium mono- and di-decyl disulfonated diphenyl oxide ; Sodium mono-and di-decyl disulfonated diphenyl oxide | 3402.11 | ||
58-32-2 | Dipyridamole | 2-[[2-[Bis(2-hydroxyethyl)amino]-4,8-di(piperidin-1-yl)pyrimido[5,4-d]pyrimidin-6-yl]-(2-hydroxyethyl)amino]ethanol | 2933.59 | 6 |
58-33-3 | Promethazine Hydrochloride | N,N-Dimethyl-1-phenothiazin-10-ylpropan-2-amine;hydrochloride | 2934.3 | |
583-39-1 | 2-Benzimidazolethiol | 1,3-Dihydrobenzimidazole-2-thione | ||
58339-34-7 | Pigment red 108 ; C.I. 77202 | 3207.1 | ||
5834-16-2 | 3-Methylthiophene-2-carbaldehyde | 3-Methylthiophene-2-carbaldehyde | 2934.99 | |
583-52-8 | Potassium oxalate | Dipotassium oxalate | ||
583-57-3 | 1,2-Dimethylcyclohexane | 1,2-Dimethylcyclohexane | 2902.19 | |
58-36-6 | 10,10'-Oxydiphenoxarsine | 10-Phenoxarsinin-10-Yloxyphenoxarsinine | 2932.99 | |
583-91-5 | Desmeninol | 2-Hydroxy-4-methylsulfanylbutanoic acid | 2930.9 | |
583-93-7 | 2,6-Diaminopimelic acid | 2,6-Diaminopimelic acid | 2922.49 | |
58-39-9 | Perphenazine | 2-[4-[3-(2-Chlorophenothiazin-10-yl)propyl]piperazin-1-yl]ethanol | 2934.3 | |
584-02-1 | Pentan-3-ol | Pentan-3-ol | 2905.19 | |
584-08-7 | Potassium carbonate | Dipotassium carbonate | 2836.4 | |
584-09-8 | Rubidium carbonate | Rubidium(1+) carbonate | 2836.99 | |
58419-36-6 | Acid green 111 | 2,7-Naphthalenedisulfonic acid, 4-amino-6-[(1-amino-4-sulfo-2-naphthalenyl)azo]-5-hydroxy-3-[[4-[[2-oxo-1-[(phenylamino)carbonyl]propyl]azo]phenyl]azo]-, trisodium salt | 3204.12 | |
58421-55-9 | Bisphenol F-epichlorohydrin polymer | Phenol, methylenebis-, polymer with 2-(chloromethyl)oxirane | 2933.99 | |
58446-52-9 | Benzoylstearoylmethane | 1-phenylicosane-1,3-dione | 2914.69 | |
58454-11-8 | Pentan-1-ol | Pentan-1-ol | 2905.19 | |
584-79-2 | Bioallethrin | (2-methyl-4-oxo-3-prop-2-enylcyclopent-2-en-1-yl) 2,2-dimethyl-3-(2-methylprop-1-enyl)cyclopropane-1-carboxylate | 2916.2 | 3 |
58479-61-1 | Tert-butyldiphenylchlorosilane | Tert-butyl-chloro-diphenylsilane | 2931.9 | |
584-84-9 | Toluene 2,4-diisocyanate | 2,4-diisocyanato-1-methylbenzene | 2929.1 | 8 |
585-07-9 | Tert-Butyl methacrylate | Tert-butyl 2-methylprop-2-enoate | 2916.14 | |
58543-16-1 | Rebaudioside A | 2938.9 | ||
58-55-9 | Theophylline | 1,3-dimethyl-7H-purine-2,6-dione | 2934.99 | 6 |
58-56-0 | Pyroxidine Hydrochloride | 4,5-bis(hydroxymethyl)-2-methylpyridin-3-ol;hydrochloride | 6 | |
5858-33-3 | Acid red 17 | Sodium 1-(1'-naphthylazo)naphth-2-ol-3,6-disulfonate | 3204.12 | |
5858-81-1 | Pigment red 57-1 | 2-Naphthalenecarboxylic acid, 3-hydroxy-4-[(4-methyl-2-sulfophenyl)azo]-, disodium salt | 3205 | |
585-88-6 | Maltitol | (2S,3R,4R,5R)-4-[(2R,3R,4S,5S,6R)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxyhexane-1,2,3,5,6-pentol | 2940 | |
58591-12-1 | Pigment green 17 | 3204.17 | ||
585-99-9 | Melibiose | (2R,3R,4S,5S,6R)-6-({[(2S,3R,4S,5R,6R)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxy}methyl)oxane-2,3,4,5-tetrol | 2940 | |
58-61-7 | Adenosine | (2R,3R,4S,5R)-2-(6-aminopurin-9-yl)-5-(hydroxymethyl)oxolane-3,4-diol | 2934.99 | |
58-63-9 | Inosine | 9-[(2R,3R,4S,5R)-3,4-dihydroxy-5-(hydroxymethyl)oxolan-2-yl]-3H-purin-6-one | 2934.99 | |
58656-04-5 | Tricyclohexylphosphine tetrafluoroborate | Tricyclohexylphosphine tetrafluoroborate | 2931.9 | |
586-62-9 | Terpinolene | 1-Methyl-4-propan-2-ylidenecyclohexene | ||
58670-89-6 | 2-Decyltetradecanol | 2-decyltetradecan-1-ol | 2905.19 | |
586-75-4 | 4-Bromobenzoyl chloride | 4-Bromobenzoyl chloride | 2916.39 | |
586-76-5 | 4-Bromobenzoic acid | 4-Bromobenzoic acid | 2933.99 | |
586-77-6 | 4-Bromo-N,N-dimethylaniline | 4-Bromo-N,N-dimethylaniline | 2921.42 | |
5872-08-2 | 2-Oxobornane-10-sulphonic acid | (7,7-Dimethyl-3-oxo-4-bicyclo[2.2.1]heptanyl)methanesulfonic acid | 2914.7 | |
58748-27-9 | Propylene glycol dicaprylate | 9-Decanoyloxy-9-(1-decanoyloxyethyl)heptadecanedioate | 3404.9 | |
58749-22-7 | Licochalcone A | (E)-3-[4-Hydroxy-2-methoxy-5-(2-methylbut-3-en-2-yl)phenyl]-1-(4-hydroxyphenyl)prop-2-en-1-one | 2914.5 | |
587-98-4 | Acid yellow 36 | Sodium 3-(p-anilinophenylazo)benzenesulfonate | 3204.12 | |
588-22-7 | 3,4-Dichlorophenoxyacetic acid | 2-(3,4-Dichlorophenoxy)acetic acid | 2918.99 | |
58-85-5 | Biotin | 5-[(3aS,4S,6aR)-2-oxo-1,3,3a,4,6,6a-hexahydrothieno[3,4-d]imidazol-4-yl]pentanoic acid | 6 | |
58855-63-3 | DEA-Oleth-10 Phosphate ; Ethanol, 2,2'-iminobis-, compd. with Polyoxyethylene oleyl ether phosphate | 3402.13 | ||
58861-74-8 | 2-Bromoethylamine hydrochloride | 2-Bromoethylamine hydrochloride | 2921.19 | |
58864-81-6 | D-alpha-tocotrienol | (2R)-2,5,7,8-tetramethyl-2-[(3E,7E)-4,8,12-trimethyltrideca-3,7,11-trienyl]-3,4-dihydrochromen-6-ol | 3504 | |
58-86-6 | Xylose | (2R,3S,4R)-2,3,4,5-tetrahydroxypentanal | ||
5888-33-5 | Isobornyl acrylate | (4,7,7-Trimethyl-3-bicyclo[2.2.1]heptanyl) prop-2-enoate | 2916.12 | |
5892-10-4 | Bismuth(III) carbonate | Bis(oxobismuthanyl) carbonate | 2836.99 | |
58-93-5 | Hydrochlorothiazide | 6-Chloro-1,1-dioxo-3,4-dihydro-2H-1$l^{6},2,4-benzothiadiazine-7-sulfonamide | 2935 | |
5893-91-4 | Diamorphine Hydrochloride Monohydrate | [(4R,4aR,7S,7aR,12bS)-9-Acetyloxy-3-methyl-2,4,4a,7,7a,13-hexahydro-1H-4,12-methanobenzofuro[3,2-e]isoquinoline-7-yl] acetate;hydrate;hydrochloride | 2939.19 | |
5894-59-7 | Digalacturonic Acid | (2S,3R,4S,5R,6S)-6-[(2S,3R,4R,5R)-2-Carboxy-4,5,6-trihydroxyoxan-3-yl]oxy-3,4,5-trihydroxyoxane-2-carboxylic acid | 2932.99 | |
58-94-6 | Chlorothiazide | 6-Chloro-1,1-dioxo-4H-1$l^{6},2,4-benzothiadiazine-7-sulfonamide | 2935 | 6 |
58-95-7 | D-alpha-Tocopheryl Acetate | [(2R)-2,5,7,8-Tetramethyl-2-[(4R,8R)-4,8,12-trimethyltridecyl]-3,4-dihydrochromen-6-yl] acetate | 2936.28 | |
58958-60-4  | Isostearyl Neopentanoate | 16-Methylheptadecyl 2,2-dimethylpropanoate | ||
589-59-3 | Fragrance of isobutyl isovalerate | Isobutyl isovalerate | 3302.1 | |
58-96-8 | Uridine | 1-[(2R,3R,4S,5R)-3,4-Dihydroxy-5-(hydroxymethyl)oxolan-2-yl]pyrimidine-2,4-dione | 2934.99 | |
58969-01-0 | Basic violet 14 | 3212.9 | ||
58985-18-5 | p-Menthan-8-yl acetate | 2-(4-Methylcyclohexyl)propan-2-yl acetate | 2915.39 | |
589-98-0 | Fragrance of 3-Octanol | Octan-3-ol | 3302.9 | |
590-00-1 | Potassium sorbate | Potassium (2E,4E)-hexa-2,4-dienoate | 3824.9 | |
590-01-2 | Butyl propionate | Butyl propionate | 2915.5 | 3 |
59-00-7 | Xanthurenic acid | 8-Hydroxy-4-oxo-1H-quinoline-2-carboxylic acid | 2933.49 | |
590-17-0 | Bromoacetonitrile | 2-Bromoacetonitrile | 2926.9 | |
59-02-9 | Alpha-Tocopherol | (2R)-2,5,7,8-tetramethyl-2-[(4R,8R)-4,8,12-trimethyltridecyl]-3,4-dihydrochromen-6-ol | 2936.28 | |
590-29-4 | Potassium formate | Potassium formate | ||
590-46-5 | Betaine Hydrochloride | Carboxymethyl(trimethyl)azanium;chloride | 2923.9 | |
590-47-6 | Betaine Hydrate | Carboxymethyl(trimethyl)azanium;hydroxide | 2923.9 | |
59-05-2 | Methotrexate | (2S)-2-[[4-[(2,4-diaminopteridin-6-yl)methyl-methylamino]benzoyl]amino]pentanedioic acid | 6 | |
590-63-6 | Bethanechol Chloride | 2-Carbamoyloxypropyl(trimethyl)azanium;chloride | 2924.19 | |
590-86-3 | Isovaleraldehyde | 3-Methylbutanal | 2912.49 | |
5908-99-6 | Atropine Sulfate | [(1R,5S)-8-methyl-8-azabicyclo[3.2.1]octan-3-yl] 3-hydroxy-2-phenylpropanoate;sulfuric acid;hydrate | 2939.99 | |
590-93-2 | 2-Butynoic acid | But-2-ynoic acid | 2916.19 | |
591-01-5 | Bis(amidinourea) sulphate | Bis(amidinourea) sulphate | 2925.29 | |
591-12-8 | 5-Methylfuran-2(3H)-one | 5-Methyl-3H-furan-2-one | 2942 | |
59113-36-9 | Diglycerin | 3-(2,3-dihydroxypropoxy)propane-1,2-diol | 2909.49 | |
591-18-4 | 1-bromo-3-iodobenzene | 1-bromo-3-iodobenzene | 2903.99 | |
591-27-5 | M-Aminophenol | 3-Aminophenol | 2922.29 | |
59130-69-7 | Cetyl Ethylhexanoate | Hexadecyl 2-ethylhexanoate | 2915.9 | |
5913-13-3 | (1R)-1-Cyclohexylethanamine | (1R)-1-Cyclohexylethanamine | 2921.3 | |
591-50-4 | Iodobenzene | Iodobenzene | 2903.99 | |
591-64-0 | Calcium Levulinate | Calcium 4-oxopentanoate | 2915.6 | |
591-78-6 | 2-Hexanone | Hexan-2-one | 2914.19 | 3 |
591-81-1 | GHB | γ-hydroxybutyric acid | 2918.19 | 9 |
59186-41-3 | Sodium cetostearyl sulfate | Sodium hexadecyl sulfate octadecyl sulfate | 3824.9 | |
59219-71-5 | Isononyl Isononanoate | 3,5,5-Trimethylhexyl 3,5,5-trimethylhexanoate | 2915.9 | |
59-23-4 | Galactose | |||
592-41-6 | 1-Hexene | Hex-1-ene | 2901.29 | |
59259-38-0 | Menthyl lactate ; Fragrance of (-)-Menthyl lactate | [(1R,2S,5R)-5-Methyl-2-propan-2-ylcyclohexyl] 2-hydroxypropanoate | ||
59-26-7 | Nikethamide | N,N-Diethylpyridine-3-carboxamide | 2933.99 | |
592-76-7 | 1-Heptene | Hept-1-ene | 2901.29 | |
59277-89-3 | Acyclovir | 2-Amino-9-(2-hydroxyethoxymethyl)-3H-purin-6-one | 2933.59 | 6 |
592-88-1 | Allyl sulfide | 3-Prop-2-enylsulfanylprop-1-ene | 2930.9 | |
59-30-3 | Folic acid | (2S)-2-[[4-[(2-amino-4-oxo-1H-pteridin-6-yl)methylamino]benzoyl]amino]pentanedioic acid | 6 | |
593-29-3 | Potassium stearate, crude | Potassium octadecanoate | ||
5934-29-2 | L-Histidine monohydrochloride monohydrate | L-Histidine, monohydrochloride, monohydrate | 6 | |
593-45-3 | Octadecane | Octadecane | 2901.1 | |
593-51-1 | Methylamine Hydrochloride | Methylamine Hydrochloride | ||
593-56-6 | Methoxyamine Hydrochloride | O-methylhydroxylamine;hydrochloride | 2928 | |
593-81-7 | Trimethylamine Hydrochloride | N,N-dimethylmethanamine;hydrochloride | 2929.9 | |
593-84-0 | Guanidinium thiocyanate | Guanidinium thiocyanate | 2925.29 | |
593-85-1 | Diguanidinium carbonate | Diguanidinium carbonate | 2925.29 | |
59-40-5 | Sulfaquinoxaline | 4-Amino-N-quinoxalin-2-ylbenzenesulfonamide | 2935 | |
5941-07-1 | Azomethine-H monosodium salt hydrate | Sodium 4-hydroxy-5-[[(E)-(6-oxocyclohexa-2,4-dien-1-ylidene)methyl]amino]-7-sulfonaphthalene-2-sulfonate | 2925.29 | |
594-27-4 | Tetramethyltin | Tetramethyltin | 2931.9 | |
594-45-6 | Ethanesulfonic acid | Ethanesulfonic acid | 2904.1 | |
5945-33-5 | Bisphenol-A bis(diphenyl phosphate) | [4-[2-(4-diphenoxyphosphoryloxyphenyl)propan-2-yl]phenyl] diphenyl phosphate | ||
594-61-6 | 2-Methyllactic acid | 2-hydroxy-2-methylpropanoic acid | 2918.19 | |
59467-70-8 | Midazolam | 8-chloro-6-(o-fluorophenyl)-1-methyl-4H-imidazo[1,5- a][1,4]benzodiazepine | 2933.91 | 9 |
59-48-3 | Oxindole | 1,3-Dihydroindol-2-one | 2933.79 | |
59483-84-0 | Bis(Pentafluorophenyl) Carbonate | Bis(2,3,4,5,6-pentafluorophenyl) carbonate | 2920.9 | |
59487-23-9 | Pigment red 187 | 3204.17 | ||
5949-29-1 | Citric acid | 2-hydroxypropane-1,2,3-tricarboxylic acid hydrate | 3824.9 | |
5949-44-0 | Testosterone Undecanoate | [(8R,9S,10R,13S,14S,17S)-10,13-dimethyl-3-oxo-1,2,6,7,8,9,11,12,14,15,16,17-dodecahydrocyclopenta[a]phenanthren-17-yl] undecanoate | 2937.29 | |
59-50-7 | Chlorocresol | 4-chloro-3-methylphenol | 2908.19 | 3 |
59-51-8 | Racemethionine | 2-Amino-4-methylsulfanylbutanoic acid | 2930.4 | |
59-52-9 | Dimercaprol | 2,3-bis(sulfanyl)propan-1-ol | 2930.9 | 6 |
59-58-5 | Prosultiamine | N-[(4-amino-2-methylpyrimidin-5-yl)methyl]-N-[(Z)-5-hydroxy-3-(propyldisulfanyl)pent-2-en-2-yl]formamide | 2936.22 | |
596-01-0 | alpha-Naphtholphthalein | 3,3-bis(4-hydroxynaphthalen-1-yl)-2-benzofuran-1-one | 2934.99 | |
596-09-8 | 3,6-Diacetoxyfluoran, di-o-acetylfluorescein | 3204.2 | ||
5964-35-2 | Potassium ethylenediaminetetraacetate | Tetrapotassium 2-[2-[bis(carboxylatomethyl)amino]ethyl-(carboxylatomethyl)amino]acetate | 2922.49 | |
5965-83-3 | Sulfosalicylic Acid Dihydrate | 2-hydroxy-5-sulfobenzoic acid;dihydrate | 2918.21 | |
59-66-5 | Acetazolamide | N-(5-Sulfamoyl-1,3,4-thiadiazol-2-yl)acetamide | 2935 | 6 |
59669-26-0 | Thiodicarb | Dimethyl (1E,1'E)-N,N'-{sulfanediylbis[(methylcarbamoyl)oxy]}diethanimidothioate | 2930.9 | 8 |
59-67-6 | Niacin | Pyridine-3-carboxylic acid | 6 | |
5968-11-6 | Sodium carbonate | Disodium carbonate hydrate | 2836.2 | |
59686-68-9 | 2-Tetradecoxyethyl tetradecanoate | 2-Tetradecoxyethyl tetradecanoate | 2915.9 | |
59690-88-9 | (3-Aminophenyl)uronium chloride | (3-Aminophenyl)uronium chloride | 2924.21 | |
5970-45-6 | Zinc Acetate | Zinc diacetate;dihydrate | ||
5970-47-8 | Zinc carbonate | Dizinc; zinc; dicarbonate; hexahydrate | 2836.99 | |
59766-31-3 | Dipotassium titanate ; Potassium octatitanate | Dipotassium;oxygen(2-);titanium(4+) | 2841.9 | |
5979-28-2 | Pigment yellow 16 | 3204.17 | ||
59800-32-7 | Reactive blue 69 | 3204.16 | ||
59800-33-8 | Reactive red 136 | 3204.16 | ||
59804-37-4 | Tenoxicam | 4-hydroxy-2-methyl-1,1-dioxo-N-pyridin-2-ylthieno[2,3-e]thiazine-3-carboxamide | 2934.99 | 6 |
59820-43-8 | HC Yellow no. 4 | 2-[2-(2-hydroxyethoxy)-4-nitroanilino]ethanol | ||
598-21-0 | Bromoacetyl Bromide | 2-bromoacetyl bromide | 2915.9 | |
598-56-1 | N,N-Dimethylethylamine | N,N-Dimethylethylamine | 2921.19 | 3 |
598-62-9 | Manganese carbonate | Manganese(2+);carbonate | 2836.99 | |
598-63-0 | Lead(II) carbonate | Lead(2+);carbonate | 2836.99 | |
59-87-0 | Nitrofurazone | [(E)-(5-Nitrofuran-2-yl)methylideneamino]urea | 2932.19 | |
59870-68-7 | Glabridin | 4-[(3R)-8,8-dimethyl-3,4-dihydro-2H-pyrano[2,3-f]chromen-3-yl]benzene-1,3-diol | 2938.9 | |
598-72-1 | 2-Bromopropanoic acid | 2-Bromopropanoic acid | 2915.9 | |
598-75-4 | 3-Methyl-2-butanol | 3-Methylbutan-2-ol | 2905.19 | |
59-88-1 | Phenylhydrazine Hydrochloride | Phenylhydrazine;hydrochloride | 2928 | |
5989-27-5 | D-Limonene | (4R)-1-Methyl-4-prop-1-en-2-ylcyclohexene | 2902.19 | |
5989-54-8 | L-Limonene | (4S)-1-Methyl-4-prop-1-en-2-ylcyclohexene | 2902.19 | |
59-92-7 | Levodopa | (2S)-2-amino-3-(3,4-dihydroxyphenyl)propanoic acid | 6 | |
5995-86-8 | Gallic Acid Monohydrate | 3,4,5-Trihydroxybenzoic acid;hydrate | ||
599-64-4 | P-Cumylphenol | 4-(2-Phenylpropan-2-yl)phenol | 2907.19 | |
599-79-1 | Sulfasalazine | (3E)-6-oxo-3-[[4-(pyridin-2-ylsulfamoyl)phenyl]hydrazinylidene]cyclohexa-1,4-diene-1-carboxylic acid | 2935 | |
60-00-4 | Edetic Acid | 2-[2-[bis(carboxymethyl)amino]ethyl-(carboxymethyl)amino]acetic acid | ||
6000-43-7 | Glycine Hydrochloride | 2-aminoacetic acid hydrochloride | 2922.49 | |
600-05-5 | 2,3-Dibromopropionic acid | 2,3-Dibromopropionic acid | 2915.5 | |
600-14-6 | 2,3-Pentanedione ; Fragrance of 2,3-Pentanedione | Pentane-2,3-dione | ||
60-01-5 | Tributyrin | 2,3-di(butanoyloxy)propyl butanoate | ||
6001-64-5 | Chlorobutanol hemihydrate | 1,1,1-trichloro-2-methylpropan-2-ol hydrate | 2905.59 | |
600-18-0 | 2-Oxobutanoic acid | 2-Oxobutanoic acid | 2918.3 | |
6004-24-6 | Cetylpyridinium Chloride | 1-hexadecylpyridin-1-ium chloride hydrate | 2933.99 | |
6009-70-7 | Ammonium oxalate monohydrate | Diazanium oxalate hydrate | 2917.11 | |
60-10-6 | Dithizone | 1-anilino-3-phenyliminothiourea | 2930.9 | |
60-11-7 | P-Dimethylaminoazobenzene | N,N-dimethyl-4-phenyldiazenylaniline | ||
60-12-8 | Phenylethyl Alcohol | 2-Phenylethanol | 2906.29 | |
601-34-3 | Cholesteryl palmitate | [(3S,8S,9S,10R,13R,14S,17R)-10,13-dimethyl-17-[(2R)-6-methylheptan-2-yl]-2,3,4,7,8,9,11,12,14,15,16,17-dodecahydro-1H-cyclopenta[a]phenanthren-3-yl] hexadecanoate | 2915.7 | |
60-13-9 | Amphetamine Sulfate | 1-phenylpropan-2-amine sulfuric acid | 2921.49 | 6 |
60142-96-3 | Gabapentin | 2-[1-(aminomethyl)cyclohexyl]acetic acid | 2922.49 | 6 |
60164-51-4 | Perfluoroalkylether | 2710.19 | ||
60166-93-0 | Iopamidol | 1-N,3-N-bis(1,3-dihydroxypropan-2-yl)-5-[[(2S)-2-hydroxypropanoyl]amino]-2,4,6-triiodobenzene-1,3-dicarboxamide | 2924.29 | 6 |
60177-36-8 | Sorbitan, Monooctanoate | [(1R)-1-[(3R,4S)-3,4-dihydroxyoxolan-2-yl]-2-hydroxyethyl] octanoate | 2932.19 | |
60181-77-3 | Acid brown 355 | 3204.12 | ||
6018-19-5 | Aminosalicylate Sodium | Sodium 4-amino-2-hydroxybenzoate dihydrate | 2922.5 | |
60-18-4 | Tyrosine | (2S)-2-amino-3-(4-hydroxyphenyl)propanoic acid | 2922.49 | |
6018-41-3 | Methyl coumalate | Methyl 6-oxopyran-3-carboxylate | 2932.2 | |
6018-89-9 | Nickel(II) acetate tetrahydrate | Nickel(2+) diacetate tetrahydrate | 2915.29 | |
6019-06-3 | Nicotine bitartrate dihydrate | 2939.99 | 6 | |
60-19-5 | Tyramine Hydrochloride | 4-(2-aminoethyl)phenol hydrochloride | 2922.29 | |
60200-06-8 | Clorsulon | 4-amino-6-(1,2,2-trichloroethenyl)benzene-1,3-disulfonamide | 2935 | |
60202-34-8 | Direct orange 118 | 3204.14 | ||
60207-90-1 | Propiconazole ; 1-[2-(2,4-dichlorophenyl)-4-propyl-1,3-dioxolan-2-ylmethyl]-1H-1,2,4-triazole | 1-[[2-(2,4-dichlorophenyl)-4-propyl-1,3-dioxolan-2-yl]methyl]-1,2,4-triazole | 2934.99 | 8 |
6020-87-7 | Creatine Monohydrate | 2-[carbamimidoyl(methyl)amino]acetic acid hydrate | ||
60209-82-7 | Isodecyl pivalate | 8-methylnonyl 2,2-dimethylpropanoate | ||
60223-95-2 | 4,5-dinonylnaphthalene-1,7-disulfonic acid | 3815.9 | ||
60-23-1 | Cysteamine | 2-Aminoethanethiol | 2930.9 | |
60-24-2 | 2-Mercaptoethanol | 2-Sulfanylethanol | 2930.9 | |
60270-33-9 | Brassicamidopropyl dimethylamine | N-methylmethanamin  | ||
60-27-5 | Creatinine | 2-amino-3-methyl-4H-imidazol-5-one | 2933.29 | |
60282-87-3 | Gestodene | (8R,9S,10R,13S,14S,17R)-13-ethyl-17-ethynyl-17-hydroxy-1,2,6,7,8,9,10,11,12,14-decahydrocyclopenta[a]phenanthren-3-one | 2937.23 | |
602-94-8 | Pentafluorobenzoic Acid | 2,3,4,5,6-pentafluorobenzoic acid | 2916.39 | |
60-29-7 | Diethyl ether | Diethyl ether | 2909.19 | 8 |
60303-68-6 | Phenol, 4-(1,1-dimethylethyl)-, polymer with sulfur chloride (S2Cl2) | 3812.3 | ||
60304-36-1 | Potassium aluminium fluoride | Aluminum;potassium;tetrafluoride | 2826.9 | |
60-31-1 | Acetylcholine Chloride | 2-acetyloxyethyl(trimethyl)azanium chloride | 2923.9 | |
60-32-2 | Aminocaproic Acid | 6-Aminohexanoic acid | 2922.49 | |
6032-29-7 | 2-Pentanol | Pentan-2-ol | 2905.19 | |
603-32-7 | Triphenylarsine | Triphenylarsine | 2931.9 | |
60-33-3 | Linoleic acid | (9Z,12Z)-octadeca-9,12-dienoic acid | ||
603-33-8 | Triphenylbismuth | Triphenylbismuthane | 2825.9 | |
603-34-9 | Triphenylamine | N,N-diphenylaniline | 2921.49 | |
603-35-0 | Triphenylphosphine | Triphenylphosphine | 2931.9 | |
603-36-1 | Triphenylstibine | Triphenylstibine | 2931.9 | |
60343-69-3 | L-Lysine sulphate | 2922.41 | ||
603-45-2 | Rosolic acid | 4-[bis(4-hydroxyphenyl)methylidene]cyclohexa-2,5-dien-1-one | ||
603-50-9 | Bisacodyl | [4-[(4-acetyloxyphenyl)-pyridin-2-ylmethyl]phenyl] acetate | 2933.39 | 6 |
6035-45-6 | Leucovorin Calcium | (2S)-2-[[4-[(2-amino-5-formyl-4-oxo-1,6,7,8-tetrahydropteridin-6-yl)methylamino]benzoyl]amino]pentanedioic acid calcium pentahydrate | 2936.29 | 6 |
6035-47-8 | Sodium formaldehydesulfoxylate hydrate | Sodium;hydroxymethanesulfinate;dihydrate | 2831.1 | |
60-35-5 | Acetamide | Acetamide | 2924.19 | |
60371-17-7 | Antarox LF 330 | 3402.13 | ||
603-76-9 | 1-Methylindole | 1-Methylindole | 2933.99 | |
60389-86-1 | Nikkol GO | (Z)-octadec-9-enoic acid 2-[2,3,4,5,6-pentakis(2-hydroxyethoxy)hexoxy]ethanol | 2916.15 | |
6041-94-7 | Pigment red 2 | 4-[(2,5-dichlorophenyl)diazenyl]-3-hydroxy-N-phenylnaphthalene-2-carboxamide | 3204.17 | |
604-32-0 | Cholesteryl Benzoate | [(3S,8S,9S,10R,13R,14S,17R)-10,13-dimethyl-17-[(2R)-6-methylheptan-2-yl]-2,3,4,7,8,9,11,12,14,15,16,17-dodecahydro-1H-cyclopenta[a]phenanthren-3-yl] benzoate | 2916.31 | |
604-44-4 | 4-Chloro-1-naphthol | 4-chloronaphthalen-1-ol | 2933.99 | |
60459-08-7 | Cobalt sulfate heptahydrate | 3402.2 | ||
6046-93-1 | Copper(II) acetate monohydrate | Copper diacetate hydrate | 2915.29 | |
60479-98-3 | Pyritinol Hydrochloride | 5-[[[5-hydroxy-4-(hydroxymethyl)-6-methylpyridin-3-yl]methyldisulfanyl]methyl]-4-(hydroxymethyl)-2-methylpyridin-3-ol;hydrate;dihydrochloride | 2933.39 | |
60506-81-2 | Dipentaerythritol Pentaacrylate | [2-(hydroxymethyl)-3-prop-2-enoyloxy-2-[[3-prop-2-enoyloxy-2,2-bis(prop-2-enoyloxymethyl)propoxy]methyl]propyl] prop-2-enoate | ||
6050-81-3 | Acetylthiocholine Chloride | 2-acetylsulfanylethyl(trimethyl)azanium chloride | 2930.9 | |
60-51-5 | Dimethoate | O,O-dimethyl S-[2-(methylamino)-2-oxoethyl] phosphorodithioate | 2930.9 | |
60-54-8 | Tetracycline | (4S,4aS,5aS,6S,12aR)-4-(dimethylamino)-1,6,10,11,12a-pentahydroxy-6-methyl-3,12-dioxo-4,4a,5,5a-tetrahydrotetracene-2-carboxamide | 2922.49 | 6 |
6055-06-7 | Morphine Hydrochloride Trihydrate | (4R,4aR,7S,7aR,12bS)-3-methyl-2,4,4a,7,7a,13-hexahydro-1H-4,12-methanobenzofuro[3,2-e]isoquinoline-7,9-diol trihydrate hydrochloride | 2939.99 | |
6055-19-2 | Cyclophosphamide | 2H-1,3,2-Oxazaphosphorin, 2-(bis(2-chloroethyl)amino)tetrahydro-,2-oxid monohydrate | 2934.99 | 6 |
60-56-0 | Methimazole | 3-methyl-1H-imidazole-2-thione | 2933.29 | 6 |
605-65-2 | Dansyl Chloride | 5-(dimethylamino)naphthalene-1-sulfonyl chloride | 2921.49 | |
605-70-9 | 1,4-Naphthalenedicarboxylic acid | Naphthalene-1,4-dicarboxylic acid | 2917.39 | |
60583-39-3 | Brucine Sulfate Heptahydrate | Brucine Sulfate Heptahydrate | 2939.99 | |
6059-47-8 | Codeine | (4R,4aR,7S,7aR,12bS)-9-methoxy-3-methyl-2,4,4a,7,7a,13-hexahydro-1H-4,12-methanobenzofuro[3,2-e]isoquinoline-7-ol hydrate | 2939.99 | 7 |
60607-34-3 | Oxatomide | 3-[3-(4-benzhydrylpiperazin-1-yl)propyl]-1H-benzimidazol-2-one | 2933.59 | |
606-28-0 | Methyl o-benzoylbenzoate | Methyl 2-benzoylbenzoate | 2916.31 | |
606-55-3 | 1-Ethyl-2-methylquinolinium iodide | 1-ethyl-2-methylquinolin-1-ium iodide | 2933.49 | |
6066-49-5 | Butylphthalide | 3-butyl-3H-2-benzofuran-1-one | 2932.2 | |
6066-82-6 | N-Hydroxysuccinimide | 1-hydroxypyrrolidine-2,5-dione | 2928 | |
606-68-8 | Disodium Nicotinamide Adenine Dinucleotide | Disodium [[(2R,3S,4R,5R)-5-(6-aminopurin-9-yl)-3,4-dihydroxyoxolan-2-yl]methoxy-oxidophosphoryl] [(2R,3S,4R,5R)-5-(3-carbamoyl-4H-pyridin-1-yl)-3,4-dihydroxyoxolan-2-yl]methyl phosphate | 2934.99 | |
60676-86-0 | Fused silica | Dioxosilane | ||
607-120-8 | Fatty acids, olive-oil, esters with polyethylene glycol mono(carboxymethyl) ether, sodium salts | 3402.13 | ||
60748-69-8 | Mannanase | 3507.9 | ||
607-80-7 | Sesamin | 5-[(3S,3aR,6S,6aR)-3-(1,3-benzodioxol-5-yl)-1,3,3a,4,6,6a-hexahydrofuro[3,4-c]furan-6-yl]-1,3-benzodioxole | 2932.99 | |
607-91-0 | Myristicin | 4-Methoxy-6-prop-2-enyl-1,3-benzodioxole | 2932.99 | |
60800-55-7 | Direct blue 201 | 3204.14 | ||
6080-56-4 | Lead Acetate | Lead(2+) diacetate trihydrate | 2915.29 | |
608-08-2 | 3-Indoxyl acetate | 1H-indol-3-yl acetate | 2933.99 | |
608-25-3 | 2-Methylresorcinol | 2-methylbenzene-1,3-diol | 2907.29 | |
60828-78-6 | Poly(oxy-1,2-ethanediyl), α-[3,5-dimethyl-1-(2-methylpropyl)hexyl]-ω-hydroxy- | 3402.13 | ||
60842-46-8 | Fluorescein isothiocyanate dextran | 3212.9 | ||
60864-33-7 | Benzyl-polyethylene glycol (1,1,3,3-tetramethylbutylphenyl) ether | 3402.13 | ||
608-66-2 | Galactitol | (2R,3S,4R,5S)-hexane-1,2,3,4,5,6-hexol | 2905.49 | |
6089-09-4 | 4-Pentynoic acid | Pent-4-ynoic acid | 2916.19 | |
608-93-5 | Pentachlorobenzene | 1,2,3,4,5-pentachlorobenzene | 2903.99 | 14 |
609-06-3 | L-xylose | (2S,3R,4S)-2,3,4,5-tetrahydroxypentanal | 2940 | |
60908-77-2 | Isohexadecane | |||
6090-95-5 | Conduritol B Epoxide | (1R,2R,3S,4S,5R,6S)-7-oxabicyclo[4.1.0]heptane-2,3,4,5-tetrol | 2910.9 | |
6091-44-7 | Piperidine Hydrochloride | Piperidine hydrochloride | 2933.32 | |
60-92-4 | Adenosine Cyclic Phosphate | (4aR,6R,7R,7aS)-6-(6-aminopurin-9-yl)-2-hydroxy-2-oxo-4a,6,7,7a-tetrahydro-4H-furo[3,2-d][1,3,2]dioxaphosphinin-7-ol | 2934.99 | |
609-36-9 | Proline | Pyrrolidine-2-carboxylic acid | 2933.99 | |
609-54-1 | 2,5-Dimethylbenzenesulfonic acid | 2,5-Dimethylbenzenesulfonic acid | 2904.1 | |
609-99-4 | 3,5-Dinitrosalicylic acid | |||
6100-05-6 | Potassium citrate | Tripotassium 2-hydroxypropane-1,2,3-tricarboxylate hydrate | ||
6100-20-5 | Potassium Trihydrogen Dioxalate Dihydrate | Potassium 2-hydroxy-2-oxoacetate;oxalic acid | 2917.11 | |
610-02-6 | 2,3,4-Trihydroxybenzoic acid | 2,3,4-Trihydroxybenzoic acid | 2918.29 | |
6104-58-1 | Acid blue 90 ; Brilliant Blue G | Benzenemethanaminium, N-[4-[[4-[(4-ethoxyphenyl)amino]phenyl][4-[ethyl[(3-sulfophenyl)methyl]amino]-2-methylphenyl]methylene]-3-methyl-2,5-cyclohexadien-1-ylidene]-N-ethyl-3-sulfo-, inner salt, monosodium salt | ||
6106-04-3 | Sodium L-glutamate monohydrate | Disodium (2S)-2-aminopentanedioate hydrate | ||
6106-21-4 | Sodium Succinate Hexahydrate | Disodium butanedioate hexahydrate | 2917.19 | |
6106-24-7 | Sodium Tartrate Dihydrate | Disodium (2R,3R)-2,3-dihydroxybutanedioate dihydrate | ||
6107-83-1 | Lead(II) citrate trihydrate | 2-Hydroxypropane-1,2,3-tricarboxylate;lead(2+);trihydrate | 2918.14 | |
6108-05-0 | Lidocaine Hydrochloride | 2-(Diethylamino)-N-(2,6-dimethylphenyl)acetamide;hydrate;hydrochloride | 2937.29 | 6 |
610-81-1 | 4-Amino-3-nitrophenol | 4-Amino-3-nitrophenol | 2922.29 | |
6108-17-4 | Lithium acetate dihydrate | Lithium acetate dihydrate | 2915.29 | |
610-92-4 | 2,5-Dihydroxyterephthalic acid | 2,5-Dihydroxyterephthalic acid | 2918.29 | |
611-008-4 | 3,6,9,12,15-Pentaoxatritriacont-24-en-1-ol, (24Z)- | 3402.13 | ||
611-14-3 | O-Ethyltoluene | 1-Ethyl-2-methylbenzene | 2902.9 | |
611-15-4 | 2-Vinyltoluene | 1-Ethenyl-2-methylbenzene | 2902.9 | 3 |
61116-28-7 | Solvent brown 43 | 3204.19 | ||
611-20-1 | 2-Hydroxybenzonitrile | 2-Hydroxybenzonitrile | 2926.9 | |
61167-58-6 | Sumilizer GM | [2-Tert-butyl-6-[(3-tert-butyl-2-hydroxy-5-methylphenyl)methyl]-4-methylphenyl] prop-2-enoate | ||
611-75-6 | Bromhexine Hydrochloride | 2,4-Dibromo-6-[[cyclohexyl(methyl)amino]methyl]aniline;hydrochloride | 2921.51 | 6 |
61177-44-4 | Clavulanate Lithium | Lithium (2R,3Z,5R)-3-(2-hydroxyethylidene)-7-oxo-4-oxa-1-azabicyclo[3.2.0]heptane-2-carboxylate | 2941.9 | |
61177-45-5 | Clavulanate Potassium | Potassium (2R,3Z,5R)-3-(2-hydroxyethylidene)-7-oxo-4-oxa-1-azabicyclo[3.2.0]heptane-2-carboxylate | 2933.59 | 6 |
6117-80-2 | Cis-2-Butene-1,4-Diol | (Z)-But-2-ene-1,4-diol | 2905.39 | |
6119-47-7 | Quinine Hydrochloride | (R)-[(2S,4S,5R)-5-Ethenyl-1-azabicyclo[2.2.2]octan-2-yl]-(6-methoxyquinolin-4-yl)methanol;dihydrate;hydrochloride | 2923.2 | 6 |
6119-70-6 | Quinine Sulfate | (R)-[(2S,5R)-5-Ethenyl-1-azabicyclo[2.2.2]octan-2-yl]-(6-methoxyquinolin-4-yl)methanol;sulfuric acid;dihydrate | 2939.2 | 6 |
61-19-8 | Adenosine Phosphate | [(2R,3S,4R,5R)-5-(6-Aminopurin-9-yl)-3,4-dihydroxyoxolan-2-yl]methyl dihydrogen phosphate | 2934.99 | 6 |
61-25-6 | Papaverine Hydrochloride | 1-[(3,4-Dimethoxyphenyl)methyl]-6,7-dimethoxyisoquinoline;hydrochloride | 2939.19 | |
612-83-9 | 3,3'-Dichlorobenzidine dihydrochloride | 4-(4-amino-3-chlorophenyl)-2-chloroaniline dihydrochloride | 2921.59 | |
612847-09-3 | Akt inhibitor VIII | 3-[1-[[4-(7-phenyl-3H-imidazo[4,5-g]quinoxalin-6-yl)phenyl]methyl]piperidin-4-yl]-1H-benzimidazol-2-one | 2933.99 | |
6130-64-9 | Penicillin G Procaine | 2-(diethylamino)ethyl 4-aminobenzoate (2S,5R,6R)-3,3-dimethyl-7-oxo-6-[(2-phenylacetyl)amino]-4-thia-1-azabicyclo[3.2.0]heptane-2-carboxylic acid hydrate | 2941.1 | 6 |
6131-90-4 | Sodium Acetate | Sodium acetate trihydrate | 2915.29 | |
6131-98-2 | Sodium bitartrate monohydrate | Sodium 2,3,4-trihydroxy-4-oxobutanoate hydrate | 2918.3 | |
6132-02-1 | Sodium carbonate | Disodium;carbonate;decahydrate | 2836.2 | |
6132-04-3 | Trisodium citrate dihydrate | Trisodium;2-hydroxypropane-1,2,3-tricarboxylate;dihydrate | 2918.15 | |
6132-05-4 | Disodium hydrogen citrate sesquihydrate | Disodium 2-(carboxymethyl)-2-hydroxybutanedioate;hydrate | 2918.15 | |
61336-70-7 | Amoxicillin Trihydrate | (2S,5R,6R)-6-[[2-amino-2-(4-hydroxyphenyl)acetyl]amino]-3,3-dimethyl-7-oxo-4-thia-1-azabicyclo[3.2.0]heptane-2-carboxylic acid trihydrate | 2941.1 | 6 |
61345-72-0 | 2,4-bis(ethenyl)phenol ; Styrenated phenol | 3812.3 | ||
613-62-7 | Benzyl 2-naphthyl ether | 2-Phenylmethoxynaphthalene | 2909.3 | |
6138-23-4 | Trehalose dihydrate | (2R,3S,4S,5R,6R)-2-(hydroxymethyl)-6-[(2R,3R,4S,5S,6R)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxyoxane-3,4,5-triol dihydrate | ||
6138-90-5 | Geranyl bromide | (2E)-1-bromo-3,7-dimethylocta-2,6-diene | 2903.39 | |
614-34-6 | p-Tolyl benzoate | (4-methylphenyl) benzoate | 2916.31 | |
61436-73-5 | 2-Allylbenzoic acid | 2-Prop-2-enylbenzoic acid | 2916.39 | |
614-45-9 | Tert-Butyl peroxybenzoate | Tert-butyl benzenecarboperoxoate | 2916.39 | |
614-47-1 | Chalcone | (E)-1,3-diphenylprop-2-en-1-one | 2914.39 | |
6145-73-9 | Tris(2-chloropropyl) phosphate | Tris(2-chloropropyl) phosphate | 2919.9 | |
6147-11-1 | Mangostin | 1,3,6-trihydroxy-7-methoxy-2,8-bis(3-methylbut-2-enyl)xanthen-9-one | 2932.99 | |
6147-37-1 | Sodium 2-methyl-1,4-dioxo-1,2,3,4-tetrahydronaphthalene-2-sulfonate, trihydrate | sodium 2-methyl-1,4-dioxo-1,2,3,4-tetrahydronaphthalene-2-sulfonate, trihydrate | 2914.7 | |
6147-53-1 | Cobaltous Acetate Tetrahydrate | Cobalt(2+) diacetate tetrahydrate | 2915.29 | |
614-75-5 | 2-Hydroxyphenylacetic acid | 2-(2-Hydroxyphenyl)acetic acid | 2918.29 | |
614-80-2 | O-Hydroxyacetanilide | N-(2-hydroxyphenyl)acetamide | 2922.29 | |
615-05-4 | 2,4-Diaminoanisole | 4-methoxybenzene-1,3-diamine | 2922.29 | |
6150-82-9 | Magnesium formate dihydrate | Magnesium diformate dihydrate | 2915.12 | |
6151-25-3 | Quercetin Dihydrate | 2-(3,4-Dihydroxyphenyl)-3,5,7-trihydroxychromen-4-one;dihydrate | 2933.99 | |
6151-30-0 | Quinacrine Hydrochloride | 4-N-(6-Chloro-2-methoxyacridin-9-yl)-1-N,1-N-diethylpentane-1,4-diamine;dihydrate;dihydrochloride | 2933.99 | |
6152-67-6 | Sodium diphenylamine-4-sulfonate | Sodium 4-anilinobenzenesulfonate | 2921.44 | |
6153-33-9 | Mebhydrolin Napadisilate | 5-Benzyl-2-methyl-3,4-dihydro-1H-pyrido[4,3-b]indole;naphthalene-1,5-disulfonic acid | 2933.99 | |
6153-39-5 | Orcinol monohydrate | 5-Methylbenzene-1,3-diol;hydrate | 2907.29 | |
6153-56-6 | Oxalic acid dihydrate | Oxalic acid dihydrate | ||
6153-64-6 | Oxytetracycline | (4S,4aR,5S,5aR,6S,12aR)-4-(Dimethylamino)-1,5,6,10,11,12a-hexahydroxy-6-methyl-3,12-dioxo-4,4a,5,5a-tetrahydrotetracene-2-carboxamide;dihydrate | 2941.3 | |
61-54-1 | Tryptamine | 2-(1H-indol-3-yl)ethanamine | 2933.99 | |
615-43-0 | 2-Iodoaniline | 2-Iodoaniline | 2921.42 | |
615-50-9 | 2,5-Diaminotoluene sulfate | 2-Methylbenzene-1,4-diamine;sulfuric acid | 2921.51 | 3 |
6155-57-3 | Saccharin Sodium | 1,1-Dioxo-1,2-benzothiazol-3-one;sodium;dihydrate | 2925.11 | |
6156-78-1 | Manganese(II) acetate tetrahydrate | Manganese (2+) diacetate tetrahydrate | 2915.29 | |
616-05-7 | 2-Bromohexanoic acid | 2-Bromohexanoic acid | 2915.9 | |
6160-80-1 | 4-Methylumbelliferyl glucuronide | (2S,3S,4S,5R,6S)-3,4,5-trihydroxy-6-[(4-methyl-2-oxo-2H-chromen-7-yl)oxy]oxane-2-carboxylic acid | ||
61617-00-3 | Zinc 4-methyl-1H-benzimidazole-2-thiolate | |||
61618-27-7 | Amfenac Sodium | Sodium 2-(2-amino-3-benzoylphenyl)acetate;hydrate | 2922.5 | 6 |
616204-22-9 | Acetyl hexapeptide-8 | (4S)-4-acetamido-5-[[(2S)-1-[[(2S)-1-[[(2S)-5-amino-1-[[(2S)-1-[[(2S)-1-amino-5-(diaminomethylideneamino)-1-oxopentan-2-yl]amino]-5-(diaminomethylideneamino)-1-oxopentan-2-yl]amino]-1,5-dioxopentan-2-yl]amino]-4-methylsulfanyl-1-oxobutan-2-yl]amino]-4-car | 3504 | |
616-25-1 | Pent-1-en-3-ol | Pent-1-en-3-ol | 2914.19 | |
616-29-5 | 1,3-Diamino-2-propanol | 1,3-Diaminopropan-2-ol | 2922.19 | |
61630-98-6 | 1,3-Dioxolan-2-one polymer with 1,6-hexanediol | 2905.39 | ||
616-38-6 | Dimethyl Carbonate | Dimethyl Carbonate | 2920.9 | 3 |
616-44-4 | 3-Methylthiophene | 3-Methylthiophene | 2934.99 | |
616-45-5 | Pyrrolidone | Pyrrolidin-2-one | 2933.79 | |
616-47-7 | 1-Methylimidazole | 1-Methylimidazole | 2922.29 | 3 |
6165-68-0 | Thiophen-2-ylboronic acid | Thiophen-2-ylboronic acid | 2933.39 | |
61682-73-3 | Pentaerythrityl Tetrabehenate | [3-Docosanoyloxy-2,2-bis(docosanoyloxymethyl)propyl] docosanoate | 2915.9 | |
61-68-7 | Mefenamic Acid | 2-(2,3-Dimethylanilino)benzoic acid | 2922.49 | 6 |
616-91-1 | Acetylcysteine | (2R)-2-acetamido-3-sulfanylpropanoic acid | 2930.9 | 6 |
61693-43-4 | 3-Amino-2,4-dichlorophenol hydrochloride | 3-Amino-2,4-dichlorophenol hydrochloride | 2922.29 | |
61698-32-6 | 4,5-Bis(hydroxymethyl)-2-phenyl-1H-imidazole | [4-(hydroxymethyl)-2-phenyl-1H-imidazol-5-yl]methanol | 2933.29 | |
61702-44-1 | 2-Chloro-P-phenylenediamine sulfate | 2-Chlorobenzene-1,4-diamine;sulfuric acid | 2921.51 | |
61703-11-5 | Disperse red 74 | 3204.11 | ||
61723-94-2 | Acid blue 142 | 3204.12 | ||
61724-11-6 | Acid brown 106 | 3204.12 | ||
61724-13-8 | Acid brown 161 | 3204.12 | ||
61724-14-9 | Acid brown 165 | 3204.12 | ||
61724-16-1 | Acid brown 191 | 3204.12 | ||
61725-12-0 | Disperse brown 3 | 3204.11 | ||
61725-69-7 | Solvent blue 44 | 3204.9 | ||
61-73-4 | Methylene blue | |||
617-45-8 | 2-Aminobutanedioic acid | 2-Aminobutanedioic acid | 2922.49 | |
617-52-7 | Dimethyl Itaconate | Dimethyl 2-methylidenebutanedioate | 2917.19 | |
6175-49-1 | 2-Dodecanone | Dodecan-2-one | 2914.19 | |
61-76-7 | Mydfrin | Hydron 3-[(1R)-1-hydroxy-2-(methylamino)ethyl]phenol;chloride | 2922.5 | |
617-84-5 | N,N-Diethylformamide | N,N-Diethylformamide | 2924.19 | |
617-86-7 | Triethylsilane | Triethylsilicon | 2931.9 | |
61788-44-1 | Styrenated phenol | 2,4-bis(ethenyl)phenol | ||
61788-45-2 | Stearamine | Octadecan-1-amine | 2921.19 | |
61788-47-4 | Fatty acids, coco | (4R,4aR,7S,7aR,12bS)-7-hydroxy-9-methoxy-3-methyl-2,4,4a,7,7a,13-hexahydro-1H-4,12-methanobenzofuro[3,2-e]isoquinoline-11-carboxylic acid | 3823.19 | |
61788-76-9 | C14-17 Chlorinated paraffin | 3812.2 | ||
61788-78-1 | Di(ethyl tallowalkylate)dimethyl ammonium chloride | 3402.12 | ||
61788-85-0 | Castor oil, hydrogenated, ethoxylated ; peg-60 hydrogenated castor oil | 3402.13 | ||
61788-89-4 | Fatty acids, C18-unsatd., dimers | |||
61788-90-7 | N,N-Dimethyl(coconut oil alkyl)amine oxide ; cocamine oxide | 3402.12 | ||
61788-93-0 | Tert-butyl N,N-dimethylcarbamate | Tert-butyl N,N-dimethylcarbamate | ||
61788-97-4 | Epoxy resins | 3812.1 | ||
61-78-9 | Aminohippuric Acid | 2-[(4-Aminobenzoyl)amino]acetic acid | 2924.29 | |
61789-09-1 | Glycerides, tallow mono-, hydrogenated | 3823.11 | ||
61789-18-2 | Quaternary ammonium compounds, coco alkyltrimethyl, chlorides | 3402.12 | ||
61789-30-8 | Potassium cocoate ; Fatty acids, coconut oil, potassium salts | 3402.11 | ||
61789-32-0 | Sodium cocoyl isethionate | 3402.9 | ||
61789-40-0 | Cocamidopropyl betaine | 3402.19 | ||
61789-51-3 | Cobalt Naphthenate | Cobalt(2+) naphthalene-2-carboxylate | 3824.1 | |
61789-52-4 | Fatty acids, tall-oil, cobalt salts | 2915.7 | ||
61789-80-8 | Distearyldimethylammonium chloride | |||
61789-85-3 | Petroleum sulfonates | 3204.11 | ||
61789-91-1 | Jojoba oil | 3301.19 | ||
61789-97-7 | Tallow | 2710.19 | ||
61790-12-3 | Fatty acids, tall-oil | |||
61790-13-4 | Sodium Naphthenate | Sodium 3-(3-ethylcyclopentyl)propanoate | 2921.45 | |
61790-33-8 | Amines, tallow alkyl | 2921.19 | ||
61790-41-8 | Soytrimonium chloride | 3402.12 | ||
61790-47-4 | Amines, rosin | 3806.9 | ||
61790-48-5 | Barium petroleum sulfonate | 2833.27 | ||
61790-49-6 | Sulfurized lard oil | 3403.99 | ||
61790-50-9 | Resin acids and rosin acids, potassium salts | 3806.2 | ||
61790-53-2 | Diatomaceous earth, natural | 3802.9 | ||
61790-63-4 | Fatty acids, coco, compds. with diethanolamine | 3402.13 | ||
61790-81-6 | Lanolin | 3402.13 | ||
61790-82-7 | Amines, hydrogenated tallow alkyl, ethoxylated | |||
61791-10-4 | Quaternary ammonium compounds, coco alkylbis(hydroxyethyl)methyl, ethoxylated, chlorides | 3402.19 | ||
61791-12-6 | PEG-40 hydrogenated castor oil | 3402.13 | ||
61791-13-7 | Alcohols, coco, ethoxylated | 3502.9 | ||
61791-14-8 | Amines, coco alkyl, ethoxylated | 3402.13 | ||
61791-24-0 | Amines, soya alkyl, ethoxylated | 3402.19 | ||
61791-26-2 | Amines, tallow alkyl, ethoxylated | |||
61791-29-5 | Fatty acids, coco, ethoxylated / PEG-12 Laurate | 3402.13 | ||
61791-31-9 | N-Cocoalkly-2,2'-iminobisethanol | |||
61791-32-0 | Glycine, N-[2-[(2-hydroxyethyl)amino]ethyl]-, N'-coco acyl derivs., monosodium salts | 3402.19 | ||
61791-34-2 | N-ethyl-N-soya morpholinium ethosulphate | 3402.12 | ||
61791-42-2 | Ethanesulfonic acid, 2-(methylamino)-, N-coco acyl derivs., sodium salts | |||
61791-44-4 | Ethanol, 2,2'-iminobis-, N-tallow alkyl derivs. | 3402.13 | ||
61791-53-5 | N-Tallow(alkyl)trimethylenediamine dioleate | 3402.12 | ||
61791-55-7 | N-Tallow-1,3-diaminopropane | 3402.12 | ||
61791-57-9 | Amines, N-tallow alkyldipropylenetri- | 3824.9 | ||
61791-63-7 | Amines, N-coco alkyltrimethylenedi- | 2921.29 | ||
61792-11-8 | 3,7-Dimethyl-2,6-nonadienenitrile | (2Z,6E)-3,7-dimethylnona-2,6-dienenitrile | 2923.9 | |
61792-31-2 | Laurylamidopropyldimethylamine Oxide | 3-(dodecanoylamino)-N,N-dimethylpropan-1-amine oxide | ||
617-94-7 | 2-Phenylpropan-2-ol | 2-Phenylpropan-2-ol | 2906.29 | |
61814-51-5 | Acid green 104 | 3204.12 | ||
61814-57-1 | Acid Yellow 218 | 3204.12 | ||
61827-42-7 | Poly(oxy-1,2-ethanediyl), α-isodecyl-ω-hydroxy- | 3402.13 | ||
618-27-9 | Cis-4-Hydroxy-L-proline | (2S,4S)-4-Hydroxypyrrolidine-2-carboxylic acid | 2933.99 | |
6184-17-4 | Riboflavin 5'-monophosphate sodium salt hydrate | Disodium [(2S,3R,4R)-5-(7,8-dimethyl-2,4-dioxobenzo[g]pteridin-10-yl)-2,3,4-trihydroxypentyl] phosphate;hydrate | 2936.23 | |
61847-48-1 | Pigment red 188 | 3204.17 | ||
61847-77-6 | Acid Black 172 | 3204.12 | ||
61849-14-7 | Prostacyclin sodium salt | 5-[5-hydroxy-4-(3-hydroxyoct-1-enyl)-3,3a,4,5,6,6a-hexahydrocyclopenta[b]furan-2-ylidene]pentanoate | 2937.5 | |
61869-08-7 | Paroxetine | (3S,4R)-3-(1,3-benzodioxol-5-yloxymethyl)-4-(4-fluorophenyl)piperidine | 2942 | 6 |
61901-18-6 | Acid brown 97 | 3204.12 | ||
61901-39-1 | Acid orange 142 | 3204.12 | ||
61901-64-2 | Basic violet 15 | 3204.13 | ||
61901-87-9 | Solvent black 29 | 3204.19 | ||
61902-11-2 | Disperse orange 29 | 3204.11 | ||
61-90-5 | Leucine | (2S)-2-amino-4-methylpentanoic acid | 2922.49 | |
619-05-6 | 3,4-Diaminobenzoic acid | 3,4-Diaminobenzoic acid | 2933.99 | |
619-21-6 | 3-Carboxybenzaldehyde | 3-Formylbenzoic acid | 2918.3 | |
6192-52-5 | P-Toluenesulfonic acid monohydrate | 4-Methylbenzenesulfonic acid;hydrate | ||
61931-02-0 | Acid black 194 | 3204.12 | ||
61931-11-1 | Acid brown 322 | 3204.12 | ||
61931-39-3 | Disperse red 202 | 3204.11 | ||
61931-52-0 | Reactive red 141 | 3204.16 | ||
61931-55-3 | Solvent yellow 88 | 3204.19 | ||
61931-80-4 | Ethyl linalyl acetate | 3,7-Dimethylnona-1,6-dien-3-yl acetate | 2915.39 | |
619-44-3 | Methyl 4-iodobenzoat | Methyl 4-iodobenzoate | 2916.39 | |
61951-36-8 | Acid red 357 | 3204.12 | ||
61951-82-4 | Reactive red 280 | (3Z)-5-[[4-chloro-6-[4-[[4-chloro-6-[[(7Z)-8-oxo-3,6-disulfo-7-[(2-sulfophenyl)hydrazinylidene]naphthalen-1-yl]amino]-1,3,5-triazin-2-yl]amino]anilino]-1,3,5-triazin-2-yl]amino]-4-oxo-3-[(2-sulfophenyl)hydrazinylidene]naphthalene-2,7-disulfonic acid | 3204.16 | |
61951-85-7 | Reactive yellow 84 | 3204.16 | ||
61951-89-1 | Solvent violet 36 | 3204.19 | ||
619-66-9 | Terephthalaldehydic acid | 4-Formylbenzoic acid | 2918.3 | |
61968-07-8 | Acid yellow 184 | 3204.12 | ||
61968-26-1 | Direct yellow 132 | 3204.14 | ||
61968-29-4 | Disperse blue 148 | 3204.11 | ||
61968-38-5 | Disperse orange 31 | 3204.11 | ||
61968-49-8 | Disperse red 159 | 3204.11 | ||
61968-66-9 | Disperse yellow 114 | 2-hydroxy-1,4-dimethyl-6-oxo-5-{[3-(phenylsulfonyl)phenyl]azo}-1,6-dihydropyridine-3-carbonitrile | 3204.11 | |
61968-70-5 | Disperse yellow 126 | 3204.11 | ||
61968-93-2 | Reactive blue 72 | 3204.16 | ||
61969-44-6 | Solvent blue 97 | 3204.9 | ||
6196-94-7 | 1-Ethyl-4-(1-phenylethyl)benzene | 1-Ethyl-4-(1-phenylethyl)benzene | 2902.9 | |
61969-47-9 | Solvent orange 60 | 3204.19 | ||
61969-51-5 | Solvent yellow 89 | 3204.19 | ||
6196-95-8 | 1,2-Dimethyl-4-(1-phenylethyl)benzene | 1,2-Dimethyl-4-(1-phenylethyl)benzene | 2902.9 | |
619-72-7 | 4-Nitrobenzonitrile | 4-Nitrobenzonitrile | 2926.9 | |
6197-30-4 | Octocrylene | 2-ethylhexyl 2-cyano-3,3-diphenylprop-2-enoate | 2926.9 | |
619-73-8 | 4-Nitrobenzyl alcohol | (4-nitrophenyl)methanol | 2906.29 | |
620-02-0 | 5-Methylfurfural ; Fragrance of 5-methylfurfural | 5-methylfuran-2-carbaldehyde | ||
62003-27-4 | Magnesium Pidolate | Magnesium (2S)-5-oxopyrrolidine-2-carboxylate | 2918.16 | |
6203-18-5 | 4-(Dimethylamino)cinnamaldehyde | (E)-3-[4-(dimethylamino)phenyl]prop-2-enal | 2922.39 | |
620-40-6 | Tribenzylamine | N,N-dibenzyl-1-phenylmethanamine | 2921.49 | |
620-45-1 | 2,6-Dichloroindophenol sodium | Sodium 4-[(3,5-dichloro-4-oxocyclohexa-2,5-dien-1-ylidene)amino]phenolate | 2925.29 | |
620-67-7 | Triheptanoin | 2,3-di(heptanoyloxy)propyl heptanoate | 3824.9 | |
620-92-8 | Bisphenol F | 4-[(4-hydroxyphenyl)methyl]phenol | 2907.29 | |
6211-15-0 | Morphine Sulfate | (4R,4aR,7S,7aR,12bS)-3-methyl-2,4,4a,7,7a,13-hexahydro-1H-4,12-methanobenzofuro[3,2-e]isoquinoline-7,9-diol sulfuric acid pentahydrate | 2939.99 | |
6211-24-1 | N-Phenylsufanilic acid barium | 4-anilinobenzenesulfonate barium(2+) | 2921.44 | |
621-23-8 | 1,3,5-Trimethoxybenzene | 1,3,5-Trimethoxybenzene | 2909.3 | |
62125-22-8 | Pentaerythityl tetraisostearate | [3-(16-methylheptadecanoyloxy)-2,2-bis(16-methylheptadecanoyloxymethyl)propyl] 16-methylheptadecanoate | ||
621-35-2 | N-(3-Aminophenyl)acetamide hydrochloride | N-(3-aminophenyl)acetamide hydrochloride | 2924.29 | |
621-37-4 | 3-Hydroxyphenylacetic acid | 2-(3-hydroxyphenyl)acetic acid | 2918.29 | |
621-42-1 | Metacetamol | N-(3-hydroxyphenyl)acetamide | 2924.29 | 6 |
62168-86-9 | Acid blue 260 | 3204.12 | ||
621-71-6 | Tricaprin | 2,3-di(decanoyloxy)propyl decanoate | 2915.9 | |
621-84-1 | Benzyl Carbamate | Benzyl Carbamate | 2924.29 | |
62202-86-2 | n-Butylethylmagnesium | Butylethylmagnesium | 3815.9 | |
62229-50-9 | Epidermal growth factor | 2937.19 | ||
62-23-7 | 4-Nitrobenzoic Acid | 4-Nitrobenzoic Acid | 2916.31 | |
62251-96-1 | Coronatine | (1S,2S)-1-[[(3aS,6R,7aS)-6-ethyl-1-oxo-2,3,3a,6,7,7a-hexahydroindene-4-carbonyl]amino]-2-ethylcyclopropane-1-carboxylic acid | 2924.29 | |
62253-63-8 | Epidermal Growth Factor | 2937.19 | ||
622-58-2 | p-Tolyl isocyanate | 1-Isocyanato-4-methylbenzene | 2929.1 | |
622-59-3 | p-Tolyl isothiocyanate | 1-Isothiocyanato-4-methylbenzene | 2930.9 | |
6226-79-5 | Acid Red 112 ; 3-Hydroxy-4-(2-Sulfo-4-[4-Sulfophenylazo]Phenylazo)-2,7-Naphthalenedisulfonic acid sodium salt | 2,7-Naphthalenedisulfonic acid, 3-hydroxy-4-[[2-sulfo-4-[(4-sulfophenyl)azo]phenyl]azo]-, tetrasodium salt | 3204.12 | |
6227-14-1 | Direct violet 9 | 3204.14 | ||
622-78-6 | Benzyl Isothiocyanate | Isothiocyanatomethylbenzene | 2930.9 | |
622-96-8 | 4-Ethyltoluene | 1-Ethyl-4-methylbenzene | 2902.9 | |
623-04-1 | 4-Aminobenzyl alcohol | (4-aminophenyl)methanol | 2922.19 | |
623-05-2 | 4-Hydroxybenzyl alcohol | 4-(hydroxymethyl)phenol | 2907.29 | |
62314-22-1 | (2-hydroxypropyl)trimethylammonium 2-ethylhexanoate | 3815.9 | ||
62314-25-4 | (2-hydroxypropyl)trimethylammonium formate | 3815.9 | ||
62-31-7 | Dopamine Hydrochloride | 4-(2-Aminoethyl)benzene-1,2-diol;hydrochloride | 2922.29 | 6 |
623172-56-5 | Palmitoyl tripeptide-5 triflate | (2S)-6-amino-2-[[(2S)-2-[[(2S)-6-amino-2-(hexadecanoylamino)hexanoyl]amino]-3-methylbutanoyl]amino]hexanoic acid;2,2,2-trifluoroacetic acid | 2933.29 | |
623-17-6 | Furfuryl acetate | Furan-2-ylmethyl acetate | 2915.39 | |
623-26-7 | Terephthalonitrile | Benzene-1,4-dicarbonitrile | 2926.9 | |
623-36-9 | 2-Methyl-2-pentenal | (E)-2-methylpent-2-enal | 2912.19 | |
62-33-9 | Edetate Calcium Disodium | Calcium disodium 2-[2-[bis(carboxylatomethyl)amino]ethyl-(carboxylatomethyl)amino]acetate | ||
62342-51-2 | Azure II Eosinate ; D&c red no. 21 | 3204.19 | ||
623-42-7 | Methyl butyrat | Methyl butyrat | 2915.6 | |
623-43-8 | Methyl crotonate | Methyl (E)-but-2-enoate | 2916.19 | |
62379-61-7 | Mischmetal (Rare Earth Metal) | Cerium; lanthanum; neodymium; praseodymium | 2805.3 | |
624-18-0 | P-Phenylenediamine dihydrochloride | Benzene-1,4-diamine;dihydrochloride | 2921.51 | 3 |
624-28-2 | 2,5-Dibromopyridine | 2,5-Dibromopyridine | 2933.39 | |
62435-71-6 | 2-(Ethoxymethyl)oxolane | 2-(Ethoxymethyl)oxolane | 2942 | |
62439-41-2 | 6-Methoxy-2,6-dimethylheptanal | 6-Methoxy-2,6-dimethylheptanal | 2912.19 | |
62442-61-9 | 4'-Aminomethyltrioxsalen hydrochloride | 3-(Aminomethyl)-2,5,9-trimethylfuro[3,2-g]chromen-7-one;hydrochloride | 2936.28 | |
624-49-7 | Dimethyl fumarate | Dimethyl (E)-but-2-enedioate | 2917.19 | |
624-92-0 | Dimethyl Disulfide | (Methyldisulfanyl)methane | ||
62-50-0 | Ethyl Methanesulfonate | Ethyl Methanesulfonate | ||
6250-23-3 | Disperse yellow 23 | 3204.11 | ||
62-51-1 | Methacholine Chloride | 2-Acetyloxypropyl(trimethyl)azanium;chloride | 2923.9 | |
62-53-3 | Aniline | Aniline | 2921.41 | 8 |
62-54-4 | Calcium acetate | Calcium diacetate | ||
62-55-5 | Thioacetamide | Ethanethioamide | 2930.9 | |
62-56-6 | Thiourea | Thiourea | ||
625-69-4 | 2,4-Pentanediol | Pentane-2,4-diol | 2905.39 | |
62570-50-7 | Disperse blue 359 | 3204.11 | ||
62571-53-3 | Tungsten(VI) ethoxide | Ethanolate tungsten | 2905.19 | |
62571-86-2 | Captopril | (2S)-1-[(2S)-2-methyl-3-sulfanylpropanoyl]pyrrolidine-2-carboxylic acid | 2933.99 | 6 |
6259-76-3 | Hexyl Salicylate | Hexyl 2-hydroxybenzoate | 2918.23 | |
625-99-0 | 1-Chloro-3-iodobenzene | 1-Chloro-3-iodobenzene | 2903.99 | |
62625-22-3 | Zincon sodium salt | Sodium (3E)-3-[(Z)-[[2-(2-carboxyphenyl)hydrazinyl]-phenylmethylidene]hydrazinylidene]-4-oxocyclohexa-1,5-diene-1-sulfonate | 2928 | |
62625-28-9 | Blue Bromophenol Sodium Salt | Sodium 2-[(3,5-dibromo-4-hydroxyphenyl)-(3,5-dibromo-4-oxocyclohexa-2,5-dien-1-ylidene)methyl]benzenesulfonate | 2914.7 | |
62625-29-0 | Cresol Red Sodium Salt | 2914.7 | ||
62625-32-5 | Bromocresol Green sodium salt | 2934.99 | ||
626-39-1 | 1,3,5-Tribromobenzene | 1,3,5-Tribromobenzene | 2903.99 | |
626-55-1 | 3-Bromopyridine | 3-Bromopyridine | 2933.39 | |
626-58-4 | 4-methylpiperidine | 4-methylpiperidine | 3815.9 | |
626-67-5 | 1-Methylpiperidine | 1-Methylpiperidine | 2933.39 | |
62669-70-9 | Rhodamine 123 | 3212.9 | ||
626-72-2 | L-Homocystine | (2S)-2-Amino-4-[[(3S)-3-amino-3-carboxypropyl]disulfanyl]butanoic acid | 2930.9 | |
62-68-0 | Proadifen Hydrochloride | 2-(diethylamino)ethyl 2,2-diphenylpentanoate;hydrochloride | 2922.49 | |
626-82-4 | Butyl Hexanoate | Butyl Hexanoate | 2915.9 | |
626-95-9 | Pentane-1,4-diol | Pentane-1,4-diol | 2905.39 | |
627-09-8 | Propargyl acetate | Prop-2-ynyl acetate | 2915.39 | |
627-18-9 | 3-Bromo-1-propanol | 3-Bromopropan-1-ol | 2905.59 | |
627-27-0 | 3-Buten-1-ol | But-3-en-1-ol | 2905.29 | |
627-30-5 | 3-Chloro-1-propanol | 3-chloropropan-1-ol | 2905.59 | |
62-73-7 | Dichlorvos | 2,2-dichloroethenyl dimethyl phosphate | 2919.9 | |
6274-12-0 | Diethylamine Hydrobromide | N-ethylethanamine hydrobromide | 2921.19 | |
62758-13-8 | Resazurin sodium salt | Sodium 10-oxido-7-oxophenoxazin-10-ium-3-olate | ||
62-76-0 | Sodium Oxalate | Disodium oxalate | 2917.11 | |
62778-12-5 | Bis[(p-aminophenyl)dimethylammonium] oxalate | Bis[(p-aminophenyl)dimethylammonium] oxalate | 2921.51 | |
627-82-7 | Diglycerin | 3-(2,3-Dihydroxypropoxy)propane-1,2-diol | 2909.49 | |
627-83-8 | Glycol distearate | 2-Octadecanoyloxyethyl octadecanoate | ||
627-93-0 | Dimethyl Adipate | Dimethyl hexanedioate | 2917.12 | |
6283-63-2 | N,N-Diethyl-P-phenylenediamine sulfate | N,N-Diethyl-P-phenylenediamine sulfate | 2921.51 | |
6283-92-7 | Dodecyl Lactate | Dodecyl 2-hydroxypropanoate | 2918.11 | |
6284-40-8 | Meglumine | (2R,3R,4R,5S)-6-(Methylamino)hexane-1,2,3,4,5-pentol | ||
628-63-7 | Amyl acetate | Amyl acetate | 2915.39 | 3 |
628-71-7 | 1-Heptyne | Hept-1-yne | 2901.29 | |
628-81-9 | Ethyl Butyl Ether | 1-Ethoxybutane | 2909.19 | |
628-97-7 | Ethyl Palmitate | Ethyl hexadecanoate | 2915.7 | |
6290-37-5 | Phenethyl Hexanoate | 2-Phenylethyl hexanoate | 2915.9 | |
629-03-8 | 1,6-Dibromohexane | 1,6-Dibromohexane | 2903.39 | |
629-11-8 | Hexanediol | Hexane-1,6-diol | 2905.39 | |
629-14-1 | 1,2-Diethoxyethane | 1,2-Diethoxyethane | 2909.44 | |
629-25-4 | Sodium Laurate | Sodium dodecanoate | ||
62929-91-3 | Procaterol hydrochloride | 8-Hydroxy-5-[(1R,2S)-1-hydroxy-2-(propan-2-ylamino)butyl]-1H-quinolin-2-one;hydrochloride | 2933.79 | |
629-41-4 | Octanediol | Octane-1,8-diol | 2905.39 | |
6294-31-1 | Hexyl Sulfide | 1-Hexylsulfanylhexane | 2930.9 | |
629-45-8 | Dibutyl Disulfide | 1-(Butyldisulfanyl)butane | 2930.9 | |
629-50-5 | Tridecane | Tridecane | 2901.1 | |
629-59-4 | Tetradecane | Tetradecane | 2901.1 | |
629-62-9 | Pentadecane | Pentadecane | 2901.1 | |
629-70-9 | Cetyl acetate  | Hexadecyl acetate | 2915.39 | |
629-73-2 | 1-Hexadecene | Hexadec-1-ene | 2710.19 | |
629-78-7 | Heptadecane | Heptadecane | 2901.1 | |
629-82-3 | Dicaprylyl Ether | 1-Octoxyoctane | 2909.19 | |
629-96-9 | Arachidyl Alcohol | Icosan-1-ol | 2905.19 | |
630-02-4 | Octacosane | Octacosane | 2901.1 | |
630-08-0 | Carbon monoxide | Carbon monoxide | 2811.21 | |
630-10-4 | Selenourea | Selenourea | 2931.9 | |
63026-01-7 | Europium(III) nitrate pentahydrate | Europium(3+);trinitrate;pentahydrate | 2846.9 | |
6303-21-5 | Hypophosphorous acid | Phosphenous acid | 2811.19 | |
63069-48-7 | 4-Chloro-2-iodoaniline | 4-Chloro-2-iodoaniline | 2921.42 | |
63084-98-0 | Bis[(4-hydroxyphenyl)ammonium] sulphate | Bis[(4-hydroxyphenyl)ammonium] sulphate | 2922.29 | |
63089-86-1 | 2-{[1,2,4,5,6-pentakis(2-hydroxyethoxy)hexan-3-yl]oxy}ethan-1-ol; tetrakis(octadec-9-enoic acid) | 3402.13 | ||
630-93-3 | Phenytoin Sodium | Sodium 5,5-diphenylimidazolidin-3-ide-2,4-dione | 2933.21 | |
6309-51-9 | Isoamyl laurate | 3-Methylbutyl dodecanoate | 2915.9 | |
63148-53-8 | Silicone ; Polysiloxane | |||
63148-56-1 | Fluorosilicone oil | Siloxanes and Silicones, Me 3,3,3-trifluoropropyl | 3403.99 | |
63148-58-3 | Polyphenyl-methylsiloxane | 3403.99 | ||
63148-62-9 | Silicone oil | Poly(dimethylsiloxane-co-methylphenylsiloxane) | 3910 | |
63148-65-2 | Polyester resin | Polyethylene terephthalate | 3404.9 | |
63148-69-6 | Alkyd resins | 2912.19 | ||
6315-89-5 | 3,4-Dimethoxyaniline | 3,4-Dimethoxyaniline | 2922.29 | |
631-61-8 | Ammonium acetate | Azanium acetate | 2915.29 | |
632-22-4 | Tetramethylurea | 1,1,3,3-Tetramethylurea | 2924.19 | |
63231-60-7 | Microcrystalline wax | |||
63231-63-0 | Ribonucleic acid diethylaminoethanol salt | 2934.99 | ||
63231-67-4 | Silica gel | Dihydroxy(oxo)silane | ||
63231-69-6 | Zeolite sieves | Aluminum; calcium; sodium; silicate | ||
63245-38-5 | 2',(2')'-bis(salicyloyl)dodecanedi(ohydrazide) | N'-(2-hydroxybenzoyl)-12-[(2-hydroxyphenyl)formohydrazido]-12-oxododecanehydrazide | 2924.29 | |
63-25-2 | Carbaryl | Naphthalen-1-yl methylcarbamate | 2924.29 | |
632-69-9 | Rose Bengal sodium salt | Disodium 4,5,6,7-tetrachloro-2',4',5',7'-tetraiodo-3-oxospiro[2-benzofuran-1,9'-xanthene]-3',6'-diolate | 3821 | |
632-79-1 | Tetrabromophthalic anhydride | 4,5,6,7-Tetrabromo-2-benzofuran-1,3-dione | 2917.39 | |
63295-48-7 | Iron(III) Trifluoromethanesulfonate | Iron(3+) trifluoromethanesulfonate | 2904.9 | |
632-99-5 | Basic fuchsin | 4,4'-[(4-methylidenecyclohexa-2,5-dien-1-ylidene)methanediyl]dianiline hydrochloride | 3204.13 | |
633-03-4 | Basic green 1 ; C.I. 42040 | N-(4-{[4-(diethylamino)phenyl](phenyl)methylidene}cyclohexa-2,5-dien-1-ylidene)-N-ethylethanaminium hydrogen sulfate | 3204.13 | |
63316-43-8 | Potassium 3-(phenylsulfonyl)benzenesulfonate | Potassium 3-(benzenesulfonyl)benzenesulfonate | 2904.1 | |
6334-25-4 | N,N,N',N'-Tetrakis(2-hydroxyethyl)adipamide | N,N,N',N'-tetrakis(2-hydroxyethyl)hexanediamide | 2924.19 | |
633-65-8 | Berberine Chloride | 2933.99 | ||
63394-02-5 | Silicone rubber | Dimethyl(oxo)silane | ||
633-96-5 | Acid orange 7 | Sodium 4-(2-hydroxy-1-naphthylazo)benzenesulfonate | 3204.9 | |
63-42-3 | Lactose | (2R,3R,4S,5R,6S)-2-(hydroxymethyl)-6-{[(2R,3S,4R,5R,6R)-4,5,6-trihydroxy-2-(hydroxymethyl)oxan-3-yl]oxy}oxane-3,4,5-triol | ||
63428-13-7 | Acetylisovaleryltylosin Tartrate | [(2R,3R,4R,5R,6R)-6-[[(2R,3R,4E,6E,9R,11R,12S,13S,14R)-12-[(2S,3R,4R,5S,6R)-5-[(2S,4R,5S,6S)-5-acetyloxy-4-hydroxy-4,6-dimethyloxan-2-yl]oxy-4-(dimethylamino)-3-hydroxy-6-methyloxan-2-yl]oxy-2-ethyl-14-hydroxy-5,9,13-trimethyl-8,16-dioxo-11-(2-oxoethyl)-1 | 2941.9 | |
63428-83-1 | Polyamide resins | 3506.91 | ||
63428-84-2 | Polyamide  | 6-Amino-N-[6-oxo-6-(6-oxohexylamino)hexyl]hexanamide | 3403.99 | |
634-36-6 | 1,2,3-Trimethoxybenzene | 1,2,3-Trimethoxybenzene | 2909.3 | |
63449-39-8 | Chlorinated paraffin ; Paraffin waxes and Hydrocarbon waxes, chloro | |||
63449-41-2 | Benzyldimethyldecylammonium Chloride | Benzyl-decyl-dimethylazanium chloride | ||
63451-35-4 | Trisodium 3-hydroxy-4-[(2-hydroxy-4-sulphonato-1-naphthyl)azo]naphthalene-2,7-disulphonate | Trisodium 3-hydroxy-4-[(2-hydroxy-4-sulphonato-1-naphthyl)azo]naphthalene-2,7-disulphonate | 2927 | |
63462-99-7 | Tetraoctadecylammonium Bromide | Tetraoctadecylazanium;bromide | 2923.9 | |
63469-23-8 | 1,1'-[[3-(dimethylamino)propyl]imino]bispropan-2-ol | 1,1'-[[3-(dimethylamino)propyl]imino]bispropan-2-ol | 2921.19 | |
634-97-9 | Pyrrole-2-carboxylic acid | 1H-pyrrole-2-carboxylic acid | 2933.99 | |
63500-71-0 | 4-Methyl-2-(2-methylpropyl)oxan-4-ol | 4-Methyl-2-(2-methylpropyl)oxan-4-ol | 2912.49 | |
635-22-3 | 4-Chloro-3-nitroaniline | 4-Chloro-3-nitroaniline | 2921.42 | 3 |
635-27-8 | 5-Chloroquinoline | 5-Chloroquinoline | 2933.49 | |
635-46-1 | 1,2,3,4-Tetrahydroquinoline | 1,2,3,4-Tetrahydroquinoline | 2933.49 | |
635-65-4 | Bilirubin | 3-[2-[[3-(2-carboxyethyl)-5-[(Z)-(3-ethenyl-4-methyl-5-oxopyrrol-2-ylidene)methyl]-4-methyl-1H-pyrrol-2-yl]methyl]-5-[(Z)-(4-ethenyl-3-methyl-5-oxopyrrol-2-ylidene)methyl]-4-methyl-1H-pyrrol-3-yl]propanoic acid | 2933.99 | |
635728-49-3 | Darunavir ethanolate | [(3aS,4R,6aR)-2,3,3a,4,5,6a-hexahydrofuro[2,3-b]furan-4-yl] N-[(2S,3R)-4-[(4-aminophenyl)sulfonyl-(2-methylpropyl)amino]-3-hydroxy-1-phenylbutan-2-yl]carbamate ethanol | 2942 | 6 |
6358-08-3 | 2-Amino-4-chloro-6-nitrophenol | 2-Amino-4-chloro-6-nitrophenol | 2922.29 | |
6358-09-4 | 2-Amino-6-chloro-4-nitrophenol | 2-Amino-6-chloro-4-nitrophenol | ||
6358-30-1 | Pigment violet 23 | Diindolo[3,2-b:3',2'-m]triphenodioxazine, 8,18-dichloro-5,15-diethyl-5,15-dihydro- | 3204.9 | |
6358-31-2 | Pigment yellow 74 | 2-[(2-methoxy-4-nitrophenyl)azo]-N-(2-methoxyphenyl)-3-oxobutanamide | 3206.19 | |
6358-57-2 | Acid red 111 | 2,7-Naphthalenedisulfonic acid, 3-[[2,2'-dimethyl-4'-[[4-[[(4-methylphenyl)sulfonyl]oxy]phenyl]azo][1,1'-biphenyl]-4-yl]azo]-4-hydroxy-, disodium salt | 3204.12 | |
6358-69-6 | Solvent green 7 | Trisodium 8-hydroxypyrene-1,3,6-trisulfonate | 3204.17 | |
6358-85-6 | Pigment yellow 12 | 2,2'-((3,3'-Dichloro(1,1'-biphenyl)-4,4'-diyl)bis(azo))bis(3-oxo-N-phenyl-butanamide); 2,2'-((3,3'-Dichloro-4,4'-biphenylylene)diazo)bisacetoanilide | 3204.17 | |
6358-87-8 | Pigment red 38 | 3204.17 | ||
6359-04-2 | Eosin methylene-blue ; Solvent red 44 | 3821 | ||
6359-05-3 | Ethyl eosin | 3212.9 | ||
635-93-8 | 5-Chlorosalicylaldehyde | 5-chloro-2-hydroxybenzaldehyde | 2913 | |
6359-50-8 | Basic yellow 21 | 3204.13 | ||
6359-98-4 | Acid yellow 17 | Disodium 2,5-dichloro-4-(5-hydroxy-3-methyl-4-(sulfophenylazo)pyrazol-1-yl)benzenesulfonate | 3204.11 | |
6360-03-8 | Tectilon red 2B | 3204.12 | ||
6361-41-7 | 2-Acetamido-8-naphthol-6-sufonic acid | 2-Acetamido-8-naphthol-6-sufonic acid | 2922.21 | |
63625-56-9 | Propylene glycol | 3802.9 | ||
6362-79-4 | Sodium 3,5-dicarboxybenzenesulfonate | Sodium 3,5-dicarboxybenzenesulfonate | 2917.39 | |
6362-80-7 | 4-Methyl-2,4-diphenyl-1-pentene | (2-methyl-4-phenylpent-4-en-2-yl)benzene | 2902.9 | |
6363-53-7 | Maltose monohydrate | (2R,3R,4R,5R)-2,3,5,6-tetrahydroxy-4-[(2R,3R,4S,5S,6R)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxyhexanal hydrate | ||
636-46-4 | 4-Hydroxyisophthalic acid | 4-Hydroxybenzene-1,3-dicarboxylic acid | 2918.29 | |
636-54-4 | Clopamide | 4-Chloro-N-[(2S,6R)-2,6-dimethylpiperidin-1-yl]-3-sulfamoylbenzamide | 2935 | 6 |
636582-62-2 | Mosapride citrate dihydrate | 2942 | ||
636-61-3 | D-(+)-malic acid | (2R)-2-Hydroxybutanedioic acid | 2918.19 | |
63-68-3 | Methionine | (2S)-2-Amino-4-methylsulfanylbutanoic acid | ||
636-94-2 | 2-Hydroxyterephthalic acid | 2-Hydroxyterephthalic acid | 2918.29 | |
63700-19-6 | Uridine 5′-diphosphoglucuronic acid trisodium salt | Trisodium 6-[[[5-(2,4-dioxopyrimidin-1-yl)-3,4-dihydroxyoxolan-2-yl]methoxy-oxidophosphoryl]oxy-oxidophosphoryl]oxy-3,4,5-trihydroxyoxane-2-carboxylate | 2934.99 | |
6370-08-7 | Acid blue 158 | Chromate(2-), hydroxy[3-(hydroxy-.kappa.O)-4-[[1-(hydroxy-.kappa.O)-8-sulfo-2-naphthalenyl]azo-.kappa.N1]-1-naphthalenesulfonato(4-)]-, disodium, (T-4)- | 3204.12 | |
637-01-4 | Tetramethyl-P-phenylenediamine dihydrochloride | 1-N,1-N,4-N,4-N-tetramethylbenzene-1,4-diamine;dihydrochloride | 2921.59 | |
637-12-7 | Aluminium stearate | Aluminum octadecanoate | ||
637-39-8 | Triethanolamine hydrochloride | 2-[bis(2-hydroxyethyl)amino]ethanol hydrochloride | 2922.19 | |
63-74-1 | Sulfanilamide | 4-Aminobenzenesulfonamide | 2935 | |
637-44-5 | Phenylpropiolic acid | 3-Phenylprop-2-ynoic acid | 2916.39 | |
6375-55-9 | Acid yellow 42 | Disodium 4,4'-bis(3-methyl-5-oxo-1-phenyl-1H-pyrazol-4-ylazo)-1,1'-biphenyl-2,6'-disulfonate | 3204.12 | |
637-69-4 | 4-Vinylanisole | 1-Ethenyl-4-methoxybenzene | 2909.3 | |
6378-65-0 | Hexyl Hexanoate | Hexyl Hexanoate | 2915.9 | |
637-88-7 | 1,4-Cyclohexanedione | Cyclohexane-1,4-dione | 2914.29 | |
6378-87-6 | Acid blue 121 | 3204.9 | ||
637-89-8 | 4-Mercaptophenol | 4-Sulfanylphenol | 2930.9 | |
63793-60-2 | Poly[oxy(methyl-1,2-ethanediyl)], a-tetradecyl-w-hydroxy- | 2905.45 | ||
63798-35-6 | Acetylated distarch adipate | 6-O-[2-[6-[5-acetyloxy-4-hydroxy-2-(hydroxymethyl)-6-methyloxan-3-yl]oxy-2-[[3,4-dihydroxy-6-(hydroxymethyl)-5-methoxyoxan-2-yl]oxymethyl]-4,5-dihydroxyoxan-3-yl]oxy-4-hydroxy-6-(hydroxymethyl)-5-methoxyoxan-3-yl] 1-O-[4,5-dihydroxy-2-(hydroxymethyl)-6-me | 3505.1 | |
63799-53-1 | Propylene glycol isostearate | 2915.7 | ||
63800-37-3 | Sepiolite | Dimagnesium dioxido (oxo) silane hydroxy-oxido-oxosilane hydrate | ||
638-07-3 | Ethyl 4-chloroacetoacetate | Ethyl 4-chloro-3-oxobutanoate | 2918.3 | |
6381-59-5 | Potassium sodium tartrate tetrahydrate | Potassium sodium 2,3-dihydroxybutanedioate tetrahydrate | ||
638-16-4 | 2,4,6-Trimercapto-s-triazine | 1,3,5-Triazinane-2,4,6-trithione | ||
6381-77-7 | Sodium erythorbate | Sodium (2R)-2-[(2R)-3,4-dihydroxy-5-oxo-2H-furan-2-yl]-2-hydroxyethanolate | 2932.2 | |
6381-79-9 | Potassium carbonate hydrate | Tetrapotassium; dicarbonate; trihydrate | 2836.4 | |
6381-92-6 | Disodium EDTA dihydrate | Disodium 2-[2-[carboxylatomethyl(carboxymethyl)amino]ethyl-(carboxymethyl)amino]acetate dihydrate | ||
638-23-3 | Carbocysteine | (2R)-2-amino-3-(carboxymethylsulfanyl)propanoic acid | 2930.9 | 6 |
638-38-0 | Manganese(II) acetate | Manganese(2+) diacetate | 2915.29 | |
63-84-3 | 3,4-Dihydroxy-DL-phenylalanine | 2-Amino-3-(3,4-dihydroxyphenyl)propanoic acid | 2922.5 | |
63843-89-0 | Bis(1,2,2,6,6-pentamethyl-4-piperidyl)((3,5-bis(1,1-dimethylethyl)-4-hydroxyphenyl)methyl)butylmalonate | Bis (1,2,2,6,6-pentamethyl-4-piperidinyl)-[[3,5-bis(1,1-dimethylethyl)-4-hydroxyphenyl]methyl]-butylmalonate | ||
638-68-6 | Triacontane | Triacontane | 2901.1 | |
63-91-2 | Phenylalanine | (2S)-2-Amino-3-phenylpropanoic acid | ||
639-46-3 | Morphine-N-Oxide | (4R,4aR,7S,7aR,12bS)-3-methyl-3-oxido-2,4,4a,7,7a,13-hexahydro-1H-4,12-methanobenzofuro[3,2-e]isoquinoline-3-ium-7,9-diol | 2939.19 | 7 |
6397-02-0 | Acid blue 129 | 3204.12 | ||
64013-70-3 | Kanamycin Acid Sulfate | (2R,3S,4S,5R,6R)-2-(aminomethyl)-6-[(1R,2R,3S,4R,6S)-4,6-diamino-3-[(2S,3R,4S,5S,6R)-4-amino-3,5-dihydroxy-6-(hydroxymethyl)oxan-2-yl]oxy-2-hydroxycyclohexyl]oxyoxane-3,4,5-triol;sulfuric acid | 2941.9 | 6 |
64022-61-3 | Tetrakis(2,2,6,6-tetramethylpiperidin-4-yl) butane-1,2,3,4-tetracarboxylate | Tetrakis(2,2,6,6-tetramethylpiperidin-4-yl) butane-1,2,3,4-tetracarboxylate | 2933.99 | |
64-02-8 | Sodium edetate | Tetrasodium 2-[2-[bis(carboxylatomethyl)amino]ethyl-(carboxylatomethyl)amino]acetate | 2922.49 | |
64044-51-5 | Lactose monohydrate | (2R,3R,4S,5S,6S)-2-(hydroxymethyl)-6-[(2R,3R,4R,5R,6S)-4,5,6-trihydroxy-2-(hydroxymethyl)oxan-3-yl]oxyoxane-3,4,5-triol hydrate | ||
64049-55-4 | triethyl(phenethyl)ammonium iodide | Triethyl(2-phenylethyl)azanium;iodide | 2827.6 | |
64057-70-1 | MDMA Hydrochloride | 1-(1,3-benzodioxol-5-yl)-N-methylpropan-2-amine;hydrochloride | 2922.29 | |
6406-53-7 | Solvent red 32 | 4-hydroxy-3-[{2-methyl-4-[(2-methylphenyl)azo]phenyl}azo]naphthalene-2,7-disulfonic acid — N-cyclohexylcyclohexanamine (1:1) | 3204.9 | |
64071-86-9 | Fast black K salt | 3204.9 | ||
6407-75-6 | Pigment yellow 10 | 3205 | ||
6408-26-0 | Acid red 180 | 3204.12 | ||
6408-29-3 | Acid violet 90 | Chromate(3-), bis[4-[[4,5-dihydro-3-methyl-5-(oxo-.kappa.O)-1-phenyl-1H-pyrazol-4-yl]azo-.kappa.N1]-3-(hydroxy-.kappa.O)-1-naphthalenesulfonato(3-)]-, disodium hydrogen | 3204.12 | |
6408-31-7 | Acid red 183 | 3204.12 | ||
6408-57-7 | Acid Green 27 | Disodium 2,2'-(anthraquinone-1,4-diyldiimino)bis(5-butylbenzenesulfonate) | 3204.12 | |
6408-72-6 | Disperse violet 26 | 3204.11 | ||
6410-30-6 | Pigment red 8 | 2-Naphthalenecarboxamide, N-(4-chlorophenyl)-3-hydroxy- 4-[(2-methyl-5-nitrophenyl) azo]- | 3204.17 | |
6410-41-9 | Pigment red 5 | 3204.17 | ||
64-10-8 | Phenylurea | Phenylurea | 2924.21 | |
6413-10-1 | Ethyl 2-methyl-1,3-dioxolane-2-acetate | Ethyl 2-(2-methyl-1,3-dioxolan-2-yl)acetate | 2915.39 | |
64165-64-6 | Propargyl glycine | 2-Aminopent-4-ynoic acid | 2922.49 | |
6416-66-6 | Acid red 249 | 2,7-Naphthalenedisulfonic acid, 3-[(5-chloro-2-phenoxyphenyl)azo]-4-hydroxy-5-[[(4-methylphenyl)sulfonyl]amino]-, disodium salt | 3204.12 | |
641-70-3 | 3-Nitrophthalic anhydride | 4-Nitro-2-benzofuran-1,3-dione | 2917.39 | |
64-17-5 | Ethyl alcohol | Ethanol | 3 | |
64-18-6 | Formic acid | 3 | ||
6419-19-8 | Amino tris(methylene phosphonic acid) | [Bis(phosphonomethyl)amino]methylphosphonic acid | 2931.9 | |
64-19-7 | Acetic acid | Acetic acid | 2915.21 | |
64-20-0 | Tetramethylammonium Bromide | Tetramethylazanium;bromide | 2923.9 | |
64221-86-9 | Imipenem | (5R,6S)-3-[2-(aminomethylideneamino)ethylsulfanyl]-6-[(1R)-1-hydroxyethyl]-7-oxo-1-azabicyclo[3.2.0]hept-2-ene-2-carboxylic acid | 2912.49 | 6 |
6422­86­2 | Bis(2-ethylhexyl) terephthalate | Bis(2-ethylhexyl) benzene-1,4-dicarboxylate | ||
64249-01-0 | Anilofos | S-{2-[(4-chlorophenyl)(isopropyl)amino]-2-oxoethyl} O,O-dimethyl dithiophosphate | 2930.9 | 8 |
6425-39-4 | Dimorpholinodiethyl Ether | 4-[2-(2-morpholin-4-ylethoxy)ethyl]morpholine | ||
64265-57-2 | Trimethylolpropane tris[3-(2-methylaziridinyl)propanoate] | |||
6428-31-5 | Direct black 19 ; C.I. 35255 | 3204.14 | ||
64294-88-8 | Disperse violet 63 | 3204.11 | ||
64294-91-3 | Pigment yellow 43 ; C.I. 77492 | 3206.19 | ||
64-31-3 | Morphine Sulfate | (4R,4aR,7S,7aR,12bS)-3-methyl-2,4,4a,7,7a,13-hexahydro-1H-4,12-methanobenzofuro[3,2-e]isoquinoline-7,9-diol sulfuric acid | 2933.39 | 7 |
64338-16-5 | 2,2,4,4-Tetramethyl-7-oxa-3,20-diazadispiro[5.1.11.2]-henicosan-21-one | 2,2,4,4-Tetramethyl-7-oxa-3,20-diazadispiro[5.1.11.2]-henicosan-21-one | 2934.99 | |
64359-81-5 | 4,5-Dichloro-2-octyl-3-isothiazolone | 4,5-Dichloro-2-octyl-1,2-thiazol-3-one | 2934.1 | |
64365-11-3 | Activated carbon | Charcoal, activated | 3802.9 | |
64366-70-7 | 2-Ethyl Hexanol EO-PO | 3402.13 | ||
643-79-8 | O-Phthalaldehyde | Phthalaldehyde | ||
64401-02-1 | Ethoxylated bisphenol A diacrylate | 3824.9 | ||
6440-58-0 | 1,3-Di(hydroxymethyl) -5,5-dimethylhydantoin | 1,3-bis(hydroxymethyl)-5,5-dimethylimidazolidine-2,4-dione | ||
64425-86-1 | Alcohols, C13-15, ethoxylated | 3402.13 | ||
64431-96-5 | 1,3-Bis[tris(hydroxymethyl)methylamino]propane | 2-[3-[[1,3-dihydroxy-2-(hydroxymethyl)propan-2-yl]amino]propylamino]-2-(hydroxymethyl)propane-1,3-diol | 2922.19 | |
64436-13-1 | Arsenobetaine | 2-Trimethylarsoniumylacetate | 2931.9 | |
64461-82-1 | Tizanidine Hydrochloride | 5-Chloro-N-(4,5-dihydro-1H-imidazol-2-yl)-2,1,3-benzothiadiazol-4-amine;hydrochloride | 2933.99 | 6 |
64-47-1 | Physostigmine Sulfate | [(3aS,8bS)-3,4,8b-trimethyl-1,2,3,3a-tetrahydropyrrolo[2,3-b]indol-3-ium-7-yl] N-methylcarbamate;sulfate | 2939.99 | 6 |
64485-93-4 | Cefotaxime Sodium | Sodium (6R,7R)-3-(acetyloxymethyl)-7-[[(2Z)-2-(2-amino-1,3-thiazol-4-yl)-2-methoxyiminoacetyl]amino]-8-oxo-5-thia-1-azabicyclo[4.2.0]oct-2-ene-2-carboxylate | 2941.9 | 6 |
6448-95-9 | Pigment red 22 | 2-Naphthalenecarboxamide, 3-hydroxy-4-[(2-methyl-5-nitrophenyl) azo]-N-phenyl- | 3204.17 | |
645-08-9 | Isovanillic Acid | 3-Hydroxy-4-methoxybenzoic acid | 2918.99 | |
64519-82-0 | Isomalt | (3R,4R,5R)-6-[(2S,3R,4S,5S,6R)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxyhexane-1,2,3,4,5-pentol | 2940 | |
645337-39-9 | Hexyldecyl myristoyl methylaminopropionate | 2-hexyldecyl 3-[methyl(tetradecanoyl)amino]propanoate | 3402.13 | |
645-35-2 | Histidine Monohydrochloride | (2S)-2-amino-3-(1H-imidazol-5-yl)propanoic acid;hydrochloride | 2933.29 | |
64544-07-6 | Cefuroxime Axetil | 1-acetyloxyethyl (6R,7R)-3-(carbamoyloxymethyl)-7-[[(2Z)-2-(furan-2-yl)-2-methoxyiminoacetyl]amino]-8-oxo-5-thia-1-azabicyclo[4.2.0]oct-2-ene-2-carboxylate | 2941.9 | 6 |
64553-79-3 | Solvent blue 79 | 3204.19 | ||
645-93-2 | Ammelide | 6-amino-1H-1,3,5-triazine-2,4-dione | 2933.69 | |
646-04-8 | Trans-2-Pentene | (E)-Pent-2-ene | 2901.29 | |
646-06-0 | Dioxolane | 1,3-Dioxolane | 2932.99 | 3 |
646-19-5 | Heptamethylenediamine | Heptane-1,7-diamine | 2921.29 | |
64628-44-0 | Triflumuron | 2-chloro-N-{[4-(trifluoromethoxy)phenyl]carbamoyl}benzamide | 2924.21 | 8 |
646-30-0 | Nonadecanoic Acid | Nonadecanoic Acid | 2915.9 | |
64638-07-9 | Dimethoxybromoampheta mine (DOB) | 1-(4-Bromo-2,5-dimethoxyphenyl)propan-2-amine | 2922.49 | 7 |
64665-57-2 | Sodium Tolyltriazole | 2933.99 | ||
64-67-5 | Diethyl sulfate | Diethyl sulfate | 2902.9 | 8 |
64-69-7 | Iodoacetic Acid | 2-Iodoacetic acid | 2915.9 | 3 |
6470-18-4 | N-(7-Hydroxynaphthalen-1-yl)acetamide | N-(7-Hydroxynaphthalen-1-yl)acetamide | 2924.29 | |
6470-24-9 | Fluorescent Brightener 220 | 3204.2 | ||
64706-30-5 | Fluoro rubber | Vinylidienefluoridehexafluropropylene | 3404.9 | |
6471-49-4 | Pigment red 23 | 3204.17 | ||
6471-50-7 | Pigment red 14 | 3204.17 | ||
64-72-2 | Chlortetracycline Hydrochloride | (4S,4aS,6S,12aR)-7-chloro-4-(dimethylamino)-1,6,10,11,12a-pentahydroxy-6-methyl-3,12-dioxo-4,4a,5,5a-tetrahydrotetracene-2-carboxamide;hydrochloride | 2941.3 | |
6473-13-8 | Direct black 22 | Trisodium 6-[(2,4-diaminophenyl)azo]-3-[[4-[[4-[[7-[(2,4-diaminophenyl)azo]-1-hydroxy-3-sulphonato-2-naphthyl]azo]phenyl]amino]-3-sulphonatophenyl]azo]-4-hydroxynaphthalene-2-sulphonate | 3204.14 | |
64741-42-0 | Naphtha (petroleum), unsweetened | 2709 | ||
64741-44-2 | Straight run middle distillate | |||
64741-47-5 | Natural gas condensates (petroleum) | 2709 | ||
64741-50-0 | Distillates(petroleum), light paraffinic | 2710.19 | ||
64741-57-7 | Gas oil | 2710.19 | ||
64741-65-7 | Naphtha (petroleum), heavy alkylate | 2710.19 | ||
64741-66-8 | Naphtha (petroleum), light alkylate | 2710.19 | ||
64741-76-0 | Distillates (petroleum), heavy hydrocracked | 2712.9 | ||
64741-79-3 | Petroleum Coke | |||
64741-88-4 | Highly refined base oil (IP 346 DMSO extract < 3%) | 2710.19 | ||
64741-96-4 | Petroleum oil (Severely solvent-refined and/or severely hydrotreated) | 2710.19 | ||
64742-01-4 | Residual oils (petroleum), solvent-refined | 2710.19 | ||
64742-10-5 | Highly-refined mineral oils | 2710.19 | ||
64742-16-1 | Petroleum resins | 2710.19 | ||
64742-43-4 | N-paraffin and isoparaffin waxes | 2712.2 | ||
64742-46-7 | Distillates (petroleum), hydrotreated middle | C13-15 alkane | ||
64742-47-8  | C13-14 isoparaffin ; Distillates (petroleum), hydrotreated light | Alkanes, C13-14-iso | ||
64742-48-9 | Naphtha (petroleum), hydrotreated heavy (benzene | |||
64742-49-0 | Petroleum ether  | 2710.12 | ||
64742-51-4 | Paraffin waxes (petroleum), hydrotreated | 2712.9 | ||
64742-52-5 | Hydrotreated Heavy Naphthenic Petroleum Distillates | 2710.19 | ||
64742-53-6 | Distillates (petroleum), hydrotreated light naphthenic | 2710.99 | ||
64742-54-7  | Distillates (petroleum), hydrotreated heavy paraffinic | 2710.19 | ||
64742-55-8 | Distillates, hydrotreated light paraffinic | 2710.19 | ||
64742-56-9 | Distillates (petroleum), solvent-dewaxed light paraffinic | 2710.19 | ||
64742-57-0 | Residual oils (petroleum), hydrotreated; baseoil-unspecified | 2710.19 | ||
64742-60-5 | Hydrocarbon waxes, petroleum, hydrotreated microcrystalline | 2712.9 | ||
64742-61-6 | Slack wax | 2712.9 | ||
64742-62-7 | Residual oils (petroleum), solvent-dewaxed | 2710.19 | ||
64742-63-8 | Distillates (petroleum), solvent-dewaxed heavy naphthenic | 2710.19 | ||
64742-65-0 | Distillates (petroleum), solvent-dewaxed heavy paraffinic | 2710.19 | ||
647-42-7 | 2-(Perfluorohexyl)ethanol | 3,3,4,4,5,5,6,6,7,7,8,8,8-tridecafluorooctan-1-ol | 2905.59 | |
64742-70-7 | Petroleum paraffinic base oil | 2710.19 | ||
64742-71-8 | Catalytic dewaxed light paraffinic oil (petroleum) | 2710.19 | ||
64742-79-6 | Gas oils (petroleum), hydrodesulfurized | 2710.19 | ||
64742-80-9 | Hydrodesulphurised middle distillate (petroleum) | 2710.19 | ||
64742-81-0 | Kerosine (petroleum), hydrodesulfurized | 2710.19 | ||
64742-82-1  | Naphtha (petroleum), hydrodesulfurized heavy | 1,3-Xylene; 2-methyldecane; hex-1-ene; methylcyclohexane | ||
64742-89-8 | Solvent naphtha (petroleum), light aromatic | 2715 | ||
64742-93-4 | Asphalt,oxidized | 2715 | ||
64742-94-5 | Solvent naphtha (petroleum), heavy arom. | 2707.99 | ||
64742-95-6 | Solvent naphta(petroleum), light aromatic | 2710.12 | ||
64743-05-1 | Calcined petroleum coke | Hydrogen sulfide | ||
64-75-5 | Tetracycline Hydrochloride | (4S,4aS,5aS,6S,12aR)-4-(dimethylamino)-1,6,10,11,12a-pentahydroxy-6-methyl-3,12-dioxo-4,4a,5,5a-tetrahydrotetracene-2-carboxamide;hydrochloride | ||
64771-71-7 | Paraffins (petroleum), normal C>10 | 2901.1 | ||
64771-72-8 | Heavy normal paraffin | 2710.19 | ||
64772-40-3 | o-Phenylene phosphorochloridite | 3202.9 | ||
64787-97-9 | Sodium formaldehyde hydrogen sulfite 1,3,5-triazine-2,4,6-triamine | 3824.4 | ||
6483-64-3 | Solvent red 18 | 3204.19 | ||
6484-52-2 | Ammonium nitrate | Ammonium nitrate | 3102.3 | |
64852-22-8 | Glyceryl poly(oxypropylene) triamine | 2-aminopropan-1-ol propane-1,2-diol propane-1,2,3-triol | 3824.9 | |
6485-39-8 | Manganese Gluconate | Manganese (2R,3S,4R,5R)-2,3,4,5,6-pentahydroxyhexanoic acid | 2918.16 | |
6485-40-1 | Carvone | (5R)-2-methyl-5-prop-1-en-2-ylcyclohex-2-en-1-one | 2914.29 | |
6486-23-3 | Pigment yellow 3 | Butanamide, 2-[(4-chloro-2-nitrophenyl) azo]-N-(2-chlorophenyl)-3- oxo- | 3207.1 | |
64-86-8 | Colchicine | N-[(7S)-1,2,3,10-tetramethoxy-9-oxo-6,7-dihydro-5H-benzo[a]heptalen-7-yl]acetamide | ||
6487-48-5 | Potassium Oxalate Monohydrate | Dipotassium;oxalate;hydrate | 2917.11 | |
648891-82-1 | Disodium Lauriminodipropionate Tocopheryl Phosphates | 2919.9 | ||
64896-70-4 | Isosorbide dicaprylate | [(3S,3aR,6R,6aR)-6-octanoyloxy-2,3,3a,5,6,6a-hexahydrofuro[3,2-b]furan-3-yl] octanoate | 3824.9 | |
6493-05-6 | Pentoxifylline | 3,7-Dimethyl-1-(5-oxohexyl)purine-2,6-dione | 2933.59 | |
65039-09-0 | 1-Ethyl-3-methylimidazolium chloride | 1-Ethyl-3-methylimidazol-3-ium;chloride | 2933.29 | |
650-51-1 | Sodium Trichloroacetate | Sodium;2,2,2-trichloroacetate | 2915.4 | 3 |
6505-28-8 | Pigment orange 16 | 3204.17 | ||
65059-61-2 | Quaternium-82 | 3402.9 | ||
65072-00-6 | Casein hydrolysate | |||
65113-99-7 | Sandalore | 3-Methyl-5-(2,2,3-trimethylcyclopent-3-en-1-yl)pentan-2-ol | 2906.19 | |
65140-91-2 | Calcium bis[ethyl(3,5-di-tert-butyl-4-hydroxylbenzyl)phosphonate] | Calcium bis[ethyl(3,5-di-tert-butyl-4-hydroxylbenzyl)phosphonate] | ||
65141-46-0 | Nicorandil | 2-(Pyridine-3-carbonylamino)ethyl nitrate | 2933.39 | 6 |
65162-13-2 | 1-Methoxy-5-methylphenazinium methyl sulfate | 1-Methoxy-5-methylphenazinium methyl sulfate | 2933.99 | |
65-19-0 | Yohimbine Hydrochloride | Methyl (1S,15R,18S,19R,20S)-18-hydroxy-1,3,11,12,14,15,16,17,18,19,20,21-dodecahydroyohimban-19-carboxylate;hydrochloride | 2939.99 | |
65195-55-3 | Abamectin | 8 | ||
65195-56-4 | Abamectin | 8 | ||
65208-41-5 | Calcium 2-sulfidoacetate | Calcium 2-sulfidoacetate trihydrate | 2930.9 | |
65212-77-3 | Pigment yellow 183 | Benzenesulfonic acid, 4,5-dichloro-2-[[4,5-dihydro- 3-methyl-5-oxo-1-(3-sulfophenyl)- 1H-pyrazol-4-yl]azo]-, calcium salt (1:1) | 3204.17 | |
652154-10-4 | Brucine Sulfate Hydrate | (4aR,5aS,8aR,13aS,15aS,15bR)-10,11-Dimethoxy-4a,5,5a,7,8,13a,15,15a,15b,16-decahydro-2H-4,6-methanoindolo[3,2,1-ij]oxepino[2,3,4-de]pyrrolo[2,3-h]quinoline-14-one;sulfuric acid;hydrate | 2939.99 | |
65-23-6 | Pyridoxine | 4,5-bis(hydroxymethyl)-2-methylpyridin-3-ol | 2936.25 | 6 |
65277-42-1 | Ketoconazole | 1-[4-[4-[[(2R,4S)-2-(2,4-dichlorophenyl)-2-(imidazol-1-ylmethyl)-1,3-dioxolan-4-yl]methoxy]phenyl]piperazin-1-yl]ethanone | 2934.99 | 6 |
6528-34-3 | Pigment yellow 65 | 3204.17 | ||
65-31-6 | Nicotine ditartrate | 2,3-dihydroxybutanedioic acid 3-(1-methylpyrrolidin-2-yl)pyridine | 2933.59 | |
6533-00-2 | Norgestrel | (10R,13S,17R)-13-Ethyl-17-ethynyl-17-hydroxy-1,2,6,7,8,9,10,11,12,14,15,16-dodecahydrocyclopenta[a]phenanthren-3-one | 2937.29 | 6 |
6533-68-2 | Scopolamine hydrobromide | (-)-6,7-Epoxytropyltropate Hydrobromide Trihydrate | 2939.99 | 6 |
6535-46-2 | Pigment red 112 | 2-Naphthalenecarboxamide, 3-hydroxy-N-(2-methylphenyl)- 4-[(2,4,5-trichlorophenyl) azo]- | 3204.17 | |
6535-47-3 | Pigment red 13 | 3204.17 | ||
6535-70-2 | 2-Amino-5-hydroxynaphthalene-1,7-disulfonic acid | 2-Amino-5-hydroxynaphthalene-1,7-disulfonic acid | 2922.21 | |
65381-09-1 | Decanoic acid, ester with 1,2,3-propanetriol octanoate | 2915.9 | ||
65405-72-3 | Oxyoctaline Formate | (2,4a,5,8a-Tetramethyl-1,2,3,4,7,8-hexahydronaphthalen-1-yl) formate | 2915.29 | |
65405-77-8 | Cis-3-Hexenyl salicylate | [(Z)-Hex-3-enyl] 2-hydroxybenzoate | 2918.23 | |
65423-83-8 | Oxirane, methyl-, polymer with oxirane, mono(hydrogen sulfate), dodecyl ether, sodium salt | 3402.9 | ||
65447-77-0 | Poly(4-hydroxy-2,2,6,6-tetramethyl-1-piperidineethanol-alt-1,4-butanedioic acid) | 2-(4-methoxy-2,2,6,6-tetramethylpiperidin-1-yl)ethyl 4-oxopentanoate | ||
65-45-2 | Salicylamide | 2-Hydroxybenzamide | 2924.29 | |
65454-33-3 | Disodium 5'-ribonucleotide | 2934.99 | ||
65460-52-8 | Tetraisopropyl di(dioctylphosphate) titanate | Dioctyl hydrogen phosphate propan-2-ol titanium | 3824.9 | |
65-46-3 | Cytidine | 4-Amino-1-[(2R,3R,4S,5R)-3,4-dihydroxy-5-(hydroxymethyl)oxolan-2-yl]pyrimidin-2-one | 2934.99 | |
654671-77-9 | Sitagliptin Phosphate | (3R)-3-Amino-1-[3-(trifluoromethyl)-6,8-dihydro-5H-[1,2,4]triazolo[4,3-a]pyrazin-7-yl]-4-(2,4,5-trifluorophenyl)butan-1-one;phosphoric acid;hydrate | 2933.99 | 6 |
65497-29-2 | Guar hydroxypropyltrimonium chloride | 3402.12 | ||
65504-94-1 | 2-Ethoxymethylpyrazine | 2-(Ethoxymethyl)pyrazine | 2933.99 | |
65546-85-2 | Evening Primrose Oil | 3301.9 | ||
6556-12-3 | Glucuronic Acid | (2S,3S,4S,5R)-2,3,4,5-Tetrahydroxy-6-oxohexanoic acid | 2933.99 | |
656-53-1 | 4-Methyl-5-thiazolylethyl acetate | 2-(4-Methyl-1,3-thiazol-5-yl)ethyl acetate | 2934.1 | |
65666-07-1 | Silymarin | 2932.99 | 6 | |
65-71-4 | Thymine | 5-Methyl-1H-pyrimidine-2,4-dione | 2933.59 | |
657-24-9 | Metformin | 3-(Diaminomethylidene)-1,1-dimethylguanidine | 2925.29 | 6 |
657-27-2 | Lysine Hydrochloride | (2S)-2,6-Diaminohexanoic acid;hydrochloride | 2922.41 | |
65733-16-6 | S-Methoprene | Propan-2-yl (2E,4E,7S)-11-methoxy-3,7,11-trimethyldodeca-2,4-dienoate | 2918.99 | |
657408-07-6 | 2-Dicyclohexylphosphino-2',6'-dimethoxybiphenyl | Dicyclohexyl-[2-(2,6-dimethoxyphenyl)phenyl]phosphane | 2931.9 | |
657-84-1 | Sodium Toluenesulfonate | Sodium 4-methylbenzenesulfonate | ||
6578-72-1 | Tai-Ace S 100 | 2833.22 | ||
65799-47-5 | 3-Glycidoxypropyldimethoxymethylsilane | Dimethoxy-methyl-[3-(oxiran-2-ylmethoxy)propyl]silane | 2931.9 | |
6583-06-8 | 4-Nitro-2,1,3-benzothiadiazole | 4-Nitro-2,1,3-benzothiadiazole | 2934.99 | |
65-85-0 | Benzoic Acid | Benzoic Acid | 2916.31 | |
6586-04-5 | Toluidine blue | (7-amino-8-methylphenothiazin-3-ylidene)-dimethylazanium;dichlorozinc;dichloride | ||
65-86-1 | Orotic Acid | 2,4-Dioxo-1H-pyrimidine-6-carboxylic acid | 2933.59 | |
65894-83-9 | Fragrance of 4,5-dimethyl-2-isobutyl-3-thiazoline | 3302.1 | ||
6591-53-3 | Bismuth lactate ; bismuth;2-hydroxypropanoate | Bismuth lactate | 3815.9 | |
659-40-5 | Hexamidine Diisethionate | 4-[6-(4-Carbamimidoylphenoxy)hexoxy]benzenecarboximidamide;2-hydroxyethanesulfonic acid | 2925.29 | |
65963-40-8 | Chlorophyllin, trisodium salt | 3302.1 | ||
659-70-1 | Isoamyl Isovalerate | 3-Methylbutyl 3-methylbutanoate | 2915.6 | |
65983-31-5 | Dicyclopentenyloxyethyl acrylate | Dicyclopentenyloxyethyl acrylate | 2916.39 | |
6598-63-6 | Direct orange 102 | 3204.14 | ||
65996-69-2 | Blast furnace slag | |||
65996-77-2 | Coke | |||
65996-93-2 | Coal tar pitch | Coal tar pitch | ||
65996-94-3 | Phosphorite | 3103.9 | 4 | |
65996-95-4 | Superphosphates | Disodium 2-hexadecyl-3-(2-sulfonatophenoxy)benzenesulfonate | 3103.1 | 4 |
65997-01-5 | Tall oil, sodium salt | 3803 | ||
65997-02-6 | Tall oil soap acidulation | 3803 | ||
65997-05-9 | Rosin, oligomers | 3806.9 | ||
65997-06-0 | Rosin, hydrogenated | 3806.9 | ||
65997-10-6 | Rosin, fumarated, polymer with glycerol | 3806.9 | ||
65997-13-9 | Glycerol ester of hydrogenated rosin | 3806.9 | ||
65997-15-1 | Portland cement | |||
65997-16-2 | Calcium aluminate cement | |||
65997-17-3 | Glass spheres ; Soda - Lime Glass | Calcium;sodium;phosphate | ||
65997-5-9 | Polymerized rosin | 3806.9 | ||
6600-31-3 | 3,9-dicyclohex-3-enyl-2,4,8,10-tetraoxaspiro[5.5]undecane | 2932.99 | ||
66009-41-4 | Stearyl Heptanoate | Octadecyl heptanoate | ||
660-60-6 | Copper(II) stearate | Copper;octadecanoate | 2827.39 | |
66063-05-6 | Pencycuron | 1-(4-chlorobenzyl)-1-cyclopentyl-3-phenylurea | 2924.31 | 8 |
6606-59-3 | 1,6-Hexanediol dimethacrylate | 1,6-Hexanediol dimethacrylate | 2916.14 | |
660-68-4 | Diethylamine Hydrochloride | N-Ethylethanamine;hydrochloride | 2921.19 | |
66068-84-6 | 4-Hydroxy-1-(5-isocamphyl)cyclohexane | 4-(2,2,3-Trimethyl-5-bicyclo[2.2.1]heptanyl)cyclohexan-1-ol | 2906.19 | |
66071-86-1 | Modified alkyd resins | 3806.9 | ||
66071-94-1 | Corn steep liquor | 2-hydroxypropanoic acid | 3821 | |
66085-00-5 | Isooctadecanoic acid, monoester with glycerol | 3402.2 | ||
6610-42-0 | Benzyloxycarbonyl-L-glutaminylglycine | 2-[[(2S)-5-Amino-5-oxo-2-(phenylmethoxycarbonylamino)pentanoyl]amino]acetic acid | 2924.19 | |
66105-29-1 | Glycerides, coco mono-, ethoxylated | 3402.13 | ||
66108-95-0 | Iohexol | 5-[Acetyl(2,3-dihydroxypropyl)amino]-1-N,3-N-bis(2,3-dihydroxypropyl)-2,4,6-triiodobenzene-1,3-dicarboxamide | 2924.29 | |
661-19-8 | Docosanol | Docosan-1-ol | ||
66142-81-2 | 2CB | 4-bromo-2,5dimethoxy phenethylamine | 2922.29 | 7 |
66161-60-2 | Decyl hydrogen sulphate, compound with 1,1',1''-nitrilotripropan-2-ol | 3402.11 | ||
66170-10-3 | Sodium Ascorbyl Phosphate | Trisodium [(5R)-5-[(1S)-1,2-dihydroxyethyl]-2-oxido-4-oxofuran-3-yl] phosphate | 2938.9 | |
66215-27-8 | Cyromazine | 2-N-cyclopropyl-1,3,5-triazine-2,4,6-triamine | 2933.69 | 8 |
66-22-8 | Uracil | 1H-pyrimidine-2,4-dione | 2933.59 | |
66228-31-7 | (2R)-3,3-Dimethylbutan-2-amine | (2R)-3,3-Dimethylbutan-2-amine | 2921.19 | |
66241-11-0 | Leuco sulphur black 1 | 3204.19 | ||
66-25-1 | Hexanal | Hexanal | 2912.19 | |
6630-33-7 | 2-Bromobenzaldehyde | 2-Bromobenzaldehyde | 2913 | |
66357-59-3 | Ranitidine Hydrochloride | (Z)-1-N'-[2-[[5-[(Dimethylamino)methyl]furan-2-yl]methylsulfanyl]ethyl]-1-N-methyl-2-nitroethene-1,1-diamine;hydrochloride | 2932.19 | 6 |
66402-68-4 | Substance H4 granules | Copper zinc oxido(oxo)iron | ||
66422-95-5 | 2,4-Diaminophenoxyethanol hydrochloride | 2-(2,4-diaminophenoxy)ethanol dihydrochloride | 2921.51 | |
6645-46-1 | Levocarnitine Hydrochloride | [(2R)-3-Carboxy-2-hydroxypropyl]-trimethylazanium;chloride | 2922.29 | |
66455-14-9 | Alcohols, C12-13, ethoxylated (1 - 2.5 moles ethoxylated) | 3402.13 | ||
66455-26-3 | Nitrogen-phosphate-potassium fertilizers | 2834.21 | ||
66455-29-6 | Betaines, C12-14-alkyldimethyl | 3402.19 | ||
66492-51-1 | (5-Ethyl-1,3-dioxan-5-yl)methyl prop-2-enoate | (5-Ethyl-1,3-dioxan-5-yl)methyl prop-2-enoate | 2916.12 | |
66555-11-1 | Dipentaerythritol stearate | Octadecanoic acid, ester with 2,2'-[oxybis(methylene)]bis[2-(hydroxymethyl)-1,3-propanediol] | 3823.19 | |
665-66-7 | Amantadine Hydrochloride | Adamantan-1-amine hydrochloride | 2921.3 | 6 |
66575-29-9 | Colforsin | [(3R,4aR,5S,6S,6aS,10S,10aR,10bS)-3-Ethenyl-6,10,10b-trihydroxy-3,4a,7,7,10a-pentamethyl-1-oxo-5,6,6a,8,9,10-hexahydro-2H-benzo[f]chromen-5-yl] acetate | 2932.99 | |
66592-87-8 | Cefadroxil | (6R,7R)-7-[[(2R)-2-amino-2-(4-hydroxyphenyl)acetyl]amino]-3-methyl-8-oxo-5-thia-1-azabicyclo[4.2.0]oct-2-ene-2-carboxylic acid hydrate | 2941.9 | 6 |
666-52-4 | Acetone-D6 | 1,1,1,3,3,3-hexadeuteriopropan-2-one | 2845.9 | |
66669-53-2 | Tetrasodium hydrogen 2-phosphonatobutane-1,2,4-tricarboxylate | Tetrasodium 2-(carboxymethyl)-2-phosphonatopentanedioate | 2931.9 | |
66676-43-5 | Protease from Staphylococcus aureus | 3507.9 | ||
66701-25-5 | Thiol protease inhibitor | (2S,3S)-3-[[(2S)-1-[4-(diaminomethylideneamino)butylamino]-4-methyl-1-oxopentan-2-yl]carbamoyl]oxirane-2-carboxylic acid | 2925.29 | |
66-71-7 | O-Phenanthroline | 1,10-Phenanthroline | 2933.99 | |
6674-22-2 | 1,8-Diazabicyclo[5.4.0]undec-7-ene | 2,3,4,6,7,8,9,10-Octahydropyrimido[1,2-a]azepine | ||
66758-31-4 | Trichlorfon | 2,2,2-trichloro-1-dimethoxyphosphorylethanol | 2931.9 | |
66-77-3 | 1-Naphthaldehyde | Naphthalene-1-carbaldehyde | 2912.29 | |
66778-08-3 | Sodium phenyl phosphate dibasic dihydrate | Disodium phenyl phosphate dihydrate | 3821 | |
66778-17-4 | Esculin Sesquihydrate | 7-Hydroxy-6-[(2S,3R,4S,5S,6R)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxychromen-2-one;trihydrate | 2938.9 | |
667-83-4 | N-(3-ethoxypropyl)-2,4-dihydroxy-3,3-dimethylbutanamide | N-(3-ethoxypropyl)-2,4-dihydroxy-3,3-dimethylbutanamide | 2936.24 | |
667-84-5 | Pantothenyl ethyl ether | N-(3-Ethoxypropyl)-2,4-dihydroxy-3,3-dimethylbutanamide | 2936.24 | |
66-81-9 | Cycloheximide | 4-[(2R)-2-[(1S,3S,5S)-3,5-dimethyl-2-oxocyclohexyl]-2-hydroxyethyl]piperidine-2,6-dione | ||
668270-12-0 | Linagliptin | 8-[(3R)-3-Aminopiperidin-1-yl]-7-but-2-ynyl-3-methyl-1-[(4-methylquinazolin-2-yl)methyl]purine-2,6-dione | 2933.59 | 6 |
6683-19-8 | Tetrakis-3[3-(3,5-di-tert-butyl-4-hydroxyphenyl propionate | Pentaerythritol tetrakis(3-(3,5-di-tert-butyl-4-hydroxyphenyl)propionate) | ||
66-84-2 | Glucosamine hydrochloride | (3R,4R,5S,6R)-3-Amino-6-(hydroxymethyl)oxane-2,4,5-triol hydrochloride | 2933.99 | |
66905-23-5 | Calcium Gluconate Monohydrate | Calcium (2R,3S,4R,5R)-2,3,4,5,6-pentahydroxyhexanoate hydrate | 2918.16 | |
66985-17-9 | Ipratropium Bromide | [(5R)-8-Methyl-8-propan-2-yl-8-azoniabicyclo[3.2.1]octan-3-yl] 3-hydroxy-2-phenylpropanoate;bromide | 2933.99 | 6 |
66988-04-3 | Sodium isostearoyl lactylate | Sodium 2-[2-(16-methylheptadecanoyloxy)propanoyloxy]propanoate | ||
66990-32-7 | 10,12-Pentacosadiynoic acid | 10,12-Pentacosadiynoic acid | 2916.19 | |
66-99-9 | 2-Naphthaldehyde | Naphthalene-2-carbaldehyde | 2912.29 | |
67-03-8 | Thiamine Hydrochloride | 2-[3-[(4-amino-2-methylpyrimidin-5-yl)methyl]-4-methyl-1,3-thiazol-3-ium-5-yl]ethanol;chloride;hydrochloride | 6 | |
6706-82-7 | Solvent yellow 29 | 3204.19 | ||
6711-48-4 | Bis-(dimethylaminopropyl)amine | N-[3-(Dimethylamino)propyl]-N',N'-dimethylpropane-1,3-diamine | ||
6712-98-7 | 1-[Bis(2-hydroxyethyl)amino]propan-2-ol | 1-[Bis(2-hydroxyethyl)amino]propan-2-ol | ||
6713-03-7 | 1-[(2-Hydroxyethyl)thio]propan-2-ol | 1-[(2-Hydroxyethyl)thio]propan-2-ol | 2905.39 | |
67-16-3 | Thiamine Disulfide | N-[(4-Amino-2-methylpyrimidin-5-yl)methyl]-N-[(Z)-3-[[(E)-2-[(4-amino-2-methylpyrimidin-5-yl)methyl-formylamino]-5-hydroxypent-2-en-3-yl]disulfanyl]-5-hydroxypent-2-en-2-yl]formamide | 2936.22 | |
67-20-9 | Nitrofurantoin | 1-[(E)-(5-Nitrofuran-2-yl)methylideneamino]imidazolidine-2,4-dione | 2934.99 | 1 |
67233-85-6 | Sodium 5-nitroguaiacolate | Sodium 2-methoxy-5-nitrophenolate | 2908.99 | 8 |
67254-73-3 | Mono and diglycerides | Mono- and diglycerides of edible fatty acids | 3403.99 | |
67256-21-7 | Hepatocyte growth factor | 3504 | ||
6728-26-3 | Trans-2-Hexenal ; Fragrance of trans-2-hexenal | Trans-hex-2-enal | ||
673-06-3 | D-Phenylalanine | (2R)-2-Amino-3-phenylpropanoic acid | 2922.49 | |
6731-36-8 | 1,1-Bis(t-butylperoxy)-3,3,5-trimethylcyclohexane | 1,1-bis(tert-butylperoxy)-3,3,5-trimethylcyclohexane | 2909.6 | |
673-22-3 | 4-Methoxysalicylaldehyde | 2-hydroxy-4-methoxybenzaldehyde | 2912.49 | |
67375-30-8 | alpha-Cypermethrin | rel-(R)-cyano(3-phenoxyphenyl)methyl (1S,3S)-3-(2,2-dichloroethenyl)-2,2-dimethylcyclopropanecarboxylate | 8 | |
673-84-7 | 2,6-Dimethyl-2,4,6-octatriene | (4E,6E)-2,6-dimethylocta-2,4,6-triene | 2901.29 | |
67392-87-4 | Drospirenone | (6R,7R,8R,9S,10R,13S,14S,15S,17S)-1,3’,4’,6,6a,7,8,9,10,11,12,13,14,15,15a,16-esadecaidro-10,13-dimetilspiro-[17H-diciclopropa-6,7:15,16]ciclopenta[a]fenantrene-17,2’(5H)-furan]-3,5’(2H)-dione | 2937.29 | 6 |
67-42-5 | Egtazic Acid | 2-[2-[2-[2-[bis(carboxymethyl)amino]ethoxy]ethoxy]ethyl-(carboxymethyl)amino]acetic acid | 2922.49 | |
67430-45-9 | Warfarin Sodium Clatharate | 2932.99 | ||
67-43-6 | Pentetic Acid | 2-[bis[2-[bis(carboxymethyl)amino]ethyl]amino]acetic acid | 2922.49 | |
67-45-8 | Furazolidone | 3-[(E)-(5-nitrofuran-2-yl)methylideneamino]-1,3-oxazolidin-2-one | 2934.99 | 6 |
67460-68-8 | 2CD | 2,5-dimethoxy-4-methylphene | 2922.29 | 7 |
67-47-0 | 5-(Hydroxymethyl)-2-furaldehyde | 5-(hydroxymethyl)furan-2-carbaldehyde | 2932.19 | |
67-48-1 | Choline Chloride | 2-hydroxyethyl(trimethyl)azanium chloride | 2923.1 | |
67490-21-5 | 2,4,6-Tri-tert-butylpyrimidine | 2,4,6-tritert-butylpyrimidine | 2919.9 | |
67-51-6 | 3,5-Dimethylpyrazole | 3,5-dimethyl-1H-pyrazole | 2933.19 | |
67-52-7 | Barbituric Acid | 1,3-diazinane-2,4,6-trione | 2933.52 | |
67-56-1 | Methyl alcohol | Methanol | 8 | |
6757-06-8 | Cytidine 5'-monophosphate disodium salt | Disodium [(2R,3S,4R,5R)-5-(4-amino-2-oxopyrimidin-1-yl)-3,4-dihydroxyoxolan-2-yl]methyl phosphate | 2934.99 | |
676168-27-7 | Ethyl acrylate/methacrylic acid/steareth-20 methacrylate copolymer | 2922.29 | ||
67-63-0 | Isopropyl alcohol | Propan-2-ol | 3 | |
67634-00-8 | Allyl (3-methylbutoxy)acetate | Prop-2-enyl 2-(3-methylbutoxy)acetate | 2918.99 | |
67634-15-5 | Ethyl 2,2-dimethylhydrocinnamal | 3-(4-Ethylphenyl)-2,2-dimethylpropanal | 2912.19 | |
67-64-1 | Acetone | Propan-2-one | 2914.11 | |
676-46-0 | Sodium Malate | Disodium;2-hydroxybutanedioate | 2918.19 | |
67-66-3 | Chloroform | Trichloromethane | 2903.13 | |
6766-87-6 | Edetate calcium disodium | Calcium disodium 2-[2-[bis(carboxylatomethyl)amino]ethyl-(carboxylatomethyl)amino]acetate dihydrate | 2922.49 | |
67-68-5 | Dimethyl sulfoxide | Methylsulfinylmethane | 2930.9 | |
67691-13-8 | Isopropyl tri(dioctylpyrophosphate) titanate | Bis(2-ethylhexoxy)phosphoryl phosphate hydron propan-2-olate titanium(4+) | 3824.9 | |
67701-01-3 | Fatty acids, C12-18 | 3823.19 | ||
67701-02-4 | Fatty acids, C14-18 | 3823.19 | ||
67701-03-5 | Fatty acids, C16-18 | |||
67701-05-7 | Fatty acids, C8-18 and C18-unsatd. | 3826 | ||
67701-06-8 | Fatty acids, C14-18 and C16-18-unsatd. | 3823.19 | ||
67701-08-0 | Fatty acids, C16-18 and C18-unsatd. | 3823.12 | ||
67701-12-6 | Fatty acids, C14-18 and C16-18-unsatd., zinc salts | 3812.1 | ||
67701-27-3 | Fatty glycerides | 3404.9 | ||
67701-33-1 | Glycerides, C14-18 mono- and di- | 3823.19 | ||
67-71-0 | Dimethyl Sulfone | Methylsulfonylmethane | 2930.9 | |
67-72-1 | Hexachloroethane | 1,1,1,2,2,2-hexachloroethane | 2903.19 | 2 |
67-73-2 | Fluocinolone Acetonide | 21-acetoxy-6,9-difluoro-11-hydroxy-16,17-isopropilidenedioxy-1,4-pregnadiene-3,20-dione | 2937.22 | |
67747-09-5 | Prochloraz | N-propyl-N-[2-(2,4,6-trichlorophenoxy)ethyl]-1H-imidazole-1-carboxamide | 2933.29 | 8 |
67762-19-0 | Alcohols, C10-16, ethoxylated, sulfates, ammonium salts (1 - 2.5 moles ethoxylated) | 3402.9 | ||
67762-27-0 | Cetostearyl alcohol | Hexadecan-1-ol;octadecan-1-ol | 3823.7 | |
67762-30-5 | Alcohols, C14-18 | 3823.7 | ||
67762-38-3 | Fatty acids, C16-18 and C18-unsatd., Me esters | 3823.19 | ||
67762-41-8 | Alcohols, C10-16 | |||
67762-90-7 | Amorphous silica | 3910 | ||
67763-18-2 | Diisostearyl Malate | Bis(16-methylheptadecyl) 2-hydroxybutanedioate | ||
67774-74-7 | Linear Alkyl Benzene ; Benzene, C10-C13 alkyl derivatives | |||
67784-62-1 | Polyglycerol esters of fatty acids | 2915.7 | ||
67784-80-9 | Soybean oil, Me ester | 3826 | ||
67784-82-1 | Fatty acids, coco, esters with cottonseed-oil fatty acids, polyglycerol and soya fatty acids | |||
67786-25-8 | Fluorescent whitening agent 263 ; Tetrasodium 4,4'-bis[[4-[bis(2-hydroxypropyl)amino]-6-[(4-sulphonatophenyl)amino]-1,3,5-triazin-2-yl]amino]-stilbene-2,2'-disulphonate | Tetrasodium 2,2'-ethene-1,2-diylbis[5-({4-[bis(2-hydroxypropyl)amino]-6-[(4-sulfonatophenyl)amino]-1,3,5-triazin-2-yl}amino)benzenesulfonate] | 3204.2 | |
67801-20-1 | Ebanol | (E)-3-methyl-5-(2,2,3-trimethylcyclopent-3-en-1-yl)pent-4-en-2-ol | 2906.19 | |
67815-68-3 | 2-Amino-4-chloro-6-nitrophenol monohydrochloride | 2-Amino-4-chloro-6-nitrophenol hydrochloride | 2935 | |
67845-93-6 | Hexadecyl 3,5-di-tert-butyl-4-hydroxybenzoate | Hexadecyl 3,5-di-tert-butyl-4-hydroxybenzoate | 2918.29 | |
67874-71-9 | Bismuth tris(2-ethylhexanoate) | 3815.9 | ||
67874-81-1 | (8alpha)-8-methoxycedrane | [3R-(3α,3aβ,6α,7β,8aα)]-octahydro-6-methoxy-3,6,8,8-tetramethyl-1H-3a,7-methanoazulene | 2909.19 | |
67884-32-6 | [(2R)-1-diphenylphosphanylpropan-2-yl]-diphenylphosphane | [(2R)-1-diphenylphosphanylpropan-2-yl]-diphenylphosphane | 2931.9 | |
67893-42-9 | Disodium 4-[2-[(12-hydroxy-1-oxooctadec-9-enyl)amino]ethyl] 2-sulphonatosuccinate | 3402.11 | ||
678983-34-1 | Aluminium potassium fluoride | Potassium tetrafluoride | 2826.9 | |
6790-58-5 | Ambroxide | (3aR,5aS,9aS,9bR)-3a,6,6,9a-tetramethyl-2,4,5,5a,7,8,9,9b-octahydro-1H-benzo[e][1]benzofuran | 2909.2 | |
67-92-5 | Dicyclomine hydrochloride | 2-(diethylamino)ethyl 1-cyclohexylcyclohexane-1-carboxylate hydrochloride | 2922.19 | |
67938-21-0 | Polyglyceryl-2 diisostearate | |||
67-97-0 | Cholecalciferol | (1S,3Z)-3-[(2E)-2-[(1R,3aS,7aR)-7a-methyl-1-[(2R)-6-methylheptan-2-yl]-2,3,3a,5,6,7-hexahydro-1H-inden-4-ylidene]ethylidene]-4-methylidenecyclohexan-1-ol | 2936.29 | 6 |
68002-88-0 | Fatty acids, C16-22 | 3823.11 | ||
68002-94-8 | Alcohols, C16-18 and C18-unsatd. | |||
68002-96-0 | Branched oxoalcohol ethoxylate with 7 EO | 3402.13 | ||
68002-97-1 | Alcohols, C10-16, ethoxylated | 3402.13 | ||
68037-01-4 | 1-Decene, homopolymer, hydrogenated | 2710.19 | ||
68037-49-0 | n-alkyl(C10-C18)sulphonic acids sodium salts | 3402.11 | ||
68038-41-5 | Rosin, maleated, polymer with glycerol | 3806.909 | ||
68038-71-1 | Bacillus thuringiensis | 3808.91 | 8 | |
68039-47-4 | [2-Isopropoxyethyl]benzene | [2-Isopropoxyethyl]benzene | 2909.3 | |
68039-49-6 | 2,4-Dimethylcyclohex-3-ene-1-carbaldehyde | 2,4-dimethylcyclohex-3-ene-1-carbaldehyde | 2912.29 | |
68-04-2 | Sodium citrate | Trisodium 2-hydroxypropane-1,2,3-tricarboxylate | ||
68047-06-3 | 4-Hydroxytamoxifen | 4-[(1Z)-1-{4-[2-(dimethylamino)ethoxy]phenyl}-2-phenylbut-1-en-1-yl]phenol | 2922.19 | |
6805-41-0 | Aescin | (2S,3S,4S,5R,6R)-6-[[(4S,6bS,8R,9R)-9-acetyloxy-8-hydroxy-4,8a-bis(hydroxymethyl)-4,6a,6b,11,11,14b-hexamethyl-10-[(E)-2-methylbut-2-enoyl]oxy-1,2,3,4a,5,6,7,8,9,10,12,12a,14,14a-tetradecahydropicen-3-yl]oxy]-4-hydroxy-3-[(2S,3R,4S,5S,6R)-3,4,5-trihydroxy | ||
68081-81-2 | Benzenesulfonic acid, mono-C10-16-alkyl derivs., sodium salts | 3402.11 | ||
68081-96-9 | Sulfuric acid, mono-C10-16-alkyl esters, ammonium salts | 3402.9 | ||
68082-29-1 | Fatty acids, C18-unsatd., dimers, polymers with tall-oil fatty acids and triethylenetetramine | 3815.9 | ||
68083-14-7 | Diphenylsiloxane-dimethylsiloxane copolymer | 3403.19 | ||
68-11-1 | Thioglycolic Acid | 2-sulfanylacetic acid | 2930.9 | |
68-12-2 | N,N-Dimethylformamide | N,N-dimethylformamide | 3 | |
68130-24-5 | Decanoic acid, ester with 2,2'-[oxybis(methylene)]bis[2-(hydroxymethyl)-1,3-propanediol] octanoate pentanoate | 3824.9 | ||
68130-55-2 | Hexanedioic acid mixed esters with decanoic acid heptanoic acid octanoic acid and pentaerythritol | 2915.9 | ||
68131-04-4 | Humic acids, sodium salts | Disodium bicyclo[2.2.1]hept-5-ene-2,3-dicarboxylate | ||
68131-39-5 | Linear alcohol (C12-15) ethoxylate, POE-7 | 3402.13 | ||
68131-40-8 | Alcohols, secondary C11-15, ethoxylated | |||
68131-61-3 | Zinc salt of fatty acids | 3404.9 | ||
68131-73-7 | Polyethylene polyamine | 3824.9 | 3 | |
68131-74-8 | Fly ash | |||
6813-38-3 | 2-(4-carboxypyridin-2-yl)pyridine-4-carboxylic acid | 2-(4-carboxypyridin-2-yl)pyridine-4-carboxylic acid | 2933.39 | |
68134-22-5 | Pigment yellow 154 | 3204.17 | ||
68139-30-0 | Cocoanutamide hydroxysulfobetaine | 3402.19 | ||
68140-00-1 | Coconut Oil Monoethanolamide ; N-(2-hydroxyethyl)dodecanamide ; Cocamide monoethanolamine | 3402.9 | ||
68140-16-9 | Tall - oil pitch, sodium salt | 3803 | ||
68141-27-5 | Heptyl Undecylenate | Heptyl undec-10-enoate | 2917.19 | |
68152-92-1 | Tall oil, disproportionated | 3803 | ||
68153-35-5 | Ethanaminium, 2-amino-N-(2-aminoethyl)-N-(2-hydroxyethyl)-N-methyl-, N,N'-ditallow acyl derivs., Me sulfates (salts) | 3824.9 | ||
68153-37-7 | Rape oil, sulfurized | 3812.1 | ||
68153-81-1 | Grease | 3403.19 | ||
68154-36-9 | Fatty acids, coco, monoesters with sorbitan | 3402.9 | ||
68154-97-2 | C10-12 Alcohol Alkoxylate | 3402.13 | ||
68155-01-1 | Alcohols, C16 (even numbered, C18 unsaturated), ethoxylated | 3402.13 | ||
68155-09-9 | N-(3-(dimethylamino)propyl) coco amides N-oxides ; Cocamidopropyl amine oxide | 3402.12 | ||
68155-78-2 | Diethylenetriamine Penta(methylene Phosphonic Acid) Heptasaodium Salt | Heptasodium [2-[2-[bis(phosphonatomethyl)amino]ethyl-(phosphonatomethyl)amino]ethyl-(phosphonomethyl)amino]methyl-hydroxyphosphinate | 2931.9 | |
68157-60-8 | Forchlorfenuron | 1-(2-chloropyridin-4-yl)-3-phenylurea | 2933.39 | |
68168-23-0 | beta-Cyclodextrin hydrate | 2940 | ||
68171-33-5 | Isopropyl Isostearate | Propan-2-yl 16-methylheptadecanoate | ||
68171-38-0 | 2-Hydroxypropyl 16-methylheptadecanoate | 2-hydroxypropyl 16-methylheptadecanoate | 2915.7 | |
681-84-5 | Tetramethyl Silicate | Tetramethyl Silicate | 2920.9 | |
68186-85-6 | Pigment green 50 | 3206.49 | ||
68186-87-8 | Pigment blue 72 ; Cobalt zinc aluminate blue spinel | 3207.1 | ||
68186-88-9 | Pigment brown 33 | 3207.1 | ||
68186-90-3 | Pigment brown 24 ; C.I. 77310 | 3206.49 | ||
68186-91-4 | Pigment black 28 | 3206.2 | ||
68186-94-7 | Pigment black 26 ; Manganese ferrite black spinel | |||
68186-95-8 | Pigment blue 71 | 3207.1 | ||
68187-11-1 | Pigment blue 36 | 3207.1 | ||
68187-15-5 | Pigment yellow 159 ; Zirconium praseodymium yellow zircon | 3207.1 | ||
68187-29-1 | L-Glutamic acid, N-coco acyl derivs., compds. with triethanolamine (1:1) | 3402.9 | ||
68187-30-4 | Disodium cocoyl glutamate | 3402.11 | ||
68187-32-6 | Sodium cocoyl glutamate | 3402.11 | ||
68187-40-6 | Pigment blue 7 | 3207.1 | ||
68187-51-9 | Pigment Yellow 119 ; Zinc ferrite brown spinel | |||
68187-54-2 | Antimon-doped tin oxide | Dioxotin; oxo(oxostibanyloxy)stibane | 2825.9 | |
68187-59-7 | Calcined anthracite | 2701.11 | ||
68187-76-8 | Castor oil, sulfated, sodium salt | 3402.11 | ||
68188-18-1 | Paraffin oils, sulfochlorinated, saponified | 3402.11 | ||
68188-83-0 | Rare earth oxides | Thorium dioxide | ||
68188-85-2 | Rare earth fluoride | Thorium dioxide | 2846.9 | |
68-19-9 | Cyanocobalamin | Cobalt(3+) [(2R,3S,4R,5S)-5-(5,6-dimethylbenzimidazol-1-yl)-4-hydroxy-2-(hydroxymethyl)oxolan-3-yl] [(2R)-1-[3-[(1R,2R,3R,5Z,7S,10Z,12S,13S,15Z,17S,18S,19R)-2,13,18-tris(2-amino-2-oxoethyl)-7,12,17-tris(3-amino-3-oxopropyl)-3,5,8,8,13,15,18,19-octamethyl- | 6 | |
68201-46-7 | Polyethylene glycol glyceryl monococoate | |||
682-01-9 | Tetrapropyl Orthosilicate | Tetrapropyl Orthosilicate | 2920.9 | |
682-09-7 | Trimethylolpropane Diallyl Ether | 2,2-Bis(prop-2-enoxymethyl)butan-1-ol | 2909.49 | |
68213-23-0 | Fatty alcohol C12 - C18 with approx. 9 moles EO | 3402.13 | ||
68223-93-8 | Diammonium dithiodiglycolate | Azane 2-(carboxymethyldisulfanyl)acetic acid | ||
68-22-4 | Norethindrone | (8R,9S,10R,13S,14S,17R)-17-ethynyl-17-hydroxy-13-methyl-1,2,6,7,8,9,10,11,12,14,15,16-dodecahydrocyclopenta[a]phenanthren-3-one | 2937.23 | 6 |
68238-36-8 | Isosulfan blue ; C.I. 42045 | 3204.12 | ||
68239-81-6 | 3-Aminophenol sulfate | 3-Aminophenol sulfuric acid | 2922.29 | |
6825-20-3 | 3,6-Dibromocarbazole | 3,6-Dibromo-9H-carbazole | 2933.99 | |
68259-02-9 | Reactive black 39 | 2,7-Naphthalenedisulfonic acid, 4-amino-6-[[5-[(4-amino-6-chloro-1,3,5-triazin-2-yl)amino]-2-sulfophenyl]azo]-3-[(2,5-disulfophenyl)azo]-5-hydroxy-, pentasodium salt | 3204.16 | |
68-26-8 | Retinol | (2E,4E,6E,8E)-3,7-dimethyl-9-(2,6,6-trimethylcyclohexen-1-yl)nona-2,4,6,8-tetraen-1-ol | 2936.21 | 6 |
6829-22-7 | Solvent red 179 | |||
68308-22-5 | Fatty acids, montan-wax, calcium salts | 3812.2 | ||
68308-48-5 | Amines, tallow alkyl, ethoxylated, phosphates | 3402.12 | ||
68308-53-2 | Fatty acids, soya | 3823.7 | ||
68309-95-5 | Ammonium zirconium carbonate | Diazanium; zirconium(4+); tricarbonate | 2836.99 | |
683-10-3 | Lauryl Betaine ; N-Dodecyl-N,N-Dimethylglycine | [dodecyl(dimethyl)ammonio]acetate | 3402.19 | |
683-18-1 | Dibutyltin Dichloride | Dibutyl(dichloro)stannane | 2931.9 | |
68333-79-9 | Ammonium polyphosphate | Triazanium;phosphate | 2835.39 | |
68333-80-2 | Alcohols, C14-16 | 2926.9 | ||
68334-21-4 | Imidazolium compounds, 1-(carboxymethyl)-4,5-dihydro-1-(hydroxyethyl)-2-norcoco alkyl, hydroxides, inner salts | 3824.9 | ||
68334-28-1 | Hydrogenated vegetable oil | 3404.9 | ||
68334-30-5 | Diesel oil | 2710.19 | ||
68334-35-0 | Resin acids and rosin acids, calcium zinc salts | 3806.2 | ||
68334-76-9 | Epoxy resin | |||
6833-84-7 | Nonactin | 2941.9 | ||
6834-92-0 | Sodium metasilicate | Disodium;dioxido(oxo)silane | ||
68-35-9 | Sulfadiazine | 4-amino-N-pyrimidin-2-ylbenzenesulfonamide | 2935 | 6 |
68359-37-5 | Beta-cyfluthrin | (RS)-cyano-4-fluoro-3-phenoxybenzyl (1RS,3RS;1RS,3SR)-3-(2,2-dichlorovinyl)-2,2-dimethylcyclopropanecarboxylate | 2926.9 | 8 |
68373-14-8 | Sulbactam | 3,3-dimethyl-7-oxo-4-thia-1-azabicyclo[3.2.0]heptane-2-carboxylic acid 4,4-dioxide | 3824.6 | 6 |
6837-46-3 | Acid violet 50 | Sodium 9-amino-11-methoxy-7-phenyl-5-(phenylamino)benzo[a]phenazin-7-ium-4,8-disulfonate | 3204.11 | |
68378-13-2 | 2-Methoxy-3-methylpyrazine | 2-methoxy-3-methylpyrazine | 2933.11 | |
68390-66-9 | Sodium Cocoamphoacetate | 3402.19 | ||
68391-03-7 | Quaternary ammonium compounds, C12-18-alkyltrimethyl, chlorides | 3402.12 | ||
68393-49-7 | Hexadimethrine chloride | 3402.12 | ||
68410-69-5 | Poly(oxy-1,2-ethanediyl), .alpha.-[2-[bis(2-aminoethyl)methylammonio]ethyl]-.omega.-hydroxy-, N,N'-ditallow acyl derivs., Me sulfate | 3809.911 | ||
68411-20-1 | Butanal, reaction products with aniline | 3812.1 | ||
68411-27-8 | Benzoic acid, C12-15-alkyl esters | |||
68411-30-3 | Sodium, alkyl-(C10-C13)-benzenesulfonate ; Sodium Alkyl Aryl Sulfonate | 3402.11 | ||
68411-32-5 | Benzenesulfonic acid, dodecyl-, branched | 3402.11 | ||
68411-46-1 | Benzenamine, N-phenyl-, reaction products with 2,4,4-trimethylpentene | |||
68411-62-1 | 4,4′-Dihydroxydiphenyl sulphone ; Naphthalenesulphonic acid/formaldehyde condensate | 3202.9 | ||
68412-01-1 | Sorbitol polyglycidyl ether | |||
68412-48-6 | 2-Propanone,reactionproducts with diphenylamine ; 9,9-dimethylacridine | 3812.3 | ||
68412-54-4 | Nonoxynol-2 | 2-[2-(4-nonylphenoxy)ethoxy]ethanol | ||
68412-79-3 | Zirconium iron pink zircon | 3207.1 | ||
68413-60-5 | Ferric ammonium ethylenediaminetetraacetate complex | Azane 2-[2-[bis(carboxymethyl)amino]ethyl-(carboxymethyl)amino]acetic acid iron hydrate | 2922.49 | |
68-41-7 | Cycloserine | (4R)-4-amino-1,2-oxazolidin-3-one | 6 | |
68424-04-4 | Polydextrose | (2S,3R,4S,5S,6R)-6-[[(3R,4S,5S,6R)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxymethyl]oxane-2,3,4,5-tetrol | 3824.9 | |
68424-37-3 | Fatty acids, C14-22 | 3823.11 | ||
68424-43-1 | Fatty acids, lanolin | 3823.19 | ||
68424-45-3 | Fatty acids, linseed-oil | 3823.19 | ||
68424-94-2 | Betaines, coco alkyldimethyl | 3402.9 | ||
68425-15-0 | Polysulfides di-tert-dodecyl | 2-(2,3,3,4,5,5-hexamethylhexan-2-yltrisulfanyl)-2,3,3,4,5,5-hexamethylhexane | 2930.9 | |
68425-17-2 | Hydrogenated starch hydrolysate | (2S,4R,5R)-4-[(2R,3R,4R)-3,4-dihydroxy-6-(hydroxymethyl)-5-[(2R,3R,4S,5S,6R)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxyoxan-2-yl]oxyhexane-1,2,3,5,6-pentol | ||
68439-46-3 | Alcohols, C9-11 ethoxylated, < 2.5 EO ; Primary 9-11 Alcohol PEG-8 Ethoxylate | 3402.13 | ||
68439-49-6 | Alcohols, C16-18, ethoxylated 1 - 2.5 moles ethoxylated ; Ceteareth-20 | |||
68439-50-9 | Alcohols, C12-14, ethoxylated 1 - 2.5 moles ethoxylated | |||
68439-51-0 | Alcohols,C12-14, ethoxylated propoxylated | 3402.13 | ||
68439-57-6 | Sulfonic acids, C14-16-alkane hydroxy and C14-16-alkene, sodium salts | 3402.9 | ||
68439-70-3 | Amines, C12-16-alkyldimethyl | 3824.9 | ||
68439-86-1 | Bone ash | Tricalcium diphosphate | ||
68440-15-3 | Fatty acids, palm-oil | Fatty acids, palm-oil | 3823.19 | |
68441-17-8 | Oxidized polyethylene | 6-Hydroxy-5-methyl-4,11-dioxoundecanoic acid | 2712.9 | |
68442-68-2 | Styrenated diphenylamine | 3812.1 | ||
68442-97-7 | 1-Aminoethyl-2-tall oil alkyl-2-imidazoline | 2933.29 | ||
6844-74-2 | Acid red 106 | Disodium 4-hydroxy-3-phenylazo-5-((p-tolyl)sulfonylamino)naphthalene-2,7-disulfonate | 3204.9 | |
68457-13-6 | Cobalt, borate neodecanoate complexes | |||
68457-79-4 | Zinc dialkyl dithiophosphate | 3812.1 | ||
68458-87-7 | Lactalbumin enzymatic hydrolysate | 3504 | ||
6846-50-0 | 2,2,4-Trimethyl-1,3-pentanediol diisobutyrate | [2,2,4-trimethyl-3-(2-methylpropanoyloxy)pentyl] 2-methylpropanoate | 2915.6 | |
68475-37-6 | Esters of rosin oligomers with glycerol | 3806.909 | ||
68476-25-5 | Feldspar | |||
68476-33-5 | Fuel oil, residual | 2710.19 | ||
68476-34-6 | Diesel fuel no. 2 | 2710.19 | ||
68476-78-8 | Fragrance of sodium cyclamate | Sodium cyclamate | 3302.1 | |
68476-85-7 | Liquefied petroleum gas | |||
68476-86-8 | Liquefied petroleum gas | 2710.19 | ||
68478-45-5 | Mixed diaryl-p-phenylenediamine | 3812.3 | ||
68478-92-2 | 1,3-Divinyl-1,1,3,3-tetramethyldisiloxane platinum complex | 3815.9 | ||
68479-98-1 | Diethylmethylbenzenediamine | 2,2-dimethyl-3H-1-benzofuran-7-amine | ||
68490-66-4 | 1,3,5-Triazine-2,4,6(1H,3H,5H)-trione, compd. with 6-2-(2-methyl-1H-imidazol-1-yl)ethyl-1,3,5-triazine-2,4-diamine (1:1) | 6-[2-(2-methylimidazol-1-yl)ethyl]-1,3,5-triazine-2,4-diamine;1,3,5-triazinane-2,4,6-trione | 2933.29 | |
68511-62-6 | Pigment yellow 150 | 3204.19 | ||
68512-91-4 | Hydrocarbons, C3-4-rich, petroleum distillate | Butane | 3606.1 | |
68513-69-9 | Carbon black feedstock | 2707.99 | ||
68514-28-3 | Potssium humate | Dipotassium;bicyclo[2.2.1]hept-5-ene-2,3-dicarboxylate | 4 | |
68514-75-0 | Orange essential oil | 3302.9 | ||
68515-40-2 | 1,2-Benzenedicarboxylic acid, benzyl C7-9-branched and linear alkyl esters | 3812.2 | ||
68515-43-5 | 1,2-Benzenedicarboxylic acid, di-C9-11-branched and linear alkyl esters | 2917.39 | ||
68515-47-9 | Undecyl dodecyl phthalate | 2-O-dodecyl 1-O-undecyl benzene-1,2-dicarboxylate | 2917.34 | |
68515-73-1 | D-Glucopyranose, oligomers, decyl octyl glycosides | |||
68526-86-3 | Isotridecyl alcohol | 11-methyldodecan-1-ol | 3823.7 | |
68526-94-3 | Alcohols, C12-20, ethoxylated | 3402.13 | ||
68527-74-2 | Vanillin propyleneglycol acetal | 2-methoxy-4-(4-methyl-1,3-dioxolan-2-yl)phenol | 2915.6 | |
68528-80-3 | Disuccinimidyl suberate | Bis(2,5-dioxopyrrolidin-1-yl) octanedioate | 2928 | |
68539-50-9 | Laureth-7 | 3402.13 | ||
68541-50-4 | Trimethylolpropane Triisostearate | 2,2-bis(16-methylheptadecanoyloxymethyl)butyl 16-methylheptadecanoate | ||
68548-08-3 | 1,2,2,6,6-Pentamethyl-4-piperidyl methacrylate | 3812.3 | ||
68551-12-2 | Alkanes, C13-16-iso- | 3402.13 | ||
68551-20-2 | C13-C16 Isoparaffin | 2710.19 | ||
68553-81-1 | Rice extract | 3301.29 | ||
68554-65-4 | Silicone defoamer oil | 3403.91 | ||
68555-06-6 | Iron chromite manganese brown spinel | 3207.1 | ||
68555-08-8 | Glycine soja sterol | 3404.9 | ||
68555-98-6 | Phenol, 4-(1,1-dimethylpropyl)-, polymer with sulfur chloride | 3812.1 | ||
685-73-4 | Polygalacturonic Acid | (2S,3R,4S,5R)-2,3,4,5-tetrahydroxy-6-oxohexanoic acid | 2932.99 | |
68583-51-7 | Decanoic acid, mixed diesters with octanoic acid and propylene glycol | 2915.9 | ||
68584-22-5 | Linear alkylbenzenesulfonic acid | 3402.11 | ||
6858-44-2 | Trisodium citrate hydrate | Trisodium 2-hydroxypropane-1,2,3-tricarboxylate hydrate | 2918.15 | |
68584-77-0 | PEG-15 cocopolyamine | 3402.12 | ||
68585-34-2 | Sodium lauryl ether sulphate | 3402.9 | ||
68585-47-7 | Sodium lauryl sulfate | 3402.11 | ||
68585-68-2 | Dihydrogen bis(ditridecyl phosphito-O'')tetrakis(octan-1-olato)titanate(2-), branched and linear | 3824.9 | ||
68603-25-8 | Alcohols, C8-10, ethoxylated propoxylated | 3402.2 | ||
68603-38-3 | Amides, C16-18 and C18-unsatd., N,N-bis(hydroxyethyl) | 2924.19 | ||
68603-42-9 | Fatty Acid Diethanolamide ; N,N-Bis(2-hydroxyethyl)-coconut fatty acid amide | |||
68606-10-0 | Pyrolysis gasoline | 2707.5 | ||
68606-18-8 | Cocoglycerides | 3823.19 | ||
68606-81-5 | Blackcurrant oil | 3302.1 | ||
68606-82-6 | Deertongue oleoresin | 3301.3 | ||
68606-83-7 | Cananga essential oil | 3301.29 | ||
68606-93-9 | Oakmoss essential Oil | 3301.29 | ||
68606-94-0 | Orange Juice Carbonyls | 3301.12 | ||
68608-26-4 | Sulfonic acids, petroleum, sodium salts | 2904.1 | ||
68608-38-8 | Tangerine terpenes | 3301.13 | ||
68608-66-2 | Acetic acid, chloro-, sodium salt, reaction products with 4,5-dihydro-2-undecyl-1H-imidazole-1-ethanol and sodium hydroxide | 3402.9 | ||
68608-82-2 | Polyethylbenzene | 2902.9 | ||
68608-89-9 | Benzenesulfonic acid, mono-C11-13-branched alkyl derivs., sodium salts | 3402.11 | ||
68609-97-2 | C12-14 Alkyl glycidyl ether | 2-(dodecyloxymethyl)oxirane2-(tetradecyloxymethyl)oxirane | ||
68610-13-9 | Pigment violet 47 | 3206.19 | ||
68610-51-5 | Phenol, 4-methyl-, reaction products with dicyclopentadiene and isobutylene | |||
68610-62-8 | Phosphorous acid, tri-C12-15-alkyl esters | 3812.3 | ||
68610-92-4 | Polyquaternium 10 | Cellulose, 2-hydroxyethyl 2-hydroxy-3-(trimethylammonio)propyl ether, chloride | 3912.39 | |
68611-03-0 | 1-(2-Hydroxyethyl)-2-(tall oil alkyl)-2-imidazoline | 2933.29 | ||
68611-44-9 | Dichlorodimethylsilane, reaction products with silica | Dioxosilane | ||
686-31-7 | Tert-Amyl peroxy-2-ethylhexanoate | 2-Methylbutan-2-yl 2-ethylhexaneperoxoate | 2915.9 | |
6864-37-5 | Bis(4-amino-3-methylcyclohexyl)methane | 4-[(4-amino-3-methylcyclohexyl)methyl]-2-methylcyclohexan-1-amine | 2921.3 | |
68647-71-2 | Tall oil, potassium salt | 3803 | ||
68647-72-3 | Orange oil terpenes | |||
68647-73-4 | Tea tree oil | 3301.29 | ||
68648-57-7 | Terpene Phenolic Resin | 3806.9 | ||
68649-11-6 | 1-decenes, dimer, hydrogenated | 3403.99 | ||
68649-12-7 | Poly(1-decene), hydrogenated | 1-Decene, tetramer mixed with 1-decene, trimer hydrogenated | 2710.19 | |
68649-29-6 | Phosphate ester of polyoxyalkylated fatty alcohol | 3402.11 | ||
68649-42-3 | Phosphorodithioic acid o,o-di-c1-14-alkyl esters zinc salts - | 3812.1 | ||
68650-39-5 | Imidazolium compounds, 1-[2-(carboxymethoxy)ethyl]-1-carboxymethyl)-4,5-dihydro-2-norcoco alkyl, hydroxides, sodium salts | 3402.19 | ||
6865-35-6 | Barium stearate | Barium(2+) octadecanoate | ||
6874-60-8 | Decylphosphonic Acid | Decylphosphonic Acid | 2931.9 | |
687-47-8 | Ethyl lactate | Ethyl (S)-2-hydroxypropionate | 2918.11 | |
687603-66-3 | Methylenedioxypyrovalerone (MDPV) | (R/S)-1-(Benzo[d][1,3] dioxol-5-yl)-2-(pyrrolidin- 1-yl)pentan-1-one | 2934.99 | 7 |
6876-37-5 | Methylammonium bromide | Methanamine;hydrobromide | ||
68783-41-5 | Fatty acids, C18-unsatd., dimers, hydrogenated | 3823.13 | ||
68797-35-3 | Dipotassium glycyrrhizinate | Dipotassium;(2S,3S,4S,5R,6R)-6-[(2S,3R,4S,5S,6S)-2-[[(3S,4aR,6aR,6bS,8aS,11S,12aR,14aR,14bS)-11-carboxy-4,4,6a,6b,8a,11,14b-heptamethyl-14-oxo-2,3,4a,5,6,7,8,9,10,12,12a,14a-dodecahydro-1H-picen-3-yl]oxy]-6-carboxylato-4,5-dihydroxyoxan-3-yl]oxy-3,4,5-tri | ||
68814-87-9 | Distillates (petroleum), full-range straight-run middle | 2710.19 | ||
68815-25-8 | Sulfuric acid, mono-C12-15-alkyl esters, compds. with triethanolamine | 3402.11 | ||
68815-56-5 | Alcohols, C10-16, ethoxylated, sulfosuccinates, disodium salts | 3402.11 | ||
68855-18-5 | Heptanoic acid, ester with 2,2-dimethyl-1,3-propanediol | 2915.9 | ||
68855-24-3 | Docosylbenzene ; C14-C30 alkyl benzene | |||
68855-54-9 | Diatomite ; Flux -Calcined Diatomaceous Earth | Dioxosilane | ||
68855-56-1 | Alcohols, C12-16 | |||
68855-99-2 | Litsea cubeba oil | 3302.9 | ||
68859-51-8 | Pigment yellow 153 | 3204.17 | ||
688-73-3 | Tributyltin Hydride | Tributyltin | 2931.2 | |
688-74-4 | Tributyl Borate | Tributyl Borate | 2920.9 | |
688-84-6 | 2-Ethylhexyl methacrylate | 2-ethylhexyl 2-methylprop-2-enoate | ||
68889-49-6 | PEG-20 glyceryl oleate | 3402.13 | ||
68890-66-4 | Piroctone Olamine | 2-aminoethanol 1-hydroxy-4-methyl-6-(2,4,4-trimethylpentyl)pyridin-2-one | ||
68891-38-3 | Alcohols, C12-14, ethoxylated, sulfates, sodium salts | 3402.11 | ||
68-89-3 | Metamizole Sodium | Sodium [(1,5-dimethyl-3-oxo-2-phenylpyrazol-4-yl)-methylamino]methanesulfonate | 2933.19 | |
68893-92-5 | Basic yellow 67 | 3204.9 | ||
68901-15-5 | Galbanum oxyacetate | Prop-2-enyl 2-cyclohexyloxyacetate | 2918.99 | |
68908-82-7 | Hydroxycitronellal, indole condensation products | 7-hydroxy-3,7-dimethyloctanal 1H-indole | 2909.3 | |
68909-20-6 | Silanamine, 1,1,1-trimethyl-N-(trimethylsilyl) | 3824.9 | ||
68909-79-5 | Hematite, chromium green black | 3207.1 | ||
68912-13-0 | Tricyclodecenyl Propionate | 2915.5 | ||
68915-25-3 | Cocodimonium hydroxypropyl hydrolyzed keratin | 2-Hydroxy-l-propanaminium, N,N-dimethyl-N- (coco-alkyl)-, 3-hydrolyzed keratin derivs., chlorides | 3504 | |
68915-31-1 | Hexasodium metaphosphate | Disodium [hydroxy(oxido)phosphoryl] hydrogen phosphate | 2835.29 | |
68915-99-1 | Rubus occidentalis seed oil ; Black Raspberry | 3302.9 | ||
68916-04-1 | Bitter orange essential oil | 3301.29 | ||
68916-47-2 | Gardenia oil | 3301.29 | ||
68916-55-2 | Elder flower absolute | 3301.9 | ||
68916-60-9 | Cyperus scariosus oil | 3301.29 | ||
68916-68-7 | Chamomile oil | 3302.9 | ||
68916-73-4 | Camellia oil | 3302.1 | ||
68917-05-5 | Osmanthus absolute | 3301.29 | ||
68917-18-0 | Peppermint essential oil | 3302.9 | ||
68917-33-9 | Terpenes and Terpenoids, lemon-oil | 3301.13 | ||
68917-75-9 | Wintergreen essential oil | 3302.9 | ||
68917-78-2 | Paprika oleoresin | |||
68919-76-6 | Fatty acids, tall-oil, reaction products with 2-[(2-aminoethyl)amino]ethanol | 3402.12 | ||
68920-03-6 | Glycerides, C16-18 and C18-unsatd., deodorizer distillates | (C16-C18) and (C18) unsaturated trialkyl glyceride, steam-distillate | 3404.9 | |
68920-65-0 | Potassium Cocoyl Hydrolyzed Collagen | 3402.11 | ||
68920-66-1 | Alcohols, C16-18 and C18-unsatd., ethoxylated | |||
68921-45-9 | Benzenamine, N-phenyl-, reaction products with styrene and 2,4,4-trimethylpentene | 3812.3 | ||
68921-68-6 | Fused Magnesia Chrome | 2519.9 | ||
6892-68-8 | Dithioerythritol | (2R,3S)-1,4-bis(sulfanyl)butane-2,3-diol | 2930.9 | |
68928-76-7 | Dimethylbis[(1-oxoneodecyl)oxy]stannane | 3815.9 | ||
68937-10-0  | Hydrogenated polyisobutene | Propene, 2-methyl-, homopolymer | ||
68937-41-7 | Isopropylphenyl phosphate | Diphenyl 4-(propan-2-yl)phenyl phosphate phenyl bis[4-(propan-2-yl)phenyl] phosphate triphenyl phosphate tris[4-(propan-2-yl)phenyl] phosphate | ||
68937-75-7 | Fatty acids, C8-10 | 3823.19 | ||
68937-76-8 | Fatty acids, C16-20 | 3823.11 | ||
68937-96-2 | Polysulfides, di-tert-Bu | 1-(2,2-dimethylpropyldisulfanyl)-2,2-dimethylpropane | 2930.9 | |
68938-15-8 | Fatty acids, coco, hydrogenated | 3823.19 | ||
68-94-0 | Hypoxanthine | 3,7-dihydropurin-6-one | 2933.99 | |
68951-99-5 | Polyether-modified polydimethylsiloxane | 3402.13 | ||
68952-43-2 | Star anise oil | 3302.9 | ||
68953-58-2 | Tetra-alkyl ammonium bentonite | 3802.902 | ||
68953-84-4 | 1,4-Benzenediamine N,N'-mixed phenyl and tolyl derivs | 1,4-Benzenediamine N,N'-mixed phenyl and tolyl derivs | ||
68954-91-6 | Alkyl polyethylene glycol derivative | 3402.9 | ||
68955-19-1 | Sulfuric acid, mono-C12-18-alkyl esters, sodium salts | |||
68955-20-4 | Sodium heptadecyl sulfate ; Sulfuric acid, mono-C16-18-alkyl esters, sodium salts | |||
68956-82-1 | Cobalt resinate, precipitated | 3806.2 | ||
68958-58-7 | Polyoxyethylene glycerol monoisostearate | 3402.13 | ||
68958-64-5 | PEG-40 glyceryl trioleate | 3402.13 | ||
68971-49-3 | Fluorescent Brightener 264 | Hexasodium 2,2'-{ethene-1,2-diylbis[(3-sulfonatobenzene-4,1-diyl)imino{6-[bis(2-hydroxyethyl)amino]-1,3,5-triazine-4,2-diyl}imino]}dibenzene-1,4-disulfonate | 3204.2 | |
68971-82-4 | 4-Tert-Butylcalix[8]arene | 2907.19 | ||
68986-95-8 | Polyglyceryl-3 Methylglucose Distearate | 3402.13 | ||
68988-92-1 | Wright's Stain | [7-(dimethylamino)phenothiazin-3-ylidene]-dimethylazanium;2-(2,4,5,7-tetrabromo-3,6-dihydroxyxanthen-10-ium-9-yl)benzoic acid | ||
68989-03-7 | Quaternary ammonium compounds, coco alkylbis(hydroxyethyl)methyl, ethoxylated, Me sulfates (salts) | 3402.12 | ||
68989-22-0 | Zeolite NaA | Dialuminum; disodium; oxygen(2-); silicon(4+); hydrate | 2842.9 | |
68990-01-2 | Rosin acids, hydrogenated, potassium salts | 3806.9 | ||
68990-09-0 | Meat extract ; Beef extract powder | |||
68990-11-4 | Arnica Oil | 3301.9 | ||
68990-47-6 | Fatty acids, tall-oil, reaction products with diethylenetriamine, maleic anhydride, tetraethylenepentamine and triethylenetetramine | 3402.19 | ||
68990-53-4 | Monoglyceride | 2-[2-(2,3-Dihydroxypropoxy)-2-oxoethyl]-2-hydroxybutanedioic acid | 3824.9 | |
68991-37-7 | Inula viscosa oil | 3301.19 | ||
69004-03-1 | Toltrazuril | 1-methyl-3-[3-methyl-4-[4-(trifluoromethylsulfanyl)phenoxy]phenyl]-1,3,5-triazinane-2,4,6-trione | 2934.99 | 6 |
69011-36-5 | Isotridecanolethoxylate | 3402.13 | ||
69011-71-8 | Aluminium dross | 2620.4 | ||
69012-64-2 | Amorphous silica fume ; Microsilica | |||
69012-86-8 | Zinc ash | 2620.19 | ||
6906-39-4 | Peonidin 3-glucoside | (2S,3R,4S,5S,6R)-2-[5,7-dihydroxy-2-(4-hydroxy-3-methoxyphenyl)chromenylium-3-yl]oxy-6-(hydroxymethyl)oxane-3,4,5-triol chloride | 2938.9 | |
69-09-0 | Chlorpromazine hydrochloride | 3-(2-chlorophenothiazin-10-yl)-N,N-dimethylpropan-1-amine hydrochloride | 2934.3 | 1 |
691400-36-9 | 1-Propanaminium,N-(3-aminopropyl)-2-hydroxy-N,N-dimethyl-3-sulfo-, N-(C12-18 and C18-unsatd. acyl) derivs., inner salts | 3402.19 | ||
6915-15-7 | Malic Acid | 2-hydroxybutanedioic acid | 2918.19 | |
6920-22-5 | 1,2-Hexanediol | Hexane-1,2-diol | 2905.39 | |
69227-09-4 | Sodium dodecylbenzenesulfonate, branched | 3402.11 | ||
69227-22-1 | Alcohols, C10-16 ethoxylated propoxylated | 3402.13 | ||
69227-93-6 | N-Dodecyl beta-D-maltoside | (2R,3R,4S,5S,6R)-2-[(2R,3S,4R,5R,6R)-6-dodecoxy-4,5-dihydroxy-2-(hydroxymethyl)oxan-3-yl]oxy-6-(hydroxymethyl)oxane-3,4,5-triol | 2940 | |
6923-52-0 | Antimony triacetate | Antimony(3+) triacetate | 2915.29 | |
6925-69-5 | Solvent orange 60 | 12-Phthaloperinone(6CI,7CI,8CI);10H-Perimidino[2,1-a]isoindol-10-one | 3204.9 | |
69267-29-4 | 2,3-Di(4-pyridyl)-2,3-butanediol | 2,3-dipyridin-4-ylbutane-2,3-diol | 2933.99 | |
69300-15-8 | 2-Methyldecanenitrile | 2-methyldecanenitrile | 2926.9 | |
693-02-7 | 1-Hexyne | Hex-1-yne | 2901.29 | |
693-13-0 | Diisopropylcarbodiimide | N,N'-di(propan-2-yl)methanediimine | 2925.29 | |
6931-54-0 | Beta-Pinene oxide | (1S,5R)-6,6-dimethylspiro[bicyclo[3.1.1]heptane-4,2'-oxirane] | 2910.9 | |
693-23-2 | Dodecanedioic Acid | Dodecanedioic Acid | ||
69327-76-0 | Buprofezin | 2-tert-butylimino-5-phenyl-3-propan-2-yl-1,3,5-thiadiazinan-4-one | 2934.99 | 8 |
693-36-7 | Distearyl Thiodipropionate | Octadecyl 3-(3-octadecoxy-3-oxopropyl)sulfanylpropanoate | ||
693-57-2 | 12-Aminododecanoic acid | 12-Aminododecanoic acid | 2933.79 | |
69364-63-2 | Polyoxyethylene 20 isohexadecyl ether | 3402.13 | ||
69365-72-6 | Gallium trinitrate | Gallium;trinitrate;hydrate | 2834.29 | |
69388-84-7 | Sulbactam Sodium | Sodium (2S,5R)-3,3-dimethyl-4,4,7-trioxo-4$l^{6}-thia-1-azabicyclo[3.2.0]heptane-2-carboxylate | 2912.49 | 6 |
6938-94-9 | Diisopropyl Adipate | Dipropan-2-yl hexanedioate | 2917.12 | |
693-98-1 | 2-Methylimidazole | 2-methyl-1H-imidazole | 2905.16 | |
69430-36-0 | Hydrolyzed keratin | 3504 | ||
69460-11-3 | Isopinocampheylamine | (1S,3R,4R,5R)-4,6,6-trimethylbicyclo[3.1.1]heptan-3-amine | 2921.3 | |
694-83-7 | 1,2-Diaminocyclohexane | Cyclohexane-1,2-diamine | 2921.3 | |
695-06-7 | gamma-Hexalactone | 5-Ethyloxolan-2-one | 2932.2 | |
69-52-3 | Ampicillin Sodium | Sodium (2R)-2-amino-N-[(2S,5R,6R)-2-carboxy-3,3-dimethyl-7-oxo-4-thia-1-azabicyclo[3.2.0]heptan-6-yl]-2-phenylethanimidate | 2941.1 | 6 |
69-53-4 | Ampicillin | (2S,5R,6R)-6-[[(2R)-2-amino-2-phenylacetyl]amino]-3,3-dimethyl-7-oxo-4-thia-1-azabicyclo[3.2.0]heptane-2-carboxylic acid | 2941.1 | 6 |
69-57-8 | Penicillin G Sodium | Sodium (2S,5R,6R)-3,3-dimethyl-7-oxo-6-[(2-phenylacetyl)amino]-4-thia-1-azabicyclo[3.2.0]heptane-2-carboxylate | 2941.1 | 6 |
6959-47-3 | 2-Chloromethylpyridine hydrochloride | 2-(chloromethyl)pyridine hydrochloride | 2933.39 | |
695-96-5 | 2-Bromo-4-chlorophenol | 2-Bromo-4-chlorophenol | 2908.19 | |
696-23-1 | 2-Methyl-5-nitroimidazole | 2-methyl-5-nitro-1H-imidazole | 2933.29 | |
696-29-7 | Isopropylcyclohexane | Propan-2-ylcyclohexane | 2902.19 | |
69655-05-6 | Didanosine | 9-[(2R,5S)-5-(hydroxymethyl)oxolan-2-yl]-3H-purin-6-one | 2933.99 | 6 |
69657-51-8 | Acyclovir Sodium | Sodium 2-amino-9-(2-hydroxyethoxymethyl)purin-6-olate | 2933.59 | 6 |
69-65-8 | Mannitol | (2R,3R,4R,5R)-hexane-1,2,3,4,5,6-hexol | ||
696-62-8 | 4-Iodoanisole | 4-Iodoanisole | 2909.3 | |
69-72-7 | Salicylic Acid | 2-hydroxybenzoic acid | ||
6973-05-3 | 2-Acetamido-5-aminobenzenesulfonic acid | 2-acetamido-5-aminobenzenesulfonic acid | 2924.29 | |
69739-34-0 | t-Butylmethylsilyl triflate | [tert-butyl(dimethyl)silyl] trifluoromethanesulfonate | 2931.9 | |
6976-37-0 | Bistris | 2-[bis(2-hydroxyethyl)amino]-2-(hydroxymethyl)propane-1,3-diol | 2922.19 | |
6976-93-8 | 2-Methoxyethyl methacrylate | 2-methoxyethyl 2-methylprop-2-enoate | 2916.14 | |
69-78-3 | 3,3'-Dithiobis[6-nitrobenzoic] acid | 3,3'-Dithiobis[6-nitrobenzoic] acid | 2930.9 | |
697-91-6 | 2,6-Dichloro-1,4-benzoquinone | 2,6-Dichlorocyclohexa-2,5-diene-1,4-dione | 2914.7 | |
69-79-4 | Maltose | (2R,3R,4R,5S,6R)-6-(hydroxymethyl)-5-{[(2R,3R,4S,5S,6R)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxy}oxane-2,3,4-triol | 2940 | |
69806-34-4 | Haloxyfop-R-methyl | 2933.39 | 8 | |
698-76-0 | Delta-Octanolactone ; Fragrance of octanolactone | 6-Propyloxan-2-one | ||
698-87-3 | 1-Phenyl-2-propanol | 1-phenylpropan-2-ol | 2906.29 | 3 |
69-89-6 | Xanthine | 3,7-dihydropurine-2,6-dione | 2933.99 | |
69898-45-9 | Ferrozine | Sodium 4-[3-pyridin-2-yl-6-(4-sulfophenyl)-1,2,4-triazin-5-yl]benzenesulfonate | 2933.69 | |
6990-06-3 | Fusidic Acid | (2Z)-2-[(3R,4S,5S,8S,9S,10S,11R,13R,14S,16S)-16-acetyloxy-3,11-dihydroxy-4,8,10,14-tetramethyl-2,3,4,5,6,7,9,11,12,13,15,16-dodecahydro-1H-cyclopenta[a]phenanthren-17-ylidene]-6-methylhept-5-enoic acid | 2941.9 | 6 |
699014-53-4 | Ferrous gluconate | Iron (2R,3S,4R,5R)-2,3,4,5,6-pentahydroxyhexanoic acid hydrate | 2918.16 | |
69912-79-4 | Molecular sieve ; Zeolites, 5A | |||
6992-11-6 | 4-[(2,5-dichlorophenyl)azo]-N-(2,3-dihydro-2-oxo-1H-benzimidazol-5-yl)-3-hydroxy-2-Naphthalenecarboxamide | 3204.17 | ||
69-93-2 | Uric Acid | 7,9-dihydro-3H-purine-2,6,8-trione | 2933.59 | |
69938-76-7 | 1,6-Bis[3-(dimethylamino)ureido]hexane | 1-(dimethylamino)-3-[6-(dimethylaminocarbamoylamino)hexyl]urea | 2928 | |
6994-46-3 | Solvent blue 59 | 3204.9 | ||
69975-86-6 | Doxofylline | 7-(1,3-dioxolan-2-ylmethyl)-1,3-dimethylpurine-2,6-dione | 2939.59 | |
69991-67-9 | Perfluoropolyether oil ; Propene, 1,1,2,3,3,3-hexa-fluoro, oxidized, polymerized | 2710.19 | ||
69993-19-7 | Zinc dialkyldithiophosphate | 3812.3 | ||
70024-90-7 | Albumin from human serum | L-alpha-aspartyl-L-alanyl-L-histidyl-L-lysyl-L-seryl-L-alpha-glutamyl-L-valyl-L-alanyl-L-histidyl-L-arginyl-L-phenylalanyl-L-lysyl-L-alpha-aspartyl-L-leucyl-glycyl-L-alpha-glutamyl-L-alpha-glutamyl-L-asparagyl-L-phenylalanyl-L-lysyl-L-alanyl-L-leucyl-L-va | 3502.19 | |
700361-47-3 | Rilpivirine Hydrochloride | 4-[[4-[4-[(E)-2-cyanoethenyl]-2,6-dimethylanilino]pyrimidin-2-yl]amino]benzonitrile;hydrochloride | 2942 | 6 |
70084-87-6 | Hydrolyzed wheat protein | 3504 | ||
70131-50-9 | Montmorillonite ; Activated Bleaching Earth | 3802.9 | ||
70131-67-8 | Siloxanes and Silicones, Di-me, Hydroxy-Terminated | 2710.19 | ||
70142-34-6 | PEG 30 Dipolyhydroxystearate | Octadecanoic acid, 12-hydroxy-, polymer with .alpha.-hydro-.omega.-hydroxypoly(oxy-1,2-ethanediyl) | ||
70161-19-2 | Acid green 40:1 | 3204.12 | ||
70161-44-3 | Sodium Hydroxymethylglycinate | Sodium 2-(hydroxymethylamino)acetate | 2922.5 | |
70-16-6 | Thiamine | 2-[3-[(4-amino-2-methylpyrimidin-5-yl)methyl]-4-methyl-1,3-thiazol-3-ium-5-yl]ethanol | 2936.22 | |
70-18-8 | Glutathione | (2S)-2-amino-5-[[(2R)-1-(carboxymethylamino)-1-oxo-3-sulfanylpropan-2-yl]amino]-5-oxopentanoic acid | 2930.9 | |
70193-21-4 | Trichlamide | N-(1-butoxy-2,2,2-trichloroethyl)-2-hydroxybenzamide | 2924.29 | |
70197-13-6 | Methyltrioxorhenium | Carbanide trioxorhenium | 2931.9 | |
701-97-3 | Cyclohexanepropionic acid | 3-cyclohexylpropanoic acid 3-cyclohexylpropanoic acid 3-cyclohexylpropanoic acid | 2916.2 | |
70209-99-3 | Reactive blue 69 | 3204.16 | ||
70210-00-3 | Reactive red 83 | 3204.12 | ||
70210-20-7 | Reactive red 24 | Trisodium 5-[[4-chloro-6-(methylphenylamino)-1,3,5-triazin-2-yl]amino]-4-hydroxy-3-[(2-sulphonatophenyl)azo]naphthalene-2,7-disulphonate | 3204.16 | |
7021-09-2 | Methoxyphenylacetic acid | 2-methoxy-2-phenylacetic acid | 2918.99 | |
7023-61-2 | Pigment red 48:2 | 2-Naphthalenecarboxylic acid, 4-[(5-chloro-4-methyl-2-sulfophenyl) azo]-3-hydroxy-, calcium salt (1:1) | 3206.49 | |
70236-60-1 | Acid brown 282 | 3204.12 | ||
70248-46-3 | Phenolic modified rosin ester | 3806.2 | ||
70-26-8 | Ornithine | (2S)-2,5-diaminopentanoic acid | 2930.9 | 6 |
70288-86-7 | Ivermectin | 2938.9 | 6 | |
70294-19-8 | Disperse red 277 | 3204.11 | ||
70321-14-1 | Pigment yellow 193 | 3207.1 | ||
70321-86-7 | 2-(2H-benzotriazol-2-yl)-4, 6-bis (1-methyl-1-phenylethyl)phenol | 2-(benzotriazol-2-yl)-4,6-bis(2-phenylpropan-2-yl)phenol | ||
70331-94-1 | 2-[[2-[2-[3-(3,5-ditert-butyl-4-hydroxyphenyl)propanoyloxy]ethylamino]-2-oxoacetyl]amino]ethyl 3-(3,5-ditert-butyl-4-hydroxyphenyl)propanoate | |||
70-34-8 | 1-Fluoro-2,4-dinitrobenzene | 1-Fluoro-2,4-dinitrobenzene | 2904.9 | |
70356-03-5 | Cefaclor | (6R,7R)-7-[[(2R)-2-amino-2-phenylacetyl]amino]-3-chloro-8-oxo-5-thia-1-azabicyclo[4.2.0]oct-2-ene-2-carboxylic acid hydrate | 2941.9 | 6 |
70356-09-1 | Avobenzone | 1-(4-tert-butylphenyl)-3-(4-methoxyphenyl)propane-1,3-dione | 2914.5 | 6 |
703-95-7 | 5-Fluoroorotic acid | 5-fluoro-2,4-dioxo-1H-pyrimidine-6-carboxylic acid | 2933.59 | |
704-45-0 | 2-Methoxy-4-methylbenzoic acid | 2-Methoxy-4-methylbenzoic acid | 2918.99 | |
70445-23-7 | Octadecenedioic acid | (E)-octadec-2-enedioic acid | 2915.7 | |
70445-33-9  | 3-(2-Ethylhexoxy)propane-1,2-diol | 3-(2-ethylhexoxy)propane-1,2-diol | 2909.49 | |
70458-96-7 | Norfloxacin | 1-ethyl-6-fluoro-4-oxo-7-piperazin-1-ylquinoline-3-carboxylic acid | 2933.59 | |
70-47-3 | Asparagine | L-asparagine | 2924.19 | |
70476-63-0 | 1,4-Bis[[2-(dimethylamino)ethyl]amino]-5,8-dihydroxy-9,10-anthracenedione | 1,4-bis({[2-(dimethylamino)ethyl]amino})-5,8-dihydroxy-9,10-dihydroanthracene-9,10-dione | 2922.5 | |
7047-84-9 | Aluminum monostearate | Octadecanoyloxyaluminum dihydrate | 2915.7 | |
7048-04-6 | Cysteine Hydrochloride | (2R)-2-amino-3-sulfanylpropanoic acid hydrate hydrochloride | 2930.9 | |
70514-12-4 | Used lubricating oil | 2710.99 | ||
70516-41-5 | 6'-[ethyl(3-methylbutyl)amino]-3'-methyl-2'-(phenylamino)-3H-spiro[2-benzofuran-1,9'-xanthene]-3-one | 6'-[ethyl(3-methylbutyl)amino]-3'-methyl-2'-(phenylamino)-3H-spiro[2-benzofuran-1,9'-xanthene]-3-one | 2932.99 | |
705-31-7 | 1-Ethynyl-4-(trifluoromethyl)benzene | 1-Ethynyl-4-(trifluoromethyl)benzene | 2903.99 | |
70-55-3 | P-Toluenesulfonamide | 4-methylbenzenesulfonamide | 2935 | |
7057-57-0 | Basic blue 6 | 3204.16 | ||
705-86-2 | delta-Decalactone | 6-pentyloxan-2-one | 2932.2 | |
706-08-1 | p-Fluoro-beta-nitrostyrene | 1-fluoro-4-[(E)-2-nitroethenyl]benzene | 2904.9 | |
706-14-9 | gamma-Decalactone | 5-hexyloxolan-2-one | 2932.2 | |
70616-89-6 | Reactive orange 13 | 3204.16 | ||
70624-18-9 | Poly [[6-[(1,1,3,3-tetramethylbutyl)amino] -1,3,5-triazine-2,4-diyl] | N,N'-bis(2,2,6,6-tetramethylpiperidin-4-yl)hexane-1,6-diamine;2,4,6-trichloro-1,3,5-triazine;2,4,4-trimethylpentan-2-amine | ||
70630-17-0 | Metalaxyl-M | Methyl N-(2,6-dimethylphenyl)-N-(methoxyacetyl)-D-alaninate | 2924.29 | 8 |
70643-19-5 | 2-(2,4-Diaminophenoxy)ethanol | 2-(2,4-diaminophenoxy)ethanol | 2921.51 | |
70643-20-8 | 2,4-Diaminophenoxyethanol sulfate | 2-(2,4-diaminophenoxy)ethanol sulfuric acid | 2922.5 | |
70693-30-0 | 1,2-Benzenedicarboxylic acid, mixed decyl and lauryl and octyl diesters | 3812.2 | ||
70693-32-2 | Decanoic acid, mixed esters with neopentyl glycol and octanoic acid | 3824.9 | ||
70693-59-3 | 2-Amino-N-cyclohexyl-N-methylbenzenesulfonamide | 2-Amino-N-cyclohexyl-N-methylbenzenesulfonamide | 2935 | |
70693-62-8 | Pentapotassium bis(peroxymonosulphate) bis(sulphate) | |||
7069-42-3 | Retinyl Propionate | [(2E,4E,6E,8E)-3,7-dimethyl-9-(2,6,6-trimethylcyclohexen-1-yl)nona-2,4,6,8-tetraenyl] propanoate | 2936.21 | |
70729-65-6 | Disperse Red Violet P-R; b-Alanine,N-[3-(acetylamino)-4-[(2,4-dinitrophenyl)azo]phenyl]-N-(3-methoxy-3-oxopropyl)-,methyl ester (9CI) | 3204.11 | ||
70750-27-5 | Alcohols, C12-13, ethoxylated propoxylated | 3402.2 | ||
70753-61-6 | Calcium L-Threonate | Calcium (2R,3S)-2,3,4-trihydroxybutanoate | 2918.19 | |
70775-75-6 | 1,1'-(1,10-Decanediyl)bis(N-octyl-4(1H)-pyridinimine) dihydrochloride | 1,1'-(1,10-Decanediyl)bis(N-octyl-4(1H)-pyridinimine) dihydrochloride | 2933.39 | |
7080-50-4 | Chloramine T trihydrate | Sodium chloro-(4-methylphenyl)sulfonylazanide trihydrate | 2935 | |
708-06-5 | 2-Hydroxy-1-naphthaldehyde | 2-hydroxynaphthalene-1-carbaldehyde | 2912.49 | |
7081-44-9 | Cloxacillin Sodium | Sodium (2S,5R,6R)-6-[[3-(2-chlorophenyl)-5-methyl-1,2-oxazole-4-carbonyl]amino]-3,3-dimethyl-7-oxo-4-thia-1-azabicyclo[3.2.0]heptane-2-carboxylate hydrate | 2941.1 | 6 |
70831-56-0 | Chicoric Acid | (2R,3R)-2,3-bis[[(E)-3-(3,4-dihydroxyphenyl)prop-2-enoyl]oxy]butanedioic acid | 2918.29 | |
70833-40-8 | Tert-Amyl peroxy 2-ethylhexyl carbonate | 2-ethylhexyl 2-methylbutan-2-yloxy carbonate | ||
7084-24-4 | Chrysanthemin | (3R,4S,5S,6R)-2-[2-(3,4-dihydroxyphenyl)-5,7-dihydroxychromenylium-3-yl]oxy-6-(hydroxymethyl)oxane-3,4,5-triol chloride | 2938.9 | |
70852-56-1 | Ampholytes | 2922.49 | ||
7085-85-0 | Ethyl-2-cyanoacrylate | Ethyl 2-cyanoprop-2-enoate | ||
70865-20-2 | Acid yellow 199 | Benzenesulfonic acid, 4-[[4-[(4-hydroxy-2-methylphenyl)azo]phenyl]amino]-3-nitro-, monosodium salt | 3204.12 | |
7087-68-5 | N,N-Diisopropylethylamine | N-ethyl-N-propan-2-ylpropan-2-amine | 2921.19 | |
70892-20-5 | Calendula officinalis Oil | 3301.9 | ||
70914-02-2 | PEG-70 Mango Glycerides | 3402.13 | ||
70955-01-0 | Molecular sieves 4A | |||
70955-25-8 | Cucumber Oil | 3302.9 | ||
70955-69-0 | Octylphenoxypolyethoxy-polypropoxypropanol | 3402.13 | ||
70967-97-4 | N-Succinyl-Ala-Ala-Pro-Phe p-nitroanilide | 4-[[(2S)-1-[[(2S)-1-[(2S)-2-[[(2S)-1-(4-nitroanilino)-1-oxo-3-phenylpropan-2-yl]carbamoyl]pyrrolidin-1-yl]-1-oxopropan-2-yl]amino]-1-oxopropan-2-yl]amino]-4-oxobutanoic acid | 2933.99 | |
70969-70-9 | Ethylhexyl Isononanoate | 2-ethylhexyl 3,5,5-trimethylhexanoate | 2915.9 | |
709-98-8 | Propanil ; 3',4'-dichloropropionanilide | 2924.29 | ||
71-00-1 | Histidine | (2S)-2-amino-3-(1H-imidazol-5-yl)propanoic acid | ||
710-04-3 | 5-Undecanolide | 6-hexyloxan-2-one | 2932.2 | |
71010-52-1 | Gellan gum | |||
7103-09-5 | 3-Butenylmagnesium bromide | Magnesium but-1-ene bromide | 2932.99 | |
71031-15-7 | Cathinone | (–)-(S)-2-aminopropiophenone | 2939.99 | 9 |
71050-62-9 | Phosphanecarboxylic Acid | Phosphanylformic acid | 2918.3 | |
71060-57-6 | Alcohols, C8-10 (even numbered), ethoxylated | 3402.11 | ||
71119-22-7 | Sodium 3-Morpholinopropanesulfonate | Sodium 3-morpholin-4-ylpropane-1-sulfonate | 2933.99 | |
71119-23-8 | Sodium 2-Morpholinoethanesulfonate | Sodium 2-morpholin-4-ylethanesulfonate | 2934.99 | |
71125-38-7 | Meloxicam | 4-hydroxy-2-methyl-N-(5-methyl-1,3-thiazol-2-yl)-1,1-dioxo-1$l^{6},2-benzothiazine-3-carboxamide | 2934.1 | 6 |
7114-03-6 | Methyl green | 3212.9 | ||
71145-03-4 | Methyl 2,6-dimethyl-5-nitro-4-[2-(trifluoromethyl)phenyl]-1,4-dihydropyridine-3-carboxylate | Methyl 2,6-dimethyl-5-nitro-4-[2-(trifluoromethyl)phenyl]-1,4-dihydropyridine-3-carboxylate | 2933.99 | |
71-23-8 | Propyl Alcohol | Propan-1-ol | 2905.12 | 3 |
71277-79-7 | Glycyrrhizinate, Disodium | Disodium (2S,3S,4S,5R,6S)-6-[(3R,4S,5S,6S)-2-[[(3S,4aR,6aR,6bS,8aS,11S,12aR,14aR,14bS)-11-carboxy-4,4,6a,6b,8a,11,14b-heptamethyl-14-oxo-2,3,4a,5,6,7,8,9,10,12,12a,14a-dodecahydro-1H-picen-3-yl]oxy]-6-carboxylato-4,5-dihydroxyoxan-3-yl]oxy-3,4,5-trihydrox | 2938.9 | |
71283-80-2 | Fenoxaprop-P-ethyl | ethyl (2R)-2-{4-[(6-chloro-1,3-benzoxazol-2-yl)oxy]phenoxy}propanoate | 2934.99 | 8 |
7128-64-5 | 2,2’-(2,5-Thiophenediyl)bis(5-Tert-butylbenzoxazole) | 5-tert-butyl-2-[5-(5-tert-butyl-1,3-benzoxazol-2-yl)thiophen-2-yl]-1,3-benzoxazole | 3207.1 | |
71310-21-9 | 11-Mercaptoundecanoic acid | 11-sulfanylundecanoic acid | 2930.9 | |
7134-11-4 | Potassium 4-hydroxy-3-methoxybenzenesulfonate hydrate | Potassium 4-hydroxy-3-methoxybenzenesulfonate hydrate | 2930.9 | |
71-36-3 | Butyl alcohol | Butan-1-ol | 3 | |
713-95-1 | Delta-Dodecalactone ; Fragrance of Delta-Dodecalactone | 6-heptyloxan-2-one | ||
7139-89-1 | 2,5-Diaminobenzene-1,4-disulfonic acid | 2,5-diaminobenzene-1,4-disulfonic acid | 2921.51 | |
71-41-0 | Amyl alcohol | Pentan-1-ol | 2905.19 | |
71418-44-5 | Monobromobimane | 7-(bromomethyl)-1,2,6-trimethylpyrazolo[1,2-a]pyrazole-3,5-dione | 2933.99 | |
71422-67-8 | Chlorfluazuron | N-[(3,5-dichloro-4-{[3-chloro-5-(trifluoromethyl)pyridin-2-yl]oxy}phenyl)carbamoyl]-2,6-difluorobenzamide | 2933.39 | 8 |
71-43-2 | Benzene | Benzene | ||
71-44-3 | Spermine | N,N'-bis(3-aminopropyl)butane-1,4-diamine | 2921.29 | |
71-48-7 | Cobaltous Acetate | Cobalt(2+) diacetate | 2915.29 | |
71539-52-1 | Oxycodone n-oxide | (4R,4aS,7aR,12bS)-4a-hydroxy-9-methoxy-3-methyl-3-oxido-2,4,5,6,7a,13-hexahydro-1H-4,12-methanobenzofuro[3,2-e]isoquinoline-3-ium-7-one | 2939.11 | |
71-55-6 | 1,1,1-Trichloroethane | 1,1,1-trichloroethane | 2833.22 | |
71566-49-9 | 2-ethylhexyl isononanoate | 2-ethylhexyl 7-methyloctanoate | 3824.9 | |
71566-54-6 | Pigment red 221 | 3204.17 | ||
71-58-9 | Medroxyprogesterone Acetate | [(6S,8R,9S,10R,13S,14S,17R)-17-acetyl-6,10,13-trimethyl-3-oxo-2,6,7,8,9,11,12,14,15,16-decahydro-1H-cyclopenta[a]phenanthren-17-yl] acetate | 2937.23 | |
71603-79-7 | Acid yellow 220 | 3204.12 | ||
71617-10-2 | Amiloxate | 3-methylbutyl (E)-3-(4-methoxyphenyl)prop-2-enoate | 2918.29 | |
7162-59-6 | 2-Hexoxybenzaldehyde | 2-Hexoxybenzaldehyde | 2912.49 | |
716-79-0 | 2-Phenylbenzimidazole | 2-phenyl-1H-benzimidazole | 2933.99 | |
7173-51-5 | Didecyldimonium Chloride | Didecyl(dimethyl)azanium chloride | ||
7173-54-8 | Tridodecylmethylammonium | Tridodecyl(methyl)azanium chloride | 2923.9 | |
7173-62-8 | N-Oleyl-1,3-propanediamine | N'-[(Z)-octadec-9-enyl]propane-1,3-diamine | ||
71751-41-2 | Abamectin | 8 | ||
7177-48-2 | Ampicillin Trihydrate | (2S,5R,6R)-6-[[(2R)-2-amino-2-phenylacetyl]amino]-3,3-dimethyl-7-oxo-4-thia-1-azabicyclo[3.2.0]heptane-2-carboxylic acid trihydrate | 2941.1 | 6 |
71799-43-4 | Acid brown 354 | 3204.12 | ||
71819-49-3 | Solvent blue 98 | 3204.19 | ||
71819-51-7 | Solvent red 164 | 3204.19 | ||
71819-52-8 | Pigment red 166 | 3204.17 | ||
71821-15-3 | 1-(2-(((4-Bromophenyl)thio)methoxy)-2-(2,4-dichlorophenyl)ethyl)-1H-imidazole nitrate | 1-[2-[(4-bromophenyl)sulfanylmethoxy]-2-(2,4-dichlorophenyl)ethyl]imidazole nitric acid | 2933.29 | |
7182-53-8 | Butylscopolamine | 2939.99 | ||
71832-19-4 | Solvent red 168 | 3204.19 | ||
71832-85-4 | Pigment yellow 168 | Benzenesulfonic acid, 4-[[1-[[(2-chlorophenyl)amino] carbonyl]-2-oxopropyl]azo]- 3-nitro-, calcium salt (2:1) | 3204.17 | |
71838-47-6 | Direct yellow 137 | 3204.9 | ||
71838-98-7 | Reactive yellow 95 | 3204.16 | ||
71839-01-5 | Solvent green 28 | 3204.19 | ||
71868-10-5 | 2-methyl-1-(4-methylthiophenyl)-2-morpholinopropan-1-one | 2-methyl-1-(4-methylthiophenyl)-2-morpholinopropan-1-one | 2934.99 | |
71872-19-0 | Acid blue 317 | 3204.12 | ||
71872-43-0 | Disperse blue 284 | 3204.11 | ||
71872-49-6 | Disperse brown 19 | 3204.11 | ||
71872-50-9 | Disperse green 9 | 3204.11 | ||
71872-76-9 | Reactive blue 160 | Benzoic acid, 2-[[[[3-[[4-chloro-6-[[4-[[4-chloro-6-[(3-sulfophenyl)amino]-1,3,5-triazin-2-yl]amino]-2,5-disulfophenyl]amino]-1,3,5-triazin-2-yl]amino]-2-hydroxy-5-sulfophenyl]azo]phenylmethyl]azo]-5-sulfo-, pentasodium salt | 3204.16 | |
71878-19-8 | Poly[[6-[(1,1,3,3-tetramethylbutyl)amino]- 1,3,5-triazine-2,4-diyl][(2,2,6,6- tetramethyl-4-piperidinyl)imino]-1,6-hexanediyl[(2,2,6,6-tetramethyl-4-piperidinyl)imino]] | 3812.3 | ||
71902-01-7 | Sorbitan, isooctadecanoate | 3402.13 | ||
71902-08-4 | Direct yellow 142 | 3204.17 | ||
71902-17-5 | Solvent red 135 | 3204.9 | ||
71902-18-6 | Solvent red 149 | 3204.19 | ||
71-91-0 | Tetraethylammonium Bromide | Tetraethylazanium bromide | 2923.9 | |
71939-50-9 | Dihydroartemisinin | 2932.99 | ||
719-59-5 | 2-Amino-5-chlorobenzophenone | (2-amino-5-chlorophenyl)-phenylmethanone | 2922.39 | |
71989-14-5 | Fmoc-L-aspartic acid 4-tert-butyl ester | (2S)-2-(9H-fluoren-9-ylmethoxycarbonylamino)-4-[(2-methylpropan-2-yl)oxy]-4-oxobutanoic acid | 2937.9 | |
71989-18-9 | Fmoc-L-glutamic acid 5-tert-butyl ester | (2S)-2-(9H-fluoren-9-ylmethoxycarbonylamino)-5-[(2-methylpropan-2-yl)oxy]-5-oxopentanoic acid | 2937.9 | |
72017-66-4 | Acid red 407 | 3204.12 | ||
72102-84-2 | Pigment orange 64 | 5-[2-(6-Methyl-2-oxobenzimidazol-5-yl)hydrazinyl]-1,3-diazinane-2,4,6-trione  | 3204.17 | |
7212-44-4 | Nerolidol | 3,7,11-trimethyldodeca-1,6,10-trien-3-ol | 2912.21 | |
72-14-0 | Sulfathiazole | 4-amino-N-(1,3-thiazol-2-yl)benzenesulfonamide | 2935 | |
721-50-6 | Prilocaine | N-(2-methylphenyl)-2-(propylamino)propanamide | 2924.29 | 6 |
72-17-3 | Sodium Lactate | Sodium 2-hydroxypropanoate | 2918.11 | |
7217-59-6 | 2-Methoxythiophenol | 2-methoxybenzenethiol | 2930.9 | |
72178-02-0 | Fomesafen | 5-[2-chloro-4-(trifluoromethyl)phenoxy]-N-(methylsulfonyl)-2-nitrobenzamide | 2935.9 | 8 |
72-18-4 | Valine | (2S)-2-amino-3-methylbutanoic acid | ||
72-19-5 | Threonine | (2S,3R)-2-amino-3-hydroxybutanoic acid | 2922.5 | |
72200-76-1 | Tris maleate | 2-amino-2-(hydroxymethyl)propane-1,3-diol (Z)-but-2-enedioic acid | 3821 | |
7220-79-3 | Methylene blue trihydrate | [7-(dimethylamino)phenothiazin-3-ylidene]-dimethylazanium chloride trihydrate | ||
72259-10-0 | Copper(II) tetrafluoroborate hydrate | Copper;ditetrafluoroborate;hexahydrate | 2826.9 | |
72300-24-4 | Propanoic acid, 2-hydroxy-, compound with N-[3-(4-morpholinyl)propyl]isooctadecanamide (1:1) | 3402.19 | ||
7232-21-5 | Metoclopramide Hydrochloride | 4-amino-5-chloro-N-[2-(diethylamino)ethyl]-2-methoxybenzamide;hydrochloride | 2924.29 | 6 |
723-46-6 | Sulfamethoxazole | 4-amino-N-(5-methyl-1,2-oxazol-3-yl)benzenesulfonamide | 2935 | |
7235-40-7 | Beta-Carotene | 1,3,3-Trimethyl-2-[3,7,12,16-tetramethyl-18-(2,6,6-trimethylcyclohex-1-en-1-yl)octadeca-1,3,5,7,9,11,13,15,17-nonaen-1-yl]cyclohex-1-ene | ||
72363-26-9 | Disperse red 92 ; C.I. 60752 | 3204.11 | ||
7240-90-6 | 5-Bromo-4-chloro-3-indolyl beta-galactoside | (2S,3R,4S,5R,6R)-2-[(5-bromo-4-chloro-1H-indol-3-yl)oxy]-6-(hydroxymethyl)oxane-3,4,5-triol | 2934.99 | |
72432-84-9 | Tris (Cobalt branched-C10 carboxylic acid salt), borate | 2942 | ||
724424-92-4 | Spirulina powder | 3203 | ||
724792-82-9 | Aluminum barium europium magnesium oxide | 3206.5 | ||
72-48-0 | 1,2-Dihydroxyanthraquinone | 1,2-Dihydroxyanthracene-9,10-dione | 2914.7 | |
72484-69-6 | Oxirane, methyl-, polymer with oxirane, mono(2-decyltetradecyl) ether | 3402.13 | ||
72509-76-3 | Felodipine | 5-O-ethyl 3-O-methyl 4-(2,3-dichlorophenyl)-2,6-dimethyl-1,4-dihydropyridine-3,5-dicarboxylate | 2942 | 6 |
72-57-1 | Direct blue 14 ; Trypan blue | Tetrasodium (3Z)-5-amino-3-[[4-[4-[(2Z)-2-(8-amino-1-oxo-3,6-disulfonatonaphthalen-2-ylidene)hydrazinyl]-3-methylphenyl]-2-methylphenyl]hydrazinylidene]-4-oxonaphthalene-2,7-disulfonate | ||
72576-80-8 | Isostearyl palmitate | 16-methylheptadecyl hexadecanoate | 2915.7 | |
72608-12-9 | Calcium carbonate precipitated | |||
72619-32-0 | Haloxyfop-p-methyl | Methyl (2R)-2-(4-{[3-chloro-5-(trifluoromethyl)pyridin-2-yl]oxy}phenoxy)propanoate | 2933.39 | 8 |
72623-85-9 | Lubricating oils (petroleum), C20-50, hydrotreated neutral oil based, high viscosity | 2710.19 | ||
72623-86-0 | Lubricating oils (petroleum), C15-30, hydrotreated neutral oilbased | 2710.19 | ||
72623-87-1 | Lubricating oils (petroleum), C20-50, hydrotreated neutral oil-based | 2710.19 | ||
7266-47-9 | Adrenocorticotropic Hormone Fragment 1-17 human | 2933.29 | ||
72676-55-2 | 5,5'-dithiodi-1,3,4-thiadiazole-2(3H)-thione | 5-[(2-sulfanylidene-3H-1,3,4-thiadiazol-5-yl)disulfanyl]-3H-1,3,4-thiadiazole-2-thione | ||
72696-48-1 | Adenosine 5′-diphosphate monopotassium salt | Potassium [[(2R,3S,4R,5R)-5-(6-aminopurin-9-yl)-3,4-dihydroxyoxolan-2-yl]methoxy-hydroxyphosphoryl] hydrogen phosphate dihydrate | 2934.99 | |
7280-81-1 | 3-Benzyladenine | 3-benzylpurin-6-amine | 2933.59 | |
72827-72-6 | Acid brown 348 | 3204.12 | ||
72828-03-6 | Reactive red 180 | 3204.16 | ||
72869-69-3 | Apricot Kernel Oil | 3301.9 | ||
72869-86-4 | Di-HEMA trimethylhexyl dicarbamate | 2-[[3,5,5-trimethyl-6-[2-(2-methylprop-2-enoyloxy)ethoxycarbonylamino]hexyl]carbamoyloxy]ethyl 2-methylprop-2-enoate | 2924.19 | |
72903-27-6 | Diethyl cyclohexane-1,4-dicarboxylate | Diethyl cyclohexane-1,4-dicarboxylate | 2917.2 | |
7291-22-7 | Pyridine-d5 | 2,3,4,5,6-pentadeuteriopyridine | 2845.9 | |
72956-09-3 | Carvedilol | 1-(9H-carbazol-4-yloxy)-3-[2-(2-methoxyphenoxy)ethylamino]propan-2-ol | 2933.99 | 6 |
72963-72-5 | Imiprothrin | (2,5-dioxo-3-prop-2-ynylimidazolidin-1-yl)methyl 2,2-dimethyl-3-(2-methylprop-1-enyl)cyclopropane-1-carboxylate | 2916.2 | |
72968-47-9 | Passionflower, Passiflora incarnata extract | 3302.9 | ||
7299-99-2 | Pentaerythritol tetra(2-ethylhexanoate) | [3-(2-ethylhexanoyloxy)-2,2-bis(2-ethylhexanoyloxymethyl)propyl] 2-ethylhexanoate | ||
73-03-0 | Cordycepin | (2R,3R,5S)-2-(6-aminopurin-9-yl)-5-(hydroxymethyl)oxolan-3-ol | 2934.99 | |
73038-25-2 | Isotridecyl alcohol, ethoxylated, phosphated | 2-(11-methyldodecoxy)ethanol phosphoric acid | ||
73049-39-5 | Thymonucleic acid sodium salt | 2934.99 | ||
73049-73-7 | Peptone ; Peptone from animal tissue | |||
73049-78-2 | Citronella oil | 3302.9 | ||
73138-39-3 | Fatty acids, coco, esters with 1,3-butanediol | 3824.9 | ||
73138-44-0 | Partly saponified ester of montanic acids | Fatty acids, montan-wax, 1-methyl-1,3-propanediyl esters | 2915.12 | |
73138-81-5 | Quaternary ammonium compound | 3809.91 | ||
73138-82-6 | Resin acids | 3806.9 | ||
7314-32-1 | S-Dioxymethionine | (2S)-2-amino-4-methylsulfonylbutanoic acid | 2930.9 | |
73183-34-3 | Bis(Pinacolato)Diborane | 4,4,5,5-tetramethyl-2-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-1,3,2-dioxaborolane | 2939.99 | |
7319-86-0 | Lead octoate | Lead(2+) dioctanoate | 3211 | |
7320-34-5 | Tetrapotassium pyro phosphate | Tetrapotassium;phosphonato phosphate | ||
73-22-3 | Tryptophan | (2S)-2-amino-3-(1H-indol-3-yl)propanoic acid | 6 | |
73-24-5 | Adenine | 7H-purin-6-amine | ||
73246-99-8 | Montanic acid | Octacosanoic acid | 2915.12 | |
7325-46-4 | 1,4-Phenylenediacetic acid | 2-[4-(carboxymethyl)phenyl]acetic acid | 2917.39 | |
7328-17-8 | Carbitol acrylate | 2-(2-ethoxyethoxy)ethyl prop-2-enoate | 2916.12 | |
7330-46-3 | 5,5'-Methylenedianthranilic acid | 2-amino-5-[(4-amino-3-carboxyphenyl)methyl]benzoic acid | 2922.43 | |
73-31-4 | Melatonin | N-[2-(5-methoxy-1H-indol-3-yl)ethyl]acetamide | 2937.9 | 6 |
73-32-5 | Isoleucine | (2S,3S)-2-amino-3-methylpentanoic acid | 2933.99 | |
73347-80-5 | Disodium 1,4-dihydroanthracene-9,10-diolate | Disodium 1,4-dihydroanthracene-9,10-diolate | 2914.69 | |
7335-65-1 | Hydrazine Acetate | Acetic acid hydrazine | 2928 | |
73384-78-8 | Acid yellow 127 | sodium;4-[[4-chloro-6-(N-methylanilino)-1,3,5-triazin-2-yl]amino]-2-[[1-(2-chlorophenyl)-3-methyl-5-oxo-4H-pyrazol-4-yl]diazenyl]benzenesulfonate | 3204.11 | |
73398-30-8 | Disodium 3,3'-[(9,10-dihydro-9,10-dioxo-1,4-anthrylene)bis[imino(3-methylpropane-1,3-diyl)]]bis(benzenesulphonate) | Disodium 3,3'-[(9,10-dihydro-9,10-dioxo-1,4-anthrylene)bis[imino(3-methylpropane-1,3-diyl)]]bis(benzenesulphonate) | 3204.11 | |
73398-61-5 | Glyceryl caprylate-caprate | 11-(2,3-dihydroxypropoxycarbonyl)heptadecanoate | ||
73398-89-7 | Basic violet 11:1 | 3204.9 | ||
73-40-5 | Guanine | 2-amino-3,7-dihydropurin-6-one | 2933.59 | |
73463-39-5 | 3-(Cyclohexylamino)-2-hydroxy-1-propanesulfonic acid | 3-(Cyclohexylamino)-2-hydroxy-1-propanesulfonic acid | 2922.19 | |
7350-00-7 | Pregnane-3,20-dione | (8R,9S,10S,13S,14S,17S)-17-acetyl-10,13-dimethyl-1,2,4,5,6,7,8,9,11,12,14,15,16,17-tetradecahydrocyclopenta[a]phenanthren-3-one | 2937.29 | |
73581-79-0 | Menadione nicotinamide bisulfite | 1,2,3,4-tetrahydro-2-methyl-1,4-dioxonaphthalene-2-sulfonic acid, compound with nicotin-3-amide | 2914.7 | |
73590-58-6 | Omeprazole | 6-methoxy-2-[(4-methoxy-3,5-dimethylpyridin-2-yl)methylsulfinyl]-1H-benzimidazole | 2941.9 | 6 |
7360-38-5 | Triethylhexanoin | 2,3-bis(2-ethylhexanoyloxy)propyl 2-ethylhexanoate | ||
736150-63-3 | Glycerides, castor-oil mono-, hydrogenated, acetates | 3812.2 | ||
7365-44-8 | N-Tri(hydroxymethyl)methyltaurine | 2-[[1,3-dihydroxy-2-(hydroxymethyl)propan-2-yl]amino]ethanesulfonic acid | 2922.19 | |
7365-45-9 | Hydroxyethylpiperazine Ethane Sulfonic Acid | 2-[4-(2-hydroxyethyl)piperazin-1-yl]ethanesulfonic acid | 2933.79 | |
7365-82-4 | N-(Carbamoylmethyl)taurine | 2-[(2-amino-2-oxoethyl)amino]ethanesulfonic acid | ||
736994-63-1 | Cyantraniliprole | 3-bromo-1-(3-chloropyridin-2-yl)-N-[4-cyano-2-methyl-6-(methylcarbamoyl)phenyl]-1H-pyrazole-5-carboxamide | 2933.39 | |
7372-88-5 | 4-Methyldibenzothiophene | 4-Methyldibenzothiophene | 2934.99 | |
73771-04-7 | Prednicarbate | [2-[(8S,9S,10R,11S,13S,14S,17R)-17-ethoxycarbonyloxy-11-hydroxy-10,13-dimethyl-3-oxo-7,8,9,11,12,14,15,16-octahydro-6H-cyclopenta[a]phenanthren-17-yl]-2-oxoethyl] propanoate | 2937.29 | 6 |
73772-46-0 | Caprylamidopropyl Betaine | 3402.19 | ||
73-78-9 | Lidocaine Hydrochloride | 2-(diethylamino)-N-(2,6-dimethylphenyl)acetamide hydrochloride | 2924.29 | 6 |
7378-99-6 | Octyldimethylamine | N,N-dimethyloctan-1-amine | 2921.19 | |
73807-15-5 | N,N-Bis(2-hydroxyethyl)-palm kernel fatty acid amide | 3402.13 | ||
7385-67-3 | Nile Red | 9-(Diethylamino)benzo[a]phenoxazin-5-one | 2934.99 | |
738-70-5 | Trimethoprim | 5-[(3,4,5-trimethoxyphenyl)methyl]pyrimidine-2,4-diamine | 2933.59 | 6 |
73936-91-1 | Tinuvin 928 | 2-(benzotriazol-2-yl)-6-(2-phenylpropan-2-yl)-4-(2,4,4-trimethylpentan-2-yl)phenol | ||
73963-72-1 | Cilostazol | 6-[4-(1-cyclohexyltetrazol-5-yl)butoxy]-3,4-dihydro-1H-quinolin-2-one | 2936.29 | 6 |
7396-58-9 | Didecylmethylamine | N-decyl-N-methyldecan-1-amine | 2921.11 | |
7398-69-8 | Diallyldimethylammonium chloride | Diallyldimethylammonium chloride | ||
7404-50-4 | 2-Carbamimidoylsulfanylacetic acid | 2-Carbamimidoylsulfanylacetic acid | 2909.19 | |
74050-97-8 | Haloperidol Decanoate | [4-(4-chlorophenyl)-1-[4-(4-fluorophenyl)-4-oxobutyl]piperidin-4-yl] decanoate | 2933.39 | 6 |
74087-85-7 | Dimethyldioxirane | 3,3-dimethyldioxirane | 2930.9 | |
74091-64-8 | 2,5-bis-isocyanatomethyl-bicyclo[2.2.1]heptane | 2929.1 | ||
74-11-3 | 4-Chlorobenzoic acid | 4-Chlorobenzoic acid | 2916.39 | |
7411-49-6 | 3,3'-Diaminobenzidine tetrahydrochloride | 4-(3,4-diaminophenyl)benzene-1,2-diamine tetrahydrochloride | 2921.59 | |
7414-83-7 | Etidronate Disodium | Disodium hydroxy-[1-hydroxy-1-[hydroxy(oxido)phosphoryl]ethyl]phosphinate | 2931.9 | 6 |
74223-64-6 | Metsulfuron-methyl | Methyl 2-({[(4-methoxy-6-methyl-1,3,5-triazin-2-yl)carbamoyl]amino}sulfonyl)benzoate | 2935.9 | 8 |
74258-86-9 | Alacepril | (2S)-2-[[(2S)-1-[(2S)-3-acetylsulfanyl-2-methylpropanoyl]pyrrolidine-2-carbonyl]amino]-3-phenylpropanoic acid | 2933.59 | 6 |
74267-27-9 | Calcium Ionophore II | N,N-dicyclohexyl-2-[2-(dicyclohexylamino)-2-oxoethoxy]acetamide | 2924.29 | |
7429-90-5 | Aluminum | 3 | ||
74-31-7 | N,N'-Diphenyl-P-phenylenediamine | N,N'-diphenyl-p-phenylenediamine | ||
74341-78-9 | N-Ethyl-3,4-MDA hydrochloride | 1-(1,3-benzodioxol-5-yl)-N-ethylpropan-2-amine;hydrochloride | 2922.29 | |
74-39-5 | 4-(4-Nitrophenylazo)resorcinol | 4-[(E)-2-(4-nitrophenyl)diazen-1-yl]benzene-1,3-diol | 2927 | |
7439-89-6 | Iron ; Ferric | Iron | ||
7439-90-9 | Krypton | Krypton | 2804.29 | |
7439-91-0 | Lanthanum metal | Lanthanum | 2805.3 | |
7439-92-1 | Lead ; C.I. Pigment Metal 4 | Lead | 8 | |
7439-93-2 | Lithium | Lithium | 2805.19 | |
7439-96-5 | Manganese | Manganese | 2602 | |
7439-97-6 | Mercury | Mercury | 2805.4 | |
7439-98-7 | Molybdenum | Molybdenum | ||
7440-01-9 | Neon | Neon | 2804.29 | |
7440-02-0 | Nickel | Nickel | 3 | |
7440-03-1 | Niobium | Niobium | 2615.9 | |
7440-05-3 | Palladium  | Palladium  | ||
7440-06-4 | Platinum | 3815.12 | ||
7440-09-7 | Potassium | Potassium | 2805.19 | 3 |
7440-12-2 | Promethium | Promethium | 2844.4 | 5 |
7440-16-6 | Rhodium | Rhodium | 3208.9 | |
7440-18-8 | Ruthenium | Ruthenium | 2843.9 | |
7440-21-3 | Silicon | Silicon | 2804.61 | |
7440-22-4 | Colloidal silver | Silver | 2843.1 | |
7440-23-5 | Sodium | Sodium | 2805.11 | 3 |
7440-24-6 | Strontium | Strontium | 2816.4 | |
7440-25-7 | Tantalum | Tantalum | 2615.9 | |
7440-29-1 | Thorium-232 | Thorium | 2844.309 | 5 |
7440-31-5 | Tin | Tin | 2620.99 | |
7440-32-6 | Titanium | Titanium | 2826.9 | |
7440-33-7 | Tungsten | |||
7440-36-0 | Antimony | Antimony | 2617.1 | |
7440-37-1 | Argon | Argon | 2804.21 | |
7440-38-2 | Arsenic Metal | Arsenic | 2804.8 | 3 |
7440-42-8 | Boron | Boron | 2804.5 | |
7440-43-9 | Cadmium | Cadmium | 2805.19 | |
7440-44-0 | Desulfurized coke ; Activated carbon ; Activated charcoal | Carbon | ||
7440-45-1 | Cerium metal | Cerium | 2805.3 | |
7440-46-2 | Cesium | Cesium | 2805.19 | |
7440-47-3 | Chromium | Chromium | ||
7440-48-4 | Cobalt-60 | Cobalt | 2844.4 | |
7440-50-8 | Copper | Copper | ||
7440-55-3 | Gallium-67 (Ga-67) | Gallium | 2844.4 | 5 |
7440-57-5 | Gold nanoparticles | Gold | 2843.1 | |
7440-59-7 | Helium | Helium | 2804.29 | |
7440-63-3 | Xenon | Xenon | 2804.3 | |
7440-64-4 | Ytterbium | Ytterbium | 2805.3 | |
7440-65-5 | Yttrium-90 | Yttrium | 2844.4 | 5 |
7440-66-6 | Zinc | Zinc | 3 | |
7440-69-9 | Bismuth | Bismuth | ||
7440-70-2 | Calcium | 3 | ||
74431-23-5 | Imipenem | (5R,6S)-3-[2-(aminomethylideneamino)ethylsulfanyl]-6-[(1R)-1-hydroxyethyl]-7-oxo-1-azabicyclo[3.2.0]hept-2-ene-2-carboxylic acid;hydrate | 2941.9 | 6 |
7443-25-6 | Dimethyl 2-[(4-methoxyphenyl)methylidene]propanedioate | 3812.2 | ||
74441-05-7 | Pigment yellow 181 | 4-[[4-[[1,3-Dioxo-1-[(2-oxo-1,3-dihydrobenzimidazol-5-yl)amino]butan-2-yl]diazenyl]benzoyl]amino]benzamide  | 3204.17 | |
7446-07-3 | Tellurium(IV) oxide | Tellurium dioxide | 2811.29 | |
7446-08-4 | Selenium dioxide | Selenium dioxide | 2804.9 | |
7446-09-5 | Sulfur dioxide | Sulfur dioxide | 2811.292 | |
7446-19-7 | Zinc sulfate monohydrate | Zinc;sulfate;hydrate | ||
7446-20-0 | Zinc Sulfate Heptahydrate | Zinc;sulfate;heptahydrate | ||
7446-26-6 | Zinc pyrophosphate | Dizinc;phosphonato phosphate | 2835.39 | |
7446-70-0 | Aluminum chloride | Trichloroalumane | 2827.32 | 3 |
7447-39-4 | Copper(II) chloride | Dichlorocopper | 2827.39 | |
7447-40-7 | Potassium chloride | Potassium chloride | 3104.2 | 4 |
7447-41-8 | Lithium chloride | |||
745070-61-5 | 1,3,5-Tris(2,2-dimethylpropionylamino)benzene | N-[3,5-bis(2,2-dimethylpropanoylamino)phenyl]-2,2-dimethylpropanamide | 2924.29 | |
7452-79-1 | Ethyl 2-methylbutyrate ; Fragrance of ethyl 2-methylbutyrate | Ethyl 2-methylbutanoate | ||
74536-44-0 | Metadoxine | 4,5-bis(hydroxymethyl)-2-methylpyridin-3-ol;(2S)-5-oxopyrrolidine-2-carboxylic acid | 2936.29 | |
74563-64-7 | Phytantriol | 3,7,11,15-tetramethylhexadecane-1,2,3-triol | 2905.49 | |
745-65-3 | Alprostadil | 7-[(1R,2R,3R)-3-hydroxy-2-[(E,3S)-3-hydroxyoct-1-enyl]-5-oxocyclopentyl]heptanoic acid | 2937.5 | 6 |
74610-55-2 | Tylosin tartrate | 2941.9 | ||
74638-76-9 | 2,4-Diaminopyrimidine 3-oxide | 3-hydroxy-2-iminopyrimidin-4-amine | 2933.59 | |
747-36-4 | Hydroxychloroquine Sulfate | 2-[4-[(7-chloroquinolin-4-yl)amino]pentyl-ethylamino]ethanol sulfuric acid | 2933.49 | |
7473-98-5 | Benzoyl Isopropanol | 2-hydroxy-2-methyl-1-phenylpropan-1-one | 2914.4 | |
7477-67-0 | Bispyrazolone | 5-methyl-4-(3-methyl-5-oxo-1-phenyl-4H-pyrazol-4-yl)-2-phenyl-4H-pyrazol-3-one | 2933.19 | |
74-79-3 | Arginine | (2S)-2-amino-5-(diaminomethylideneamino)pentanoic acid | ||
74-82-8 | Methane | Methane | 2711.19 | |
74-83-9 | Methyl Bromide | Bromomethane | 2903.39 | |
74-84-0 | Ethane | Ethane | 2901.1 | 3 |
74-85-1 | Ethylene | Ethene | 3 | |
74-86-2 | Acetylene | Acetylene | 2901.29 | 3 |
74869-21-9 | Lubricating greases A complex combination of hydrocarbons having carbon numbers predominantly in the range of C12 through C50. may contain organic salts of alkali metals, alkaline earth metals, etc | 2710.19 | ||
74-87-3 | Methyl chloride ; Chloromethane | Chloromethane | 2903.11 | |
7487-88-9 | Magnesium sulfate | Magnesium sulfate | 2833.21 | |
7487-94-7 | Mercury (II) chloride | Chloromercury | 2827.39 | |
74-88-4 | Methyl Iodide | Iodomethane | 2903.39 | 3 |
7488-55-3 | Tin sulphate ; Stannous sulfate | Tin(2+) sulfate | ||
7488-56-4 | Selenium sulfide | Selenium(IV) disulfide | ||
7488-99-5 | Carotene | 1,3,3-trimethyl-2-[3,7,12,16-tetramethyl-18-(2,6,6-trimethylcyclohex-2-en-1-yl)octadeca-1,3,5,7,9,11,13,15,17-nonaenyl]cyclohexene | 3203 | |
74-89-5 | Methylamine | Methanamine | 2921.11 | |
7491-02-3 | Diisopropyl Sebacate | Dipropan-2-yl decanedioate | 2917.13 | |
7491-74-9 | Piracetam | 2-(2-oxopyrrolidin-1-yl)acetamide | 2933.79 | 6 |
74918-21-1 | 1,3-Bis(2,4-diaminophenoxy)propane tetrahydrochloride | 3210 | ||
7492-66-2 | Citral Diethyl Acetal | (2E)-1,1-diethoxy-3,7-dimethylocta-2,6-diene | 2911 | |
7492-70-8 | Butyl butyrolactate | (1-butoxy-1-oxopropan-2-yl) butanoate | 2918.11 | |
7493-95-0 | p-nitrophenyl α-D-galactopyranoside | (2R,3R,4S,5R,6R)-2-(hydroxymethyl)-6-(4-nitrophenoxy)oxane-3,4,5-triol | 2940 | |
74-94-2 | Dimethylamine borane | Dimethylamine borane | 2929.9 | |
74-96-4 | Bromoethane | Bromoethane | 2903.39 | 3 |
74-98-6 | Propane liquefied | Propane liquefied | 3 | |
749886-87-1 | 4-Methyl-N1-(3-phenylpropyl)-1,2-benzenediamine | 4-Methyl-N1-(3-phenylpropyl)-1,2-benzenediamine | 2921.51 | |
75006-64-3 | Dimethylglyoxime disodium salt octahydrate | Disodium 2-N,3-N-dioxidobutane-2,3-diimine octahydrate | 2928 | |
75-01-4 | Vinyl chloride ; Chloroethene | Chloroethene | 2903.21 | |
75-03-6 | Iodoethane | Iodoethane | 2903.39 | |
75-04-7 | Ethylamine | Ethanamine | 2926.9 | 3 |
75-05-8 | Acetonitrile | Acetonitrile | 3 | |
75-07-0 | Acetaldehyde | Acetaldehyde | 2912.12 | 3 |
7507-86-0 | 2-Bromo-5-methoxybenzaldehyde | 2-Bromo-5-methoxybenzaldehyde | 2913 | |
75-08-1 | Ethanethiol | Ethanethiol | 2930.9 | |
75-09-2 | Methylene Chloride | Dichloromethane | ||
75-10-5 | Difluoromethane | Difluoromethane | 8 | |
75-11-6 | Diiodomethane | Diiodomethane | 2710.19 | |
7512-17-6 | N-Acetylglucosamine | N-[(2R,3R,4S,5R)-3,4,5,6-tetrahydroxy-1-oxohexan-2-yl]acetamide | 2933.99 | |
75-12-7 | Formamide | Formamide | 2924.19 | 8 |
75-15-0 | Carbon disulfide | Methanedithione | ||
75-18-3 | Methyl sulfide ; Fragrance of dimethyl sulfide | Methylsulfanylmethane | ||
75-20-7 | Calcium carbide | Calcium carbide | 2827.2 | 3 |
75216-45-4 | Solvent yellow 114 | 3204.19 | ||
75-21-8 | Ethylene Oxide | Oxirane | 2910.9 | |
7521-80-4 | Butyltrichlorosilane | Butyl(trichloro)silane | 2931.9 | |
75-23-0 | Ethylamine-borontrifluoride | Ethanamine trifluoroborane | 2942 | |
75-24-1 | Trimethylaluminum | Trimethylalumane | 2931.9 | |
75277-39-3 | Sodium 2-(4-(2-hydroxyethyl)piperazin-1-yl)ethanesulfonate | Sodium 2-[4-(2-hydroxyethyl)piperazin-1-yl]ethanesulfonate | ||
75-28-5 | Isobutane | 2-methylpropane | ||
7529-22-8 | Methyl Morpholine Oxide | 4-methyl-4-oxidomorpholin-4-ium | 2934.99 | |
75-29-6 | Isopropyl Chloride | 2-chloropropane | 2903.19 | |
75-30-9 | Isopropyl Iodide | 2-iodopropane | 2903.39 | |
75-31-0 | Isopropylamine | Propan-2-amine | 2921.19 | 3 |
75330-75-5 | Lovastatin | [(1S,3R,7S,8S,8aR)-8-[2-[(2R,4R)-4-hydroxy-6-oxooxan-2-yl]ethyl]-3,7-dimethyl-1,2,3,7,8,8a-hexahydronaphthalen-1-yl] (2S)-2-methylbutanoate | 2932.2 | 6 |
7534-94-3 | Isobornyl Methacrylate | [(1R,4R)-4,7,7-trimethyl-3-bicyclo[2.2.1]heptanyl] 2-methylprop-2-enoate | 2916.14 | |
75-36-5 | Acetyl Chloride | Acetyl Chloride | 2915.9 | |
753-73-1 | Dimethyltin dichloride | Dichloro(dimethyl)stannane | ||
75-37-6 | 1,1-Difluoroethane | 1,1-difluoroethane | 2903.39 | |
75389-89-8 | Diethyltoluenediamine | 2,4-diethyl-6-methylbenzene-1,3-diamine;4,6-diethyl-2-methylbenzene-1,3-diamine | 2921.51 | |
754-12-1 | 2,3,3,3-Tetrafluoropropene | 2,3,3,3-tetrafluoroprop-1-ene | 2903.99 | 8 |
75422-59-2 | 4,4'-Bis(1-phenylethyl)diphenylamine | 4-(1-phenylethyl)-N-[4-(1-phenylethyl)phenyl]aniline | 2921.44 | |
7542-45-2 | 3,3’-dihydroxy-beta-beta-carotene-4,4’-dione | 3204.19 | ||
75431-54-8 | Adenosine 3',5'-diphosphate sodium salt | Disodium [(2R,3S,4R,5R)-5-(6-aminopurin-9-yl)-4-hydroxy-2-[[hydroxy(oxido)phosphoryl]oxymethyl]oxolan-3-yl] hydrogen phosphate | 2934.99 | |
75-44-5 | Phosgene | Carbonyl dichloride | 2812.11 | |
75-45-6 | Chlorodifluoromethane ; HCFC-22 | Chloro(difluoro)methane | 2903.11 | |
75-46-7 | Fluoroform | Fluoroform | 2903.79 | 8 |
75-47-8 | Iodoform | Iodoform | ||
7549-37-3 | Geranial Dimethyl Acetal | (2E)-1,1-dimethoxy-3,7-dimethylocta-2,6-diene | 2911 | |
75497-74-4 | Disperse blue 79:1 | 3204.11 | ||
75-50-3 | Trimethylamine | N,N-dimethylmethanamine | 2921.19 | |
7550-35-8 | Lithium bromide | Lithium;bromide | ||
7550-45-0 | Titanium(IV) chloride solution | Titanium(4+);tetrachloride | 2827.39 | |
75-52-5 | Nitromethane | Nitromethane | 2904.9 | 3 |
75535-27-2 | C30-38 Olefin ; Isopropyl maleate ; MA copolymer | 3404.9 | ||
7553-56-2 | Iodine | Molecular iodine | 2801.2 | |
75-54-7 | Dichloro(methyl)silane | Methyldichlorosilane | 2931.9 | |
75-56-9 | Propylene Oxide | 2-Methyloxirane | 2910.2 | |
75-57-0 | Tetramethylammonium Chloride | Tetramethylazanium chloride | 2923.9 | |
7557-93-9 | Dicalcium phosphate | Calcium 2-aminopentanedioate | 2835.26 | |
7558-79-4 | Disodium hydrogen phosphate | Disodium;hydrogen phosphate | 2835.22 | |
7558-80-7 | Monosodium phosphate | Sodium;dihydrogen phosphate | 2835.22 | |
75-59-2 | Tetramethylammonium Hydroxide | Tetramethylazanium hydroxide | ||
7560-83-0 | N,N-Dicyclohexylmethylamine | N-cyclohexyl-N-methylcyclohexanamine | 2921.3 | |
756-13-8 | Perfluoro-2-methyl-3-pentanone | 1,1,1,2,2,4,5,5,5-nonafluoro-4-(trifluoromethyl)pentan-3-one | ||
75621-03-3 | (3-[(3-Cholamidopropyl)dimethylammonio]propanesulfonate | (3-[(3-Cholamidopropyl)dimethylammonio]propanesulfonate | ||
75-65-0 | Tert-butyl alcohol | 2-methylpropan-2-ol | 2905.14 | 3 |
75-66-1 | 2-Methyl-2-propanethiol | 2-methylpropane-2-thiol | 2930.9 | 8 |
75706-12-6 | Leflunomide | 5-methyl-N-[4-(trifluoromethyl)phenyl]-1,2-oxazole-4-carboxamide | 2934.99 | 6 |
75-73-0 | Fluorocarbon ; Tetrafluoromethane | Tetrafluoromethane | 2903.39 | 8 |
75-75-2 | Methanesulphonic acid | Methanesulfonic Acid | 2904.1 | |
7575-23-7 | Pentaerythrityl tetrakis(3-mercaptopropionate) | [3-(3-sulfanylpropanoyloxy)-2,2-bis(3-sulfanylpropanoyloxymethyl)propyl] 3-sulfanylpropanoate | ||
75-76-3 | Tetramethylsilane | Tetramethylsilane | 2931.9 | |
7576-65-0 | Disperse yellow 54 ; Solvent yellow 114 | 2-(3-hydroxyquinolin-2-yl)-1H-indene-1,3(2H)-dione | 3204.9 | |
75768-65-9 | 4,4'-(Hexafluoroisopropylidene)diphenol benzyltriphenylphosphonium salt | 3812.1 | ||
75-77-4 | Trimethylchlorosilane | Chloro(trimethyl)silane | 2931.9 | 8 |
75-78-5 | Dimethyldichlorosilane | Dichloro(dimethyl)silane | 2931.9 | 3 |
75-79-6 | Methyltrichlorosilane | Trichloro(methyl)silane | 2931.9 | 3 |
7580-85-0 | 2-tert-Butoxyethanol | 2-[(2-methylpropan-2-yl)oxy]ethanol | 2905.39 | |
758-12-3 | Fragrance of acetic acid-d | 3302.1 | ||
75-83-2 | 2,2-Dimethylbutane | 2,2-dimethylbutane | 2901.1 | |
7585-20-8 | Zirconium Acetate | Zirconium (4+) tetraacetate | ||
7585-39-9 | Beta-cyclodextrin | |||
75-85-4 | Amylene Hydrate | 2-methylbutan-2-ol | 2905.19 | 3 |
7585-41-3 | Pigment red 48:1 | 2-Naphthalenecarboxylic acid, 4-[(5-chloro-4-methyl-2-sulfophenyl) azo]-3-hydroxy-, barium salt (1:1) | 3204.17 | |
75-87-6 | Chloral | 2,2,2-trichloroacetaldehyde | 2905.59 | |
75-89-8 | 2,2,2-Trifluoroethanol | 2,2,2-trifluoroethanol | 2905.59 | |
75-91-2 | Tert-butyl hydroperoxide | 2-hydroperoxy-2-methylpropane | 2909.6 | |
75-96-7 | Tribromoacetic acid | 2,2,2-tribromoacetic acid | 2915.9 | |
75980-60-8 | 2,4,6-Trimethylbenzoyl diphenylphosphine oxide | Diphenylphosphoryl-(2,4,6-trimethylphenyl)methanone | 2930.9 | |
75-98-9 | Pivalic Acid | 2,2-dimethylpropanoic acid | 2915.9 | |
76015-11-7 | 3-Methoxy-2-methyl-1H-pyridin-4-one | 3-methoxy-2-methyl-1H-pyridin-4-one | 2933.39 | |
7601-54-9 | Trisodium phosphate | Trisodium;phosphate | 2835.291 | |
7601-89-0 | Sodium perchlorate | Sodium;perchlorate | 2829.9 | |
7601-90-3 | Perchloric acid | Perchloric acid | 3 | |
76-03-9 | Trichloroacetic Acid | 2,2,2-trichloroacetic acid | 2915.4 | 3 |
76050-42-5 | Carbomer 940 | 3809.1 | ||
76-05-1 | Trifluoroacetic acid | 2,2,2-trifluoroacetic acid | 3 | |
76095-16-4 | Enalapril maleate | (Z)-but-2-enedioic acid (2S)-1-[(2S)-2-[[(2S)-1-ethoxy-1-oxo-4-phenylbutan-2-yl]amino]propanoyl]pyrrolidine-2-carboxylic acid | 2933.99 | 6 |
76-16-4 | Hexafluoroethane | 1,1,1,2,2,2-hexafluoroethane | 8 | |
76168-74-6 | Pigment orange 61 | 3204.17 | ||
7617-78-9 | Isodecyloxypropylamine | 3402.12 | ||
76-19-7 | Perfluoropropane | 1,1,1,2,2,3,3,3-octafluoropropane | 2903.39 | 8 |
76204-02-9 | 2'-(4-Methylumbelliferyl)-alpha-D-N-acetylneuraminic acid sodium salt | Sodium (2R,4S,5R,6R)-5-acetamido-4-hydroxy-2-(4-methyl-2-oxochromen-7-yl)oxy-6-[(1R,2R)-1,2,3-trihydroxypropyl]oxane-2-carboxylate | 2941.4 | |
762-04-9 | Diethyl Phosphite | Diethoxy(oxo)phosphanium | 2920.9 | |
7620-77-1 | 12-Hydroxy lithium stearate | Lithium;12-hydroxyoctadecanoate | 3403.99 | |
76-22-2 | Camphor | 4,7,7-trimethylbicyclo[2.2.1]heptan-3-one | 2914.29 | |
76-25-5 | Triamcinolone Acetonide | 9-alpha-fluoro-11-beta,21-dihydroxy-16-alpha,17-alpha-isopropylidenedioxypregna-1,4-diene-3,20-dione | 2937.22 | |
762-72-1 | Allyltrimethylsilane | Trimethyl(prop-2-enyl)silane | 2932.99 | |
7631-86-9 | Silicon dioxide | Dioxosilane | ||
7631-90-5 | Sodium bisulfite | Sodium;hydrogen sulfite | ||
7631-95-0 | Sodium molybdate | Disodium;dioxido(dioxo)molybdenum | ||
7631-97-2 | Sodium monofluorophodphate | Disodium;fluoro-dioxido-oxo-$l^{5}-phosphane | 2826.9 | |
7631-98-3 | Sodium N-lauroylsarcosinate | Sodium [dodecyl(methyl)amino]acetate | 3402.9 | |
7631-99-4 | Sodium nitrate | Sodium nitrate | 4 | |
7632-00-0 | Sodium nitrite | Sodium;nitrite | ||
7632-04-4 | Sodium perborate | Sodium peroxometaborate | ||
76330-20-6 | 3-O-Sulfate glucosamine | [(2R,3R,4R,5R)-2-amino-4,5,6-trihydroxy-1-oxohexan-3-yl] hydrogen sulfate | 2932.99 | |
76333-53-4 | Cathinone hydrochloride | (2R)-2-amino-1-phenylpropan-1-one hydrochloride | 2942 | 9 |
763-69-9 | Ethyl 3-ethoxypropionate | Ethyl 3-ethoxypropanoate | ||
7637-03-8 | Ammonium cerium(IV) sulfate | Diazanium cerium(4+) trisulfate | 2846.1 | |
7637-07-2 | Boron trifluoride | Boron trifluoride | 2826.19 | |
76-42-6 | Oxycodone | 14-hydroxydihydro codeinone | 2939.11 | 7 |
76-43-7 | Fluoxymesterone | (8S,9R,10S,11S,13S,14S,17S)-9-fluoro-11,17-dihydroxy-10,13,17-trimethyl-1,2,6,7,8,11,12,14,15,16-decahydrocyclopenta[a]phenanthren-3-one | 2939.99 | 6 |
7643-75-6 | L-arabitol | (2S,4S)-pentane-1,2,3,4,5-pentol | 2905.49 | |
764-48-7 | Vinyloxyethanol | 2-Ethenoxyethanol | 2909.49 | |
7646-69-7 | Sodium hydride powder (moistened with oil) | Sodium;hydride | 3 | |
7646-78-8 | Stannic chloride , anhydrous | Tetrachlorostannane | 2827.39 | 3 |
7646-79-9 | Cobalt chloride | Dichlorocobalt | 2827.391 | |
7646-85-7 | Zinc chloride | Dichlorozinc | 3 | |
7646-93-7 | Potassium acid sulfate | Potassium;hydrogen sulfate | 2833.29 | |
7647-01-0 | Hydrochloric acid | Chlorane | 2806.1 | |
7647-10-1 | Palladium chloride | Dichloropalladium | 2843.9 | |
7647-14-5 | Sodium chloride | Sodium chloride | 2501 | |
7647-15-6 | Sodium bromide | Sodium;bromide | 2827.51 | |
764-71-6 | Potassium octoate | Potassium;octoate | ||
7647-17-8 | Cesium chloride | Cesium;chloride | 2827.39 | |
7651-02-7 | Stearamidopropyl dimethylamine | N-[3-(dimethylamino)propyl]octadecanamide | ||
76-54-0 | 2′,7′-Dichlorofluorescein | 2',7'-dichloro-3',6'-dihydroxyspiro[isobenzofuran-1(3H),9'-xanthen]-3-one | 3204.9 | |
765-70-8 | 3-Methylcyclopentane-1,2-dione | 3-Methylcyclopentane-1,2-dione | 2914.29 | |
76-57-3 | Codeine | (5α,6α)-7,8-Didehydro-4,5-epoxy-3-methoxy-17-methylmorphinan-6-ol | 7 | |
76-59-5 | Bromthymol Blue | 2-bromo-4-[3-(3-bromo-4-hydroxy-2-methyl-5-propan-2-ylphenyl)-1,1-dioxo-2,1$l^{6}-benzoxathiol-3-yl]-3-methyl-6-propan-2-ylphenol | 2934.99 | |
7659-86-1 | 2-Ethylhexyl mercaptoacetate | 2-ethylhexyl 2-sulfanylacetate | 2930.9 | |
7659-95-2 | Betanin | 4-(2-(2-carboxy-5-(beta-D-glucopyranosyloxy)-2,3-dihydro-6-hydroxy-1H-indol-1-yl)ethenyl)-2,3-dihydro-(S-(R*,R*))-2,6-pyridinedicarboxylic acid | 3203 | |
76-60-8 | Bromocresol Green | 2,6-Dibromo-4-[7-(3,5-dibromo-4-hydroxy-2-methyl-phenyl)- 9,9-dioxo-8-oxa-9λ6- thiabicyclo[4.3.0]nona- 1,3,5-trien-7-yl]-3-methyl-phenol | 2934.99 | |
766-09-6 | N-Ethylpiperidine | 1-Ethylpiperidine | 2933.99 | |
76-61-9 | Thymolsulfonephthalein | 4-[3-(4-hydroxy-2-methyl-5-propan-2-ylphenyl)-1,1-dioxo-2,1$l^{6}-benzoxathiol-3-yl]-5-methyl-2-propan-2-ylphenol | 2934.99 | |
76-62-0 | Tetrabromophenolphthalein | 3,3-bis(3,5-dibromo-4-hydroxyphenyl)-2-benzofuran-1-one | 2918.99 | |
7664-38-2 | Phosphoric acid | Phosphoric acid | 2809.2031 | |
7664-39-3 | Hydrofluoric acid | Fluorane | 2811.11 | |
7664-41-7 | Ammonia | Azane | 2814.1 | |
7664-93-9 | Sulfuric acid | Sulfuric acid | 2807 | |
766-77-8 | Dimethylphenylsilane | Dimethyl(phenyl)silicon | 2931.9 | |
766-92-7 | Benzyl Methyl Sulfide | Methylsulfanylmethylbenzene | 2930.9 | |
766-96-1 | 4-Bromophenylacetylene | 1-bromo-4-ethynylbenzene | 2903.99 | |
766-97-2 | 4-Ethynyltoluene | 1-Ethynyl-4-methylbenzene | 2902.9 | |
76703-62-3 | Gamma-cyhalothrin | (S)-cyano(3-phenoxyphenyl)methyl (1R,3R)-3-[(1Z)-2-chloro-3,3,3-trifluoroprop-1-en-1-yl]-2,2-dimethylcyclopropanecarboxylate | 2926.9 | |
76738-62-0 | Paclobutrazol | (2S,3S)-1-(4-chlorophenyl)-4,4-dimethyl-2-(1H-1,2,4-triazol-1-yl)pentan-3-ol | 2933.99 | 8 |
76-74-4 | Pentobarbital | 5-ethyl-5-(1-methylbutyl)barbituric acid | 3004.9 | 9 |
76774-68-0 | Basyntan AN | 3202.1 | ||
7681-11-0 | Potassium iodide | 2827.6 | ||
7681-38-1 | Sodium bisulfate | Sodium;hydrogen sulfate | 2832.2 | |
7681-49-4 | Sodium fluoride | Sodium;fluoride | 2826.19 | |
7681-52-9 | Sodium hypochlorite | Sodium;hypochlorite | 2828.901 | |
7681-53-0 | Sodium hypophosphite | Sodium phosphinate | ||
7681-55-2 | Sodium iodate | Sodium;iodate | 2829.9 | |
7681-57-4 | Sodium disulfite | Disodium disulphite | ||
7681-65-4 | Copper iodide | Copper(1+) iodide | ||
7681-82-5 | Sodium iodide | Sodium iodide | 2827.6 | |
7681-93-8 | Natamycin | (1R,3S,5R,7R,8E,12R,14E,16E,18E,20E,22R,24S,25R,26S)-22-{[(2R,3S,4S,5S,6R)-4-amino-3,5-dihydroxy-6-methyloxan-2-yl]oxy}-1,3,26-trihydroxy-12-methyl-10-oxo-6,11,28-trioxatricyclo[22.3.1.0⁵,⁷]octacosa-8,14,16,18,20-pentaene-25-carboxylic acid | 3824.9 | 6 |
76824-35-6 | Famotidine | 3-[[2-(diaminomethylideneamino)-1,3-thiazol-4-yl]methylsulfanyl]-N'-sulfamoylpropanimidamide | 2935 | 6 |
76-84-6 | Triphenylcarbinol | Triphenylmethanol | 2906.29 | |
769-42-6 | 1,3-Dimethylbarbituric acid | 1,3-dimethyl-1,3-diazinane-2,4,6-trione | 2933.54 | |
76947-02-9 | Tetrabutylammonium hydrogendiphosphate | [Hydroxy(oxido)phosphoryl] phosphate;tetrabutylazanium | 2923.9 | |
7695-91-2 | dl-alpha-Tocopheryl acetate | 2,5,7,8-tetramethyl-2-(4,8,12-trimethyltridecyl)-3,4- dihydro-2H-chromen-6-yl acetate | 2936.28 | |
7696-12-0 | Tetramethrin | (1,3-dioxo-4,5,6,7-tetrahydroisoindol-2-yl)methyl 2,2-dimethyl-3-(2-methylprop-1-enyl)cyclopropane-1-carboxylate | 2916.2 | 8 |
7697-37-2 | Nitric acid | Nitric acid | 2808 | |
76-99-3 | Methadone | (RS)-6-(Dimethylamino)-4,4-diphenylheptan-3-one | 2922.31 | 7 |
7699-45-8 | Zinc bromide | Zinc;dibromide | 2827.59 | |
77026-92-7 | 3-(Carboxymethyl)-2-(2-pentenyl)cyclopentanone | 2-[3-oxo-2-[(E)-pent-2-enyl]cyclopentyl]acetic acid | 2918.3 | |
770-35-4 | Phenoxyisopropanol | 1-phenoxypropan-2-ol | 2915.39 | |
7704-34-9 | Sulfur, precipitated, sublimed or colloidal | 8 | ||
7704-67-8 | Erythromycin Thiocyanate | (3R,4S,5S,6R,7R,9R,11R,12R,13S,14R)-6-[(2S,3R,4S,6R)-4-(dimethylamino)-3-hydroxy-6-methyloxan-2-yl]oxy-14-ethyl-7,12,13-trihydroxy-4-[(2R,4R,5S,6S)-5-hydroxy-4-methoxy-4,6-dimethyloxan-2-yl]oxy-3,5,7,9,11,13-hexamethyl-oxacyclotetradecane-2,10-dione;thioc | 2941.5 | 6 |
7704-98-5 | Titanium dioxide | Hydride; titanium(+2) cation | 2823 | |
7705-07-9 | Titanium(III) chloride | Trichlorotitanium | 2827.39 | |
7705-08-0 | Iron(III) chloride ; Ferric chloride | Trichloroiron | 2827.392 | |
77-06-5 | Gibberellic acid | (3S,3aS,4S,4aS,6S,8aR,8bR,11S)-6,11-Dihydroxy-3-methyl-12-methylene-2-o xo-4a,6-ethano-3,8b-prop-1-enoperhydroindeno[1,2-b]furan-4-carboxylic acid | ||
77-09-8 | Phenolphthalein | 3,3-bis(4-hydroxyphenyl)-2-benzofuran-1-one | 2932.2 | |
77-10-1 | Phencyclidine (PCP) | 2933.33 | 9 | |
771-50-6 | Indole-3-carboxylic acid | 1H-indole-3-carboxylic acid | 2933.99 | |
771-61-9 | Pentafluorophenol | 2,3,4,5,6-pentafluorophenol | 2908.19 | |
77182-82-2 | Glufosinate-ammonium | Ammonium (3-amino-3-carboxypropyl)methylphosphinate | 2931.39 | 8 |
7718-54-9 | Nickel chloride | Dichloronickel | ||
7718-98-1 | Vanadium(III) chloride | Trichlorovanadium | 2827.39 | |
771-97-1 | 2,3-Naphthalenediamine | Naphthalene-2,3-diamine | 2921.59 | |
7720-78-7 | Ferrous sulfate | Iron(2+); sulfate | 2833.29 | |
77214-82-5 | Ferric p-toluenesulfonate | Iron(3+) 4-methylbenzenesulfonate | ||
7722-64-7 | Potassium permanganate | Potassium;permanganate | 2841.61 | 3 |
7722-76-1 | Ammonium dihydrogenorthophosphate, with an iron content not exceeding 0,03% by weight on the dry anhydrous product | Azanium dihydrogen phosphate | 3105.4 | 4 |
7722-84-1 | Hydrogen peroxide | Hydrogen peroxide | 2847.001 | |
7722-88-5 | Tetrasodium pyrophosphate | Tetrasodium;phosphonato phosphate | 2835.391 | |
7723-14-0 | Phosphorus | Phosphorus | 2804.7 | |
7726-95-6 | Bromine water ; Bromine | Molecular bromine | 2827.51 | |
7727-21-1 | Potassium peroxydisulfate | Dipotassium;sulfonatooxy sulfate | ||
7727-37-9 | Nitrogen | Molecular nitrogen | ||
7727-43-7 | Barium sulfate ; C.I. Pigment White 21 | Barium sulfate | ||
7727-54-0 | Ammonium peroxydisulfate | Diazanium;sulfonatooxy sulfate | 2833.4 | |
7727-73-3 | Sodium sulfate decahydrate | Disodium;sulfate;decahydrate | 2833.11 | |
77287-58-2 | 2-Iodo-5-methoxybenzaldehyde | 2-Iodo-5-methoxybenzaldehyde | 2913 | |
7732-18-5 | Water, distilled, conductivity or of similar purity | 2853.9 | ||
7733-02-0 | Zinc sulfate | Zinc;sulfate | 2833.29 | |
77341-67-4 | Monomenthyl succinate | 4-[(1R,2S,5R)-5-methyl-2-propan-2-ylcyclohexyl]oxy-4-oxobutanoic acid | 2917.19 | |
773-76-2 | Chloroxine | 5,7-dichloroquinolin-8-ol | 2906.29 | |
77377-52-7 | N-[tert-butyl(dimethyl)silyl]-2,2,2-trifluoro-N-methylacetamide | N-[tert-butyl(dimethyl)silyl]-2,2,2-trifluoro-N-methylacetamide | 2931.9 | |
7738-94-5 | Chromic acid | Dihydroxy(dioxo)chromium | 8 | |
7745-93-9 | 2-Bromo-4-nitrotoluene | 2-Bromo-1-methyl-4-nitrobenzene | 2904.9 | |
7746-20-0 | Zince sulfate | Zinc sulphate | 2833.292 | |
77465-46-4 | Pigment yellow 155 | 1,4-Benzenedicarboxylic acid, 2,2'-(1,4-phenylenebis(imino(1-acetyl-2-oxo-2,1-ethanediyl)-2,1-diazenediyl))bis-, 1,1',4,4'-tetramethyl ester | 3206.49 | |
77466-09-2 | Miglyol 840 | Decanoic acid octanoic acid propane-1,2-diol | 3824.9 | |
77-52-1 | Ursolic acid | (10R)-10-hydroxy-1,2,6a,6b,9,9,12a-heptamethyl-2,3,4,5,6,6a,7,8,8a,10,11,12,13,14b-tetradecahydro-1H-picene-4a-carboxylic acid | 2918.19 | |
77-53-2 | Cedrol | 2906.19 | ||
77538-14-8 | Disperse violet 77 | 3204.11 | ||
77538-19-3 | Glyceryl Behenate | 2,3-dihydroxypropyl docosanoate | 2915.9 | |
77-54-3 | Cedryl Acetate | (3R,3aS,6R,7R,8aS)-3,6,8,8-tetramethyloctahydro-1H-3a,7-methanoazulen-6-yl acetate | 2915.39 | |
7756-96-9 | Fragrance of butyl anthranilate | Butyl anthranilate | 3301.29 | |
7757-69-9 | Magnesium carbonate | Magnesium;carbonate | 2836.99 | |
7757-79-1 | Potassium nitrate | potassium nitrate | 2834.21 | |
7757-82-6 | Sodium sulfate anhydrous | Disodium sulfate | 2833.11 | |
7757-83-7 | Sodium sulfite | Disodium sulfite | 2832.1 | |
7757-93-9 | Dicalcium phosphate | Calcium;hydrogen phosphate | 2835.251 | |
7757-96-2 | 1-Octenylsuccinic anhydride | 3-[(E)-oct-1-enyl]oxolane-2,5-dione | 2922.29 | |
7758-01-2 | Potassium bromate ACS reagent | Potassium;bromate | 2829.9 | 3 |
7758-02-3 | Potassium bromide | 2827.51 | 9 | |
7758-05-6 | Potassium iodate | Potassium;iodate | 2829.9 | |
7758-09-0 | Potassium nitrate | Potassium;nitrite | 2834.1 | 3 |
7758-11-4 | Di-potassium hydrogen phosphate | Dipotassium; hydrogen phosphate | 2835.22 | |
7758-16-9 | Sodium acid pyrophosphate | Disodium [hydroxy(oxido)phosphoryl] hydrogen phosphate | 2835.39 | |
7758-19-2 | Sodium chlorite | Sodium;chlorite | 2828.9 | |
7758-23-8 | Monocalcium phosphate | Calcium; dihydrogen phosphate; hydrate | 2835.26 | |
7758-29-4 | Pentasodium triphosphate | Pentasodium [oxido(phosphonatooxy)phosphoryl] phosphate | 2835.31 | |
77-58-7 | Dibutyltin dilaurate | Dibutylbis((1-oxododecyl)-oxy) stannane | ||
7758-87-4 | Tribasic calcium phosphate | Tricalcium diphosphate | 2835.26 | |
7758-89-6 | Cuprous chloride | Chlorocopper | 2827.39 | |
7758-94-3 | Iron(II) chloride | Iron(2+); dichloride | 2827.39 | |
7758-95-4 | Lead(II) chloride | Dichlorolead | 2827.39 | |
7758-98-7 | Copper(II) sulfate | Copper sulfate | 8 | |
7758-99-8 | Copper(II) sulfate pentahydrate | Copper; sulfate; pentahydrate | 2833.25 | 8 |
7761-88-8 | Silver nitrate | Silver nitrate | 3 | |
77-71-4 | 5,5-Dimethylhydantoin | 5,5-dimethylimidazolidine-2,4-dione | 2933.21 | |
7772-98-7 | Sodium thiosulfate | Disodium; dioxido-oxo-sulfanylidene-λ6-sulfane | 2830.1 | |
7772-99-8 | Tin(II) chloride | Dichlorotin | 2827.39 | |
7773-01-5 | Manganese(II) chloride | Manganese(2+) dichloride | ||
7773-06-0 | Ammonium sulfamate | Azanium;sulfamate | 2842.9 | 3 |
77-73-6 | Dicyclopentadiene | 2902.19 | ||
7774-29-0 | Mercury (II) iodide | Diiodomercury | 2852.1 | |
7774-34-7 | Calcium chloride hexahydrate | Calcium; dichloride; hexahydrate | 2827.2 | |
7774-82-5 | 2-Tridecenal | (E)-tridec-2-enal | 2912.19 | |
7775-09-9 | Sodium chlorate | Sodium;chlorate | 2827.59 | |
7775-11-3 | Sodium chromate | Disodium dioxido(dioxo)chromium | 2841.5 | 8 |
7775-14-6 | Sodium hydrosulfide | Disodium dithionite | 2831.1 | 3 |
7775-27-1 | Sodium persulfate | Disodium;sulfonatooxy sulfate | 2833.4 | |
7775-39-5 | 1-Phenylethyl isobutyrate | 1-phenylethyl 2-methylpropanoate | 2915.6 | |
7776-28-5 | Calcium Phytate | Hexacalcium (2,3,4,5,6-pentaphosphonatooxycyclohexyl) phosphate | 2919.9 | |
77-76-9 | 2,2-Dimethoxypropane | 2,2-dimethoxypropane | 2911 | |
77-77-0 | Vinyl Sulfone | 1-Ethenylsulfonylethene | 2930.9 | |
77-78-1 | Dimethyl Sulfate | Dimethyl Sulfate | 2920.9 | |
7778-18-9 | Calcium sulfate | Calcium;sulfate | ||
7778-50-9 | Potassium dichromate | Dipotassium;oxido-(oxido(dioxo)chromio)oxy-dioxochromium | 2841.5 | 3 |
7778-53-2 | Potassium phosphate | Tripotassium;phosphate | 2835.24 | |
7778-54-3 | Calcium hypochlorite | Calcium;dihypochlorite | 2828.1 | |
7778-74-7 | Potassium Perchlorate | Potassium Perchlorate | 2929.9 | |
7778-77-0 | Potassium phosphate monobasic | Potassium dihydrogen phosphate | 2835.24 | |
7778-80-5 | Potassium sulphate | Dipotassium sulfate | 3104.3 | 4 |
7779-50-2 | Oxacycloheptadec-7-en-2-one | 1-oxacycloheptadec-7-en-2-one | 2932.2 | |
7779-88-6 | Zinc nitrate | Zinc;dinitrate | 2834.29 | |
7779-90-0 | Zinc phosphate ; Pigment white 32 | Trizinc bis(orthophosphate) | ||
77804-81-0 | Pigment yellow 180 | 2,2'-{ethane-1,2-diylbis[oxybenzene-2,1-diylazo-2,1-diyl]}bis[3-oxo-N-(2-oxo-2,3-dihydro-1H-benzimidazol-5-yl)butanamide] | 3204.17 | |
7781-49-9 | Iodonitrotetrazolium Formazan | N-(4-iodophenyl)imino-N'-(4-nitroanilino)benzenecarboximidamide | 2928 | |
7782-41-4 | Mixture of Fluorine | Molecular fluorine | 2804.3 | 8 |
7782-42-5 | Graphite ; C.I. Pigment Black 10 | Graphite | ||
7782-44-7 | Oxygen | Molecular oxygen | 2804.4 | 3 |
7782-49-2 | Selenium | Selenium | 2804.9 | 3 |
7782-50-5 | Chlorine | Chlorine | 2801.1 | |
7782-54-4 | Dimagnesium phosphate | 2835.29 | ||
7782-61-8 | Ferric nitrate | Iron(3+);trinitrate;nonahydrate | 2834.1 | |
7782-63-0 | Ferrous sulfate | Iron(2+);sulfate;heptahydrate | 2833.29 | |
7782-75-4 | Magnesium hydrogen phosphate trihydrate, | Magnesium;hydrogen phosphate;trihydrate | 2816.1 | |
7782-82-3 | Sodium biselenite | Sodium hydrogen selenite | 3821 | |
7782-85-6 | Disodium hydrogen orthophosphate | Disodium;hydrogen phosphate;heptahydrate | 2835.22 | |
7782-91-4 | Molybdic acid | Dihydroxy(dioxo)molybdenum | 2825.7 | |
7782-92-5 | Sodium amide | Sodium;azanide | 2853 | |
7782-99-2 | Sulfurous acid | Sulfurous acid | 2811.19 | |
7783-00-8 | Selenous acid | Selenous acid | 2811.19 | 8 |
7783-06-4 | Hydrogen Sulfide (H2S) | Sulfane | 2804.29 | |
7783-11-1 | Ammonium sulfite monohydrate | Diazanium;sulfite;hydrate | 2832.2 | |
7783-13-3 | Sodium ammonium hydrogen tetrahydrate phosphate | Azanium;sodium;hydrogen phosphate;tetrahydrate | 2835.29 | |
7783-18-8 | Ammonium thiosulfate | Azane; sulfurothioic O-acid | 2832.3 | |
7783-20-2 | Ammonium sulphate | Diazanium sulfate | 3102.21 | 4 |
7783-28-0 | Diammonium phosphate | Diazanium hydrogen phosphate | 3105.3 | 4 |
7783-33-7 | Potassium tetraiodomercurate(II) | Dipotassium tetraiodomercurate | 2852.1 | |
7783-34-8 | Mercury(II) dinitrate monohydrate | Mercury(2+);dinitrate;hydrate | 2834.29 | |
7783-35-9 | Mercury sulfate | Mercury(2+);sulfate | 2833.29 | |
7783-40-6 | Magnesium fluoride | Magnesium difluoride | 2826.19 | |
7783-49-5 | Zinc fluoride | Zinc;difluoride | 2826.19 | |
7783-54-2 | Nitrogen trifluoride | Nitrogen trifluoride | 2812.9 | |
77-83-8 | Ethyl Methylphenylglycidate | Ethyl 3-methyl-3-phenyloxirane-2-carboxylate | 2918.99 | |
7783-83-7 | Ferric ammonium sulfate | Azanium;iron(3+);disulfate;dodecahydrate | 2833.29 | |
7783-85-9 | Ammonium ferrous sulphate hexahydrate | Azane; hydrogen sulfate; iron(2+); hexahydrate | 2842.9 | |
7783-90-6 | Silver chloride | Chlorosilver | 2843.29 | |
77840-01-8 | Copper Formazane Blue | 2927 | ||
7784-13-6 | Aluminum chloride hexahydrate | Trichloroalumane; hexahydrate | 2827.32 | |
7784-18-1 | Aluminum fluoride | Trifluoroalumane | 2826.12 | |
7784-24-9 | Potassium alum | Aluminum; potassium; disulfate; dodecahydrate | 2833.3 | |
7784-25-0 | Ammonium alum | Aluminum azanium disulfate | 2833.3 | |
7784-26-1 | Ammonium alum | Aluminum azanium disulfate dodecahydrate | 2833.3 | |
7784-27-2 | Aluminium nitrate nonahydrate | aluminium nitrate nonahydrate | 2834.29 | |
7784-30-7 | Aluminium orthophosphate | 3402.11 | ||
7784-46-5 | Sodium arsenite solution | Sodium; oxoarsinite | 2842.9 | 8 |
77-85-0 | Trimethylolethane | 2-(hydroxymethyl)-2-methylpropane-1,3-diol | 2905.49 | |
7785-20-8 | Ammonium nickel(II) sulfate hexahydrate | Sulfuric acid, ammonium nickel(2+) salt (2:2:1), hexahydrate | 3208.9 | |
7785-84-4 | Sodium trimetaphosphate | Trisodium; 2,4,6-trioxido-1,3,5,2$l^{5},4$l^{5},6$l^{5}-trioxatriphosphinane 2,4,6-trioxide | 2835.291 | |
7785-87-7 | Manganese sulfate | Manganese(2+); sulfate | 2833.29 | |
7785-88-8 | Sodium aluminium phosphate | Aluminum sodium phosphate | 2842.9 | |
77-86-1 | Trometamol | 2-amino-2-(hydroxymethyl)propane-1,3-diol | 2922.19 | 6 |
7786-30-3 | Magnesium chloride | Magnesium;dichloride | 2827.1 | |
7786-81-4 | Nickel sulfate | Nickel(2+);sulfate | 2833.24 | |
7787-20-4 | L-Fenchone | (1R,4R)-2,2,4-trimethylbicyclo[2.2.1]heptan-3-one | 2914.29 | |
7787-37-3 | Barium molybdate | 3207.2 | ||
7787-59-9 | Bismuth oxychloride | Oxobismuth;hydrochloride | ||
7787-60-2 | Barium chloride dihydrate | Trichlorobismuthane | 2827.39 | |
77876-39-2 | [(2S,4S)-4-diphenylphosphanylpentan-2-yl]-diphenylphosphane | [(2S,4S)-4-diphenylphosphanylpentan-2-yl]-diphenylphosphane | 2931.9 | |
7787-93-1 | 3-Chloropropylmethyldichlorosilane | Dichloro-(3-chloropropyl)-methylsilane | 2931.9 | |
77883-43-3 | Doxazosin Mesylate | [4-(4-amino-6,7-dimethoxyquinazolin-2-yl)piperazin-1-yl]-(2,3-dihydro-1,4-benzodioxin-3-yl)methanone methanesulfonic acid | 2934.99 | 6 |
7788-97-8 | Chromium(III) trifluoride | Trifluorochromium | 2826.19 | |
7788-99-0 | Basic chromium sulfate | Potassium; chromium(3+); disulfate; dodecahydrate | 2833.3 | |
7789-00-6 | Potassium chromate | Dipotassium dioxido(dioxo)chromium | 2841.5 | 3 |
7789-04-0 | Chromium phosphate | Chromium(3+) phosphate | ||
7789-12-0 | Sodium dichromate dihydrate | Disodium; oxido-(oxido(dioxo) chromio)oxy-dioxochromium; dihydrate | 2841.3 | |
7789-17-5 | Cesium iodide | Cesium iodide | 2827.6 | |
7789-20-0 | Deuterium oxide | (2H2)water | 2845.1 | |
7789-23-3 | Potassium fluoride | Potassium;fluoride | 2826.19 | |
7789-24-4 | Lithium fluoride | Lithium;fluoride | 2826.19 | |
7789-33-5 | Iodine monobromide | Bromoiodine | 2812.9 | |
7789-38-0 | Sodium bromate | Sodium bromate | 2829.9 | |
7789-41-5 | Calcium bromide | Calcium dibromide | 2827.51 | |
7789-45-9 | Copper(II) bromide | Dibromocopper | 2827.59 | |
7789-47-1 | Mercury(II) bromide | Dibromomercury | 2852.1 | 15 |
7789-75-5 | Calcium fluoride | Calcium difluoride | 2826.19 | |
7789-77-7 | Dicalcium phosphate dihydrate | Calcium; hydrogen phosphate; dihydrate | 2835.25 | |
7789-78-8 | Calcium hydride | Calcium hydride | 2850 | 3 |
7790-21-8 | Potassium periodate | Potassium;periodate | 2829.9 | |
779-02-2 | 9-Methylanthracene | 9-Methylanthracene | 2902.9 | |
7790-26-3 | Sodium iodide I 131 | Sodium;iodine-131(1-) | 2844.4 | 5 |
7790-28-5 | Sodium Periodate | Sodium;periodate | ||
7790-47-8 | Tin(IV) iodide | Tetraiodostannane | 2827.6 | |
7790-53-6 | Potassium metaphosphate | 2835.24 | ||
7790-58-1 | Potassium tellurite | Dipotassium tellurite | ||
7790-62-7 | Potassium disulfate | Dipotassium;sulfonato sulfate | 2833.29 | |
7790-69-4 | Lithium nitrate | Lithium;nitrate | 2834.29 | |
77-90-7 | Acetyltributyl citrate | Tributyl 2-acetyloxypropane-1,2,3-tricarboxylate | 2918.15 | |
77907-31-4 | Reactive blue 139 | 3204.16 | ||
77907-32-5 | Reactive blue 171 | 3204.16 | ||
77907-38-1 | Reactive yellow 135 | 3204.16 | ||
7790-76-3 | Calcium pyrophosphate | Dicalcium phosphonato phosphate | 2510.2 | |
7790-98-9 | Ammonium perchlorate | Azanium;perchlorate | 2829.9 | |
7790-99-0 | Iodine monochloride | Iodmonochlorid  | 2812.1 | |
7791-03-9 | Lithium Perchlorate | Lithium Perchlorate | 2933.99 | 2 |
7791-07-3 | Sodium perchlorate monohydrate | Sodium;perchlorate;hydrate | 2829.11 | |
7791-11-9 | Rubidium chloride ReagentPlus® | Rubidium(1+);chloride | 2827.39 | |
7791-13-1 | Cobalt(II) chloride hexahydrate | Dichlorocobalt; hexahydrate | 2827.39 | |
7791-18-6 | Magnesium chloride hexahydrate | Magnesium; dichloride; hexahydrate | 2827.31 | |
7791-20-0 | Nickel(II) chloride hexahydrate | Dichloronickel; hexahydrate | 2827.35 | |
7791-25-5 | Sulfuryl chloride | Sulfuryl chloride | 2827.39 | |
77916-77-9 | Bis(1-butylpentyl) adipate | Dinonan-5-yl hexanedioate | 2917.12 | |
77-91-8 | Choline dihydrogen citrate | Dihydrogen (2-hydroxyethyl)trimethylazanium 2-hydroxypropane-1,2,3-tricarboxylate | 2923.9 | |
77-92-9 | Citric acid | 2-hydroxypropane-1,2,3-tricarboxylic acid | 2918.14 | |
77-93-0 | Triethyl citrate | 1,2,3-Triethyl 2-hydroxypropane-1,2,3-tricarboxylate | 2916.15 | |
77938-63-7 | Dextrose monohydrate | (2R,3S,4R,5R)-2,3,4,5,6-pentahydroxyhexanal hydrate | 2922.42 | |
77-98-5 | Tetraethylammonium Hydroxide | Tetraethylazanium hydroxide | 2923.9 | |
77-99-6 | Trimethylolpropane | 2-Ethyl-2-(hydroxymethyl)propane-1,3-diol | 2905.41 | |
7803-51-2 | Phosphine | Phosphine | 2853.9 | |
7803-55-6 | Ammonium metavanadate | Azanium;oxido(dioxo)vanadium | 2841.9 | |
7803-57-8 | Hydrazine hydrate | Hydrazine;hydrate | 2825.1 | |
7803-62-5 | Silane | Silane | 2850 | 8 |
78059-14-0 | 8,13-Dimethylicosa-8,12-dienedioic acid | 8,13-dimethylicosa-8,12-dienedioic acid | 2933.99 | |
78-07-9 | Ethyltriethoxysilane | Triethoxy(ethyl)silane | 2931.9 | |
78-08-0 | Vinyltriethoxysilane | Ethenyl(triethoxy)silane | 2931.9 | |
78-10-4 | Tetraethyl Silicate | Tetraethyl Silicate | 3 | |
781-43-1 | 9,10-Dimethylanthracene | 9,10-dimethylanthracene | 2902.9 | |
78145-84-3 | Isostearyl Glyceryl Ether | 3-(16-methylheptadecoxy)propane-1,2-diol | 2909.49 | |
78-18-2 | Cyclohexanone peroxide | 1-hydroperoxycyclohexyl 1-hydroxycyclohexyl peroxide | 3815.9 | |
78213-16-8 | Diclofenac diethylamine | 2-[2-(2,6-dichloroanilino)phenyl]acetic acid;N-ethylethanamine | 2922.49 | 6 |
78245-94-0 | Pigment orange 72 | 3204.17 | ||
78246-49-8 | Paroxetine Hydrochloride | (3S,4R)-3-(1,3-benzodioxol-5-yloxymethyl)-4-(4-fluorophenyl)piperidine;hydrochloride | 2934.99 | 6 |
78247-49-1 | Potassium guaiacolsulfonate | Dipotassium 4-hydroxy-3-methoxybenzenesulfonate hydrate | 2909.2 | |
78-27-3 | 1-ethynylcyclohexanol | 1-ethynylcyclohexanol | 3814 | |
78281-02-4 | Safflomin A ; Hydroxysafflor Yellow A | |||
78330-20-8 | Alcohols, C9-11-iso-, C10-rich, ethoxylated | 3402.9 | ||
78330-21-9 | Alcohols, C11-14-iso-, C13-rich, ethoxylated | 3402.9 | ||
78336-31-9 | Poly(oxy-1,2-ethanediyl),a-(12-hydroxydodecyl)-w-[(12-hydroxydodecyl)oxy]- (9CI) | 3402.13 | ||
78338-22-4 | Thionin Acetate | (7-aminophenothiazin-3-ylidene)azanium acetate | 2930.9 | |
78-38-6 | Diethyl Ethylphosphonate | 1-[ethoxy(ethyl)phosphoryl]oxyethane | 2931.9 | |
78-39-7 | Triethyl orthoacetate | 1,1,1-triethoxyethane | 2915.9 | |
78-40-0 | Triethyl Phosphate | Triethyl phosphate | 2919.9 | 3 |
78415-72-2 | Milrinone | 6-methyl-2-oxo-5-pyridin-4-yl-1H-pyridine-3-carbonitrile | 2933.39 | |
78-42-2 | Tris(2-ethylhexyl) phosphate | Tris(2-ethylhexyl) phosphate | 2919.9 | |
78491-02-8 | Diazolidinyl Urea | 1-[1,3-bis(hydroxymethyl)-2,5-dioxoimidazolidin-4-yl]-1,3-bis(hydroxymethyl)urea | ||
78-50-2 | Trioctylphosphine Oxide | 1-dioctylphosphoryloctane | 2931.9 | |
78-51-3 | Tris(2-butoxyethyl) phosphate | Tris(2-butoxyethyl) phosphate | ||
78564-86-0 | Disperse red 152 | 3-[{4-[(5,6(or6,7)-dichloro-1,3-benzothiazol-2-yl)azo]-3-methylphenyl}(ethyl)amino]propanenitrile | 3204.17 | |
78564-87-1 | Disperse red 153 | 3204.11 | ||
78587-05-0 | Hexythiazox ; 5-(4-chlorophenyl)-N-cyclohexyl-4-methyl-2-oxo-1,3-thiazolidine-3-carboxamide | 5-(4-chlorophenyl)-N-cyclohexyl-4-methyl-2-oxo-1,3-thiazolidine-3-carboxamide | 2934.1 | 8 |
78-59-1 | Isophorone | 3,5,5-trimethylcyclohex-2-en-1-one | 2914.29 | 3 |
78-62-6 | Diethoxydimethylsilane | Diethoxy(dimethyl)silane | 2910.9 | |
78-63-7 | 2,5-Dimethyl-2,5-DI-(tert-butylperoxy)hexane | 2,5-bis(tert-butylperoxy)-2,5-dimethylhexane | 2909.6 | |
78642-25-8 | Lysyl endopeptidase | Achromopeptidase | 3507.9 | |
78-67-1 | Azobisisobutyronitrile | 2-(2-cyanopropan-2-yldiazenyl)-2-methylpropanenitrile | 2927 | |
78-69-3 | Tetrahydrolinalool | 3,7-dimethyloctan-3-ol | 2905.19 | |
78-70-6 | Linalool | 3,7-dimethylocta-1,6-dien-3-ol | 2905.22 | |
78-76-2 | 2-Bromobutane | 2-bromobutane | 2903.39 | |
787-70-2 | 4-(4-Carboxyphenyl)benzoic acid | 4-(4-carboxyphenyl)benzoic acid | 2917.39 | |
78-78-4 | Isopentane | 2-methylbutane | 2901.1 | 3 |
78-79-5 | Isoprene | 2-methylbuta-1,3-diene | 2901.24 | 3 |
78-81-9 | Isobutylamine | 2-methylpropan-1-amine | 2921.19 | |
78-83-1 | Isobutyl Alcohol | 2-Methylpropan-1-ol | 2905.14 | |
78832-65-2 | 2-Furanacryloyl-leucyl-glycyl-prolyl-alanine | (2S)-2-[[(2S)-1-[2-[[(2S)-2-[[(E)-3-(furan-2-yl)prop-2-enoyl]amino]-4-methylpentanoyl]amino]acetyl]pyrrolidine-2-carbonyl]amino]propanoic acid | 2934.99 | |
78-84-2 | Isobutyraldehyde | 2-methylpropanal | 2912.19 | |
78-86-4 | 2-Chlorobutane | 2-Chlorobutane | 2933.99 | |
78-88-6 | 2,3-Dichloropropene | 2,3-dichloroprop-1-ene | 2903.99 | 3 |
78-90-0 | Propylenediamine | Propane-1,2-diamine | 2921.29 | |
78-92-2 | 2-Butyl alcohol | Butan-2-ol | 2905.14 | |
789-25-3 | Triphenylsilane | Triphenylsilicon | 2931.9 | |
78-93-3 | Butanone ; Methyl Ethyl Ketone | Butan-2-one | ||
78952-72-4 | Pigment yellow 174 | 2-[{3,3'-dichloro-4'-[{1-[(2,4-dimethylphenyl)amino]-1,3-dioxobutan-2-yl}azo]biphenyl-4-yl}azo]-N-(2-methylphenyl)-3-oxobutanamide | 3204.17 | |
78-96-6 | Monoisopropanolamine | 1-Aminopropan-2-ol | 2922.19 | 3 |
78-98-8 | Methylglyoxal | 2-Oxopropanal | 2914.4 | |
79-01-6 | Trichloroethylene | 1,1,2-trichloroethene | 2903.23 | |
79-03-8 | Propionyl chloride | Propanoyl chloride | 2915.9 | 3 |
79-06-1 | Acrylamide | Prop-2-enamide | 2924.19 | |
79-07-2 | Chloroacetamide | 2-chloroacetamide | 2924.19 | |
79-09-4 | Propionic Acid | Propionic Acid | 2915.9 | 3 |
79-10-7 | Acrylic Acid | Prop-2-enoic acid | 2916.11 | |
79-11-8 | Chloroacetic Acid | 2-chloroacetic acid | 2915.36 | 3 |
79-14-1 | Glycolic Acid | 2-hydroxyacetic acid | 2918.19 | |
79-19-6 | Thiosemicarbazide | Aminothiourea | 2930.9 | 8 |
79-20-9 | Methyl Acetate | Methyl acetate | 2915.39 | |
79241-46-6 | Fluazifop-P-butyl | butyl (2R)-2-(4-{[5-(trifluoromethyl)pyridin-2-yl]oxy}phenoxy)propanoate | 2933.39 | 8 |
79-24-3 | Nitroethane | 1-nitroethane | 2904.2 | 3 |
79-27-6 | 1,1,2,2-Tetrabromoethane | 1,1,2,2-tetrabromoethane | 2903.39 | |
79-29-8 | 2,3-Dimethylbutane | 2,3-dimethylbutane | 2901.1 | |
79300-11-1 | Disperse orange 73 | 3204.11 | ||
79300-13-3 | Disperse red 354 | 3204.11 | ||
79-31-2 | Isobutyric Acid | 2-methylpropanoic acid | 2915.6 | 3 |
793-24-8 | N-(1,3-Dimethylbutyl)-N'-phenyl-p-phenylenediamine | 4-N-(4-methylpentan-2-yl)-1-N-phenylbenzene-1,4-diamine | ||
79-33-4 | L-Lactic acid | (2S)-2-hydroxypropanoic acid | 2918.11 | |
79-34-5 | 1,1,2,2-Tetrachloroethane | 1,1,2,2-tetrachloroethane | ||
79350-37-1 | Cefixime | (6R,7R)-7-[[(2Z)-2-(2-amino-1,3-thiazol-4-yl)-2-(carboxymethoxyimino)acetyl]amino]-3-ethenyl-8-oxo-5-thia-1-azabicyclo[4.2.0]oct-2-ene-2-carboxylic acid | 2941.9 | 6 |
79-37-8 | Oxalyl Chloride | Oxalyl dichloride | 2917.19 | |
79-38-9 | Chlorotrifluoroethylene | 1-chloro-1,2,2-trifluoroethene | 2903.77 | |
79-39-0 | 2-Methylacrylamide | 2-methylprop-2-enamide | 2924.19 | |
79-40-3 | Dithiooxamide | Ethanedithioamide | 2930.9 | |
79-41-4 | Methacrylic Acid | 2-methylprop-2-enoic acid | 2916.13 | 3 |
79-42-5 | 2-Mercaptopropionic acid | 2-sulfanylpropanoic acid | 2930.9 | |
79-43-6 | Dichloroacetic Acid | 2,2-dichloroacetic acid | 2915.4 | 3 |
79517-01-4 | Octreotide | (4R,7S,10S,13R,16S,19R)-10-(4-aminobutyl)-19-[[(2R)-2-amino-3-phenylpropanoyl]amino]-16-benzyl-N-[(2R,3R)-1,3-dihydroxybutan-2-yl]-7-[(1R)-1-hydroxyethyl]-13-(1H-indol-3-ylmethyl)-6,9,12,15,18-pentaoxo-1,2-dithia-5,8,11,14,17-pentazacycloicosane-4-carboxa | 2903.89 | 6 |
79551-14-7 | Ferene | Disodium 5-[3-pyridin-2-yl-6-(5-sulfonatofuran-2-yl)-1,2,4-triazin-5-yl]furan-2-sulfonate | 2934.99 | |
79559-97-0 | Sertraline Hydrochloride | (1S,4S)-4-(3,4-dichlorophenyl)-N-methyl-1,2,3,4-tetrahydronaphthalen-1-amine hydrochloride | 2921.45 | |
79-57-2 | Oxytetracycline | (4S,4aR,5S,5aR,6S,12aR)-4-(dimethylamino)-1,5,6,10,11,12a-hexahydroxy-6-methyl-3,12-dioxo-4,4a,5,5a-tetrahydrotetracene-2-carboxamide | 2941.3 | 6 |
79586-22-4 | Ubiquitin from bovine erythrocytes | 2933.29 | ||
79622-59-6 | Fluazinam | 3-chloro-N-[3-chloro-2,6-dinitro-4-(trifluoromethyl)phenyl]-5-(trifluoromethyl)pyridin-2-amine | 2933.39 | |
79-69-6 | Irone | 4-(2,5,6,6-tetramethylcyclohex-2-en-1-yl)but-3-en-2-one | 2914.23 | |
79725-98-7 | Kojic Acid Dipalmitate | [5-(hexadecanoyloxy)-4-oxo-4H-pyran-2-yl]methyl hexadecanoate | 2915.7 | |
79-74-3 | 2,5-Di-tert-amylhydroquinone | 2,5-bis(2-methylbutan-2-yl)benzene-1,4-diol | ||
797-63-7 | Levonorgestrel | (8R,9S,10R,13S,14S,17R)-13-ethyl-17-ethynyl-17-hydroxy-1,2,6,7,8,9,10,11,12,14,15,16-dodecahydrocyclopenta[a]phenanthren-3-one | 2937.23 | 6 |
79-77-6 | beta-Ionone | (E)-4-(2,6,6-trimethylcyclohexen-1-yl)but-3-en-2-one | 2914.23 | |
79777-30-3 | Polyglyceryl-10 hydroxystearate | Polyglyceryl-10 Heptahydroxystearate | 3824.9 | |
79794-75-5 | Loratadine | Ethyl 4-(8-chloro-5,6-dihydrobenzo[1,2]cyclohepta[2,4-b]pyridin-11-ylidene)piperidine-1-carboxylate | 2933.39 | 6 |
79809-27-1 | Reactive orange 122 | 2-[[6-[[4-Chloro-6-[[4-[[2-(sulfooxy)ethyl]sulfonyl]phenyl]amino]-1,3,5-triazin-2-yl]amino]-1-hydroxy-3-sulfo-2-naphthalenyl]azo]-1,5-naphthalenedisulfonic acid tetrasodium salt | 3204.16 | |
79811-24-8 | Sodium stearoyl glutamate | 3402.11 | ||
79-81-2 | Retinyl palmitate | [(2E,4E,6E,8E)-3,7-dimethyl-9-(2,6,6-trimethylcyclohexen-1-yl)nona-2,4,6,8-tetraenyl] hexadecanoate | 3824.9 | |
79-83-4 | Pantothenic Acid | 3-[[(2R)-2,4-dihydroxy-3,3-dimethylbutanoyl]amino]propanoic acid | 2942 | |
79839-49-9 | 2-Bromoisophthalaldehyde | 2-Bromobenzene-1,3-dicarbaldehyde | 2913 | |
79869-59-3 | Solvent green 5 ; C.I. 59075 | Bis(2-methylpropyl) perylene-1,?-dicarboxylate | 3204.2 | |
79902-63-9 | Simvastatin | [(1S,3R,7S,8S,8aR)-8-[2-[(2R,4R)-4-hydroxy-6-oxooxan-2-yl]ethyl]-3,7-dimethyl-1,2,3,7,8,8a-hexahydronaphthalen-1-yl] 2,2-dimethylbutanoate | 2932.2 | 6 |
79917-90-1 | Butylmethylimidazolium Chloride | 1-Butyl-3-methylimidazol-3-ium chloride | 2933.29 | |
79-94-7 | Tetrabromobisphenol A | 2,6-dibromo-4-[2-(3,5-dibromo-4-hydroxyphenyl)propan-2-yl]phenol | ||
79953-85-8 | 3,3'-[(2-Chloro-5-methyl-p-phenylene)bis[imino(1-acetyl-2-oxoethylene)azo]]bis[4-chloro-N-[2-(4-chlorophenoxy)-5-(trifluoromethyl)phenyl]benzamide] | 3204.17 | ||
79983-71-4 | Hexaconazole | 2-(2,4-dichlorophenyl)-1-(1H-1,2,4-triazol-1-yl)hexan-2-ol | 2933.99 | 8 |
8000-25-7 | Rosemary essential oil | 3302.9 | ||
8000-27-9 | Cedarwood essential oil | 3302.9 | ||
8000-28-0 | Lavender essential oil | 3301.29 | ||
8000-29-1 | Citronella essential oil | 3302.9 | 8 | |
8000-34-8 | Clove essential oil | 3302.9 | ||
8000-42-8 | Caraway seed oil | 3301.12 | ||
8000-46-2 | Geranium essential oil | 3302.9 | ||
8000-48-4 | Eucalyptus essential oil | 3302.9 | ||
8000-66-6 | Cardamom essential oil | 3302.1 | ||
8000-78-0 | Garlic essential oil | 3302.1 | ||
8001-21-6 | Sunflower seed oil | 3302.1 | ||
8001-22-7 | Soyabean Oil ; Glycine soja extract | |||
8001-23-8 | Safflower seed oil | 3301.29 | ||
8001-25-0 | Olive oil | 3302.9 | ||
8001-26-1 | Linseed oil | 3301.29 | ||
8001-30-7 | Corn oil | 3302.1 | ||
8001-31-8 | Coconut oil | 3302.1 | ||
8001-54-5 | Benzalkonium chloride ; Dodecyl Dimethyl Benzyl ammonium Chloride | 3402.12 | 8 | |
8001-58-9 | Creosote | 2707.91 | ||
8001-61-4 | Copaiba oil | 3301.19 | ||
8001-75-0 | Ceresin | 2712.9 | ||
8001-78-3 | Hydrogenated castor oil | 3402.13 | ||
8001-79-4 | Castor oil | |||
8001-99-8 | Ajowan Essential Oil | 3301.19 | ||
8002-03-7 | Peanut oil | 3302.1 | ||
8002-05-9 | Crude oil | 2709 | ||
8002-09-3 | Pine oil | |||
8002-13-9 | Rapeseed oil ; Canola oil | |||
8002-23-1 | Cetyl esters | 3404.9 | ||
8002-26-4 | Refined tall oil | 3803 | ||
8002-33-3 | Sulphonated oil | Disodium;(Z,12R)-12-hydroxy-18-sulfonatooctadec-9-enoate | 3402.9 | |
8002-41-3 | Laurel Essential Oil | 3301.19 | ||
8002-43-5 | Lecithin | 2923.2 | ||
8002-48-0 | Malt extract | |||
8002-56-0 | Oleoresin black pepper | 3302.1 | ||
8002-60-6 | Ginger oleoresin | 3302.1 | ||
8002-66-2 | Chamomile oil | 3301.29 | ||
8002-67-3 | Amber essential Oil | 3301.29 | ||
8002-68-4 | Juniperberry essential oil | 3302.1 | ||
8002-72-0 | Onion oil | 3302.9 | ||
8002-74-2 | Selected microcrystalline wax ; Synthetic paraffin waxes | 2712.9 | ||
8002-75-3 | Palm oil | 3302.1 | ||
8002-78-6 | Peachkernel oil | 3301.9 | ||
8003-22-3 | Solvent yellow 33 | 3204.19 | ||
80-04-6 | 4,4'-Isopropylidenedicyclohexanol | 4-[2-(4-hydroxycyclohexyl)propan-2-yl]cyclohexan-1-ol | 2906.19 | |
8004-87-3 | Basic violet 1 ; Methyl violet | (4-{[4-(dimethylamino)phenyl][4-(methylamino)phenyl]methylidene}cyclohexa-2,5-dien-1-ylidene)-dimethylazanium chloride | 3204.13 | |
8004-92-0 | Acid yellow 3 | Sodium 2-(1,3-dioxoindan-2-yl)quinolinedisulfonate | 3205 | |
8005-02-5 | Solvent black 7 | 3204.17 | ||
8005-03-6 | Nigrosin ; Acid black 2 ; C.I. 50420 | 3212.9 | ||
8005-44-5 | Cetostearyl alcohol | 3402.9 | ||
80-05-7 | Bisphenol A | 4-[2-(4-hydroxyphenyl)propan-2-yl]phenol | 2908.19 | 3 |
8006-14-2 | Natural gas | 2711.11 | ||
8006-28-8 | Soda lime | Sodium oxocalcium hydroxide | 3824.9 | |
8006-61-9 | Gasoline, natural | 2710.12 | ||
8006-64-2 | Gum Turpentine oil ; Spirit of turpentine | 3805.1 | 3 | |
8006-75-5 | Dill seed oil | 3301.29 | ||
8006-76-6 | Michelia Alba Flower Essential Oil | 3301.29 | ||
8006-77-7 | Pimenta Oil | 3302.1 | ||
8006-78-8 | Bay leaf oil | 3301.29 | ||
8006-81-3 | Ylang Ylang essential oil | 3302.9 | ||
8006-82-4 | Black pepper oil ; White pepper oil | 3301.9 | ||
8006-83-5 | Hyssop oil | 3301.29 | ||
8006-84-6 | Fennel essential oil | 3301.29 | ||
8006-87-9 | Sandalwood essential oil | 3302.9 | ||
8006-90-4 | Peppermint essential oil | 3302.9 | ||
8007-00-9 | Balsam Peru Oil | 3301.29 | ||
8007-01-0 | Rose essential oil | 3301.29 | ||
8007-02-1 | Lemongrass essential oil | 3302.9 | ||
8007-04-3 | Hop oil | 3301.29 | ||
8007-08-7 | Ginger essential oil | 3302.1 | ||
8007-11-12 | Oregano Oleoresin | 3301.29 | ||
8007-11-2 | Origanum oil | 3302.9 | ||
8007-12-3 | Nutmeg essential oil | 3302.1 | ||
8007-18-9 | Pigment yellow 53 ; C.I. 77788 | 3209.9 | ||
8007-40-7 | Mustard oil | 3301.29 | ||
8007-43-0 | Sorbitan, (Z)-9-octadecenoate (2:3) | |||
8007-45-2 | Coal tar | 2706 | ||
8007-46-3 | Thyme essential oil | 3302.9 | ||
8007-69-0 | Almond oil | 3301.29 | ||
8007-70-3 | Anise oil | 3302.1 | ||
8007-75-8 | Bergamot essential oil | 3301.9 | ||
8007-78-1 | Cactus flower extract | 3301.9 | ||
8007-80-5 | Cassia essential Oil | 3302.1 | ||
8007-93-0 | Belladonna, extract | 2932.99 | ||
80-08-0 | Dapsone | 4-(4-aminophenyl)sulfonylaniline | 2930.9 | |
8008-20-6 | Kerosene (petroleum) | 2710.19 | ||
8008-26-2 | Lime Essential Oil | 3301.9 | ||
8008-31-9 | Mandarin essential oil | 3302.9 | ||
80083-40-5 | Pigment red 81:1 | 3204.17 | ||
8008-45-5 | Nutmeg essential oil | 3302.1 | ||
8008-46-6 | Myrtle Oil | 3301.29 | ||
8008-51-3 | Camphor essential oil | 3301.19 | ||
8008-52-4 | Coriander essential Oil | 3302.1 | ||
8008-56-8 | Lemon essential oil | 3301.29 | ||
8008-57-9 | Orange essential Oil | 3302.9 | ||
8008-60-4 | Opium | 2939.11 | 7 | |
8008-74-0 | Sesame oil | 3302.1 | ||
8008-79-5 | Spearmint essential oil | 3302.9 | ||
8008-80-8 | Spruce oil | 3301.19 | ||
8008-88-6 | Valerian oil | 3301.29 | ||
8008-98-8 | Cajeput essential oil | 3302.9 | ||
8008-99-9 | Garlic essential oil | 3302.9 | ||
8009-03-8 | Petroleum jelly | 2712.1 | ||
80-09-1 | 4,4'-Sulfonyldiphenol | 4-(4-hydroxyphenyl)sulfonylphenol | ||
8011-48-1 | Tar, pine | 3807 | ||
8011-63-0 | Bordeaux mixture | 3808.92 | 8 | |
8011-86-7 | Acid brown 75 | 3204.12 | ||
8012-89-3 | White wax ; Yellow Beeswax | |||
8012-91-7 | Juniperberry essential oil | 3302.9 | ||
8012-95-1 | Paraffin oil | |||
8013-01-2 | Yeast extract | 3821 | ||
8013-07-8 | Epoxidized soya bean oil | |||
8013-86-3 | Cypress essential oil | 3301.29 | ||
8014-09-3 | Patchouli essential oil | 3302.9 | ||
8014-13-9 | Cumin seed essential oil | 3301.29 | ||
8014-17-3 | Petitgrain essential Oil | 3301.29 | ||
8014-19-5 | Palmarosa oil | 3301.29 | ||
8014-29-7 | Rue oil | 3301.29 | ||
80146-85-6 | Transglutaminase | 3507.9 | ||
8014-71-9 | Lemon Balm Oil | 3301.29 | ||
8014-95-7 | Fuming sulfuric acid; OLEUM | Sulfuric acid;sulfur trioxide | 2807 | |
8015-01-8 | Marjoram essential Oil | 3302.1 | ||
8015-62-1 | Ambrette seed oil | 3301.29 | ||
8015-64-3 | Angelica seed oil | 3301.29 | ||
8015-65-4 | Amyris Oil | 3301.29 | ||
80156-96-3 | Reactive red 261 ; C.I. 182145 | Trisodium 5-({4-chloro-6-[(4-{[2-(sulfonatooxy)ethyl]sulfonyl}phenyl)amino]-1,3,5-triazin-2-yl}amino)-4-hydroxy-3-(phenylazo)naphthalene-2,7-disulfonate | 3204.16 | |
8015-73-4 | Basil essential oil | 3302.9 | ||
8015-77-8 | Rosewood Oil | 3302.9 | ||
8015-79-0 | Calamus essential oil | 3301.29 | ||
8015-80-3 | Candlenut oil | 3301.9 | ||
8015-86-9 | Carnauba wax | 3301.29 | ||
8015-88-1 | Carrot seed oil | 3301.19 | ||
80-15-9 | Cumene Hydroperoxide | 2-hydroperoxypropan-2-ylbenzene | 3 | |
8015-90-5 | Celery seed essential oil | 3302.9 | ||
8015-91-6 | Cinnamon essential oil | 3302.9 | ||
8015-92-7 | Camomile essentail oil | 3302.9 | ||
8016-03-3 | Davana essentail oil | 3301.29 | ||
8016-06-6 | Dill seed oil | 3301.29 | ||
8016-20-4 | Grapefruit essentail oil | 3302.9 | ||
8016-21-5 | Cognac oil | 3302.9 | ||
8016-23-7 | Guaiac wood Oil | 3301.29 | ||
8016-24-8 | Hemp seed oil | 3301.9 | ||
8016-26-0 | Labdanum Oil | 3301.29 | ||
8016-31-7 | Lovage oil | 3302.1 | ||
8016-33-9 | Marjoram essential Oil | 3302.1 | ||
8016-34-8 | Neroli essentail oil | 3302.9 | ||
8016-36-2 | Frankincense essential oil | 3302.9 | ||
8016-37-3 | Myrrh essential oil | 3301.29 | ||
8016-38-4 | Neroli essential oil | 3301.29 | ||
8016-44-2 | Petitgrain essential Oil | 3302.9 | ||
8016-46-4 | Pine needle oil | 3301.29 | ||
8016-49-7 | Pumpkin seed Oil | 3302.1 | ||
8016-63-5 | Clary sage essential oil | 3301.29 | ||
8016-68-0 | Savory oil | 3301.19 | ||
8016-78-2 | Spike lavender essentia oil | 3301.29 | ||
8016-81-7 | Tall-oil pitch | 3807 | ||
8016-85-1 | Tangerine essential oil | 3301.9 | ||
8016-88-4 | Estragon essentia oil | 3301.29 | ||
8016-96-4 | Vetiver essentia Oil | 3301.29 | ||
8017-16-1 | Polyphosphoric acid | 2809.2 | 8 | |
8018-01-7 | Mancozeb ; Manganese ethylenebis(dithiocarbamate) (polymeric) complex with zinc salt | 8 | ||
80-20-6 | 4-Hydroxymetanilanilide | 3-amino-4-hydroxy-N-phenylbenzenesulfonamide | 2935 | |
80206-82-2 | Alcohols, C12-14 | 3823.7 | ||
8020-83-5 | Mineral oil | 3402.9 | ||
8021-27-0 | Silver fir needle oil | 3301.19 | ||
8021-28-1 | Fir needle oil | 3301.29 | ||
8021-29-2 | Siberian fir oil | 3301.29 | ||
8021-39-4 | Wood creosote | 3807 | ||
8021-43-0 | Carnation essential oil | 3301.29 | ||
80214-83-1 | Roxithromycin | (3R,4S,5S,6R,7R,9R,10E,11S,12R,13S,14R)-6-[(2S,3R,4S,6R)-4-(dimethylamino)-3-hydroxy-6-methyloxan-2-yl]oxy-14-ethyl-7,12,13-trihydroxy-4-[(2R,4R,5S,6S)-5-hydroxy-4-methoxy-4,6-dimethyloxan-2-yl]oxy-10-(2-methoxyethoxymethoxyimino)-3,5,7,9,11,13-hexamethyl | 2941.5 | 6 |
8021-55-4 | Ozokerite | 2712.9 | ||
8021-56-5 | Palm wax | 2712.2 | ||
8022-15-9 | Lavandin essential oil from lavandula hybrida | 3301.29 | ||
8022-56-8 | Sage essential oil | 3302.1 | ||
8022-79-5 | Verbena oil | 3301.9 | ||
8022-96-6 | Jasmine essential oil | 3301.19 | ||
8023-77-6 | Capsicum Oleoresin Oil | 3301.9 | ||
8023-78-7 | Vanilla oleoresin | 3301.29 | ||
8023-84-5 | Catnip oil | 3301.9 | ||
8023-85-6 | Cedarwood oil atlas | 3301.19 | ||
8023-89-0 | Elemi essential oil | 3301.29 | ||
8023-94-7 | Hyacinth oil | 3301.9 | ||
8023-95-8 | Immortelle oil | 3301.29 | ||
8023-99-2 | Pine needle oil | 3301.29 | ||
8024-01-9 | Styrax benzoin oil | 3301.29 | ||
8024-06-4 | Vanilla extract | 3301.29 | ||
8024-09-7 | Walnut oil | 3302.1 | ||
8024-12-2 | Verbena oil from lippia citriodora cymbopogon | 3301.19 | ||
8024-15-5 | Canada balsam oil | 3301.19 | ||
8024-22-4 | Grape seed oil | 3301.12 | ||
8024-32-6 | Avocado oil | 3301.29 | ||
8024-37-1 | Curcuma essential oil | 3302.9 | ||
8024-40-6 | Galanga root essential oil | 3301.29 | ||
802575-11-7 | Butylone | 1-(1,3-benzodioxol-5-yl)-2-(methylamino)butan-1-one | 2932.99 | 7 |
80-26-2 | Terpinyl acetate | 2-(4-methylcyclohex-3-en-1-yl)propan-2-yl acetate | 2915.39 | |
8028-48-6 | Orange essential Oil | 3302.1 | ||
8028-89-5 | Caramel color | 3203 | ||
8029-10-5 | Coal, anthracite | Anthracen-1-ylmethanolate | ||
8030-28-2 | Neroli hydrosol | 3301.29 | ||
8030-30-6 | Naphtha; Low boiling point naphtha | 2710.12 | ||
8031-03-6 | Mimosa oil | 3301.29 | ||
8031-18-3 | Fuller's earth | 2508.4 | ||
8031-67-2 | Royal jelly | 2936.29 | ||
8032-32-4 | Ligroine | 2710.2 | ||
8038-65-1 | Ambergris Essential Oil | 3301.29 | ||
8038-79-7 | Benzoin oil | 3301.9 | ||
8039-23-4 | 12-Hydroxystearic acid | 12-hydroxyoctadecanoic acid | 3823.19 | |
80-39-7 | N-ethyltoluene-4-sulphonamide | N-ethyltoluene-4-sulfonamide | 3812.3 | |
8040-85-5 | Fatty acids, dehydrated castor-oil, Me esters | 3823.19 | ||
8042-47-5 | White mineral oil (petroleum) ; Mixture of highly purified petroleum oils | 2710.19 | ||
804-30-8 | Fursultiamine | N-[(4-amino-2-methylpyrimidin-5-yl)methyl]-N-[(E)-5-hydroxy-3-(oxolan-2-ylmethyldisulfanyl)pent-2-en-2-yl]formamide | 2936.22 | 6 |
80-43-3 | Dicumyl peroxide | 2-(2-phenylpropan-2-ylperoxy)propan-2-ylbenzene | 3 | |
8044-71-1 | Cetrimide | Trimethyl(tetradecyl)azanium hydrobromide | 2923.9 | |
80459-59-2 | N,N-Bis[3-(dimethylamino)propyl]formamide | N,N-Bis[3-(dimethylamino)propyl]formamide | 2921.29 | |
8046-22-8 | Tonka bean absolute (Dipteryx odorata) | 3301.9 | ||
80-46-6 | P-Tert-pentylphenol | 4-(2-methylbutan-2-yl)phenol | 2907.19 | |
8047-15-2 | Saponin | (3S,4S,6R)-6-{[(3S,4S,6aR,6bS,8R,8aR,12aS,14bR)-8a-({[(2S,4S,5S)-5-(acetyloxy)-3-{[(2S,4R,5R)-3,4-dihydroxy-6-methyl-5-{[(2S,4R,5R)-3,4,5-trihydroxyoxan-2-yl]oxy}oxan-2-yl]oxy}-6-methyl-4-{[(2S,4S,5R)-3,4,5-trihydroxy-6-methyloxan-2-yl]oxy}oxan-2-yl]oxy}c | 2938.9 | 8 |
80-47-7 | P-Menthane hydroperoxide | 1-(2-hydroperoxypropan-2-yl)-4-methylcyclohexane | 2909.6 | |
8047-99-2 | N-ethyl-o(or p)-toluenesulphonamide; mixture of isomers consisting of N-ethyltoluene-2-sulphonamide and N-ethyltoluene-4-sulphonamide | N-ethyl-2(or 4)-methylbenzenesulfonamide | 3812.3 | |
8048-07-5 | Pigment yellow 35 | 3207.1 | ||
80481-35-2 | Aluminum alkylacetylacetonate diisopropoxide | (Z)-4-di(propan-2-yloxy)alumanyloxy-4-[(E)-octadec-9-enoxy]but-3-en-2-one | 3824.9 | |
8049-47-6 | Pancreatin | 3507.9 | ||
80498-15-3 | Laccase | 1-ethyl-2,5-dimethylpyrrole-3-carbaldehyde | 3507.9 | |
8049-97-6 | Melanin | Melanin | ||
8050-07-5 | Frankincense essential oil | 3302.9 | ||
8050-09-7 | Gum rosin | 3806.1 | ||
8050-15-5 | Rosin acids, hydrogenated, Methyl esters | 3806.9 | ||
8050-26-8 | Resin acids and Rosin acids, esters with pentaerythritol | 3806.9 | ||
8050-31-5 | Resin acids and rosin acids, esters with glycerol | 3806.3 | ||
80506-64-5 | Polyethylene glycol amide  | Poly(oxy-1,2-ethanediyl), alpha-(2-aminoethyl)-omega-methoxy- | 3404.9 | |
80508-23-2 | N-Nitrosonornicotine | 3-(1-nitrosopyrrolidin-2-yl)pyridine | 2933.39 | |
80-51-3 | 4,4'-oxydibenzenesulfonohydrazide | 4-[4-(hydrazinesulfonyl)phenoxy]benzenesulfonohydrazide | 2935.9 | |
8051-73-8 | Sorbeth-20 Beeswax | 3402.13 | ||
8052-41-3 | Stoddard solvent;Low boiling point naphtha – unspecified;[A colourless, refined petroleum distillate | |||
8052-42-4 | Bitumen ; Asphalt | 3 | ||
8052-47-9 | Disproportionated rosin | 3806.9 | ||
80-54-6 | Butylphenyl Methylpropional | 3-(4-tert-butylphenyl)-2-methylpropanal | 2912.19 | |
80-56-8 | alpha-Pinene | 4,6,6-trimethylbicyclo[3.1.1]hept-3-ene | 2902.9 | |
80584-85-6 | Tetraphenyl dipropyleneglycol diphosphite | 1-(2-diphenoxyphosphanyloxypropoxy)propan-2-yl diphenyl phosphite | 2909.49 | |
80584-86-7 | Oxybispropylenebis[(1,5,9,13,17,21-hexamethyl-7,15,23,23-tetraphenoxy-3,6,8,11,14,16,19,22-octaoxa-7,15,23-triphosphatricos-1-yl)(phenyl)phosphine] | 2,18-bis({[({1-[2-({[(1-{2-[(diphenoxyphosphanyl)oxy]propoxy}propan-2-yl)oxy](phenoxy)phosphanyl}oxy)propoxy]propan-2-yl}oxy)(phenoxy)phosphanyl]oxy})-6,8,12,14-tetramethyl-7,13-diphenyl-4,10,16-trioxa-7,13-diphosphanonadecane | 2920.9 | |
80584-91-4 | 2,4,6-Tri-(6-aminocaproic acid)-1,3,5-triazine | 6-[[4,6-bis(5-carboxypentylamino)-1,3,5-triazin-2-yl]amino]hexanoic acid | 2933.69 | |
80-59-1 | Tiglinic acid | (E)-2-methylbut-2-enoic acid | 2916.19 | |
8061-51-6 | Lignosulfonic acid, sodium salt | 3804 | ||
8061-52-7 | Calcium Lignosulfonate | Calcium 3-(2-hydroxy-3-methoxyphenyl)-2-[2-methoxy-4-(3-sulfonatopropyl)phenoxy]propane-1-sulfonate | ||
8062-15-5 | Lignosulfonate | 3804 | ||
80-62-6 | Methyl Methacrylate | Methyl 2-methylprop-2-enoate | 2916.14 | |
8063-07-8 | Kanamycin | (2R,3S,4S,5R,6R)-2-(aminomethyl)-6-[(1R,2R,3S,4R,6S)-4,6-diamino-3-[(2S,3R,4S,5S,6R)-4-amino-3,5-dihydroxy-6-(hydroxymethyl)oxan-2-yl]oxy-2-hydroxycyclohexyl]oxyoxane-3,4,5-triol | 2922.19 | 6 |
8063-24-9 | Acriflavine hydrochloride | 9-methylacridin-10-ium-3,6-diamine chloride | ||
8064-00-4 | Alumina trihydrate | Aluminum trihydroxide | 2818.3 | |
8064-60-6 | Direct yellow 59 ; Primuline | Sodium 2-[2'-(4''-anilino)benzo[d]thiazol-6'-yl]-6-methylbenzo[d]thiazole-7-sulfonate | 3212.9 | |
8067-24-1 | Dihydroergotoxine mesilate ; Ergoloid mesylate | (6aR,9R)-N-((2S,5S,10aS,10bR)-10b-hydroxy-2-isopropyl-3,6-dioxo-5-tert-pentyloctahydro-2H- oxazolo[3,2-a]pyrrolo[2,1-c]pyrazin-2-yl)-7-methyl-4,6,6a,7,8,9,10,10a-octahydroindolo[4,3-fg] quinoline-9-carboxamide | 2939.69 | 7 |
8067-32-1 | Octadecanoic acid, ester with 1,2,3-propanetriol hexadecanoate | 2915.7 | ||
8067-69-4 | Halquinols | 5-chloroquinolin-8-ol 7-chloroquinolin-8-ol 5,7-dichloroquinolin-8-ol | 2933.49 | |
8068-05-1 | Lignin, alkali | 2702.1 | ||
8068-28-8 | Colistimethate Sodium | Pentasodium [2-[17-(1-hydroxyethyl)-22-[[2-[[3-hydroxy-2-[[2-(6-methyloctanoylamino)-4-(sulfonatomethylamino)butanoyl]amino]butanoyl]amino]-4-(sulfonatomethylamino)butanoyl]amino]-5,8-bis(2-methylpropyl)-3,6,9,12,15,18,23-heptaoxo-11,14-bis[2-(sulfonatome | 2941.9 | |
80693-00-1 | Bis(2,6-DI-tert-butyl-4-methylphenyl)pentaerythritol diphosphite | 3,9-bis(2,6-ditert-butyl-4-methylphenoxy)-2,4,8,10-tetraoxa-3,9-diphosphaspiro[5.5]undecane | ||
80-70-6 | 1,1,3,3-Tetramethylguanidine | 1,1,3,3-Tetramethylguanidine | 2925.29 | |
80-73-9 | Dimethyl Imidazolidinone | 1,3-dimethylimidazolidin-2-one | 2933.29 | |
80748-21-6 | Disperse yellow 201 ; Solvent yellow 179 | 3204.11 | ||
80844-07-1 | Etofenprox | 1-{[2-(4-ethoxyphenyl)-2-methylpropoxy]methyl}-3-phenoxybenzene | 2909.3 | 8 |
80939-62-4 | Amines, C11-14 Branched Alkyl Monohexyl and dihexyl phosphates | 2919.9 | ||
81012-88-6 | Inosine 5'-diphosphate sodium salt | Trisodium [[(2R,3S,4R,5R)-3,4-dihydroxy-5-(6-oxo-3H-purin-9-yl)oxolan-2-yl]methoxy-oxidophosphoryl] phosphate hydrate | 2934.99 | |
81012-89-7 | Sodium 1-naphthyl phosphate monohydrate | Sodium naphthalen-1-yl hydrogen phosphate hydrate | 2919.9 | |
81025-04-9 | Lactitol Monohydrate | (2S,3R,4R,5R)-4-[(2S,3R,4S,5R,6R)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxyhexane-1,2,3,5,6-pentol hydrate | 2940 | |
81029-06-3 | Aluminum perchlorate monahydrate | Aluminum;triperchlorate;nonahydrate | 2829.9 | |
81-05-0 | 6-Aminonaphthalene-1-sulphonic acid | 6-Aminonaphthalene-1-sulphonic acid | 2921.45 | |
81-07-2 | Saccharin | 1,1-dioxo-1,2-benzothiazol-3-one | 2925.11 | |
81103-11-9 | Clarithromycin | (3R,4S,5S,6R,7R,9R,11R,12R,13S,14R)-6-[(2S,3R,4S,6R)-4-(dimethylamino)-3-hydroxy-6-methyloxan-2-yl]oxy-14-ethyl-12,13-dihydroxy-4-[(2R,4R,5S,6S)-5-hydroxy-4-methoxy-4,6-dimethyloxan-2-yl]oxy-7-methoxy-3,5,7,9,11,13-hexamethyl-oxacyclotetradecane-2,10-dion | 2941.9 | 6 |
81-11-8 | Flavonic acid | 5-amino-2-[(E)-2-(4-amino-2-sulfophenyl)ethenyl]benzenesulfonic acid | 2921.59 | |
81129-83-1 | Cilastatin Sodium | Sodium (Z)-7-[(2R)-2-amino-2-carboxyethyl]sulfanyl-2-[[(1S)-2,2-dimethylcyclopropanecarbonyl]amino]hept-2-enoate | 2930.9 | 6 |
81-13-0 | Dexpanthenol ; Fragrance of d-Panthenol | (2R)-2,4-dihydroxy-N-(3-hydroxypropyl)-3,3-dimethylbutanamide | 2936.24 | |
81131-70-6 | Pravastatin sodium | Sodium (3R,5R)-7-[(1S,2S,6S,8S,8aR)-6-hydroxy-2-methyl-8-[(2S)-2-methylbutanoyl]oxy-1,2,6,7,8,8a-hexahydronaphthalen-1-yl]-3,5-dihydroxyheptanoate | 6 | |
81-14-1 | Musk Ketone | 1-(4-tert-butyl-2,6-dimethyl-3,5-dinitrophenyl)ethanone | 2914.7 | |
81-16-3 | 2-Aminonaphthalene-1-sulfonic acid | 2-Aminonaphthalene-1-sulfonic acid | 2921.45 | |
811-97-2 | Norflurane | 1,1,1,2-tetrafluoroethane | 2903.39 | |
811-98-3 | Methanol-d4 | Trideuterio(deuteriooxy)methane | 2845.9 | |
81230-05-9 | Diisostearyl malate | Bis(16-methylheptadecyl) 2-hydroxybutanedioate | 3824.9 | |
81-23-2 | Dehydrocholic acid | (4R)-4-[(5S,8R,9S,10S,13R,14S,17R)-10,13-dimethyl-3,7,12-trioxo-1,2,4,5,6,8,9,11,14,15,16,17-dodecahydrocyclopenta[a]phenanthren-17-yl]pentanoic acid | 2918.3 | |
81-25-4 | Cholic Acid | (4R)-4-[(3R,5S,7R,8R,9S,10S,12S,13R,14S,17R)-3,7,12-trihydroxy-10,13-dimethyl-2,3,4,5,6,7,8,9,11,12,14,15,16,17-tetradecahydro-1H-cyclopenta[a]phenanthren-17-yl]pentanoic acid | 2918.19 | |
81262-93-3 | Procaterol Hydrochloride Hemihydrate | 8-hydroxy-5-[1-hydroxy-2-(propan-2-ylamino)butyl]-1H-quinolin-2-one hydrate hydrochloride | 2933.79 | |
81290-20-2 | Trifluoromethyltrimethylsilane | Trimethyl(trifluoromethyl)silane | 2931.9 | |
81-39-0 | Solvent red 52 | 3-methyl-6-[(4-methylphenyl)amino]-3H-naphtho[1,2,3-de]quinoline-2,7-dione | 3204.11 | |
813-94-5 | Calcium citrate | Tricalcium bis(2-hydroxypropane-1,2,3-tricarboxylate) | 2918.15 | |
81403-68-1 | Alfuzosin Hydrochloride | N-[3-[(4-amino-6,7-dimethoxyquinazolin-2-yl)-methylamino]propyl]oxolane-2-carboxamide hydrochloride | 2934.99 | 6 |
81406-37-3 | Fluroxypyr-meptyl | 1-methylheptyl [(4-amino-3,5-dichloro-6-fluoropyridin-2-yl)oxy]acetate | 2933.39 | 8 |
81-42-5 | Disperse violet 28 | 3204.11 | ||
814-49-3 | Diethyl Chlorophosphate | 1-[chloro(ethoxy)phosphoryl]oxyethane | 2920.9 | 8 |
814-80-2 | Calcium lactate | Calcium 2-hydroxypropanoate | 2918.11 | |
81-48-1 | Solvent violet 13 | 1-hydroxy-4-[(4-methylphenyl)amino]anthracene-9,10-dione | 3204.19 | |
81-64-1 | Quinizarin | 1,4-dihydroxyanthracene-9,10-dione | 2914.69 | |
81-77-6 | Pigment blue 60 | 6,15-dihydrodinaphtho[2,3-a:2',3'-h]phenazine-5,9,14,18-tetrone | 3204.9 | |
81777-89-1 | Clomazone | 2-(2-chlorobenzyl)-4,4-dimethylisoxazolidin-3-one | 2934.99 | 8 |
81782-77-6 | 4-Methyl-3-decen-5-ol | (E)-4-methyldec-3-en-5-ol | 2905.29 | |
81786-73-4 | 3,4,5,6,6-pentamethylhept-3-en-2-one | (Z)-3,4,5,6,6-Pentamethylhept-3-en-2-one | 2914.19 | |
818-08-6 | Dibutyltin(IV) oxide | Dibutyl(oxo)tin | 2931.9 | |
81-81-2 | Warfarin | 4-hydroxy-3-(3-oxo-1-phenylbutyl)-2H-chromen-2-one | 2932.2 | |
81859-24-7 | Cellulose 2-hydroxyethyl 2-[2-hydroxy-3- | 3402.11 | ||
818-61-1 | 2-Hydroxyethyl acrylate | 2-hydroxyethyl prop-2-enoate | 2916.12 | 3 |
81-88-9 | Basic violet 10 ; Rhodamine | 9-(2-carboxyphenyl)-3,6-bis(diethylamino)xanthylium chloride | 3212.9 | |
81907-62-2 | Ganoderic acid A | (2R,6R)-6-[(5R,7S,10S,13R,14R,15S,17R)-7,15-dihydroxy-4,4,10,13,14-pentamethyl-3,11-dioxo-2,5,6,7,12,15,16,17-octahydro-1H-cyclopenta[a]phenanthren-17-yl]-2-methyl-4-oxoheptanoic acid | 2918.99 | |
81925-81-7 | 5-Methyl-2-hepten-4-one | (E)-5-methylhept-2-en-4-one | 2914.19 | |
820959-16-8 | Protein hydrolyzates, pseudoalteromonas antarctica | 3504 | ||
82115-62-6 | Interferon gamma | 3502.9 | 6 | |
821-55-6 | 2-Nonanone | Nonan-2-one | 2914.19 | |
82159-09-9 | Epalrestat | 2-[(5Z)-5-[(E)-2-methyl-3-phenylprop-2-enylidene]-4-oxo-2-sulfanylidene-1,3-thiazolidin-3-yl]acetic acid | 2934.1 | 6 |
82199-12-0 | Pigment yellow 194 | 3204.17 | ||
822-06-0 | Hexamethylene Diisocyanate | 1,6-diisocyanatohexane | 2929.1 | 8 |
822-16-2 | Sodium Stearate | Sodium octadecanoate | ||
822-17-3 | Sodium Linoleate | Sodium (9Z,12Z)-octadeca-9,12-dienoate | 2916.15 | |
822-27-5 | Dioctyl disulphide | 1-(octyldisulfanyl)octane | 3824.9 | |
82249-33-0 | Softisan 649 | 2917.12 | ||
822-67-3 | 2-Cyclohexenol | Cyclohex-2-en-1-ol | 2906.19 | |
823202-99-9 | Snake trippetide | Acetic acid N-[4-amino-1-(benzylamino)-1-oxobutan-2-yl]-1-(3-aminopropanoyl)pyrrolidine-2-carboxamide | 2933.29 | |
823-22-3 | Delta-Hexalactone | 6-methyloxan-2-one | 2932.2 | |
82347-07-7 | Solvent red 218 | 3204.19 | ||
82376-08-7 | Isodecanol, ethoxylated | 3402.9 | ||
82-38-2 | Solvent red 111 ; 1-(methylamino)anthraquinone | |||
82385-42-0 | Saccharin sodium salt hydrate | 1,2-Benzisothiazol-3(2H)-one, 1,1-dioxide, sodium salt, hydrate | 3210 | |
823-96-1 | Trimethylboroxine | 2,4,6-trimethyl-1,3,5,2,4,6-trioxatriborinane | 2931.9 | |
82419-36-1 | Ofloxacin | (RS)-7-fluoro-2-methyl-6-(4-methylpiperazin-1-yl)-10-oxo-4-oxa-1-azatricyclotrideca-5(13),6,8,11-tetraene-11-carboxylic acid | 2934.99 | |
82436-77-9 | Bis(sulfosuccinimidyl) suberatesodium salt | 3402.11 | ||
824-39-5 | Sodium 2-nitrophenolate | Sodium 2-nitrophenolate | 2908.99 | 8 |
82451-48-7 | Poly[N,N'-bis(2,2,6,6-tetramethyl-4-piperidinyl)-1,6-hexanediamine-co-2,4-dichloro-6-morpholino-1,3,5-triazine] | 3812.3 | ||
824-78-2 | Sodium 4-nitrophenolate | Sodium 4-nitrophenolate | 2908.99 | 8 |
82560-54-1 | Benfuracarb | 2,3-dihydro-2,2-dimethyl-7-benzofuranyl 2-methyl-4-(1-methylethyl)-7-oxo- 8-oxa-3-thia-2,4-diazadecanoate | 2932.99 | 8 |
82626-48-0 | Zolpidem | N,N,6-trimethyl-2-p-tolylimidazo[1,2-a]pyridine-3-acetamide | 2933.99 | 9 |
82654-98-6 | Vanillyl butyl ether | 4-(butoxymethyl)-2-methoxyphenol | ||
82657-04-3 | Bifenthrin | (2-methyl-3-phenylphenyl)methyl (1S,3S)-3-[(Z)-2-chloro-3,3,3-trifluoroprop-1-enyl]-2,2-dimethylcyclopropane-1-carboxylate | 2916.2 | 8 |
827-15-6 | Pentafluoroiodobenzene | 1,2,3,4,5-pentafluoro-6-iodobenzene | 2903.99 | |
827-21-4 | Sodium 2,4-Dimethylbenzenesulfonate | Sodium 2,4-Dimethylbenzenesulfonate | ||
827-54-3 | 2-Vinylnaphthalene | 2-ethenylnaphthalene | 2902.9 | |
82-76-8 | 8-Anilino-1-naphthalenesulfonic acid | 8-Anilino-1-naphthalenesulfonic acid | 2921.45 | |
82785-45-3 | Neuropeptide Y | 2933.29 | ||
82799-44-8 | 2,4-Diethyl-9H-thioxanthen-9-one | 2,4-diethylthioxanthen-9-one | 2934.99 | |
828-26-2 | Trithioacetone | 2,2,4,4,6,6-hexamethyl-1,3,5-trithiane | 2934.99 | |
82-86-0 | Acenaphthenequinone | Acenaphthylene-1,2-dione | 2914.69 | |
828918-62-3 | Bis-ethoxydiglycol succinate | Bis[2-(2-ethoxyethoxy)ethyl] butanedioate | 3824.9 | |
82905-32-6 | Homogenol L 18 | 3402.19 | ||
82911-69-1 | N-(9H-Fluoren-2-ylmethoxycarbonyloxy)succinimide | (2,5-dioxopyrrolidin-1-yl) 9H-fluoren-9-ylmethyl carbonate | 2925.19 | |
82951-55-1 | Carbocysteine-lysine | (2S)-6-amino-2-[[(2R)-2-amino-3-(carboxymethylsulfanyl)propanoyl]amino]hexanoic acid | 2922.41 | |
82985-35-1 | Bis(trimethoxysilylpropyl)amine | 3-trimethoxysilyl-N-(3-trimethoxysilylpropyl)propan-1-amine | 2931.9 | |
830-03-5 | 4-Nitrophenyl acetate | (4-nitrophenyl) acetate | 2915.39 | |
830-09-1 | 4-Methoxycinnamic acid | (E)-3-(4-methoxyphenyl)prop-2-enoic acid | 2918.99 | |
83016-70-0 | N,N,N'-trimethyl-N'-hydroxyethyl-bis-(aminoethyl)ether | 2-[2-[2-(dimethylamino)ethoxy]ethyl-methylamino]ethanol | 2922.19 | |
83048-65-1 | Trimethoxy(1H,1H,2H,2H-heptadecafluorodecyl)silane | Trimethoxy(1H,1H,2H,2H-heptadecafluorodecyl)silane | 2931.9 | |
83055-99-6 | Bensulfuron-methyl | 3808.93 | 8 | |
83-07-8 | Ampyrone | 4-amino-1,5-dimethyl-2-phenylpyrazol-3-one | 2939.99 | |
830-81-9 | 1-Naphthyl acetate | Naphthalen-1-yl acetate | 2916.39 | |
83105-70-8 | Sultamicillin tosylate | 2941.1 | 6 | |
831-52-7 | Sodium picramate | Sodium 2-amino-4,6-dinitrophenolate | 3 | |
831-61-8 | Ethyl gallate | Ethyl 3,4,5-trihydroxybenzoate | 2918.29 | |
83164-33-4 | Diflufenican | N-(2,4-difluorophenyl)-2-[3-(trifluoromethyl)phenoxy]nicotinamide | 2933.39 | 8 |
83-32-9 | Acenaphthene | 1,2-dihydroacenaphthylene | 2902.9 | |
83-33-0 | 1-Indanone | 2,3-dihydroinden-1-one | 2914.39 | |
83-34-1 | 3-Methylindole | 3-Methylindole | 2933.99 | |
83382-48-3 | NOPCO 8034 | 2710.19 | ||
834-12-8 | Ametryn | 2933.69 | ||
83-44-3 | Deoxycholic acid | (4R)-4-[(3R,5R,8R,9S,10S,12S,13R,14S,17R)-3,12-dihydroxy-10,13-dimethyl-2,3,4,5,6,7,8,9,11,12,14,15,16,17-tetradecahydro-1H-cyclopenta[a]phenanthren-17-yl]pentanoic acid | 2918.19 | |
83-46-5 | beta-Sitosterol | (3S,8S,9S,10R,13R,14S,17R)-17-[(2R,5R)-5-ethyl-6-methylheptan-2-yl]-10,13-dimethyl-2,3,4,7,8,9,11,12,14,15,16,17-dodecahydro-1H-cyclopenta[a]phenanthren-3-ol | 2906.13 | |
83-48-7 | Stigmasterol | (3S,8S,9S,10R,13R,14S,17R)-17-[(E,2R,5S)-5-ethyl-6-methylhept-3-en-2-yl]-10,13-dimethyl-2,3,4,7,8,9,11,12,14,15,16,17-dodecahydro-1H-cyclopenta[a]phenanthren-3-ol | 2933.99 | |
83506-93-8 | 4,5-Difluoroanthranilic acid | 2-amino-4,5-difluorobenzoic acid | 2922.49 | |
83574-63-4 | N-Ethyl-3-(2-sulfatoethylsulfonyl)aniline | 2-[3-(ethylamino)phenyl]sulfonylethyl hydrogen sulfate | 2930.9 | |
83-67-0 | Theobromine | 3,7-dimethylpurine-2,6-dione | 2939.99 | |
83682-78-4 | Linoleamidopropyl PG-dimonium chloride phosphate | [3-bis[3-[dimethyl-[3-[[(9Z,12Z)-octadeca-9,12-dienoyl]amino]propyl]azaniumyl]-2-hydroxypropoxy]phosphoryloxy-2-hydroxypropyl]-dimethyl-[3-[[(9Z,12Z)-octadeca-9,12-dienoyl]amino]propyl]azanium trichloride | 3824.9 | |
83708-66-1 | Isocetyl myristate | 14-Methylpentadecyl tetradecanoate | 2915.9 | |
83-72-7 | 2-Hydroxy-1,4-naphthoquinone | 4-hydroxynaphthalene-1,2-dione | 2914.69 | |
83730-53-4 | L-Buthionine-sulfoximine | (2S)-2-amino-4-(butylsulfonimidoyl)butanoic acid | 2930.9 | |
83-73-8 | Iodoquinol | 5,7-diiodoquinolin-8-ol | 2933.49 | |
83763-48-8 | 2-Amino-4-hydroxyethylaminoanisole sulfate | 2-(3-amino-4-methoxyanilino)ethanol sulfuric acid | 2922.5 | |
83-86-3 | Phytic acid | (1R,2S,3r,4R,5S,6s)-cyclohexane-1,2,3,4,5,6-hexayl hexakis[dihydrogen (phosphate)] | 2919.9 | |
83881-52-1 | Cetirizine hydrochloride | 2-[2-[4-[(4-chlorophenyl)-phenylmethyl]piperazin-1-yl]ethoxy]acetic acid dihydrochloride | 2933.59 | 6 |
83-88-5 | Riboflavin | 7,8-dimethyl-10-[(2S,3S,4R)-2,3,4,5-tetrahydroxypentyl]benzo[g]pteridine-2,4-dione | 2936.23 | 6 |
83897-84-1 | Calcined dolomite | Calcium magnesium dicarbonate | 2518.2 | |
83898-65-1 | Domperidone maleate | (Z)-but-2-enedioic acid 6-chloro-3-[1-[3-(2-oxo-3H-benzimidazol-1-yl)propyl]piperidin-4-yl]-1H-benzimidazol-2-one | 2933.39 | 6 |
83905-01-5 | Azithromycin | (2R,3S,4R,5R,8R,10R,11R,12S,13S,14R)-11-[(2S,3R,4S,6R)-4-(dimethylamino)-3-hydroxy-6-methyloxan-2-yl]oxy-2-ethyl-3,4,10-trihydroxy-13-[(2R,4R,5S,6S)-5-hydroxy-4-methoxy-4,6-dimethyloxan-2-yl]oxy-3,5,6,8,10,12,14-heptamethyl-1-oxa-6-azacyclopentadecan-15-o | 2941.5 | 6 |
83915-83-7 | Lisinopril | (2S)-1-[(2S)-6-amino-2-[[(1S)-1-carboxy-3-phenylpropyl]amino]hexanoyl]pyrrolidine-2-carboxylic acid dihydrate | 2933.99 | 6 |
83919-23-7 | Mometasone furoate | [(8S,9R,10S,11S,13S,14S,16R,17R)-9-chloro-17-(2-chloroacetyl)-11-hydroxy-10,13,16-trimethyl-3-oxo-6,7,8,11,12,14,15,16-octahydrocyclopenta[a]phenanthren-17-yl] furan-2-carboxylate | 2941.1 | 6 |
83926-73-2 | 4-cyclohexyl-2-methyl-2-butanol | 4-cyclohexyl-2-methylbutan-2-ol | 2906.19 | |
83949-75-1 | Basic yellow 51 | 3204.13 | ||
83950-69-0 | Potassium Hydrolyzed Polygamma-Glutamate | 2922.42 | ||
839-90-7 | Tris(2-hydroxyethyl) isocyanurate | 1,3,5-tris(2-hydroxyethyl)-1,3,5-triazinane-2,4,6-trione | 2933.69 | |
84012-14-6 | Artichoke, ext. | 2930.9 | ||
84012-21-5 | Hazelnut absolute | 3302.1 | ||
84012-39-5 | Styrax tonkinensis | 3301.29 | ||
84-02-6 | Prochlorperazine maleate | (Z)-but-2-enedioic acid 2-chloro-10-[3-(4-methylpiperazin-1-yl)propyl]phenothiazine | 2934.3 | 6 |
84030-86-4 | Allethrin | 2-methyl-4-oxo-3-(prop-2-en-1-yl)cyclopent-2-en-1-yl 2,2-dimethyl-3-(2-methylprop-1-en-1-yl)cyclopropane-1-carboxylate | 2916.2 | |
84057-80-7 | Zirconium propionate | Propanoate zirconium (4+) | 2915.5 | |
84057-84-1 | Lamotrigine | 6-(2,3-dichlorophenyl)-1,2,4-triazine-3,5-diamine | 2933.69 | 6 |
84082-34-8 | Blueberry extract | 3302.1 | ||
84082-51-9 | Glycoproteins, bovine-whey | 3504 | ||
84082-60-0 | Chamomilla Recutita (Matricaria) Flower Extract | 3302.9 | ||
84082-64-4 | Gastric mucin | 3504 | ||
84082-80-4 | St. John's wort essential oil | 3301.19 | ||
84082-82-6 | Willow, Salix alba, ext. | 3824.9 | ||
84087-01-4 | Quinclorac | 3,7-dichloroquinoline-8-carboxylic acid | 2933.49 | 8 |
84-11-7 | 9,10-Phenanthrenequinone | Phenanthrene-9,10-dione | 2914.69 | |
84133-50-6 | Alcohols, C12-14-secondary, ethoxylated | |||
84145-95-9 | Disodium [2-hydroxy-3-[(2-hydroxy-1-naphthyl)azo]-5-nitrobenzene-1-sulphonato(3-)][1-[(2-hydroxy-4-nitrophenyl)azo]-2-naphtholato(2-)]chromate(2-) | 3204.12 | ||
84-15-1 | o-Terphenyl | 1,2-Diphenylbenzene | 2902.9 | |
84170-74-1 | Propoxylated neopentyl glycol diacrylate | Propoxylated neopentyl glycol diacrylate | ||
842-07-9 | Sudan I ; Solvent yellow 14 | 1-(phenylazo)naphthalen-2-ol | 3212.9 | |
84238-39-1 | Patchouli essential oil | 3824.9 | ||
84309-23-9 | L-Ascorbyl-2-phosphate, magnesium salt | Magnesium [2-(1,2-dihydroxyethyl)-3-hydroxy-5-oxo-2H-furan-4-yl] phosphate | 2936.27 | |
843663-66-1 | Bedaquiline | (1R,2S)-1-(6-bromo-2-methoxyquinolin-3-yl)-4-(dimethylamino)-2-naphthalen-1-yl-1-phenylbutan-2-ol | 2922.19 | 6 |
84366-81-4 | Flavin adenine dinucleotide disodium | Disodium [[(2R,3S,4R,5R)-5-(6-aminopurin-9-yl)-3,4-dihydroxyoxolan-2-yl]methoxy-oxidophosphoryl] [(2R,3S,4S)-5-(7,8-dimethyl-2,4-dioxobenzo[g]pteridin-10-yl)-2,3,4-trihydroxypentyl] phosphate | 2934.99 | |
84380-01-8 | alpha-Arbutin | (2R,3S,4S,5R,6R)-2-(hydroxymethyl)-6-(4-hydroxyphenoxy)oxane-3,4,5-triol | 2938.9 | |
84434-11-7 | Ethyl phenyl(2,4,6-trimethylbenzoyl)phosphinate | [Ethoxy(phenyl)phosphoryl]-(2,4,6-trimethylphenyl)methanone | 2914.5 | |
845-10-3 | Methyl Red sodium salt | Sodium 2-[[4-(dimethylamino)phenyl]diazenyl]benzoate | 2927 | |
84-51-5 | 2-Ethylanthraquinone | 2-Ethylanthracene-9,10-dione | 2914.69 | |
84539-55-9 | Acetic acid, oxo-, sodium salt, reaction products with ethylenediamine and phenol, Iron sodium salts | 3105.9 | 4 | |
84540-47-6 | 2,6-Dihydroxy-3,4-dimethylpyridine | 6-Hydroxy-4,5-dimethyl-1H-pyridin-2-one | 2933.39 | |
84540-50-1 | 5-Amino-6-chloro-o-cresol | 3-amino-2-chloro-6-methylphenol | 2922.5 | |
845674-84-2 | 4-[5-(4-bromophenyl)-3-(trifluoromethyl)pyrazol-1-yl]benzenesulfonamide | 4-[5-(4-bromophenyl)-3-(trifluoromethyl)pyrazol-1-yl]benzenesulfonamide | 2934.99 | |
84-57-1 | Dichlorsulfofenyl-methylpyrazolon | 2,5-dichloro-4-(3-methyl-5-oxo-4H-pyrazol-1-yl)benzenesulfonic acid | 2933.39 | |
84-58-2 | 2,3-Dichloro-5,6-dicyanobenzoquinone | 4,5-dichloro-3,6-dioxocyclohexa-1,4-diene-1,2-dicarbonitrile | 2926.9 | |
845885-86-1 | Pyridine-3-boronic acid neopentylglycol ester | 3-(5,5-dimethyl-1,3,2-dioxaborinan-2-yl)pyridine | 2934.99 | |
84604-10-4 | Quassia amara extract | 3302.1 | ||
84604-12-6 | Rose essential oil | 3302.9 | ||
84604-96-6 | Zinc diisononyldithiocarbamate | Zinc N,N-bis(3,5,5-trimethylhexyl)carbamodithioate | ||
84605-20-9 | (2-aminoethyl)[2-({2-[(2-aminoethyl)amino]ethyl}amino)ethyl]amine | (2-aminoethyl)[2-({2-[(2-aminoethyl)amino]ethyl}amino)ethyl]amine | 2925.19 | |
84625-29-6 | Green Pepper oil ; Capsicum annum | |||
84625-38-7 | Fatty acids, sunflower-oil | 3823.19 | ||
84625-61-6 | Itraconazole | 2-butan-2-yl-4-[4-[4-[4-[[2-(2,4-dichlorophenyl)-2-(1,2,4-triazol-1-ylmethyl)-1,3-dioxolan-4-yl]methoxy]phenyl]piperazin-1-yl]phenyl]-1,2,4-triazol-3-one | 2934.99 | 6 |
84-62-8 | Diphenyl phthalate | Diphenyl benzene-1,2-dicarboxylate | 2917.34 | |
84632-59-7 | Pigment orange 73 | 3,6-bis(4-tert-butylphenyl)-2,5-dihydropyrrolo[3,4-c]pyrrole-1,4-dione | 3204.17 | |
84632-65-5 | Pigment red 254 | 3,6-bis(4-chlorophenyl)-2,5-dihydropyrrolo[3,4-c]pyrrole-1,4-dione | 3208.2 | |
84643-53-8 | Hydroxycetyl Hydroxyethyl Dimonium Chloride | 3402.12 | ||
846-49-1 | Lorazepam | 7-chloro-5-(2-chlorophenyl)-3-hydroxy-1,3-dihydro-1,4-benzodiazepin-2-one | 2933.91 | 9 |
84649-99-0 | Cocoa extract | 3302.1 | ||
84650-00-0 | Coffee extract | 3302.9 | ||
84650-12-4 | Ginseng, Panax pseudoginseng, ext. | 2938.9 | ||
84650-15-7 | Leek oil | 3302.1 | ||
846-50-4 | Temazepam | 7-chloro-1,3-dihydro-3-hydroxy-1-methyl-5-phenyl-2H-1,4- benzodiazepin-2-one | 2933.91 | 9 |
84650-60-2 | Green tea extract powder | 3302.1 | ||
84-65-1 | Anthraquinone | Anthracene-9,10-dione | 2914.61 | 8 |
84-66-2 | Diethyl phthalate | Diethyl benzene-1,2-dicarboxylate | 2917.34 | 8 |
846-70-8 | Acid yellow 1 ; C.I. 10316 | Disodium 5,7-dinitro-8-oxidonaphthalene-2-sulfonate | 3204.12 | |
84-67-3 | M-Tolidine | 4-(4-amino-2-methylphenyl)-3-methylaniline | 2921.43 | |
84695-96-5 | Ammi visnaga extract | 3301.19 | ||
84696-15-1 | Zingiber Cassumunar Root Oil | 3301.9 | ||
84696-19-5 | Hamamelis virginiana extract | 3302.9 | ||
84-71-9 | Bis(2-ethylhexyl) cyclohexane-1,2-dicarboxylate | Bis(2-ethylhexyl) cyclohexane-1,2-dicarboxylate | 2917.2 | |
84-74-2 | Dibutyl phthalate | Dibutyl benzene-1,2-dicarboxylate | 2917.34 | 8 |
84775-39-3 | Acorus calamus extract | 3301.29 | ||
84775-50-8 | Coriander extract | 3302.9 | ||
84775-62-2 | Horseradish extract | 3301.29 | ||
84775-78-0 | Ascophyllum nodosum extract | 3104.9 | 4 | |
84775-80-4 | Lemon myrtle oil | 3301.9 | ||
84775-81-5 | Piper betle L. (Piperaceae) oil | 3301.29 | ||
84776-23-8 | Marigold Essential Oil | 3301.29 | ||
84787-70-2 | Sandalwood oil from Santalum album L. | 3302.9 | ||
84-80-0 | Phytonadione | 2-methyl-3-[(E,7R,11R)-3,7,11,15-tetramethylhexadec-2-enyl]naphthalene-1,4-dione | 2936.29 | |
848301-69-9 | C18-C50 branched, cyclic and linear hydrocarbons – Distillates | 2710.19 | ||
84842-86-4 | Acid orange 7 | 3204.12 | ||
84852-15-3 | 4-Nonylphenol | 4-Nonylphenol | 2907.13 | |
84852-53-9 | Decabromodiphenyl ethane | 1,2-Bis(pentabromophenyl) ethane | 2903.99 | |
84861-79-0 | Potassium cetyl phosphate | 3402.11 | ||
84870-65-5 | Disperse blue 366 | 3204.11 | ||
84-87-7 | 4-Hydroxynaphthalene-1-sulphonic acid | 4-hydroxynaphthalene-1-sulfonic acid | 2922.21 | |
84878-33-1 | Cetearyl isononanoate | Hexadecyl 7-methyloctanoate | ||
849061-97-8 | Quercetin hydrate | 2-(3,4-dihydroxyphenyl)-3,5,7-trihydroxychromen-4-one hydrate | 2932.99 | |
84929-27-1 | Grape seed extract ; Natural astaxanthin | |||
84929-28-2 | Guarana | 3302.1 | ||
84929-41-9 | Black pepper oleoresin | 3302.1 | ||
84929-61-3 | Carrot extract | 3203 | ||
84929-62-4 | Castor oil, acetylated | 2916.19 | ||
84929-76-0 | Raspberry extract | 3301.29 | ||
84931-03-3 | Disperse blue 257 | 3204.11 | ||
84961-46-6 | Cinnamomum cassia extract | 3302.9 | ||
84961-50-2 | Clove bud oleoresin | 3302.1 | ||
84961-57-9 | Pomegranate extract | 3302.1 | ||
84961-58-0 | Cotton lavender oil | 3301.19 | ||
84961-62-6 | Tamarind extract | 3302.9 | ||
85029-63-6 | Fatty acids, coco, esters with 3,3'-oxybis[1,2-propanediol] | 3824.9 | ||
85085-29-6 | Cedarwood essential oil | 3302.9 | ||
85085-41-2 | Juniperus virginiana extract | 3302.1 | ||
85085-43-4 | Lemon scented tea tree oil | 3301.13 | ||
85085-46-7 | Lycium barbarum extract | 3824.9 | ||
85085-51-4 | Nelumbo nucifera extract | 3302.9 | ||
85095-61-0 | Bis[4-[3-(dimethylamino)ureido]phenyl]methane | 1-(dimethylamino)-3-[4-[[4-(dimethylaminocarbamoylamino)phenyl]methyl]phenyl]urea | 2933.99 | |
85100-77-2 | 1-Butyl-3-methylimidazolium bromide | 1-butyl-3-methylimidazol-3-ium bromide | 2933.29 | |
85116-80-9 | Cetearyl olivate | 3402.9 | ||
85186-71-6 | Driselase | 3507.9 | ||
85-18-7 | Chlortheophylline | 8-chloro-1,3-dimethyl-7H-purine-2,6-dione | 2933.79 | |
85187-10-6 | Sphingomyelin | 2923.2 | ||
85187-33-3 | Reactive red 84 | 3204.16 | ||
85203-81-2 | Hexanoic acid, 2-ethyl-, zinc salt, basic | 3812.3 | ||
85209-91-2 | Sodium 2,2'-methylene-bis-(4,6-di-tert-butylphenyl)phosphate | Sodium 1,3,7,9-tetratert-butyl-11-oxido-5H-benzo[d][1,3,2]benzodioxaphosphocine 11-oxide | 2919.9 | |
85251-77-0 | Glycerides, C16-18 mono- and di- | (2R)-2,3-dihydroxypropyl octadecanoate 2,3-dihydroxypropyl hexadecanoate 2-hydroxy-3-(octadecanoyloxy)propyl octadecanoate 3-(hexadecanoyloxy)-2-hydroxypropyl octadecanoate | 2915.7 | |
85-27-8 | Phenylethyl resorcinol | 4-(1-phenylethyl)benzene-1,3-diol | 2907.29 | |
85338-42-7 | Sulfuric acid, mono-C8-10-alkyl esters, sodium salts | 3402.11 | ||
853645-22-4 | Pyridoxal phosphate | (4-formyl-5-hydroxy-6-methylpyridin-3-yl)methyl dihydrogen phosphate | 2936.25 | |
85404-83-7 | 2-Octyl decanoic acid/2-hexyldodecanoic acid | 2915.7 | ||
85408-49-7 | Amines, C12-16-alkyldimethyl, N-oxides | 3402.19 | ||
85409-09-2 | Glycerides, C8-10 | Decanoic acid octanoic acid propane-1,2,3-triol | 2915.9 | |
85409-22-9 | Quaternary ammonium compounds, benzyl-C12-14-alkyldimethyl, chlorides | 3402.12 | ||
85409-23-0 | C12-14-Alkyldimethyl(ethylbenzyl)ammonium chloride | 3402.11 | ||
85-41-6 | Phthalimide | Phthalimide | 3809.91 | |
85-42-7 | Hexahydrophthalic anhydride | 3a,4,5,6,7,7a-hexahydro-2-benzofuran-1,3-dione | 2917.2 | 3 |
85-43-8 | Tetrahydrophthalic anhydride | 3a,4,7,7a-tetrahydro-2-benzofuran-1,3-dione | 2917.39 | 3 |
85-44-9 | Phthalic anhydride | Phthalic anhydride | 2917.35 | 3 |
854812-04-7 | J Acid Urea | 4-hydroxy-7-[(5-hydroxy-7-sulfonaphthalen-2-yl)carbamoylamino]naphthalene-2-sulfonic acid | 2924.29 | |
85507-69-3 | Aloe Vera Extract | 3302.9 | ||
85508-38-9 | Ricinoleamidopropyltrimonium Methosulfate | 3402.12 | ||
85509-19-9 | Flusilazole | 1-{[bis(4-fluorophenyl)(methyl)silyl]methyl}-1H-1,2,4-triazole | 2933.99 | 8 |
85535-85-9 | Chlorinated paraffins, C14-17 ; Medium chained chlorinated paraffins (MCCP) | 3824.99 | ||
85536-03-4 | Copper sodium chlorophyllin | 3203 | ||
85536-06-7 | Glycerides, C8-18 | 3823.19 | ||
85536-14-7 | Benzenesulfonic acid, 4-C10-13-sec-alkyl derivs. | 3402.11 | ||
85566-12-7 | Alcohols, C8-10 | 3823.7 | ||
85566-29-6 | Fatty acids, coco, triesters with trimethylolpropane | 2905.41 | ||
85586-07-8 | Sulfuric acid, mono-C12-14-alkyl esters, sodium salts | 3402.11 | ||
85594-37-2 | Grape Seed Oil | 3301.12 | ||
85601-30-5 | Methane Sulfuric Acid | Methane Sulfuric Acid | 2904.1 | |
85-60-9 | Santowhite ; Phenol, 4,4'-butylidenebis[2-(1,1-dimethylethyl)-5-methyl- | 2-tert-butyl-4-[1-(5-tert-butyl-4-hydroxy-2-methylphenyl)butyl]-5-methylphenol | ||
85632-63-9 | Amines, N-(3-aminopropyl)-N-tallow alkyltrimethylenedi- | 3402.12 | ||
85650-52-8 | Mirtazapine | 2-methyl-1,2,3,4,10,14b-hexahydrobenzo[c]pyrazino[1,2-a]pyrido[3,2-f]azepine | 2930.2 | 6 |
85666-92-8 | Glyceryl stearate | 1,3-Dihydroxy-2-propanyl stearate  | 3402.13 | |
856676-23-8 | Choline Fenofibrate | 2-[4-(4-chlorobenzoyl)phenoxy]-2-methylpropanoate 2-hydroxyethyl(trimethyl)azanium | 2916.39 | |
85-68-7 | Benzyl butyl phthalate | 2-O-benzyl 1-O-butyl benzene-1,2-dicarboxylate | 2917.34 | |
856925-71-8 | Blebbistatin | (3aS)-3a-hydroxy-6-methyl-1-phenyl-2,3-dihydropyrrolo[2,3-b]quinolin-4-one | 2933.79 | 6 |
85711-58-6 | Lecithins, hydrolyzed | 2923.2 | ||
85715-60-2 | Edetate Trisodium Monohydrate | Trisodium 2-[2-[bis(carboxylatomethyl)amino]ethyl-(carboxymethyl)amino]acetate hydrate | 2922.5 | |
85721-33-1 | Ciprofloxacin | 1-cyclopropyl-6-fluoro-4-oxo-7-piperazin-1-ylquinoline-3-carboxylic acid | 2933.59 | |
85-73-4 | Phthalylsulfathiazole | 2-[[4-(1,3-thiazol-2-ylsulfamoyl)phenyl]carbamoyl]benzoic acid | 2935 | |
857367-60-3 | Magnesium bis(hexamethyldisilazide) | Magnesium bis(trimethylsilyl)azanide | 2931.9 | |
85-83-6 | Solvent red 24 | 1-[{2-methyl-4-[(2-methylphenyl)azo]phenyl}azo]naphthalen-2-ol | 3204.9 | |
85-85-8 | 1-(2-Pyridylazo)-2-naphthol | (1Z)-1-(pyridin-2-ylhydrazinylidene)naphthalen-2-one | 2933.39 | |
85-86-9 | Solvent red 23 | 1-{[4-(phenylazo)phenyl]azo}naphthalen-2-ol | 3212.9 | |
85874-44-8 | Cerium nitrate | Cerium(3+);trinitrate | 2846.1 | |
85877-79-8 | Nonafluorotrimethoxysilane | Trimethoxy(3,3,4,4,5,5,6,6,6-nonafluorohexyl)silane | 2916.14 | |
85895-78-9 | Potassium L-lactate | Potassium (2S)-2-hydroxypropanoate | 2918.11 | |
85-91-6 | Dimethyl Anthranilate | Methyl 2-(methylamino)benzoate | 2922.49 | |
859-18-7 | Lincomycin Hydrochloride | (2S,4R)-N-[(1R,2R)-2-hydroxy-1-[(2R,3R,4S,5R,6R)-3,4,5-trihydroxy-6-methylsulfanyloxan-2-yl]propyl]-1-methyl-4-propylpyrrolidine-2-carboxamide;hydrochloride | 2941.9 | 6 |
860-22-0 | Indigo carmine ; Acid blue 74 | Disodium 3,3'-dioxo-2,2'-biindolylidene-5,5'-disulfonate | 3203 | |
86088-83-7 | Fibronectin | 3502.9 | ||
861390-34-3 | N-[1,5-bis(butylamino)pentan-2-yl]-2-ethylhexanamide | N-[1,5-bis(butylamino)pentan-2-yl]-2-ethylhexanamide | 2924.19 | |
86221-07-0 | Quaternium-33 | 3402.9 | ||
86-25-9 | N-octyl-N-phenylaniline | 3812.3 | ||
86261-90-7 | Ureidomethacrylate | 3824.9 | ||
86-28-2 | 9-Ethylcarbazole | 9-Ethylcarbazole | 2921.59 | 2 |
86290-81-5 | Gasoline, low boiling point naphtha | 2710.12 | ||
863031-24-7 | Azilsartan medoxomil potassium | Potassium (5-methyl-2-oxo-1,3-dioxol-4-yl)methyl 2-ethoxy-3-[[4-[2-(5-oxo-1-oxa-4-aza-2-azanidacyclopent-3-en-3-yl)phenyl]phenyl]methyl]benzimidazole-4-carboxylate | 2934.99 | 6 |
86-30-6 | N-Nitrosodiphenylamine | N,N-diphenylnitrous amide | 2921.44 | |
86386-73-4 | Fluconazole | 2-(2,4-difluorophenyl)-1,3-bis(1,2,4-triazol-1-yl)propan-2-ol | 2933.99 | 6 |
86393-32-0 | Ciprofloxacin Hydrochloride | 1-cyclopropyl-6-fluoro-4-oxo-7-piperazin-1-ylquinoline-3-carboxylic acid;hydrate;hydrochloride | 2941.9 | |
86393-33-1 | Fluoroquinolonic Acid | 7-chloro-1-cyclopropyl-6-fluoro-4-oxoquinoline-3-carboxylic acid | 2933.49 | |
86403-32-9 | A mixture of: 2,2,6,6-Tetramethylpiperidin-4-yl-hexadecanoate; 2,2,6,6-Tetramethylpiperidin-4-yl-octadecanoate | 3812.3 | ||
86404-04-8 | 3-O-Ethyl ascorbic acid | (2R)-2-[(1S)-1,2-dihydroxyethyl]-3-ethoxy-4-hydroxy-2H-furan-5-one | ||
86437-47-0 | Direct blue 201 | 3204.14 | ||
86438-79-1 | Cocamidopropyl betaine | 3402.9 | ||
86-48-6 | 1-Hydroxy-2-naphthoic acid | 1-hydroxynaphthalene-2-carboxylic acid | 2918.29 | |
86508-42-1 | Perfluoro compounds, C5-18 | |||
86543-85-3 | Direct red 243 ; C.I. 29315 | 3204.14 | ||
865-44-1 | Iodine trichloride | Trichloro-$l^{3}-iodane | 2812.1 | |
865-47-4 | Potassium chromate | Potassium; 2-methylpropan-2-olate | 2841.5 | |
865-49-6 | Chloroform-d ; Deuterochloroform | Trichloro(deuterio)methane | ||
86-55-5 | 1-Naphthoic acid | Naphthalene-1-carboxylic acid | 2916.39 | |
86-56-6 | N,N-Dimethyl-1-naphthylamine | N,N-dimethylnaphthalen-1-amine | 2921.45 | |
866405-64-3 | Dorsomorphin | 6-[4-(2-piperidin-1-ylethoxy)phenyl]-3-pyridin-4-ylpyrazolo[1,5-a]pyrimidine | 2933.59 | |
86-66-8 | Naphthalene-1,3,6-trisulfonic acid | Naphthalene-1,3,6-trisulfonic acid | 2904.1 | |
866-84-2 | Potassium citrate | Tripotassium 2-hydroxypropane-1,2,3-tricarboxylate | 2918.15 | |
867-13-0 | Triethyl phosphonoacetate | Ethyl 2-diethoxyphosphorylacetate | 2931.9 | |
86-73-7 | Fluorene | 9H-fluorene | 2902.9 | |
86-74-8 | Carbazole | 9H-carbazole | 2933.99 | |
868-14-4 | Potassium bitartrate | Potassium 2,3,4-trihydroxy-4-oxobutanoate | 2918.13 | |
868-18-8 | Sodium Tartrate | Disodium 2,3-dihydroxybutanedioate | 2918.13 | |
868272-85-9 | 3,3-Diaminobenzidine tetrahydrochloride | 4-(3,4-diazaniumylphenyl)benzene-1,2-bis(aminium) hydrate tetrachloride | 2922.49 | |
86836-00-2 | Disperse blue 165:1 | 3204.11 | ||
86836-02-4 | Disperse yellow 211 | 3204.11 | ||
86846-21-1 | PEG-20 glyceryl triisostearate | 3402.13 | ||
86-87-3 | 1-naphthylacetic acid | 1-naphthylacetic acid | 2916.39 | 3 |
868738-44-7 | 2,5-Dimethoxy-4-(isopropylthio)phenethylamine hydrochloride | 2-(2,5-dimethoxy-4-propan-2-ylsulfanylphenyl)ethanamine hydrochloride | 2942 | |
868-77-9 | 2-Hydroxyethyl methacrylate | 2-hydroxyethyl 2-methylprop-2-enoate | 2916.14 | 3 |
868839-23-0 | Octanoic acid, 4-methyl-2-pentylbutyl ester | 3402.9 | ||
86893-19-8 | Ethoxylated methyl glucoside dioleate ; PEG 120 methyl glucose dioleate | Poly(oxy-1,2-ethanediyl), alpha-hydro-omega-hydroxy-, ether with methyl D-glucopyranoside 2,6-di-(9Z)-9-octadecenoate (2:1) | ||
86923-71-9 | Acid green 25 | 3204.12 | ||
86-93-1 | 1-Phenyltetrazole-5-thiol | 1-Phenyl-2H-tetrazole-5-thione | 2933.99 | |
86-95-3 | 4-Hydroxycarbostyril | 4-hydroxy-1H-quinolin-2-one | 2933.79 | |
870-08-6 | Di-n-octyltin oxide | Dioctyl(oxo)tin | 2825.9 | |
870196-80-8 | 4-Cyano-4-(dodecylsulfanylthiocarbonyl)sulfanylpentanoic acid | 4-cyano-4-dodecylsulfanylcarbothioylsulfanylpentanoic acid | 2930.9 | |
87-02-5 | 1-Hydroxy-6-amino-3-naphthalenesulfonic acid | 7-amino-4-hydroxynaphthalene-2-sulfonic acid | 2924.29 | |
87-03-6 | Rhoduline Acid | 4-hydroxy-7-[(5-hydroxy-7-sulfonaphthalen-2-yl)amino]naphthalene-2-sulfonic acid | 2922.29 | |
870-46-2 | Tert-Butyl carbazate | Tert-butyl N-aminocarbamate | 2928 | |
87061-04-9 | Menthoxypropanediol | 3-(5-methyl-2-propan-2-ylcyclohexyl)oxypropane-1,2-diol | 2906.19 | |
870-72-4 | Formaldehyde Sodium Bisulfite | Sodium hydroxymethanesulfonate | ||
871038-72-1 | Raltegravir Potassium | Potassium 4-[(4-fluorophenyl)methylcarbamoyl]-1-methyl-2-[2-[(5-methyl-1,3,4-oxadiazole-2-carbonyl)amino]propan-2-yl]-6-oxopyrimidin-5-olate | 2942 | |
871659-76-6 | Collagens type II | 3504 | ||
87189-25-1 | Reaction products of zinc oxide and glycerol | 3812.3 | ||
87-19-4 | Isobutyl Salicylate | 2-methylpropyl 2-hydroxybenzoate | 2918.23 | |
872-05-9 | 1-Decene | Dec-1-ene | 2901.29 | |
87-20-7 | Isoamyl Salicylate | 3-methylbutyl 2-hydroxybenzoate | 2918.23 | |
872182-46-2 | Bis-ethylhexyl hydroxydimethoxy benzylmalonate | Bis(2-ethylhexyl) 2-[(4-hydroxy-3,5-dimethoxyphenyl)methyl]propanedioate | 2918.99 | |
87244-72-2 | Siloxanes and Silicones, polyoxyalkylene- | 3402.13 | ||
872-50-4 | 1-methyl-2-pyrrolidone | 1-methyl-2-pyrrolidone | 3 | |
87-25-2 | Fragrance of ethyl anthranilate | Ethyl anthranilate | 3302.9 | |
872-53-7 | Cyclopentanecarbaldehyde | Cyclopentanecarbaldehyde | 2912.29 | |
872-55-9 | 2-Ethylthiophene | 2-ethylthiophene | 2934.99 | |
87-28-5 | Glycol Salicylate | 2-hydroxyethyl 2-hydroxybenzoate | 2918.21 | |
872-85-5 | Isonicotinaldehyde | Pyridine-4-carbaldehyde | 2912.29 | |
87-33-2 | Isosorbide Dinitrate | [(3S,3aS,6R,6aS)-3-nitrooxy-2,3,3a,5,6,6a-hexahydrofuro[3,2-b]furan-6-yl] nitrate | 2942 | |
873-74-5 | 4-Aminobenzonitrile | 3824.9 | ||
87392-12-9 | s-metolachlor | 2-chloro-N-(2-ethyl-6-methylphenyl)-N-[(1S)-2-methoxy-1-methylethyl]acetamide | 2924.29 | |
87-41-2 | Phthalide | 3H-2-benzofuran-1-one | 2932.2 | |
87413-09-0 | Triacetoxyperiodinane | 1,1-bis(acetyloxy)-3-oxo-3H-1λ⁵,2-benziodaoxol-1-yl acetate | 2934.99 | |
874195-61-6 | Triafamone | N-{2-[(4,6-dimethoxy-1,3,5-triazin-2-yl)carbonyl]-6-fluorophenyl}-1,1-difluoro-N-methylmethanesulfonamide | 2935.9 | |
87-42-3 | 6-Chloropurine | 6-chloro-7H-purine | 2933.59 | |
874-24-8 | 3-Hydroxypicolinic acid | 3-hydroxypyridine-2-carboxylic acid | 2933.39 | |
87-44-5 | Caryophyllene | 4,11,11-trimethyl-8-methylidenebicyclo[7.2.0]undec-4-ene | 2902.19 | |
874807-57-5 | Monascus red | 3203 | ||
87-51-4 | 3-Indoleacetic Acid | 3821 | 8 | |
875-59-2 | 4-Hydroxy-2-methylacetophenone | 1-(4-hydroxy-2-methylphenyl)ethanone | 2914.5 | |
87-59-2 | 2,3-Xylidine | 2,3-dimethylaniline | 2921.49 | |
87-60-5 | 3-Chloro-O-toluidine | 3-chloro-2-methylaniline | 2921.43 | |
87-62-7 | 2,6-Xylidine | 2,6-dimethylaniline | 2921.49 | |
87-65-0 | 2,6-Dichlorophenol | 2,6-Dichlorophenol | 2908.19 | |
87-66-1 | Pyrogallol | pyrogallol | 2907.29 | 3 |
87-67-2 | Choline Bitartrate | 2-hydroxyethyl(trimethyl)azanium 2,3,4-trihydroxy-4-oxobutanoate | 2923.1 | |
87687-02-3 | Benzyloxyresorufin | 7-Phenylmethoxyphenoxazin-3-one | 2934.99 | |
87-69-4 | Tartaric Acid | (2R,3R)-2,3-dihydroxybutanedioic acid | 2918.12 | |
877-24-7 | Potassium Biphthalate | Potassium 2-carboxybenzoate | 2917.39 | |
87-72-9 | L-Arabipyranose | (3R,4S,5S)-oxane-2,3,4,5-tetrol | 3821 | |
87749-50-6 | Tetrabutylammonium Fluoride Trihydrate | Tetrabutylazanium fluoride trihydrate | 2923.9 | |
87771-40-2 | Ioversol | 1-N,3-N-bis(2,3-dihydroxypropyl)-5-[(2-hydroxyacetyl)-(2-hydroxyethyl)amino]-2,4,6-triiodobenzene-1,3-dicarboxamide | 2942 | |
87787-67-5 | 2-[2-(Tert-butylamino)ethoxy]ethanol | 2-[2-(tert-butylamino)ethoxy]ethanol | 2922.19 | |
87-79-6 | Sorbose | (3S,4R,5S)-1,3,4,5,6-pentahydroxyhexan-2-one | 2940 | |
87-81-0 | Tagatose | (3S,4S,5R)-1,3,4,5,6-pentahydroxyhexan-2-one | 2940 | |
87-83-2 | Pentabromotoluene | 1,2,3,4,5-pentabromo-6-methylbenzene | 2917.19 | |
87-85-4 | Hexamethylbenzene | 1,2,3,4,5,6-hexamethylbenzene | 2902.9 | |
87-86-5 | Pentachlorophenol | 2,3,4,5,6-pentachlorophenol | 2908.11 | |
87-89-8 | Inositol | Cyclohexane-1,2,3,4,5,6-hexol | 2906.13 | 6 |
87-90-1 | Symclosene | 1,3,5-trichloro-1,3,5-triazinane-2,4,6-trione | 2933.69 | 3 |
87947-13-5 | Cobalt octoate | 3211 | ||
879643-71-7 | Formamidinium iodide | Methanimidamide;hydroiodide | ||
87-99-0 | Xylitol | (2S,4R)-pentane-1,2,3,4,5-pentol | 2905.49 | |
88-04-0 | Chloroxylenol | 4-chloro-3,5-dimethylphenol | 2908.19 | 6 |
88-06-2 | 2,4,6-Trichlorophenol | 2,4,6-Trichlorophenol | 2908.19 | 3 |
880649-77-4 | yttrium-90 | Yttrium-90(3+) | 2844.4 | 5 |
881005-91-0 | 4-Methylumbelliferyl beta-D-glucuronide hydrate | (2S,3S,4S,5R,6S)-3,4,5-trihydroxy-6-(4-methyl-2-oxochromen-7-yl)oxyoxane-2-carboxylic acid hydrate | 2932.2 | |
88-12-0 | N-Vinyl-2-Pyrrolidone | 1-ethenylpyrrolidin-2-one | 2933.79 | |
88122-99-0 | Ethylhexyl Triazone | 2-ethylhexyl 4-[[4,6-bis[4-(2-ethylhexoxycarbonyl)anilino]-1,3,5-triazin-2-yl]amino]benzoate | 2933.69 | |
88-14-2 | 2-Furoic acid | Furan-2-carboxylic acid | 2932.19 | |
88150-42-9 | Amlodipine | 3-O-ethyl 5-O-methyl 2-(2-aminoethoxymethyl)-4-(2-chlorophenyl)-6-methyl-1,4-dihydropyridine-3,5-dicarboxylate | 2942 | 6 |
88-15-3 | 2-Acetylthiophene | 1-Thiophen-2-ylethanone | 2934.99 | |
88161-12-0 | Cumene peroxide  | 2-Phenyl-2-propanyl hydroperoxide  | 2909.6 | |
88189-03-1 | Bismuth trifluoromethanesulfonate | Bismuth trifluoromethanesulfonate | 2904.9 | |
882-06-4 | 4-Nitrocinnamic acid | (2E)-3-(4-nitrophenyl)prop-2-enoic acid | 2916.39 | |
882073-43-0 | Bis (4-propylbenzylidene) propylsorbitol | 1-[8-propyl-2,6-bis(4-propylphenyl)-4,4a,8,8a-tetrahydro-[1,3]dioxino[5,4-d][1,3]dioxin-4-yl]ethane-1,2-diol | 2932.99 | |
88-21-1 | Orthanilic Acid | 2-Aminobenzenesulfonic acid | 2921.42 | |
88230-35-7 | Fragrance of hexyl acetate | Hexyl acetate | 3302.1 | |
88232-20-6 | Reactive red 111 | 3204.16 | ||
882-33-7 | Diphenyl Disulfide | (Phenyldisulfanyl)benzene | 2930.9 | |
88-24-4 | 2,2'-Methylenebis(4-ethyl-6-tert-butylphenol) | 2-tert-butyl-6-[(3-tert-butyl-5-ethyl-2-hydroxyphenyl)methyl]-4-ethylphenol | 2907.29 | |
88264-80-6 | Acid blue 324 | 3204.12 | ||
88-27-7 | 2,6-di-tert-Butyl-4-(dimethylaminomethyl)phenol | 2,6-ditert-butyl-4-[(dimethylamino)methyl]phenol | 2922.29 | |
88284-48-4 | 2-(Trimethylsilyl)phenyl trifluoromethanesulfonate | (2-trimethylsilylphenyl) trifluoromethanesulfonate | 2931.9 | |
88-41-5 | 2-Tert-Butylcyclohexyl acetate | (2-tert-butylcyclohexyl) acetate | 2915.39 | |
884324-74-7 | Dicnate NBC II | 2942 | ||
88-44-8 | 2-Amino-5-methylbenzenesulfonic acid | 2-amino-5-methylbenzenesulfonic acid | 2921.43 | |
88475-69-8 | Beraprost Sodium | Sodium 4-[2-hydroxy-1-[(E)-3-hydroxy-4-methyloct-1-en-6-ynyl]-2,3,3a,8b-tetrahydro-1H-cyclopenta[b][1]benzofuran-5-yl]butanoate | 2937.5 | |
88-50-6 | 2,5-Dichlorosulfanilic acid | 4-amino-2,5-dichlorobenzenesulfonic acid | 2921.42 | |
88507-00-0 | Oxirane,decyl-,polymer with oxirane,monomethyl ether | 3402.13 | ||
88511-27-7 | 4-Amino-3-iodopyridine | 3-Iodopyridin-4-amine | 2933.39 | |
88-58-4 | 2,5-Di-tert-butylhydroquinone | 2,5-ditert-butylbenzene-1,4-diol | 2907.29 | |
88-63-1 | 2,4-Diaminobenzenesulfonic acid | 2,4-Diaminobenzenesulfonic acid | 2921.51 | |
886-38-4 | Diphencyprone | 2,3-Diphenylcycloprop-2-en-1-one | 2914.39 | |
886-50-0 | Terbutryn | 2-N-tert-butyl-4-N-ethyl-6-methylsulfanyl-1,3,5-triazine-2,4-diamine | 2933.69 | |
88650-54-8 | Polyester adipate ; Adipate oligomer | 3812.2 | ||
88-65-3 | 2-Bromobenzoic acid | 2-Bromobenzoic acid | 2916.39 | |
88671-89-0 | Myclobutanil | 2-(4-chlorophenyl)-2-(1H-1,2,4-triazol-1-ylmethyl)hexanenitrile | 2933.99 | 8 |
88-67-5 | O-Iodobenzoic acid | 2-Iodobenzoic acid | 2916.39 | |
88738-78-7 | Methyl Bis(2,2,2-trifluoroethyl)phosphonoacetate | Methyl 2-[bis(2,2,2-trifluoroethoxy)phosphoryl]acetate | 2932.99 | |
88-75-5 | O-Nitrophenol | 2-Nitrophenol | 2908.99 | |
887-76-3 | 1-Diazo-2-naphthol-4-sulfonic Acid | 1-Diazo-2-naphthol-4-sulfonic Acid | 2927 | |
88793-79-7 | N-(p-nitrophenyl)-N-(p-tolylsulphonyl)glycyl-L-prolyl-L-lysinamide, monoacetate | 3402.19 | ||
888888-02-9 | Liquitint red | 3204.17 | ||
88-89-1 | Picric acid | 2,4,6-trinitrophenol | 2908.99 | |
88895-93-6 | Fatty acids, C18-unsatd. | 3823.12 | ||
88917-22-0 | Dipropylene glycol monomethyl ether acetate | 2915.39 | ||
88949-33-1 | Pigment red 264 | 3,6-di(biphenyl-4-yl)-2,5-dihydropyrrolo[3,4-c]pyrrole-1,4-dione | 3204.17 | |
88-99-3 | Phthalic acid | 2917.39 | ||
89030-95-5 | Copper tripeptide-1 | [N2-(N-Glycyl-L-histidyl)-L-lysinato(2-)]copper | 3504 | |
89-04-3 | Trioctyl trimellitate | Trioctyl benzene-1,2,4-tricarboxylate | 2917.39 | |
89073-21-2 | Retingan R7 | Retingan R 7 | 3202.9 | |
89-08-7 | 4-Sulfophthalic acid | 4-Sulfophthalic acid | 2917.39 | |
89106-94-5 | Solvent red 179 | 3204.19 | ||
89157-03-9 | Reactive red 239 | 3204.16 | ||
89226-75-5 | Manidipine hydrochloride | 5-O-[2-(4-benzhydrylpiperazin-1-yl)ethyl] 3-O-methyl 2,6-dimethyl-4-(3-nitrophenyl)-1,4-dihydropyridine-3,5-dicarboxylate dihydrochloride | 2933.59 | 6 |
89-25-8 | Edaravone | 5-methyl-2-phenyl-4H-pyrazol-3-one | 2933.19 | 6 |
89-32-7 | Pyromellitic Dianhydride | Furo[3,4-f][2]benzofuran-1,3,5,7-tetrone | 2917.39 | 3 |
89331-94-2 | 2-Anilino-3-methyl-6-(dibutylamino)fluoran | 2'-anilino-6'-(dibutylamino)-3'-methylspiro[2-benzofuran-3,9'-xanthene]-1-one | 2922.5 | |
89343-06-6 | (Triisopropylsilyl)acetylene | Ethynyl-tri(propan-2-yl)silane | 2931.9 | |
89347-09-1 | 2,5-Bis(tert-nonyldithio)-1,3,4-thiadiazole | 2,5-bis(2-methyloctan-2-yldisulfanyl)-1,3,4-thiadiazole | 2934.99 | |
89-36-1 | 3-Methyl-1-(4-sulfophenyl)-2-pyrazolin-5-one | 4-(3-methyl-5-oxo-4H-pyrazol-1-yl)benzenesulfonic acid | 2933.19 | |
894-71-3 | Nortriptyline hydrochloride | 3-(5,6-dihydrodibenzo[2,1-b:2',1'-f][7]annulen-11-ylidene)-N-methylpropan-1-amine hydrochloride | 2921.49 | 6 |
89-48-5 | Menthyl acetate | (5-methyl-2-propan-2-ylcyclohexyl) acetate | 2915.39 | |
894-86-0 | Reduced vat blue 1 | 3204.15 | ||
89-57-6 | Mesalamine | 5-amino-2-hydroxybenzoic acid | 2922.5 | |
89-65-6 | Erythorbic Acid | (2R)-2-[(1R)-1,2-dihydroxyethyl]-3,4-dihydroxy-2H-furan-5-one | ||
89686-69-1 | 2,2-Di(tetrahydrofuryl)propane | 2-[2-(oxolan-2-yl)propan-2-yl]oxolane | 2932.99 | |
89749-77-9 | Bentone SD 1 | 3802.9 | ||
89-78-1 | Menthol ; Racementhol ; Fragrance of L-(-)-Menthol | rel-(1R,2S,5R)-5-methyl-2-(propan-2-yl)cyclohexanol | 2906.11 | |
89-79-2 | Isopulegol | (1R,2S,5R)-5-methyl-2-prop-1-en-2-ylcyclohexan-1-ol | 2906.19 | |
89797-01-3 | Reactive blue 216 | Trisodium hydrogen [3-carboxy-1-(4-{[3-{[{[2-(carboxy-κO)-5-sulfonatophenyl]azo-κN2}(phenyl)methyl]azo-κN1}-2-(hydroxy-κO)-5-sulfonatophenyl]amino}-6-[(2-chloro-5-sulfonatophenyl)amino]-1,3,5-triazin-2-yl)pyridiniumato(7-)]cuprate(4-) | 3204.16 | |
89797-02-4 | Reactive yellow 163 | 3204.16 | ||
89-82-7 | 2-isopropylidene-5-methylcyclohexanone | 5-methyl-2-(propan-2-ylidene)cyclohexan-1-one | 2914.29 | |
89-83-8 | Thymol | 5-methyl-2-propan-2-ylphenol | 2907.19 | |
89957-48-2 | Apple Malus pumila extract | 3301.25 | ||
89-98-5 | 2-Chlorobenzaldehyde | 2-Chlorobenzaldehyde | 2913 | 3 |
89998-31-2 | Direct blue 77 | 3204.14 | ||
9000-11-7 | Carboxymethyl cellulose | Acetic acid 2,3,4,5,6-pentahydroxyhexanal | 3823.7 | |
9000-16-2 | Dammar resins | 3806.9 | ||
9000-30-0 | Guar gum | Disodium [[[5-(6-aminopurin-9-yl)-3-hydroxyoxolan-2-yl]methoxy-hydroxyphosphoryl]oxy-oxidophosphoryl] hydrogen phosphate | 3824.9 | |
9000-50-4 | Oakmoss Essential Oil | 3301.29 | ||
9000-64-0 | Tolu Balsam oil | 3301.29 | ||
9000-70-8 | Gelatin | 3503 | ||
9000-71-9 | Casein | |||
9000-72-0 | Benzoin absolute | 3301.9 | ||
9000-81-1 | Acetylcholinesterase | 3507.9 | ||
9000-85-5 | α-Amylase, from Bacillus licheniformis | 3507.9 | ||
9000-89-9 | L-Amino Acid Oxidase | 3507.9 | ||
9000-90-2 | α-Amylase | 1,4-α-D-Glucan-glucanohydrolase | 3507.9 | |
9000-91-3 | Beta-amylase | 3507.9 | ||
9000-92-4 | Diastase | 3507.9 | ||
9001-05-2 | Catalase | 3507.9 | ||
9001-06-3 | Chitinase | 3507.9 | ||
9001-08-5 | Butyrylcholinesterase | 3507.9 | ||
9001-12-1 | Collagenase | 3507.9 | ||
9001-15-4 | Creatine Kinase | 3507.9 | ||
9001-19-8 | α-Amylase from Aspergillus oryzae | Alfa-1,4-glucan-4-glucan-hydrolasa | 3507.9 | |
9001-22-3 | B-Glucosidase | 3507.9 | ||
9001-37-0 | Glucose oxidase | (2R,3R,4S,5S,6R)-6-(hydroxymethyl)oxane-2,3,4,5-tetrol | 3507.9 | |
9001-40-5 | Glucose-6-phosphate Dehydrogenase | 3507.9 | ||
9001-42-7 | α-Glucosidase | 3507.9 | ||
9001-45-0 | b-Glucuronidase | 3507.9 | ||
9001-47-2 | Glutaminase | 3507.9 | ||
9001-48-3 | Glutathione reductase | 3507.9 | ||
9001-50-7 | Glyceraldehyde-3-phosphate Dehydrogenase | 3507.9 | ||
9001-57-4 | Invertase | 3507.9 | ||
9001-60-9 | L-Lactic Dehydrogenase | 3507.9 | ||
9001-61-0 | Aminopeptidase | 3507.9 | ||
9001-62-1 | Lipase | Sodium;(4Z)-3-hydroxy-4-(pyridin-2-ylhydrazinylidene)cyclohexa-2,5-dien-1-one | 3507.9 | |
9001-63-2 | Lysozyme solution | 2-(6-amino-2-{4-carbamoyl-4-[2-(2-{[3-(carboxyamino)-5-{[4,5-dihydroxy-6-(hydroxymethyl)-3-(2-oxopropyl)oxan-2-yl]oxy}-2-hydroxy-6-(hydroxymethyl)oxan-4-yl]oxy}propanamido)propanamido]butanamido}hexanamido)propanoic acid | 3507.9 | |
9001-64-3 | Malate Dehydrogenase, Porcine Heart | 3507.9 | ||
9001-67-6 | Sialidase | 3507.9 | ||
90-01-7 | 2-Hydroxybenzyl alcohol ; Fragrance of 2-Hydroxybenzyl alcohol | Salicyl alcohol | ||
9001-73-4 | Papain | 2-(3-aminopropanoylamino)-3-(1H-imidazol-5-yl)propanoic acid | 3507.9 | |
9001-75-6 | Pepsin | |||
9001-77-8 | Acid Phosphatase | 1-prop-2-ynoxypropan-2-ol | 3507.9 | |
9001-78-9 | Alkaline phosphatase | (2S)-2-[[(2S)-1-[2-[[(2S)-1-[(2S)-2-aminopropanoyl]pyrrolidine-2-carbonyl]amino]acetyl]pyrrolidine-2-carbonyl]amino]-5-(diaminomethylideneamino)pentanoic acid | 3507.9 | |
9001-83-6 | 3-Phosphoglyceric Phosphokinase | 3507.9 | ||
9001-87-0 | Phospholipase D | 3507.9 | ||
9001-89-2 | 6-Phytase | 3507.9 | ||
9001-92-7 | Proteinase, Tritirachium album serine | 3507.9 | ||
9001-98-3 | Rennin | N-[(3S,7S,11S)-7,11-bis[(2,3-dihydroxybenzoyl)amino]-2,6,10-trioxo-1,5,9-trioxacyclododec-3-yl]-2,3-dihydroxybenzamide | 3507.9 | |
9001-99-4 | Ribonuclease A | 2-(3-aminopropanoylamino)-3-(1H-imidazol-5-yl)propanoic acid | 3507.9 | |
9002-04-4 | Thrombin | 3507.9 | ||
9002-06-6 | Thymidine kinase | 2931.9 | ||
9002-07-7 | Trypsin | Tert-butyl N-[(2S)-1-[[(2S)-1-[[(2S)-5-(diaminomethylideneamino)-1-[(5-methyl-2-oxochromen-7-yl)amino]-1-oxopentan-2-yl]amino]-3-hydroxy-1-oxopropan-2-yl]amino]-1-oxo-3-phenylpropan-2-yl]carbamate | ||
9002-08-4 | Micronized polyolefin wax | 3404.9 | ||
9002-10-2 | Tyrosinase | 3507.9 | ||
9002-12-4 | Uricase | Azane;[5-(2,4-dioxopyrimidin-1-yl)-3,4-dihydroxyoxolan-2-yl]methyl [5-(2,4-dioxopyrimidin-1-yl)-4-hydroxy-2-(hydroxymethyl)oxolan-3-yl] hydrogen phosphate | 3507.9 | |
9002-13-5 | Urease | 3507.9 | ||
9002-17-9 | Native bovine xanthine oxidase | 3507.9 | ||
9002-18-0 | Agar | (2R,3S,4S,5R)-2-(hydroxymethyl)-6-[[(4R,5S)-4-hydroxy-3-methyl-2,6-dioxabicyclo[3.2.1]octan-8-yl]oxy]-4-methoxyoxane-3,5-diol | 3821 | |
9002-61-3 | Gonadotropin, chorionic | Gonadotropin, chorionic | 2909.6 | |
9002-62-4 | Prolactin | 2844.4 | 5 | |
9002-68-0 | Follicle-stimulating hormone | 2937.19 | ||
9002-70-4 | Gonadotropin, pregnant mare serum | Gonadotropin, pregnant mare serum | 2937.19 | |
9002-71-5 | Thyrotropin | 2937.9 | ||
90-02-8 | Salicylaldehyde | Salicylaldehyde | 2912.49 | |
9002-83-9 | Ethene, 1-chloro-1,2,2-trifluoro-, homopolyer | Poly(1-chloro-1,2,2-trifluoroethane-1,2-diyl) | 2710.19 | |
9002-84-0 | Polytetrafluoroethylene | Poly(1,1,2,2-tetrafluoroethylene) | 2710.19 | |
9002-85-1 | Polyvinylidene chloride | 1,1-dichloroethene | 3505.2 | |
9002-86-2 | Poly(vinyl chloride) | 3904.1 | ||
9002-88-4 | Polyethylene ; Mixture of activated carbon and polyethylene, in form of powder | |||
9002-89-5 | Polyvinyl alcohol | Ethenol | 3824.4 | |
9002-91-9 | Metaldehyde | 2912.5 | 8 | |
9002-92-0  | Polyoxyethylene lauryl ether | 2-[2-[2-[2-[2-[2-(2-Dodecoxyethoxy)ethoxy]ethoxy]ethoxy]etho | 3402.13 | |
9002-93-1 | Octoxinol ; Polyethylene glycol tert-octylphenyl ether | 3402.13 | ||
9002-96-4 | Poly(oxy-1,2-ethanediyl),alpha-[4-[[(2R)-3,4-dihydro-2,5,7,8-tetramethyl-2-[(4R,8R)-4,8,12-trimethyltridecyl]-2H-1-benzopyran-6-yl]oxy]-1,4-dioxobutyl]-omega-hydroxy- | 2936.28 | ||
9003-01-4 | 2-Propenoic acid, homopolymer | 3824.9 | ||
9003-04-7 | Sodium polyacrylate | 2-Propenoic acid, homopolymer, sodium salt | 2916.11 | |
9003-05-8 | 2-Propenamide, homopolymer ; Fragrance of poly (acrylamide) | |||
9003-07-0 | Polypropylene | 12-(3-Octyloxiran-2-yl)dodecanoic acid | 3812.39 | |
9003-08-1 | Melamine resin | 1,3,5-triazine-2,4,6-triamine, polymer with formaldehyde | 3507.9 | |
9003-09-2 | Polyvinyl methyl ether | Methoxyethene | 3907.2 | |
9003-11-6 | Polyoxyethylene polyoxypropylene glycol ; 2-methyloxirane | 3402.13 | ||
9003-17-2 | Polybutadiene | Buta-1,3-diene | 3902.9 | |
9003-27-4 | Polyisobutylene | 2922.19 | ||
9003-29-6 | Polybutene | But-1-ene;(E)-but-2-ene | 2710.19 | |
9003-31-0 | Polyisoprene | 3812.1 | ||
9003-35-4 | Formaldehyde, oligomeric reaction products with phenol | |||
9003-36-5 | Phenol, polymer with formaldehyde, glycidyl ether | 2-(chloromethyl)oxirane formaldehyde phenol | 2916.14 | |
9003-39-8 | Polyvinylpyrrolidone | 1-ethenylpyrrolidin-2-one | 3824.9 | |
9003-53-6 | Polystyrene | 9H-fluoren-9-ylmethyl N-[(2,4-dimethoxyphenyl)-[4-[2-oxo-2-(2-phenylethylamino)ethoxy]phenyl]methyl]carbamate | 3903.19 | |
9003-55-8 | Styrene butadiene Rubber | 4002.19 | ||
9003-74-1 | Terpene resin | 2902.19 | ||
9003-98-9 | Deoxyribonuclease I | 1-[(2R,4S,5S)-4-azido-5-(hydroxymethyl)oxolan-2-yl]-5-methylpyrimidine-2,4-dione | 3507.9 | |
9003-99-0 | Peroxidase | 3507.9 | ||
90-04-0 | o-Anisidine | o-Anisidine | 2922.29 | 3 |
9004-02-8 | Lipoprotein lipase | N-(4-bromo-2-cyanophenyl)-4-(diethoxyphosphorylmethyl)benzamide | 3504 | |
9004-07-3 | Chymotrypsin | 3507.9 | ||
9004-34-6 | Cellulose microcrystalline | 2-(hydroxymethyl)-6-[4,5,6-trihydroxy-2-(hydroxymethyl)oxan-3-yl]oxy-oxane-3,4,5-triol | 3824.9 | |
9004-36-8 | Cellulose Acetate Butyrate | 3402.19 | ||
90045-23-1 | Garcinia cambogia extract | 3302.9 | ||
90045-28-6 | Gaultheria procumbens, ext. | 2918.21 | ||
90045-38-8 | Ginseng extract | 3302.9 | ||
9004-53-9 | Dextrin | (3R,4S,5S,6R)-2-[(2R,3S,4R,5R)-4,5-dihydroxy-2-(hydroxymethyl)-6-[(2R,3S,4R,5R,6S)-4,5,6-trihydroxy-2-(hydroxymethyl)oxan-3-yl]oxyoxan-3-yl]oxy-6-(hydroxymethyl)oxane-3,4,5-triol | 3505.1 | |
9004-54-0 | Dextran | 2,3,4,5-tetrahydroxy-6-[3,4,5-trihydroxy-6-[[3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxymethyl]oxan-2-yl]oxyhexanal | 3821 | |
90045-56-0 | Helichrysum angustifolium extract | 3302.9 | ||
9004-57-3 | Ethyl cellulose | 3212.9 | 6 | |
9004-58-2 | Oleylalcohol, ethoxylated | 3402.13 | ||
90045-98-0 | Simmondsia chinensis seed oil | 3301.19 | ||
90046-01-9 | PEG-6 Tridecyl ether phosphate | 3402.11 | ||
9004-61-9 | Hyaluronic Acid | Sodium;(2S,3S,4S,5R,6R)-6-[(2S,3R,4R,5S,6R)-3-acetamido-2-[(2S,3S,4R,5R,6R)-6-[(2R,3R,4R,5S,6R)-3-acetamido-2,5-dihydroxy-6-(hydroxymethyl)oxan-4-yl]oxy-2-carboxy-4,5-dihydroxyoxan-3-yl]oxy-5-hydroxy-6-(hydroxymethyl)oxan-4-yl]oxy-3,4,5-trihydroxyoxane-2- | ||
9004-65-3 | Cellulose, 2-hydroxypropyl methyl ether | Cellulose, 2-hydroxypropyl methyl ether | 2918.16 | |
9004-70-0 | Nitrocellulose | Nitrocellulose | 3912.2 | |
9004-77-7 | 2-Butoxyethanol | 2-Butoxyethanol | 2909.49 | |
9004-78-8 | Phenol, ethoxylated | 2-Phenoxyethan-1-ol | 2909.49 | |
9004-81-3 | Poly(ethylene glycol) monolaurate | 3402.9 | ||
9004-82-4 | Sodium laurylether sulfate | Sodium 2-dodecoxyethyl sulfate | ||
9004-86-8 | 2-Benzoyloxyethyl benzoate | 3812.3 | ||
9004-93-7 | Poly(oxy-1,2-ethanediyl),a-(2-ethyl-1-oxohexyl)-w-[(2-ethyl-1-oxohexyl)oxy]- | 3812.3 | ||
9004-95-9 | Ceteareth-25 ; Polyoxyethylene(20) cetyl ether | 3402.9 | ||
9004-96-0 | Polyethylene glycol monooleate | |||
9004-98-2 | (Z)-9-Octadecen-1-ol ethoxylated 1 - 2.5 moles ethoxylated | 3402.13 | ||
9004-99-3 | Glycol stearate | 2-hydroxyethyl octadecanoate | ||
9005-00-9 | 2-Octadecoxyethanol ; Polyoxyethylene stearyl ether | Stearyl alcohol, ethoxylated | 3402.13 | |
9005-07-6 | Polyethylene glycol 600 dioleate | |||
9005-08-7 | PEG-250 distearate ; Polyethyleneglycol distearate | Poly(oxy-1,2-ethanediyl), alpha-(1-oxooctadecyl)-omega-((1-oxooctadecyl)oxy)- | 3402.13 | |
90-05-1 | Guaiacol | |||
9005-25-8 | Starch | (2R,3S,4S,5R,6R)-2-(hydroxymethyl)-6-[(2R,3S,4R,5R,6S)-4,5,6-trihydroxy-2-(hydroxymethyl)oxan-3-yl]oxyoxane-3,4,5-triol | 3505.1 | |
90052-75-8 | Octyldodecyl stearoyl stearate | 2-octyldodecyl 12-octadecanoyloxyoctadecanoate | 2915.7 | |
9005-38-3 | Sodium alginate | |||
9005-43-0 | Calcium caseinate | 3501.9 | ||
9005-46-3 | Sodium caseinate ; Caseins, sodium complexes | |||
9005-53-2 | Lignin | 3804 | ||
9005-64-5 | Sorbitan monolaurate, ethoxylated ; Polysorbate 20 ; PEG-80 sorbitan laurate | 3402.13 | ||
9005-65-6 | Polysorbate 80 ; Sorbitan monooleate, ethoxylated 1 - 6.5 moles ethoxylated | |||
9005-66-7 | Polysorbate 40 / Sorbitan, monohexadecanoate, poly(oxy-1,2-ethanediyl) derivs. | 3402.13 | ||
9005-67-8 | Polysorbate 60 / Sorbitan monostearate, ethoxylated 1 - 6.5 moles ethoxylated | 3402.13 | ||
9005-70-3 | Polyoxyethylene sorbitan trioleate | 3402.9 | ||
9005-79-2 | Glycogen | (2S,3R,4S,5S,6R)-2-[[(2R,3S,4R,5R,6R)-4,5-dihydroxy-3-[(2R,3R,4S,5S,6R)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxy-6-[(2R,3S,4R,5R,6S)-4,5,6-trihydroxy-2-(hydroxymethyl)oxan-3-yl]oxyoxan-2-yl]methoxy]-6-(hydroxymethyl)oxane-3,4,5-triol | ||
9005-84-9 | Soluble starch | alpha-D-gluco-hexopyranosyl-(1->4)-alpha-D-gluco-hexopyranose | 3505.1 | |
9005-97-4 | Thyroprotein | 3501.9 | ||
90063-37-9 | Lavender hydrosol | 3301.9 | ||
90063-38-0 | Lavandula stoechas oil | 3301.19 | ||
90063-86-8 | Mango extract | 3302.1 | ||
90063-97-1 | Mentha arvensis extract | 3301.29 | ||
9006-53-5 | Albumins, blood | 3821 | ||
9006-59-1 | Egg albumin | |||
9007-28-7 | Chondroitin Sulfate | (2S,3S,4S,5R,6R)-6-[(2R,3R,4R,5R,6R)-3-acetamido-2,5-dihydroxy-6-sulfooxyoxan-4-yl]oxy-3,4,5-trihydroxyoxane-2-carboxylic acid | 2934.99 | |
9007-34-5 | Collagens | 3824.9 | ||
9007-43-6 | Cytochrome C | 3-[8,13-bis[1-[2-amino-3-(methylamino)-3-oxopropyl]sulfanylethyl]-18-(2-carboxyethyl)-3,7,12,17-tetramethylporphyrin-21,24-diid-2-yl]propanoic acid;iron(2+) | ||
9007-48-1 | Polyglyceryl-4 Oleate | 3402.13 | ||
9007-49-2 | Nucleic acid, sodium salt (yeast) | [5-amino-2-[[[5-amino-2-(hydroxymethyl)oxolan-3-yl]oxy-hydroxyphosphoryl]oxymethyl]oxolan-3-yl] (5-amino-3-hydroxyoxolan-2-yl)methyl hydrogen phosphate | 2934.99 | |
90076-65-6 | Bis(trifluoromethane)sulfonimide lithium salt | Lithium bis(trifluoromethylsulfonyl)azanide | 2935 | |
9008-02-0 | Hemoglobin | 3821 | ||
90082-43-2 | Pear extract | 3302.9 | ||
90082-51-2 | Pelargonium graveolens Oil | 3301.29 | ||
90082-81-8 | Pistacia vera seed oil | 3301.9 | ||
9008-63-3 | Naphthalenesulfonic acid sodium salt polymer with formaldehyde | 3402.19 | ||
9008-97-3 | Agglutinins and Lectins, phytohemagglutinins ; Phytohemagglutinin | |||
9009-10-3 | Polyalkylene glycol ether | 2-[2-[2-[2-[2-[2-[2-(2-hydroxyethoxy)ethoxy]ethoxy]ethoxy]ethoxy]ethoxy]ethoxy]ethanol | 3402.11 | |
9009-54-5 | Polyurethane | Butane-1,4-diol;hexanedioic acid;2-[4-(2-hydroxyethoxy)phenoxy]ethanol;1-isocyanato-4-[(4-isocyanatophenyl)methyl]benzene | 3926.9 | |
9009-75-0 | Sodium lignosulfonate | 3804 | ||
90098-04-7 | Rebamipide | 2-[(4-chlorobenzoyl)amino]-3-(2-oxo-1H-quinolin-4-yl)propanoic acid | 2933.79 | 6 |
9010-10-0 | Isolated soy protein | |||
90106-38-0 | Rose essential oil | 3302.9 | ||
90106-49-3 | Sage, Salvia lavandulifolia extract | 3301.29 | ||
9010-66-6 | Zein | 3504 | ||
9010-77-9 | Ethylene acrylic acid copolymer wax  | 3906.1 | ||
9010-79-1 | Propylene copolymer | 3902.3 | ||
9010-88-2 | Poly(methyl methacrylate-co-ethyl acrylate) | 2922.19 | ||
9010-92-8 | 2-Propenoic acid, 2-methyl-, polymer with ethenylbenzene | 3402.9 | ||
9011-11-4 | Prop-1-en-2-ylbenzene styrene | 3824.9 | ||
9011-14-7 | Polymethyl methacrylate | 2916.14 | ||
9011-18-1 | Dextran sulphate | 2942 | ||
90-11-9 | 1-Bromonaphthalene | 1-Bromonaphthalene | 2903.99 | |
9011-93-2 | Lysostaphin | 3507.9 | ||
90-12-0 | 1-Methylnaphthalene | 1-Methylnaphthalene | ||
9012-09-3 | Cellulose triacetate | [(2R,3R,4S,5R,6S)-4,5-diacetyloxy-3-[(2S,3R,4S,5R,6R)-3,4,5-triacetyloxy-6-(acetyloxymethyl)oxan-2-yl]oxy-6-[(2R,3R,4S,5R,6S)-4,5,6-triacetyloxy-2-(acetyloxymethyl)oxan-3-yl]oxyoxan-2-yl]methyl acetate | 2905.45 | |
9012-36-6 | Agarose | (2S,3R,4S,5R,6R)-2-[[(1S,3S,4S,5S,8R)-3-[(2S,3R,4S,5S,6R)-2-[[(1S,3R,4S,5S,8R)-3,4-dihydroxy-2,6-dioxabicyclo[3.2.1]octan-8-yl]oxy]-3,5-dihydroxy-6-(hydroxymethyl)oxan-4-yl]oxy-4-hydroxy-2,6-dioxabicyclo[3.2.1]octan-8-yl]oxy]-6-(hydroxymethyl)oxane-3,4,5- | ||
9012-54-8 | Cellulase | (2S,3R,4S,5S,6R)-2-[(2R,3S,4R,5R,6S)-4,5-dihydroxy-2-(hydroxymethyl)-6-[(2R,3S,4R,5R,6R)-4,5,6-trihydroxy-2-(hydroxymethyl)oxan-3-yl]oxyoxan-3-yl]oxy-6-(hydroxymethyl)oxane-3,4,5-triol | 3507.9 | |
9012-72-0 | beta-Glucan | (2S,3R,4S,5S,6R)-2-[(2R,4R,5R,6S)-4,5-dihydroxy-2-(hydroxymethyl)-6-[(2R,4R,5R,6S)-4,5,6-trihydroxy-2-(hydroxymethyl)oxan-3-yl]oxyoxan-3-yl]oxy-6-(hydroxymethyl)oxane-3,4,5-triol | 2938.9 | |
9012-76-4 | Chitosan Oligosaccharide | Methyl N-[(2S,3R,4R,5S,6R)-5-[(2S,3R,4R,5S,6R)-3-amino-5-[(2S,3R,4R,5S,6R)-3-amino-5-[(2S,3R,4R,5S,6R)-3-amino-5-[(2S,3R,4R,5S,6R)-3-amino-5-[(2S,3R,4R,5S,6R)-3-amino-5-[(2S,3R,4R,5S,6R)-3-amino-4,5-dihydroxy-6-(hydroxymethyl)oxan-2-yl]oxy-4-hydroxy-6-(hy | 2922.49 | |
9012-90-2 | Nucleotidyltransferase | 3507.9 | ||
9013-05-2 | Phosphatase | 3507.9 | ||
90-13-1 | 1-Chloronaphthalene | 1-Chloronaphthalene | 2903.99 | |
90131-36-5 | Strawberry Fragaria virginiana extract | 3302.1 | ||
9013-20-1 | Streptavidin | 2-[(3-chlorophenyl)-piperidin-1-ium-1-ylidenemethyl]sulfanylacetic acid;bromide | 3502.9 | |
9013-53-0 | Nuclease | 3507.9 | ||
9013-90-5 | Milk protein concentrate | 3504 | ||
9014-01-1 | Protease | 3507.9 | ||
9014-24-8 | RNA Polymerase | 3507.9 | ||
9014-25-9 | Ribonucleic acid, transfer from baker's yeast | 2934.99 | ||
9014-63-5 | Beechwood | 3807 | ||
9014-85-1 | A mixture of docusate dodium, ethoxylated 2,4,7,9-tetramethyldec-5-yne-4,7-diol | |||
9014-90-8 | Sodium nonylphenol ethoxylated sulfate | 3402.11 | 8 | |
9015-54-7 | Protein hydrolysate | 3504 | ||
9015-75-2 | Pectate lyase | 3507.9 | ||
9015-82-1 | Peptidyl - dipeptidase A | 3504 | ||
9015-85-4 | DNA ligase | 3507.9 | ||
9016-45-9 | Nonylphenol, ethoxylated | 3402.13 | ||
9016-87-9 | Isocyanic acid, polymethylenepolyphenylene ester | 3909.31 | ||
9016-88-0 | 1,4-Benzenedicarboxylic acid, polymer with 1,2-ethanediol and .alpha.-hydro-.omega.-hydroxypoly(oxy- | 3402.13 | ||
90170-45-9 | Sodium Cocoyl Alaninate | 3402.11 | ||
9018-04-6 | Polyurethane resin | 3505.2 | ||
90193-92-3 | 1,2-Benzenedicarboxylic acid, mixed decyl and lauryl and myristyl diesters | 3812.2 | ||
90-20-0 | 1-Naphthol-8-amino-3,6-disulfonic acid | 4-amino-5-hydroxynaphthalene-2,7-disulfonic acid | 2922.21 | |
90218-76-1 | 1,2,4-Benzenetricarboxylic acid, mixed decyl and octyl triesters | 2917.39 | ||
9023-82-9 | Glucose isomerase | 3507.9 | ||
9024-28-6 | Phenylalanine ammonia-lyase | 3507.9 | ||
9024-52-6 | Aldolase | 3507.9 | ||
9024-82-2 | Pyrophosphatase | 3507.9 | ||
9025-24-5 | Carboxypeptidase B | 4-[[1-[[1-[2-[(1-benzylsulfanyl-1-oxo-3-phenylpropan-2-yl)carbamoyl]pyrrolidin-1-yl]-1-oxopropan-2-yl]amino]-1-oxopropan-2-yl]amino]-4-oxobutanoic acid | 2847 | |
9025-38-1 | Thioglucosidase | 3507.9 | ||
9025-49-4 | Aspergillopepsin I | 3507.9 | ||
9025-56-3 | Hemicellulase | 3507.9 | ||
9025-57-4 | Xylanase | Benzyl-[3-[[4-[3-[benzyl(diethyl)azaniumyl]propylamino]-3,6-dioxocyclohexa-1,4-dien-1-yl]amino]propyl]-diethylazanium | 3507.9 | |
9025-65-4 | Nuclease | 3507.9 | ||
9025-67-6 | Inulinase | 3507.9 | ||
9026-00-0 | Cholesterol esterase | 3507.9 | ||
90268-24-9 | Pigment yellow 176 | 3204.17 | ||
9027-14-9 | Cytochrome c reductase | 3507.9 | ||
9027-96-7 | Synthase, citrate | 3507.9 | ||
9028-56-2 | 3-alpha-hydroxysteroid dehydrogenase | 3507.9 | ||
9028-67-5 | Choline oxidase | 3507.9 | ||
9028-72-2 | Lactate oxidase | 3507.9 | ||
9028-76-6 | Cholesterol oxidase | 3507.9 | ||
9028-88-0 | Aldehyde dehydrogenase | 3507.9 | ||
9029-27-0 | Nitrate Reductase (NAD[P]H) from Aspergillus niger | 3507.9 | ||
9029-44-1 | Ascorbate oxidase | 3507.9 | ||
9029-60-1 | Lipoxidase | 3507.9 | ||
9030-09-5 | Cyclomaltodextrin glucanotransferase | 3507.9 | ||
90-30-2 | N-phenyl-1-napthylamine | N-phenylnaphthalen-1-amine | 2921.49 | |
9030-66-4 | Glycerokinase | 3507.9 | ||
9031-11-2 | Lactase | (2R,3R,4S,5R,6R)-6-(hydroxymethyl)oxane-2,3,4,5-tetrol | 3507.9 | |
90-31-3 | 1-(3-chlorophenyl)-3-methyl-4,5-dihydro-1H-pyrazol-5-one | 1-(3-chlorophenyl)-3-methyl-4,5-dihydro-1H-pyrazol-5-one | 2933.19 | |
9031-96-3 | Peptidase | 3507.9 | ||
90320-37-9 | Sweet Almond extract | 3301.9 | ||
90320-57-3 | Lectin | 3504 | ||
9032-08-0 | Amyloglucosidase | 3507.9 | ||
9032-75-1 | Pectinase | (2R)-1-[(4S,7S,10S,13S,16S,19S)-19-amino-7-(2-amino-2-oxoethyl)-10-(3-amino-3-oxopropyl)-13-[(2S)-butan-2-yl]-16-[(4-hydroxyphenyl)methyl]-6,9,12,15,18-pentaoxo-1,2-dithia-5,8,11,14,17-pentazacycloicosane-4-carbonyl]-N-[(2S)-1-[(2-amino-2-oxoethyl)amino]- | 3507.9 | |
9035-99-8 | Sulfur, homopolymer | Sulfur, homopolymer | ||
9036-06-0 | Protease from Streptomyces griseus | 3507.9 | ||
9036-19-5 | 2-(2-[4-(1,1,3,3-Tetramethylbutyl)phenoxy]ethoxy)ethanol | α-hydroxy-ω-[(2,4,4-trimethylpentan-2-yl)phenyl]poly(ethane-1,2-diyloxy) | 3402.13 | |
90367-28-5 | Ethanol, 2,2'-iminobis-, N-(hydrogenated tallow alkyl) derivs. | 3402.12 | ||
90387-74-9 | Glycine, N-coco acyl derivs., sodium salts | 3402.11 | ||
9038-95-3 | Polyalkylene glycol monobutyl ether | 3402.13 | ||
90-39-1 | Alkyl Polyglucoside | 3402.13 | ||
9040-38-4 | Disodium ethoxylated nonylphenol half ester of sulfosuccinic acid | 3402.9 | ||
90-40-4 | 3-Amino-5-hydroxynaphthalene-2,7-disulfonic acid | 3-amino-5-hydroxynaphthalene-2,7-disulfonic acid | 2922.21 | |
9041-07-0 | Decaglycerol | 3402.13 | ||
9041-08-1 | Heparin Sodium | 6-[5-acetamido-4,6-dihydroxy-2-(sulfooxymethyl)oxan-3-yl]oxy-3-[5-(6carboxy -4,5dihydroxy-3-sulfooxyoxan-2-yl)oxy-6-(hydroxymethyl)-3-(sulfoamino)-4-sulfooxyoxan-2-yl]oxy-4-hydroxy-5-sulfooxyoxane-2-carboxylic acid | 2933.99 | |
9041-09-2 | Polyoxyethylene Aryl Ether | 3402.13 | ||
90411-66-8 | Hexanoic acid, 2-ethyl-, C12-15-alkyl esters | 3824.9 | ||
90411-68-0 | Hexanoic acid, 2-ethyl-, C16-18-alkyl esters | 3824.9 | ||
9041-65-0 | Latex | 2-methylbuta-1,3-diene | 3507.9 | |
9042-08-4 | Rennets | 3507.9 | ||
9043-29-2 | Phospholipase A1 | 3507.9 | ||
9043-30-5 | Tridecyl alcohol ethoxylate | 3402.13 | ||
9043-71-4 | Isocyanate mixed isomers or mixture ; 1-4,Butanediol, polymer with 1,3-diisocyanatomethylbenzene and alpha-hydro-omaga-hydroxypoly(Oxy-1,4-butanediyl) | 2905.14 | ||
90-44-8 | Anthrone | 9,10-dihydroanthracen-9-one | 3821 | |
90452-21-4 | Pigment red 101 | 3206.49 | ||
9045-23-2 | Beta-lactoglobulin | L-alanyl-L-leucyl-L-prolyl-L-methionyl-L-histidyl-L-isoleucyl-L-arginine | ||
9045-28-7 | Starch acectate | [2-[2-[[3,4-dihydroxy-6-(hydroxymethyl)-5-methoxyoxan-2-yl]oxymethyl]-6-[4,5-dihydroxy-2-(hydroxymethyl)-6-methyloxan-3-yl]oxy-4,5-dihydroxyoxan-3-yl]oxy-4-hydroxy-6-(hydroxymethyl)-5-methoxyoxan-3-yl] acetate | 3505.1 | |
90453-16-0 | Tanigan Pak | 3202.9 | ||
9045-77-6 | Fatty acid synthase | 3507.9 | ||
90-45-9 | Aminoacridine | Aminoacridine | 2933.99 | |
90-46-0 | Xanthydrol | 9H-xanthen-9-ol | 2933.99 | |
9046-01-9 | 2-(tricylcoxy) ethyl dihydrogen phosphate | 3402.11 | ||
9046-10-0 | alpha-(2-Aminomethylethyl)-omega-(2-aminomethylethoxy)poly(oxy(methyl-1,2-ethanediyl)) | 3824.9 | ||
90471-79-7 | L-Carnitine fumarate | (R)-(3-carboxy-2-hydroxypropyl)trimethylammonium hydrogen fumarate | 2923.9 | |
9047-22-7 | Cathepsin B | 2932.2 | ||
9048-46-8 | Albumin bovine serum | |||
9049-76-7 | Hydroxypropyl starch | 5-[6-[[3,4-dihydroxy-6-(hydroxymethyl)-5-methoxyoxan-2-yl]oxymethyl]-5-[3-(2,3-dihydroxy-2-methylpropoxy)-4-hydroxy-6-(hydroxymethyl)-5-methoxyoxan-2-yl]oxy-3,4-dihydroxyoxan-2-yl]oxy-6-(hydroxymethyl)-2-methyloxane-3,4-diol | 3505.1 | |
90498-90-1 | 3,9-bis(2-(3-(3-tert-butyl-4-hydroxy-5-methylphenyl)propionyloxy-1,1-dimethylethyl)-2,4,8,10-tetraoxaspiro[5.5]undecane | 3,9-bis(2-(3-(3-tert-butyl-4-hydroxy-5-methylphenyl)propionyloxy-1,1-dimethylethyl)-2,4,8,10-tetraoxaspiro[5.5]undecane | 2932.99 | |
9050-36-6 | Maltodextrin | 3505.1 | ||
9051-29-0 | Alpha-lactalbumin | 3502.2 | ||
9051-57-4 | Ammonium 1-(4-nonylphenyl)-1,4,7,10-tetraoxadodecan-12-yl sulfate | 3402.9 | ||
90-51-7 | 6-amino-4-hydroxynaphthalene-2-sulphonic acid | 6-amino-4-hydroxynaphthalene-2-sulphonic acid | 2922.21 | |
9054-89-1 | Superoxide Dismutase | 3507.9 | ||
90551-76-1 | 2-Propenoic acid, 2-methyl-, C12-16-alkyl esters | 2916.14 | ||
90551-83-0 | 2-Propenoic acid, 2-methyl-, C16-18-alkyl esters | 2916.14 | ||
9057-91-4 | Polyurethane prepolymer | Poly(oxy(methyl-1,2-ethanediyl)), alpha-hydro-omega-hydroxy-, polymer with 1,3-diisocyanatomethylbenzene | 3909.5 | |
9061-27-2 | alpha1-39-Corticotropin (pig) | 2937.19 | ||
90622-53-0 | C9 to C21 Alkanes, Linear and Branched | 2710.19 | ||
90622-56-3 | Alkanes, C7-10-iso- | 2710.19 | ||
90622-57-4 | Alkanes, C9-12-iso | 2710.12 | ||
90622-58-5 | Alkanes, C11-15-iso- | 2710.19 | ||
906-33-2 | Neochlorogenic acid | (1R,3R,4S,5R)-3-[(E)-3-(3,4-dihydroxyphenyl)prop-2-enoyl]oxy-1,4,5-trihydroxycyclohexane-1-carboxylic acid | 2918.29 | |
9063-38-1 | Sodium starch glycolate | 3505.1 | ||
90640-67-8 | Amines, polyethylenepoly-, triethylenetetramine fraction | 2710.19 | ||
90640-86-1 | Distillate (coal tar), heavy oils; heavy anthracene oil | 2707.99 | ||
9064-13-5 | Cresol propoxylate | 3707.1 | ||
90-64-2 | Mandelic acid | 2-hydroxy-2-phenylacetic acid | 2918.19 | |
9064-47-5 | Histone type III | 3504 | ||
9064-67-9 | Collagen | 3504 | ||
9065-11-6 | Acrylic Polymer | 3906.9 | ||
9066-59-5 | Lysozyme chloride | [(8S,9R,10S,11S,13S,14S,16R,17R)-9-chloro-17-(2-chloroacetyl)-11-hydroxy-10,13,16-trimethyl-3-oxo-6,7,8,11,12,14,15,16-octahydrocyclopenta[a]phenanthren-17-yl] furan-2-carboxylate hydrate | 3507.9 | |
90669-62-8 | Aluminum oxide | 3815.9 | ||
9067-32-7 | Hyaluronic acid sodium salt | Sodium (2S,3S,4R,5R,6R)-3-[(2S,3R,4R,5S,6R)-3-acetamido-4-[(2R,3R,4S,5S,6S)-6-carboxy-3,4,5-trihydroxyoxan-2-yl]oxy-5-hydroxy-6-(hydroxymethyl)oxan-2-yl]oxy-6-[(2R,3R,4R,5S,6R)-3-acetamido-2,5-dihydroxy-6-(hydroxymethyl)oxan-4-yl]oxy-4,5-dihydroxyoxane-2- | 2940 | |
9069-80-1 | Ammonium naphthalene-formaldehyde sulfonate | 3402.11 | ||
90-72-2 | Tris(dimethylaminomethyl)phenol | 2,4,6-tris(dimethylaminomethyl)phenol | 3 | |
9073-60-3 | ß-Lactamase | 3507.9 | ||
9073-78-3 | Thermolysin | 3507.9 | ||
9073-79-4 | Proteinase | 3507.9 | ||
9074-07-1 | Protease | 3823.11 | ||
9074-98-0 | β-Glucanase | 3507.9 | ||
9075-65-4 | α-Glycerophosphate Dehydrogenase | 3507.9 | ||
9075-68-7 | Pullulanase | 3507.9 | ||
90-80-2 | D-glucono-1,5-lactone | 3,4,5-trihydroxy-6-(hydroxymethyl)tetrahydro-2H-pyran-2-one | 2932.2 | |
90817-34-8 | 6-methoxy-N2-methylpyridine-2,3-diamine | 6-methoxy-N2-methylpyridine-2,3-diamine | 2933.39 | |
9082-00-2 | Oxirane, methyl-, polymer with oxirane, ether with 1,2,3-propanetriol | Ethane-1,2-diol propane-1,2-diol propane-1,2,3-triol | 2933.59 | |
9082-07-9 | Chondroitin sodium sulfate | 2S,3S,4S,5R,6R)-6-[(2R,3R,4R,5R,6R)-3-acetamido-2,5-dihydroxy-6-sulfooxyoxan-4-yl]oxy-3,4,5-trihydroxyoxane-2-carboxylic acid | 2934.99 | |
90-82-4 | Pseudoephedrine | ([S-(R*,R*)]-α-[1-(methylamino)ethyl]-benzenemethanol) | 2939.42 | 9 |
9084-06-04 | Sodium poly(naphthaleneformaldehyde)sulfonate | 3202.1 | ||
9084-06-4 | Sodium poly[(naphthaleneformaldehyde)sulfonate] | |||
9087-53-0 | PPG-4-Ceteth-20 ; 2-methyloxirane; hexadecan-1-ol; oxirane | 3402.13 | ||
9087-61-0 | Aluminum starch octenylsuccinate | 3505.1 | ||
9087-70-1 | Trypsin inhibitor, pancreatic basic | 2933.99 | ||
90-89-1 | Diethylcarbamazine | N,N-diethyl-4-methylpiperazine-1-carboxamide | 2933.59 | 6 |
909250-59-5 | Polarzyme | 3507.9 | ||
90-93-7 | 4,4'-bis(diethylamino)benzophenone | 4,4'-bis(diethylamino)benzophenone | 2922.39 | |
90989-93-8 | Cephalins, Brain | [2-acetyloxy-3-[2-aminoethoxy(hydroxy)phosphoryl]oxypropyl] acetate | 2923.2 | |
90990-15-1 | Fatty acids, C12-18 and C18-unsatd. | 3826 | ||
91031-31-1 | Fatty acids, C16-18, esters with ethylene glycol | 3402.13 | ||
91031-58-2 | Fatty acids, C16-18 (even numbered), isopropyl esters | 2915.9 | ||
91031-88-8 | Fatty acids, coco, esters with sucrose | 3402.9 | ||
91032-11-0 | Dicocoylethyl hydroxyethylmonium methosulfate | 3402.12 | ||
91051-01-3 | Fatty acids, C16-18, zinc salts | 3823.19 | ||
91051-34-2 | Fatty acids, palm-oil, Me esters | Methyl (9Z)-octadec-9-enoate methyl hexadecanoate | 3823.11 | |
91053-39-3 | Calcined diatomaceous earth | 3802.9 | ||
91079-38-8 | Bovine meat peptone | 3504 | ||
91079-40-2 | Tryptone | |||
91079-43-5 | Peptone from gelatin | 3504 | ||
91079-46-8 | Peptone from soymeal | 3504 | ||
91082-17-6 | (C10-21)alkylsulfonic acid, phenyl ester | 3812.2 | ||
91082-88-1 | Whey protein | |||
91-16-7 | Fragrance of 1,2-dimethoxybenzene | veratrole | 3301.29 | |
911-77-3 | N-alpha-Benzoyl-DL-arginine-4-nitroanilide hydrochloride | N-[5-(diaminomethylideneamino)-1-(4-nitroanilino)-1-oxopentan-2-yl]benzamide;hydrochloride | 2925.29 | |
91-20-3 | Crude naphthalene | 2707.4 | 8 | |
91-22-5 | Quinoline | Quinoline | 2933.49 | |
91261-29-9 | Reactive orange 84 | Octasodium 4,4'-bis{[4-chloro-6-({6-[(4,8-disulfonatonaphthalen-2-yl)azo]-5-hydroxy-7-sulfonatonaphthalen-2-yl}amino)-1,3,5-triazin-2-yl]amino}biphenyl-2,2'-disulfonate | 3204.16 | |
91-29-2 | 2-(4-aminoanilino)-5-nitrobenzenesulphonic acid | 2-(4-aminoanilino)-5-nitrobenzenesulphonic acid | 2921.44 | |
91-30-5 | 5-amino-2-anilinobenzenesulphonic acid | 5-amino-2-anilinobenzenesulphonic acid | 2922.5 | |
91-40-7 | Fenamic Acid | 2-anilinobenzoic acid | 2922.49 | |
91-44-1 | Diethylaminomethylcoumarin | 7-(diethylamino)-4-methylchromen-2-one | ||
91465-08-6 | Lambda-cyhalothrin | rel-(R)-cyano(3-phenoxyphenyl)methyl (1S,3S)-3-[(1Z)-2-chloro-3,3,3-trifluoroprop-1-en-1-yl]-2,2-dimethylcyclopropanecarboxylate | 2926.9 | 8 |
91-51-0 | Verdantiol | Methyl 2-[[3-(4-tert-butylphenyl)-2-methylpropylidene]amino]benzoate | 2925.29 | |
91-53-2 | Ethoxyquin | 6-ethoxy-2,2,4-trimethyl-1H-quinoline | 3 | |
91-56-5 | Isatin | 1H-indole-2,3-dione | 2933.79 | |
915-67-3 | Acid red 27 | trisodium 3-hydroxy-4-(4-sulfonato-1-naphthylazo)naphthalene-2,7-disulfonate | 3204.9 | |
915967-82-7 | Piperaquine Phosphate | 7-chloro-4-[4-[3-[4-(7-chloroquinolin-4-yl)piperazin-1-yl]propyl]piperazin-1-yl]quinoline;phosphoric acid;tetrahydrate | 2933.59 | |
91-63-4 | Quinaldine | 2-Methylquinoline | 2933.49 | |
91-64-5 | Coumarin | Chromen-2-one | 2932.2 | |
91-66-7 | Diethylaniline | N,N-diethylaniline | 2921.42 | |
91-68-9 | N,N-Diethyl-M-aminophenol | 3-(Diethylamino)phenol | 2922.29 | |
91721-75-4 | Oleoresin Bay | 3301.9 | ||
91722-19-9 | Black spruce oil | 3301.19 | ||
91722-22-4 | Sugarcane extract | 3302.1 | ||
91722-69-9 | Lavender, Lavandula hybrida extract | 3301.19 | ||
917-23-7 | Tetraphenylporphyrin | 5,10,15,20-tetraphenyl-21,22-dihydroporphyrin | 2934.99 | |
91744-42-2 | Glycerides, coco mono-, di- and tri-, hydrogenated | 2915.9 | ||
91744-68-2 | Glycerides, palm-oil mono-, di- and tri-, hydrogenated, citrates | 3824.9 | ||
91745-97-0 | Chamaecyparis obtusa extract | 3301.29 | ||
91-76-9 | Benzoguanamine | 6-Phenyl-1,3,5-triazine-2,4-diyldiamine | 2933.69 | 3 |
91770-12-6 | Guava extract | 3302.1 | ||
91770-14-8 | Jasmine Jasminum sambac extract | 3301.9 | ||
91770-56-8 | Ravensara aromatica extract | 3301.9 | ||
91770-88-6 | Cranberry extract | 3302.1 | ||
91771-50-5 | Citrus hystrix extract | 3301.29 | ||
91771-61-8 | Citronella oil | 3302.9 | ||
91771-68-5 | Eucalyptus smithii leaf oil | 3301.19 | ||
91788-83-9 | 1,2,3,4-Butanetetra carboxylic acid, tetrakis(1,2,2,6,6-pentamethyl-4-piperidinyl) ester | Tetrakis(1,2,2,6,6-pentamethylpiperidin-4-yl) butane-1,2,3,4-tetracarboxylate | ||
91824-88-3 | Isooctadecanoic acid, monoester with tetraglycerol | 2915.7 | ||
91832-40-5 | Cefdinir | (6R,7R)-7-[[(2Z)-2-(2-amino-1,3-thiazol-4-yl)-2-hydroxyiminoacetyl]amino]-3-ethenyl-8-oxo-5-thia-1-azabicyclo[4.2.0]oct-2-ene-2-carboxylic acid | 2941.9 | 6 |
91844-53-0 | Sorbitan sesquioctanoate | [(2R,3S,4R,5R)-1,2,3,4,5,6-hexahydroxyhexyl] octanoate | ||
91884-86-5 | Turmeric extract | 3203 | ||
91-91-8 | Fast blue b salt ; Dizinc;4-(4-diazonio-3-methoxyphenyl)-2-methoxybenzenediazonium;tetrachloride;sulfate | 3204.17 | ||
919-30-2 | 3-(Triethoxysilyl)propylamine | 3-Triethoxysilylpropan-1-amine | ||
91-95-2 | 3,3'-Diaminobenzidine | 4-(3,4-diaminophenyl)benzene-1,2-diamine | 2921.59 | |
919797-19-6 | 25I-NBOMe | 2-(4-iodo-2,5-dimethoxyphenyl)-N-(2-methoxybenzyl) ethanamine | 2922.29 | 7 |
919-857-5 | Hydrocarbons, C9-C11, n-alkanes, isoalkanes, cyclics, < 2% aromatics | 2710.12 | ||
91995-81-2 | Fatty acids, C10-20 and C16-18-unsatd., reaction products with triethanolamine, di-Me sulfate-quaternized | 3402.12 | ||
92044-87-6 | Fatty acids, coco, 2-ethylhexyl esters | 3824.9 | ||
92044-99-0 | Fatty acids, olive-oil, Et esters | 2916.15 | ||
92061-68-2 | Quaternaryammonium compounds, C12-18-alkyltrimethyl, Me sulfates | 3402.11 | ||
92061-97-7 | Residues (petroleum), catalytic cracking | 2707.99 | ||
92113-31-0 | Hydrolyzed collagen | |||
921226-01-9 | Calcium hydroxycitrate tribasic | Calcium (1S,2S)-1,2-dihydroxypropane-1,2,3-tricarboxylic acid | 2918.19 | |
92-12-6 | Phenyltoloxamine | 2-(2-benzylphenoxy)-N,N-dimethylethanamine | 2922.19 | |
92128-82-0 | Kelp extract | 3101 | 4 | |
92128-87-5 | Lecithins, hydrogenated | 2923.2 | ||
92201-13-3 | Aegle marmelos extract | 3302.1 | ||
92201-64-4 | Eucalyptus Radiata essential oil | 3301.29 | ||
92201-88-2 | Quaternium-87 | 3402.9 | ||
922165-31-9 | Bis-ethoxydiglycol cyclohexane 1,4-dicarboxylate | Bis[2-(2-ethoxyethoxy)ethyl] cyclohexane-1,4-dicarboxylate | 2916.39 | |
922-32-7 | Creatine phosphate disodium | Disodium [N'-(hydroxyphosphinato)-N-methylcarbamimidamido]acetate | 2925.29 | |
923013-67-6 | 2,5-Dimethoxy-4-ethylphenethylamine | 2-(4-ethyl-2,5-dimethoxyphenyl)ethanamine;hydrochloride | 2942 | |
92307-87-4 | Reactive red 3:1 | 3204.16 | ||
92-31-9 | Basic blue 17 ; Tolonium chloride | 3204.13 | ||
923-26-2 | 2-Hydroxypropyl methacrylate | 2-hydroxypropyl 2-methylprop-2-enoate | 2918.19 | |
92332-22-4 | 1-Hexanol, 2-ethyl-, ethers with 2-butoxyethanol, 2-(2-butoxyethoxy)ethanol, 2-(2-(2-butoxyethoxy)ethoxy)ethanol and 2,2'-thiobis(ethanol) | 3812.2 | ||
92339-11-2 | Iodixanol | 5-[acetyl-[3-[N-acetyl-3,5-bis(2,3-dihydroxypropylcarbamoyl)-2,4,6-triiodoanilino]-2-hydroxypropyl]amino]-1-N,3-N-bis(2,3-dihydroxypropyl)-2,4,6-triiodobenzene-1,3-dicarboxamide | 2924.29 | |
92347-25-6 | Rosa rubiginosa seed oil | 3301.9 | ||
924-42-5 | N-methylolacrylamide | N-(hydroxymethyl)prop-2-enamide | 2924.19 | |
92456-63-8 | Kiwi seed essential oil | 3301.9 | ||
92457-01-7 | Gardenia jasminoides extract | 3302.9 | ||
92484-48-5 | Sodium benzotriazolyl butylphenol sulfonate | sodium 3-(2H-1,2,3-benzotriazol-2-yl)-5-(butan-2-yl)-4-hydroxybenzene-1-sulfonate | 2933.99 | |
92-48-8 | 6-Methylbenzopyrone | 6-Methylchromen-2-one | 2932.2 | |
925-83-7 | Sebacic acid Dihydrazide | decanedihydrazide | 2928 | |
926-141-6 | Hydrocarbons, C11-C14, n-alkanes, isoalkanes, cyclics, | 2710.19 | ||
92-61-5 | Scopoletin | 7-hydroxy-6-methoxychromen-2-one | 2932.2 | |
92704-41-1 | Calcined kaolin | 3,3,7,7-tetrahydroxy-2,4,6,8,9-pentaoxa-3,7-disila-1,5-dialuminabicyclo[3.3.1]nonane hydrate | ||
92-70-6 | Hydroxynaphthoic Acid | 3-hydroxynaphthalene-2-carboxylic acid | 2928 | |
927-07-1 | Tert-butyl peroxypivalate | 3 | ||
92-71-7 | 2,5-Diphenyloxazole | 2,5-diphenyl-1,3-oxazole | 2933.99 | |
927-20-8 | Magnesium glycerophosphate | Magnesium 2,3-dihydroxypropyl phosphate | 2919.9 | |
92-74-0 | 3-Hydroxy-2-naphtho-O-phenetidide | N-(2-ethoxyphenyl)-3-hydroxynaphthalene-2-carboxamide | 2924.29 | |
927-58-2 | 4-Bromobutyryl chloride | 4-bromobutanoyl chloride | 2915.9 | |
92-77-3 | 3-Hydroxy-2-naphthanilide | 3-hydroxy-N-phenylnaphthalene-2-carboxamide | 2924.29 | |
92-78-4 | 4'-Chloro-3-hydroxy-2-naphthanilide | N-(4-chlorophenyl)-3-hydroxynaphthalene-2-carboxamide | 2924.29 | |
92797-39-2 | Hydrolyzed milk proteins | 3504 | ||
92797-42-7 | Calcined bauxite | Oxo (oxoalumanyloxy) alumane | 2508.3 | |
92797-60-9 | Dioxosilane trimethoxy(octyl)silane | 3824.9 | ||
92823-03-5 | Flomoxef Sodium | Sodium N-[(6R,7R)-2-carboxy-3-[[1-(2-hydroxyethyl)tetrazol-5-yl]sulfanylmethyl]-7-methoxy-8-oxo-5-oxa-1-azabicyclo[4.2.0]oct-2-en-7-yl]-2-(difluoromethylsulfanyl)ethanimidate | 2941.9 | |
92-84-2 | Phenothiazine | 10H-phenothiazine | 2934.3 | 6 |
928-96-1 | Fragrance of cis-3-Hexen-1-ol | Cis-hex-3-en-1-ol | 3302.1 | |
929-06-6 | Diglycolamine | 2-(2-aminoethoxy)ethanol | 2918.29 | |
92952-81-3 | 4-Hydroxypropylamino-3-nitrophenol | 4-(3-hydroxypropylamino)-3-nitrophenol | 2922.29 | |
929-77-1 | Methyl Behenate | Methyl docosanoate | 2915.9 | |
93-00-5 | 2-Naphthylamine-6-sulfonic acid | 6-aminonaphthalene-2-sulfonic acid | 2922.21 | |
93037-36-6 | Polyoxyethylene sorbitan monolaurate | 3402.13 | ||
93-05-0 | 4-Amino-N,N-diethylaniline | 4-N,4-N-diethylbenzene-1,4-diamine | 2921.51 | 3 |
93050-78-3 | Reactive blue 194 | 3204.16 | ||
93050-79-4 | Reactive red 195 | 3204.16 | ||
93050-80-7 | Reactive yellow 145 | 3204.9 | ||
93051-41-3 | Reactive blue 221 | 3204.16 | ||
93051-43-5 | Reactive red 223 | 3204.16 | ||
93051-44-6 | Reactive blue 222 | 3204.9 | ||
93051-45-7 | Reactive red 222 | 3204.16 | ||
93-07-2 | Veratric Acid | 3,4-dimethoxybenzoic acid | 2918.99 | |
93-08-3 | 2-Acetylnaphthalene | 1-naphthalen-2-ylethanone | 2918.99 | |
93106-60-6 | Enrofloxacin | 1-cyclopropyl-7-(4-ethylpiperazin-1-yl)-6-fluoro-4-oxoquinoline-3-carboxylic acid | 2933.59 | |
93107-08-5 | Ciprofloxacin Hydrochloride | 1-cyclopropyl-6-fluoro-4-oxo-7-piperazin-1-ylquinoline-3-carboxylic acid;hydrochloride | 2933.59 | |
931-36-2 | 2-Ethyl-4-methylimidazole | 2-ethyl-5-methyl-1H-imidazole | 2933.99 | |
931418-92-7 | 1,9-Dimethyl-methylene blue zinc chloride double salt | 3212.9 | ||
931-48-6 | Ethynylcyclohexane | Ethynylcyclohexane | 2921.29 | |
93165-54-9 | Moringa oleifera extract | 3301.29 | ||
93-25-4 | 2-Methoxyphenylacetic acid | 2-(2-methoxyphenyl)acetic acid | 2918.99 | |
93-28-7 | Eugenol Acetate | (2-methoxy-4-prop-2-enylphenyl) acetate | 2915.39 | |
93334-48-6 | Rose, Rosa alba extract | 3301.19 | ||
93348-22-2 | Sodium Methyl Ester Sulfonate | 3402.11 | ||
93384-25-9 | Ledum groenlandicum extract | 3301.19 | ||
93-40-3 | Homoveratric Acid | 2-(3,4-dimethoxyphenyl)acetic acid | 2918.99 | |
93455-95-9 | Hedychium spicatum extract | 3301.29 | ||
93-46-9 | N,N'-Di-beta-naphthyl-p-phenylenediamine | 1-N,4-N-dinaphthalen-2-ylbenzene-1,4-diamine | ||
93479-97-1 | Glimepiride | 4-ethyl-3-methyl-N-[2-[4-[(4-methylcyclohexyl)carbamoylsulfamoyl]phenyl]ethyl]-5-oxo-2H-pyrrole-1-carboxamide | 2935 | 6 |
93-53-8 | Hydratropaldehyde | 2-phenylpropanal | 3824.9 | |
935545-74-7 | Spinetoram | 3808.91 | ||
93-58-3 | Methyl Benzoate | Methyl Benzoate | 2916.31 | |
93-60-7 | Methyl Nicotinate | Methyl pyridine-3-carboxylate | 2933.39 | |
93-68-5 | O-Acetoacetotoluidide | N-(2-methylphenyl)-3-oxobutanamide | 2924.29 | |
93685-79-1 | Isoeicosane | 2710.99 | ||
93685-80-4 | Hydrocarbons, C4, 1,3-butadiene-free, polymd., tetraisobutylene fraction, hydrogenated | 2710.19 | ||
93685-81-5 | Isododecane | 2710.99 | ||
93685-96-2 | Mimosa tenuiflora extract | 3201.9 | ||
93-69-6 | O-Tolyl biguanide | 1-(diaminomethylidene)-2-(2-methylphenyl)guanidine | ||
93697-74-6 | Pyrazosulfuron-ethyl | Ethyl 5-({[(4,6-dimethoxypyrimidin-2-yl)carbamoyl]amino}sulfonyl)-1-methyl-1H-pyrazole-4-carboxylate | 2935.9 | 8 |
93-70-9 | Acetoacetyl-2-chloroanilide | N-(2-chlorophenyl)-3-oxobutanamide | 2924.29 | |
937-14-4 | 3-Chloroperbenzoic acid | 3-chlorobenzenecarboperoxoic acid | 2916.39 | |
93763-70-3 | Perlite | 2621.9 | ||
93778-54-2 | Barium bis(2-nonylphenolate) | 3812.3 | ||
93792-77-9 | Dextrin myristate | 3505.1 | ||
93820-33-8 | N-(2-Ethylhexyl)-7-methyloctanamide | N-(2-ethylhexyl)-7-methyloctanamide | 2924.19 | |
93-82-3 | Stearic Diethanolamide | N,N-bis(2-hydroxyethyl)octadecanamide | 2915.7 | |
93-83-4 | Oleyl diethanolamide | 9-Octadecenamide, N,N-bis(2-hydroxyethyl)-, (9Z)- | 3204.17 | |
93841-25-9 | Hydroxyethyl-p-phenylenediamine Sulfate | 2-(2,5-diaminophenyl)ethanol;sulfuric acid | 2921.51 | |
93-89-0 | Ethyl Benzoate | Ethyl Benzoate | 2916.31 | |
93-90-3 | Phenylmethyl Ethanol Amine | 2-(N-methylanilino)ethanol | 2921.43 | |
93924-07-3 | Alkanes, C10-14 ; n-paraffin C10-C13 | Alkanes, C10-14 | 2710.99 | |
93924-10-8 | C20-24 Alpha Olefin Fraction | 2710.19 | ||
93924-11-9 | Alpha olefin fraction, C24-28 | 2712.2 | ||
93924-19-7 | Ash cenosphere | 2621.9 | ||
93-92-5 | Styrallyl acetate ; Fragrance of methyl phenylcarbinyl acetate | 1-phenylethyl acetate | ||
93925-36-1 | Propanoic acid, 2-hydroxy-, C12-15-alkyl esters | 2918.11 | ||
93951-21-4 | Reactive blue 250 | Tetrasodium 4-amino-5-hydroxy-6-[[2-methoxy-5-[[2-(sulphonatooxy)ethyl]sulphonyl]phenyl]azo]-3-[[4-[[2-(sulphonatooxy)ethyl]sulphonyl]phenyl]azo]naphthalene-2,7-disulphonate | 3204.16 | |
93952-11-5 | Dibutyl phthalate | 3812.2 | ||
93963-24-7 | 4-(2-Ethylaminopropyl)anisole Hydrochloride | N-ethyl-1-(4-methoxyphenyl)propan-2-amine;hydrochloride | 2922.19 | |
93-97-0 | Benzoic Anhydride | Benzoyl benzoate | 2916.39 | |
93-98-1 | Benzanilide | N-phenylbenzamide | 2924.29 | |
94035-02-6 | Hydroxypropyl betacyclodextrin | 3505.1 | ||
940-69-2 | Thioctic Acid Amide | 5-(dithiolan-3-yl)pentanamide | 2934.99 | |
94-09-7 | Benzocaine | Ethyl 4-aminobenzoate | 2922.49 | |
94108-97-1 | Ditrimethylolpropane Tetraacrylate | [2-[2,2-bis(prop-2-enoyloxymethyl)butoxymethyl]-2-(prop-2-enoyloxymethyl)butyl] prop-2-enoate | 2916.12 | |
94109-09-8 | Tritridecyl benzene-1,2,4-tricarboxylate | Tritridecyl benzene-1,2,4-tricarboxylate | 2917.39 | |
941296-64-6 | C12-14 hydroxyalkyl hydroxyethyl sarcosine | 3402.11 | ||
94-13-3 | Propylparaben | Propyl 4-hydroxybenzoate | 2918.29 | |
94158-14-2 | 2-(1,3-Benzodioxol-5-ylamino)ethanol hydrochloride | 2-(1,3-benzodioxol-5-ylamino)ethanol;hydrochloride | 2922.29 | |
94200-24-5 | 2-(2-Butoxyethoxy)ethyl dihydrogen phosphate, compound with N,N-dimethylcyclohexylamine | 2921.3 | ||
94-26-8 | Butylparaben | Butyl 4-hydroxybenzoate | 2918.29 | |
94270-86-7 | N,N-bis(2-ethylhexyl)-ar-methyl-1H-benzotriazole-1-methanamine | N,N-bis(2-ethylhexyl)-ar-methyl-1H-benzotriazole-1-methanamine | 2933.99 | |
94-28-0 | Tri(ethylene glycol) bis(2-ethylhexanoate) | 2,2'-ethylenedioxydiethyl bis(2-ethylhexanoate) | 3812.2 | |
943-17-9 | Etilefrine Hydrochloride | 3-[2-(ethylamino)-1-hydroxyethyl]phenol;hydrochloride | 2922.5 | |
94333-75-2 | Hyacinth extract | 3302.9 | ||
94350-02-4 | Plumeria alba extract | 3301.29 | ||
94350-09-1 | Agarwood essential oil | 3302.1 | ||
94-36-0 | Dibenzoyl peroxide | Dibenzoyl peroxide | 2916.32 | |
94361-06-5 | Cyproconazole | 2-(4-chlorophenyl)-3-cyclopropyl-1-(1H-1,2,4-triazol-1-yl)butan-2-ol | 2933.99 | 8 |
94-41-7 | Chalcone | (E)-1,3-diphenylprop-2-en-1-one | 2914.39 | |
94-46-2 | Isoamyl benzoate | 3-methylbutyl benzoate | 2916.31 | |
94-47-3 | Phenethyl Benzoate | 2-phenylethyl benzoate | 2916.31 | |
94-52-0 | 5-Nitrobenzimidazole | 6-nitro-1H-benzimidazole | 2934.99 | |
94525-01-6 | Sodium polyaspartate | Polyaspartic acid sodium salt | 2918.15 | |
94552-04-2 | Chamotte | 2508.7 | ||
945558-97-4 | 3-(3,4,5-Trimethoxy benzylidene)-2,4-pentanedione | 3824.9 | ||
94581-16-5 | Resin acids and Rosin acids, maleated, esters with glycerol | 3806.9 | ||
94-60-0 | Dimethyl 1,4-cyclohexanedicarboxylate | Dimethyl cyclohexane-1,4-dicarboxylate | 2917.2 | |
94-62-2 | Piperine | (2E,4E)-5-(1,3-benzodioxol-5-yl)-1-piperidin-1-ylpenta-2,4-dien-1-one | 2939.99 | |
947-19-3 | Hydroxycyclohexyl Phenyl Ketone | (1-hydroxycyclohexyl)-phenylmethanone | 2914.4 | |
94-74-6 | MCPA | 4-chloro-2-methylphenoxyacetic acid | 2918.99 | 3 |
94-75-7 | 2,4-Dichlorophenoxyacetic acid | 2-(2,4-dichlorophenoxy)acetic acid | 2918.99 | |
947753-66-4 | Ethylhexyl Methoxycrylene | 2-ethylhexyl 2-cyano-3-(4-methoxyphenyl)-3-phenylprop-2-enoate | 2926.9 | |
94790-37-1 | O-Benzotriazol-1-yl-N,N,N',N'-tetramethyluronium hexafluorophosphate | [benzotriazol-1-yloxy(dimethylamino)methylidene]-dimethylazanium;hexafluorophosphate | 2933.99 | |
94-80-4 | 2,4-D-butyl | Butyl 2,4-dichlorophenoxyacetate | 2918.99 | 8 |
948-32-3 | 1,2,4-Triisopropylbenzene | 1,2,4-tri(propan-2-yl)benzene | 2902.9 | |
94-86-0 | Vanitrope | 2-ethoxy-5-[(E)-prop-1-enyl]phenol | 2912.21 | |
94945-04-7 | Glycosaminoglycans | 2922.52 | ||
94945-27-4 | Solvent yellow 160:1 | 3204.9 | ||
94-96-2 | Ethohexadiol | 2-ethylhexane-1,3-diol | 2905.39 | 8 |
94-97-3 | 5-Chlorobenzotriazole | 5-chloro-2H-benzotriazole | 2933.99 | |
95009-13-5 | 1-Propanaminium, 2-hydroxy-N-(2-hydroxypropyl)-N,N-dimethyl-, diesters with vegetable-oil fatty acids, Me sulfates (salts) | 3402.9 | ||
950582-72-6 | Boric acid (hbo2) | Barium(2+);oxido(oxo)borane | 2833.27 | |
950-59-4 | 2,6-Di-tert-butyl-4-mercaptophenol | 2,6-ditert-butyl-4-sulfanylphenol | 2930.9 | |
95077-05-7 | Kaolin | 3802.9 | ||
95078-84-5 | Sellasol NG | 3202.1 | ||
95-13-6 | Indene | 1H-indene | 2902.9 | |
95-14-7 | Benzotriazole | 2H-benzotriazole | 2933.99 | |
951659-40-8 | Flupyradifurone | 4-{[(6-chloropyridin-3-yl)methyl](2,2-difluoroethyl)amino}furan-2(5H)-one | 2934.99 | |
95-16-9 | Benzosulfonazole | 1,3-benzothiazole | 2934.2 | |
95-19-2 | Fragrance of 2-(2-Heptadecyl-2-imidazolin-1-yl)ethanol | 2-(2-heptadecyl-2-imidazolin-1-yl)ethanol | 3301.9 | |
95-20-5 | 2-Methylindole | 2-methyl-1H-indole | 2933.99 | |
95266-40-3 | Trinexapac-ethyl | Ethyl 4-[cyclopropyl(hydroxy)methylene]-3,5-dioxocyclohexanecarboxylate | 2918.99 | 8 |
953030-84-7 | Buprofezin | (2Z)-2-(tert-butylimino)-5-phenyl-3-(propan-2-yl)-1,3,5-thiadiazinan-4-one | 2934.99 | |
95-31-8 | N-tert-butylbenzothiazole-2-sulphenamide | N-tert-butylbenzothiazole-2-sulfenamide | ||
95-32-9 | 2-(Morpholinodithio)benzothiazole | 4-(1,3-benzothiazol-2-yldisulfanyl)morpholine | ||
95-33-0 | N-Cyclohexyl-2-benzothiazosulfenamide | N-(1,3-benzothiazol-2-ylsulfanyl)cyclohexanamine | 2934.2 | |
95370-65-3 | Dl-Proline, 5-oxo-, compd. with N2-coco acyl-l-arginine Et ester | 3402.12 | ||
95-38-5 | 2-(8-Heptadecenyl)-2-imidazoline-1-ethanol | 2-(2-heptadec-8-enyl-4,5-dihydroimidazol-1-yl)ethanol | 2933.29 | |
95418-58-9 | 4-Tert-Butoxystyrene | 1-ethenyl-4-[(2-methylpropan-2-yl)oxy]benzene | 2909.3 | |
95-45-4 | Dimethylglyoxime | N-(3-nitrosobut-2-en-2-yl)hydroxylamine | 2928 | |
95461-65-7 | Octadecanoic acid,esters,monoester with hexaglycerol | 3402.9 | ||
95464-05-4 | 1,1'-Bis(diphenylphosphino)ferrocene-palladium(II)dichloride dichloromethane complex | 1,1'-Bis(diphenylphosphino)ferrocene-palladium(II)dichloride dichloromethane complex | 2843.9 | |
954-67-6 | Benzhydryl acetate | 3824.9 | ||
95-47-6 | O-Xylene | 1,2-xylene | 2902.41 | 3 |
95481-62-2 | Dicarboxylic acid-dimethyl ester mixture | 3814 | ||
95-48-7 | Orthocresol | 2-methylphenol | 2907.12 | 8 |
95-50-1 | O-Dichlorobenzene | 1,2-dichlorobenzene | 2903.91 | |
95510-70-6 | Omeprazole Sodium | Sodium 5-methoxy-2-[(4-methoxy-3,5-dimethylpyridin-2-yl)methylsulfinyl]benzimidazol-1-ide;hydrate | 2933.99 | |
95-53-4 | O-Toluidine | 2-methylaniline | 2921.43 | 3 |
95-54-5 | O-Phenylenediamine | Benzene-1,2-diamine | 2921.51 | 3 |
95-55-6 | O-Aminophenol | 2-Aminophenol | 2922.29 | 3 |
95-57-8 | 2-Chlorophenol | 2-Chlorophenol | 2908.19 | 8 |
95-63-6 | Pseudocumene | 1,2,4-trimethylbenzene | 2902.9 | |
95-64-7 | 3,4-Xylidine | 3,4-dimethylaniline | 2921.59 | |
956-48-9 | 2,6-Dichloroindophenol | 4-(3,5-dichloro-4-hydroxyphenyl)iminocyclohexa-2,5-dien-1-one | 2925.29 | |
95-68-1 | 2,4-Xylidine | 2,4-dimethylaniline | 2921.49 | |
95-70-5 | 2,5-Diaminotoluene | 2-methylbenzene-1,4-diamine | 3824.9 | |
95713-52-3 | N-alpha -(2,4-Dinitro-5-fluorophenyl)-L-alaninamide | (2S)-2-(5-fluoro-2,4-dinitroanilino)propanamide | 2924.29 | |
95-71-6 | Methylhydroquinone | 2-methylbenzene-1,4-diol | 2907.29 | |
95-78-3 | 2,5-Xylidine | 2,5-dimethylaniline | 2921.59 | |
95-80-7 | Toluene-2,4-diamine | 4-methylbenzene-1,3-diamine | 2921.51 | |
95-84-1 | 2-Amino-4-methylphenol | 2-amino-4-methylphenol | 2922.19 | |
95-85-2 | 4-Chloro-2-aminophenol | 2-amino-4-chlorophenol | 2922.29 | |
95-87-4 | 2,5-Xylenol | 2,5-dimethylphenol | 2907.19 | |
95-88-5 | 4-Chlororesorcinol | 4-chlorobenzene-1,3-diol | 2907.21 | |
95912-86-0 | Fatty acids, C8-10, C12-18-alkyl esters | 3824.9 | ||
95912-87-1 | Fatty acids, C16-18, C12-18-alkyl esters | 2915.7 | ||
95917-61-6 | Japan red No. 218 | 3205 | ||
95-92-1 | Diethyl Oxalate | Diethyl Oxalate | 2917.11 | 3 |
959-36-4 | Salicylaldazine | (6Z)-6-[[2-[(Z)-(6-oxocyclohexa-2,4-dien-1-ylidene)methyl]hydrazinyl]methylidene]cyclohexa-2,4-dien-1-one | 2928 | |
959-55-7 | Benzyldimethyloctylammonium Chloride | Benzyl-dimethyl-octylazanium chloride | 2923.9 | |
959610-30-1 | Myristoyl Pentapeptide-17 | N-[(2S)-6-amino-1-[[(2S)-1-[[(2S)-1-[[(2S)-6-amino-1-[[(2S)-1,6-diamino-1-oxohexan-2-yl]amino]-1-oxohexan-2-yl]amino]-1-oxopropan-2-yl]amino]-4-methyl-1-oxopentan-2-yl]amino]-1-oxohexan-2-yl]tetradecanamide | 2933.29 | |
95-96-5 | Polylactide | 3,6-dimethyl-1,4-dioxane-2,5-dione | 2932.2 | |
960132-48-3 | O-(2-Aminoethyl)-O′-[2-(biotinylamino)ethyl]octaethylene glycol | 5-[(3aS,4S,6aR)-2-oxo-1,3,3a,4,6,6a-hexahydrothieno[3,4-d]imidazol-4-yl]-N-[2-[2-[2-[2-[2-[2-[2-[2-[2-(2-aminoethoxy)ethoxy]ethoxy]ethoxy]ethoxy]ethoxy]ethoxy]ethoxy]ethoxy]ethyl]pentanamide | 2934.99 | |
96036-03-2 | Meropenem | (4R,5S,6S)-3-[(3S,5S)-5-(dimethylcarbamoyl)pyrrolidin-3-yl]sulfanyl-6-[(1R)-1-hydroxyethyl]-4-methyl-7-oxo-1-azabicyclo[3.2.0]hept-2-ene-2-carboxylic acid | 2941.9 | 6 |
960531-53-7 | Tripeptide-10 citrulline | L-Ornithinamide, L-lysyl-L-alpha-aspartyl-L-isoleucyl-N5-(aminocarbonyl)- | 3504 | |
96-05-9 | Allyl Methacrylate | Prop-2-enyl 2-methylprop-2-enoate | 2916.14 | |
960608-17-7 | Tetrapeptide-21 | glycyl-L-alpha-glutamyl-L-lysyl-glycine | 3504 | |
96081-39-9 | Ceteareth-60 myristyl glycol | 3402.13 | ||
96-09-3 | Styrene oxide | 2-phenyloxirane | 2910.9 | |
96-10-6 | Diethylaluminum Chloride | Chloro(diethyl)alumane | ||
96-14-0 | 3-Methylpentane | 3-methylpentane | 2901.1 | |
96152-48-6 | Phosphorous acid, (1-methylethylidene)di-4,1-phenylene tetra-C12-15-alkyl esters | 2920.9 | ||
96-17-3 | 2-Methylbutyraldehyde | 2-methylbutanal | 2912.19 | |
96-20-8 | 2-Aminobutan-1-ol | 2-Aminobutan-1-ol | 2922.19 | |
96-22-0 | Diethyl Ketone | Pentan-3-one | 2914.19 | 3 |
96-24-2 | 3-Chloro-1,2-propanediol | 3-chloropropane-1,2-diol | 2905.59 | |
96-26-4 | Dihydroxyacetone | 1,3-dihydroxypropan-2-one | 2914.4 | |
96-27-5 | Monothioglycerol | 3-sulfanylpropane-1,2-diol | 2930.9 | |
96-29-7 | 2-Butanone oxime | (NE)-N-butan-2-ylidenehydroxylamine | 2928 | 3 |
96300-95-7 | 8-methylnonyl diphenyl phosphate;triphenyl phosphate | 3812.2 | ||
96-31-1 | 1,3-Dimethylurea | 1,3-dimethylurea | 2924.19 | |
96-32-2 | Methyl bromoacetate | Methyl 2-bromoacetate | 2915.9 | 2 |
96-33-3 | Methyl Acrylate | Methyl prop-2-enoate | 2916.12 | 8 |
96-45-7 | 2-Mercaptoimidazoline | Imidazolidine-2-thione | 2933.29 | |
96-48-0 | Butyrolactone | Oxolan-2-one | 2932.2 | 8 |
96489-71-3 | Pyridaben | 2-tert-butyl-5-[(4-tert-butylbenzyl)sulfanyl]-4-chloropyridazin-3(2H)-one | 2933.99 | 8 |
96-49-1 | Ethylene Carbonate | 1,3-dioxolan-2-one | 2920.9 | |
96507-86-7 | Diundecyl Phthalate | 2710.99 | ||
96-67-3 | 6-Amino-4-nitro-1-phenol-2-sulfonic acid | 2922.29 | ||
96690-41-4 | Hydrolyzed silk | 3504 | ||
96-69-5 | 4,4'-Thiobis(2-tert-butyl-5-methylphenol) | 2-tert-butyl-4-(5-tert-butyl-4-hydroxy-2-methylphenyl)sulfanyl-5-methylphenol | 2930.9 | |
96702-03-3 | Ectoine | (6S)-2-methyl-1,4,5,6-tetrahydropyrimidine-6-carboxylic acid | 2933.59 | |
96726-27-1 | Reactive red 221 | 3204.16 | ||
96-76-4 | 2,4-DI-Tert-butylphenol | 2,4-ditert-butylphenol | 2907.19 | |
96-77-5 | Phenoldisulfonic Acid | 4-Hydroxybenzene-1,3-disulfonic acid | 2908.99 | |
967-80-6 | Sulfaquinoxaline Sodium | Sodium (4-aminophenyl)sulfonyl-quinoxalin-2-ylazanide | 2935 | |
96810-35-4 | Stearyl erucamide | (Z)-N-octadecyldocos-13-enamide | 2924.19 | |
96829-58-2 | Orlistat | [(2S)-1-[(2S,3S)-3-hexyl-4-oxooxetan-2-yl]tridecan-2-yl] (2S)-2-formamido-4-methylpentanoate | 2933.59 | 6 |
96-91-3 | Picramic Acid | 2922.29 | 3 | |
969-33-5 | Cyproheptadine Hydrochloride | 4-(dibenzo[1,2-a:1',2'-e][7]annulen-11-ylidene)-1-methylpiperidine;hydrochloride | 2942 | |
96-93-5 | 3-Amino-4-hydroxy-5-nitrobenzenesulphonic acid | 2922.29 | ||
96-96-8 | 2-Nitro-4-methoxyaniline | 4-methoxy-2-nitroaniline | 2922.29 | 3 |
96-97-9 | 5-Nitrosalicylic acid | 2918.29 | ||
97-00-7 | Dinitrochlorobenzene | 1-chloro-2,4-dinitrobenzene | 2904.9 | |
97-02-9 | 2,4-Dinitroaniline | 2,4-dinitroaniline | 2921.42 | |
970-74-1 | Epigallocatechin | (2R,3R)-2-(3,4,5-trihydroxyphenyl)-3,4-dihydro-2H-chromene-3,5,7-triol | 2932.99 | |
971-15-3 | Dipentamethylenethiuram Hexasulfide | (Piperidine-1-carbothioylpentasulfanyl) piperidine-1-carbodithioate | ||
97173-34-7 | 1-[Hydroxy(2-hydroxypropyl)amino]propan-2-ol | 1-[hydroxy(2-hydroxypropyl)amino]propan-2-ol | 2928 | |
97-23-4 | Dichlorophen | 4-chloro-2-[(5-chloro-2-hydroxyphenyl)methyl]phenol | 2908.99 | 8 |
97240-79-4 | Topiramate | [(3aS,5aR,8aR,8bS)-2,2,7,7-tetramethyl-5,5a,8a,8b-tetrahydrodi[1,3]dioxolo[4,5-a:5',3'-d]pyran-3a-yl]methyl sulfamate | 2933.99 | |
97280-96-1 | Disteardimonium hectorite | 3802.9 | ||
97281-48-6 | Phosphatidylcholines, soya, hydrogenated | [(2R)-2,3-di(octadecanoyloxy)propyl] 2-(trimethylazaniumyl)ethyl phosphate | 2923.2 | |
97-30-3 | Methyl alpha-D-glucopyranoside | (2R,3S,4S,5R,6S)-2-(hydroxymethyl)-6-methoxyoxane-3,4,5-triol | 2940 | |
97338-28-8 | Isocetyl Stearoyl Stearate | 14-methylpentadecyl 12-octadecanoyloxyoctadecanoate | ||
97343-66-3 | Dipentamethylenethiuram Tetrasulfide | (Piperidine-1-carbothioyltrisulfanyl) piperidine-1-carbodithioate | 2934.99 | |
97375-27-4 | Sulfuric acid, monococo alkyl esters, sodium salts | 3402.11 | ||
97-39-2 | 1,3-DI-O-Tolylguanidine | 1,2-bis(2-methylphenyl)guanidine | 2925.29 | |
97416-84-7 | 1,1'-propane-2,2-diylbis[3,5-dibromo-4-(2,3-dibromo-2-methylpropoxy)benzene] | 1,3-dibromo-5-[2-[3,5-dibromo-4-(2,3-dibromo-2-methylpropoxy)phenyl]propan-2-yl]-2-(2,3-dibromo-2-methylpropoxy)benzene | 2903.99 | |
97489-11-7 | Resin acids and Rosin acids, fumarated, esters with glycerol | 3806.9 | ||
97489-15-1 | Sulfonic acids, C14-17-sec-alkane, sodium salts | 3402.11 | ||
975-17-7 | Phenylfluorone | 2,6,7-trihydroxy-9-phenylxanthen-3-one | 2932.99 | |
97-52-9 | 2-Methoxy-4-nitroaniline | 2-Methoxy-4-nitroaniline | 2922.29 | |
97-53-0 | Eugenol | 2-methoxy-4-prop-2-enylphenol | ||
97-54-1 | Isoeugenol | 2-methoxy-4-[(E)-prop-1-enyl]phenol | 2909.5 | |
97553-80-5 | Phosphoric acid, mono- and bis(branched and linear octyl) esters | 2919.9 | ||
97-59-6 | Allantoin | (2,5-dioxoimidazolidin-4-yl)urea | 2933.21 | |
97600-39-0 | Sodium Ionophore X | 2918.99 | ||
97-61-0 | 2-Methylpentanoic acid | 2-Methylpentanoic acid | 2915.9 | |
97-62-1 | Ethyl Isobutyrate | Ethyl 2-methylpropanoate | 2915.6 | |
97-63-2 | Ethyl Methacrylate | Ethyl 2-methylprop-2-enoate | 2916.14 | |
97632-95-6 | Potassium lauroyl glycinate | 3402.11 | ||
97-64-3 | Ethyl Lactate | Ethyl 2-hydroxypropanoate | 2918.11 | |
97-65-4 | Itaconic Acid | 2-methylidenebutanedioic acid | 2917.19 | |
97660-01-0 | Lavender oil | 3301.9 | ||
97675-54-2 | Averrhoa carambola extract/Starfruit extract | 3302.9 | ||
97675-85-9 | Hydrocarbons, (C=16-20) hydrotreated middle distillate, distn. lights | 2710.19 | ||
97-67-6 | L-Malic acid | (2S)-2-hydroxybutanedioic acid | 2918.19 | |
97676-19-2 | Blackcurrant extract | 3302.1 | ||
97676-26-1 | Passion fruit seed oil | 3301.9 | ||
977017-82-5 | Oleoresin basil | 3302.9 | ||
977018-21-5 | Oleoresin White Pepper | 3301.9 | ||
977029-66-5 | Oleoresin sage | 3302.1 | ||
977029-78-9 | Tangerine essence | 3302.1 | ||
97744-44-0 | Dibenzylfluorescein | Benzyl 2-(3-oxo-6-phenylmethoxyxanthen-9-yl)benzoate | 2917.19 | |
97-74-5 | Tetramethylthiuram monosulfide | Tetramethylthiuram monosulfide | ||
97-77-8 | Disulfiram | Diethylcarbamothioylsulfanyl N,N-diethylcarbamodithioate | 2930.3 | 6 |
97-78-9 | Lauroyl Sarcosine | 2-[dodecanoyl(methyl)amino]acetic acid | 2924.19 | |
97792-39-7 | Proteasome Substrate | Benzyl N-[2-[[2-[[(2S)-4-methyl-1-[(4-methyl-2-oxochromen-7-yl)amino]-1-oxopentan-2-yl]amino]-2-oxoethyl]amino]-2-oxoethyl]carbamate | 2932.2 | |
977-96-8 | Pseudoisocyanin | (2E)-1-ethyl-2-[(1-ethylquinolin-1-ium-2-yl)methylidene]quinoline iodide | 2933.49 | |
97-85-8 | Isobutyl isobutyrate | 2-methylpropyl 2-methylpropanoate | 2915.6 | |
97862-59-4 | 1-Propanaminium, 3-amino-N-(carboxymethyl)-N,N-dimethyl-, N-C8-18(even numbered) acyl derivs., hydroxides, inner salts | 3402.19 | ||
97862-72-1 | Fatty acids, C10-30, esters with lanolin alcs. | 3823.7 | ||
97867-33-9 | Ciprofloxacin Lactate | 1-cyclopropyl-6-fluoro-4-oxo-7-piperazin-1-ylquinoline-3-carboxylic acid;2-hydroxypropanoic acid | 2933.59 | |
97-86-9 | Isobutyl methacrylate | 2-methylpropyl 2-methylprop-2-enoate | 2916.14 | 3 |
97-88-1 | N-Butyl methacrylate | Butyl 2-methylprop-2-enoate | 2916.14 | 3 |
97-90-5 | Glycol Dimethacrylate | 2-(2-methylprop-2-enoyloxy)ethyl 2-methylprop-2-enoate | ||
97926-19-7 | Douglas essential oil | 3301.19 | ||
97-93-8 | Triethylaluminum | Triethylalumane | ||
979-88-4 | Sodium bicinchoninate | Disodium 2-(4-carboxylatoquinolin-2-yl)quinoline-4-carboxylate | 2933.49 | |
97-99-4 | Tetrahydrofurfuryl alcohol | Oxolan-2-ylmethanol | 2932.13 | 3 |
98-00-0 | Furfuryl alcohol | Furan-2-ylmethanol | 2932.13 | 3 |
98-01-1 | Furfural ; 2-furraldehyde | 2-furaldehyde | 2932.12 | |
98-02-2 | Furfuryl Mercaptan | Furan-2-ylmethanethiol | 2932.99 | |
980-26-7 | Pigment red 122 | Quino[2,3-b]acridine- 7,14-dione, 5,12-dihydro-2,9-dimethyl- | 3205 | |
98-03-3 | Thiophene-2-carbaldehyde | Thiophene-2-carbaldehyde | 2934.99 | |
98-06-6 | Tert-butylbenzene | Tert-butylbenzene | 2902.9 | |
980-71-2 | Brompheniramine maleate | 3-(4-bromophenyl)-N,N-dimethyl-3-pyridin-2-ylpropan-1-amine;(Z)-but-2-enedioic acid | 2933.99 | 6 |
98-09-9 | Benzenesulfonyl chloride | Benzenesulfonyl chloride | 2904.9 | |
98-10-2 | Benzenesulfonamide | Benzenesulfonamide | 2935 | |
98106-71-9 | Satsuma Mandarin orange extract | 3301.19 | ||
98-11-3 | Benzenesulfonic acid | Benzenesulfonic acid | 2922.21 | |
98114-32-0 | Reactive red 180 | Tetrasodium 4-hydroxy-5-[(phenylcarbonyl)amino]-3-[(1-sulfonato-6-{[2-(sulfonatooxy)ethyl]sulfonyl}naphthalen-2-yl)azo]naphthalene-2,7-disulfonate | 3204.16 | |
98231-71-1 | 2-[2-(2-chloroethylsulfonyl)ethoxy]ethanamine hydrochloride | 2-[2-(2-chloroethylsulfonyl)ethoxy]ethanamine hydrochloride | 2922.19 | |
982-57-0 | Chloramphenicol Succinate Sodium Salt | 4-[(2R,3R)-2-[(2,2-dichloroacetyl)amino]-3-hydroxy-3-(4-nitrophenyl)propoxy]-4-oxobutanoic acid;sodium | 2941.4 | 1 |
98-29-3 | 4-tert-Butylbenzene-1,2-diol | 4-tert-butylpyrocatechol | 3812.3 | |
98-30-6 | 2-Amino-4-(methylsulfonyl)phenol | 2-amino-4-methylsulfonylphenol | 2930.9 | |
98319-26-7 | Finasteride | (1S,3aS,3bS,5aR,9aR,9bS,11aS)-N-tert-butyl-9a,11a-dimethyl-7-oxo-1,2,3,3a,3b,4,5,5a,6,9b,10,11-dodecahydroindeno[5,4-f]quinoline-1-carboxamide | 2937.29 | 6 |
98-32-8 | 4-Hydroxymetanilamide | 3-amino-4-hydroxybenzenesulfonamide | 2935 | |
98-33-9 | 6-Aminotoluene-3-sulfonic acid | 4-amino-3-methylbenzenesulfonic acid | 2921.43 | |
98-36-2 | 3-Amino-4-chlorobenzenesulfonic acid | 3-amino-4-chlorobenzenesulfonic acid | 2921.42 | |
98-37-3 | 3-Amino-4-hydroxybenzenesulfonic acid | 3-amino-4-hydroxybenzenesulfonic acid | 2922.29 | |
98-42-0 | 3-Amino-4-methoxybenzenesulfonic acid | 3-amino-4-methoxybenzenesulfonic acid | 2922.29 | |
98437-23-1 | 2-Benzothienylboronic acid | 1-benzothiophen-2-ylboronic acid | 2931.9 | |
98-44-2 | 2-Amino-P-benzenedisulfonic acid | 2-aminobenzene-1,4-disulfonic acid | 2921.42 | |
985-12-6 | Drotaverine Hydrochloride | (1E)-1-[(3,4-diethoxyphenyl)methylidene]-6,7-diethoxy-3,4-dihydro-2H-isoquinoline;hydrochloride | 2933.49 | |
98-52-2 | 4-Tert-butylcyclohexanol | 4-tert-butylcyclohexan-1-ol | 2906.12 | |
98-54-4 | 4-tert-Butylphenol | 4-Tert-butylphenol | 2907.29 | 3 |
98-55-5 | alpha-Terpineol | 2-(4-methylcyclohex-3-en-1-yl)propan-2-ol | 2906.19 | |
98-59-9 | p-Toluenesulfonyl chloride | 4-methylbenzenesulfonyl chloride | 2904.9 | |
98615-67-9 | Silicic acid, aluminum salt | 3206.49 | ||
98653-76-0 | Phosphoric acid, C8-10-alkyl esters | 3815.9 | ||
98-66-8 | 4-Chlorobenzenesulfonic acid | 4-Chlorobenzenesulfonic acid | 2904.9 | |
98-68-0 | 4-Methoxybenzenesulfonyl chloride | 4-Methoxybenzenesulfonyl chloride | 2909.3 | |
98725-78-1 | Fibronectin | 3504 | ||
98726-64-8 | Synthetic Human Transforming Growth Factor beta | 2937.19 | ||
98730-04-2 | Benoxacor | 2,2-dichloro-1-(3-methyl-2,3-dihydro-1,4-benzoxazin-4-yl)ethanone | 2924.29 | |
98-73-7 | 4-Tert-butylbenzoic acid | 4-Tert-butylbenzoic acid | 2916.31 | |
98-74-8 | 4-Nitrobenzenesulfonyl chloride | 4-Nitrobenzenesulfonyl chloride | 2904.9 | |
98-77-1 | Piperidine pentamethylenedithiocarbamate | Piperidine piperidine-1-carbodithioic acid | 2933.39 | |
987-78-0 | Citicoline | [[(2R,3S,4R,5R)-5-(4-amino-2-oxopyrimidin-1-yl)-3,4-dihydroxyoxolan-2-yl]methoxy-hydroxyphosphoryl] 2-(trimethylazaniumyl)ethyl phosphate | 2934.99 | |
98-80-6 | Phenylboronic acid | Phenylboronic acid | 2931.9 | |
98-82-8 | Cumene | Cumene | 2902.7 | 3 |
98-83-9 | 2-Phenylpropene | Prop-1-en-2-ylbenzene | 2902.9 | 3 |
98-86-2 | Acetophenone | 1-phenylethanone | 2914.39 | |
98-88-4 | Benzoyl chloride | Benzoyl chloride | 2916.32 | 3 |
98-92-0 | Nicotinamide | Pyridine-3-carboxamide | 2936.29 | 6 |
989-38-8 | Basic red 1 | 9-[2-(ethoxycarbonyl)phenyl]-3,6-bis(ethylamino)-2,7-dimethylxanthenium chloride | ||
98-94-2 | N,N-Dimethylcyclohexylamine | N,N-Dimethylcyclohexylamine | ||
989-51-5 | Green tea extract powder | |||
98-95-3 | Nitrobenzene | Nitrobenzene | 2904.2 | |
98-96-4 | Pyrazinamide | Pyrazine-2-carboxamide | 3823.19 | 6 |
98-98-6 | Picolinic acid | Pyridine-2-carboxylic acid | 2933.39 | |
99031-78-6 | Disperse red 343 | 3204.11 | ||
99035-77-5 | Basic blue 147 | 3204.13 | ||
99035-78-6 | Disperse red 343 | 3204.11 | ||
99-03-6 | M-Aminoacetophenone | 1-(3-aminophenyl)ethanone | 2922.39 | |
99-04-7 | 3-Methylbenzoic acid | 3-Methylbenzoic acid | 2916.39 | |
99-05-8 | 3-Aminobenzoic acid | 3-Aminobenzoic acid | 2922.49 | |
99-06-9 | 3-Hydroxybenzoic acid | 3-Hydroxybenzoic acid | 2918.29 | |
99-09-2 | 3-Nitroaniline | 3-Nitroaniline | 2921.42 | 3 |
99129-21-2 | Clethodim | 2-{N-[(-3-chloroprop-2-en-1-yl)oxy]propanimidoyl}-5-[2-(ethylthio)propyl]-3-hydroxycyclohex-2-en-1-one | 2930.9 | 8 |
99130-30-0 | Solvent orange 22 | 3204.19 | ||
991-84-4 | 2,6-di-tert-butyl-4-(4,6-bis(octylthio) -1,3,5-triazin-2-ylamino)phenol | 4-[[4,6-bis(octylsulfanyl)-1,3,5-triazin-2-yl]amino]-2,6-ditert-butylphenol | 2930.9 | |
99-20-7 | Trehalose | (2R,3S,4S,5R,6R)-2-(hydroxymethyl)-6-[(2R,3R,4S,5S,6R)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxyoxane-3,4,5-triol | 2940 | |
992-59-6 | Benzopurpurin b | Disodium;4-amino-3-[[4-[4-[(1-amino-4-sulfonatonaphthalen-2-yl)diazenyl]-3-methylphenyl]-2-methylphenyl]diazenyl]naphthalene-1-sulfonate | 2833.22 | |
99291-25-5 | Levodropropizine | (2S)-3-(4-phenylpiperazin-1-yl)propane-1,2-diol | 2941.9 | 6 |
99300-78-4 | Venlafaxine hydrochloride | 1-[2-(dimethylamino)-1-(4-methoxyphenyl)ethyl]cyclohexan-1-ol hydrochloride | 2932.19 | 6 |
99-30-9 | Dicloran | 2,6-dichloro-4-nitroaniline | 2921.42 | 8 |
99-31-0 | 5-Aminoisophthalic acid | 5-Aminobenzene-1,3-dicarboxylic acid | 2922.49 | |
99-33-2 | 3,5-Dinitrobenzoyl chloride | 3,5-Dinitrobenzoyl chloride | 2916.39 | |
99-34-3 | 3,5-Dinitrobenzoic acid | 2916.39 | ||
99402-80-9 | Pigment red 184 | 3204.17 | ||
994-05-8 | 2-methoxy-2-methylbutane | 2-methoxy-2-methylbutane | 2909.19 | |
99439-28-8 | Dioxosilane | Dioxosilane | 2811.221 | |
99-49-0 | Carvone | 2-methyl-5-prop-1-en-2-ylcyclohex-2-en-1-one | 2914.29 | |
99497-03-7 | Domperidone maleate | (E)-but-2-enedioic acid 6-chloro-3-[1-[3-(2-oxo-3H-benzimidazol-1-yl)propyl]piperidin-4-yl]-1H-benzimidazol-2-one | 2922.5 | 6 |
99-50-3 | 3,4-Dihydroxybenzoic acid | 3,4-Dihydroxybenzoic acid | 2918.29 | |
99-52-5 | 2-Methyl-4-nitroaniline | 2-Methyl-4-nitroaniline | 2921.43 | |
99-54-7 | 1,2-Dichloro-4-nitrobenzene | 1,2-Dichloro-4-nitrobenzene | 2904.9 | |
99549-42-5 | Fluorescent Brightener 263 | 3204.2 | ||
99-55-8 | 2-Methyl-5-nitroaniline | 2-Methyl-5-nitroaniline | 2921.43 | 3 |
99-56-9 | 4-Nitro-o-phenylenediamine | 4-Nitrobenzene-1,2-diamine | 2921.51 | |
99569-11-6 | Methylidene glycerol | 2932.99 | ||
99-57-0 | 2-Amino-4-nitrophenol | 2-Amino-4-nitrophenol | 2922.29 | |
99576-15-5 | Acid black 210 | Dipotassium 4-amino-6-{[4-({4-[(2,4-diaminophenyl)diazenyl]phenyl}sulfamoyl)phenyl]diazenyl}-5-hydroxy-3-[(4-nitrophenyl)diazenyl]naphthalene-2,7-disulfonate | 3204.12 | |
99-62-7 | 1,3-Diisopropylbenzene | 1,3-di(propan-2-yl)benzene | 2902.9 | |
99-63-8 | Isophthaloyl chloride | Benzene-1,3-dicarbonyl chloride | 2917.39 | |
99638-63-8 | Talc powder | 3812.2 | ||
996-50-9 | Trimethylsilyldiethylamine | N-ethyl-N-trimethylsilylethanamine | 2931.9 | |
99-66-1 | Valproic acid | 2-Propylpentanoic acid | 2915.9 | 6 |
99685-96-8 | Fullerene | C60-Ih)[5,6]fullerene | 3802.1 | |
996-98-5 | Ethanedihydrazide | Ethanedihydrazide | 2928 | |
99728-16-2 | (Z)-1-Chloro-3,3,3-trifluoropropene | (Z)-1-chloro-3,3,3-trifluoroprop-1-ene | 3824.9 | |
99734-09-5 | Tristyrylphenol ethoxylates | 3402.9 | ||
997-43-3 | Monopotassium oxoglurate | Potassium 5-hydroxy-2,5-dioxopentanoate | 2918.3 | |
99-76-3 | Methylparaben | Methyl 4-hydroxybenzoate | 2918.29 | |
99792-79-7 | Chlorophenol Red-β-D-galactopyranoside | 2940 | ||
99-83-2 | Fragrance of α-phellandrene | p-Mentha-1,5-diene | 3301.9 | |
99896-85-2 | Arginyl-glycyl-aspartic acid | (2S)-2-[[2-[[(2S)-2-amino-5-(diaminomethylideneamino)pentanoyl]amino]acetyl]amino]butanedioic acid | 2925.29 | |
99-89-8 | 4-Isopropylphenol | 4-propan-2-ylphenol | 2907.19 | |
99-92-3 | 4-Aminoacetophenone | 1-(4-aminophenyl)ethanone | 2922.39 | |
99-93-4 | 4-Hydroxyacetophenone | 1-(4-hydroxyphenyl)ethanone | ||
99-94-5 | 4-Methylbenzoic acid | 4-Methylbenzoic acid | 2916.39 | |
999-61-1 | 2-Hydroxypropyl acrylate | 2-hydroxypropyl prop-2-enoate | 2916.12 | |
99-96-7 | 4-Hydroxybenzoic acid | 4-Hydroxybenzoic acid | 2918.29 | |
99-97-8 | N,N-dimethyl-p-toluidine | N,N,4-trimethylaniline | 3824.9 | |
99-98-9 | N,N-Dimethyl-p-phenylenediamine | 4-N,4-N-dimethylbenzene-1,4-diamine | 2921.51 | 8 |
999-97-3 | Hexamethyldisilazane | [Dimethyl-(trimethylsilylamino)silyl]methane | 2931.9 |